Full list of alvaDesc descriptors
| No. | Name | Description | Block | Sub-Block | 
| 1 | MW | molecular weight | Constitutional indices | Basic descriptors | 
| 2 | AMW | average molecular weight | Constitutional indices | Basic descriptors | 
| 3 | Sv | sum of atomic van der Waals volumes (scaled on Carbon atom) | Constitutional indices | Basic descriptors | 
| 4 | Se | sum of atomic Sanderson electronegativities (scaled on Carbon atom) | Constitutional indices | Basic descriptors | 
| 5 | Sp | sum of atomic polarizabilities (scaled on Carbon atom) | Constitutional indices | Basic descriptors | 
| 6 | Si | sum of first ionization potentials (scaled on Carbon atom) | Constitutional indices | Basic descriptors | 
| 7 | Mv | mean atomic van der Waals volume (scaled on Carbon atom) | Constitutional indices | Basic descriptors | 
| 8 | Me | mean atomic Sanderson electronegativity (scaled on Carbon atom) | Constitutional indices | Basic descriptors | 
| 9 | Mp | mean atomic polarizability (scaled on Carbon atom) | Constitutional indices | Basic descriptors | 
| 10 | Mi | mean first ionization potential (scaled on Carbon atom) | Constitutional indices | Basic descriptors | 
| 11 | GD | graph density | Constitutional indices | Basic descriptors | 
| 12 | nAT | number of atoms | Constitutional indices | Basic descriptors | 
| 13 | nSK | number of non-H atoms | Constitutional indices | Basic descriptors | 
| 14 | nTA | number of terminal atoms | Constitutional indices | Basic descriptors | 
| 15 | nBT | number of bonds | Constitutional indices | Basic descriptors | 
| 16 | nBO | number of non-H bonds | Constitutional indices | Basic descriptors | 
| 17 | nBM | number of multiple bonds | Constitutional indices | Basic descriptors | 
| 18 | SCBO | sum of conventional bond orders (H-depleted) | Constitutional indices | Basic descriptors | 
| 19 | RBN | number of rotatable bonds | Constitutional indices | Basic descriptors | 
| 20 | RBF | rotatable bond fraction | Constitutional indices | Basic descriptors | 
| 21 | nDB | number of double bonds | Constitutional indices | Basic descriptors | 
| 22 | nTB | number of triple bonds | Constitutional indices | Basic descriptors | 
| 23 | nAB | number of aromatic bonds | Constitutional indices | Basic descriptors | 
| 24 | nH | number of Hydrogen atoms | Constitutional indices | Basic descriptors | 
| 25 | nC | number of Carbon atoms | Constitutional indices | Basic descriptors | 
| 26 | nN | number of Nitrogen atoms | Constitutional indices | Basic descriptors | 
| 27 | nO | number of Oxygen atoms | Constitutional indices | Basic descriptors | 
| 28 | nP | number of Phosphorous atoms | Constitutional indices | Basic descriptors | 
| 29 | nS | number of Sulfur atoms | Constitutional indices | Basic descriptors | 
| 30 | nF | number of Fluorine atoms | Constitutional indices | Basic descriptors | 
| 31 | nCL | number of Chlorine atoms | Constitutional indices | Basic descriptors | 
| 32 | nBR | number of Bromine atoms | Constitutional indices | Basic descriptors | 
| 33 | nI | number of Iodine atoms | Constitutional indices | Basic descriptors | 
| 34 | nB | number of Boron atoms | Constitutional indices | Basic descriptors | 
| 35 | nHM | number of heavy atoms | Constitutional indices | Basic descriptors | 
| 36 | nHet | number of heteroatoms | Constitutional indices | Basic descriptors | 
| 37 | nX | number of halogen atoms | Constitutional indices | Basic descriptors | 
| 38 | H% | percentage of H atoms | Constitutional indices | Basic descriptors | 
| 39 | C% | percentage of C atoms | Constitutional indices | Basic descriptors | 
| 40 | N% | percentage of N atoms | Constitutional indices | Basic descriptors | 
| 41 | O% | percentage of O atoms | Constitutional indices | Basic descriptors | 
| 42 | X% | percentage of halogen atoms | Constitutional indices | Basic descriptors | 
| 43 | nCsp3 | number of sp3 hybridized Carbon atoms | Constitutional indices | Basic descriptors | 
| 44 | nCsp2 | number of sp2 hybridized Carbon atoms | Constitutional indices | Basic descriptors | 
| 45 | nCsp | number of sp hybridized Carbon atoms | Constitutional indices | Basic descriptors | 
| 46 | max_conj_path | maximum number of atoms that can be in conjugation with each other | Constitutional indices | Basic descriptors | 
| 47 | nStructures | number of disconnected structures | Constitutional indices | Basic descriptors | 
| 48 | totalcharge | total charge | Constitutional indices | Basic descriptors | 
| 49 | nCIC | number of rings (cyclomatic number) | Ring descriptors | Basic descriptors | 
| 50 | nCIR | number of circuits | Ring descriptors | Basic descriptors | 
| 51 | TRS | total ring size | Ring descriptors | Basic descriptors | 
| 52 | Rperim | ring perimeter | Ring descriptors | Basic descriptors | 
| 53 | Rbrid | ring bridge count | Ring descriptors | Basic descriptors | 
| 54 | MCD | molecular cyclized degree | Ring descriptors | Basic descriptors | 
| 55 | RFD | ring fusion density | Ring descriptors | Basic descriptors | 
| 56 | RCI | ring complexity index | Ring descriptors | Basic descriptors | 
| 57 | NRS | number of ring systems | Ring descriptors | Basic descriptors | 
| 58 | NNRS | normalized number of ring systems | Ring descriptors | Basic descriptors | 
| 59 | nR03 | number of 3-membered rings | Ring descriptors | Basic descriptors | 
| 60 | nR04 | number of 4-membered rings | Ring descriptors | Basic descriptors | 
| 61 | nR05 | number of 5-membered rings | Ring descriptors | Basic descriptors | 
| 62 | nR06 | number of 6-membered rings | Ring descriptors | Basic descriptors | 
| 63 | nR07 | number of 7-membered rings | Ring descriptors | Basic descriptors | 
| 64 | nR08 | number of 8-membered rings | Ring descriptors | Basic descriptors | 
| 65 | nR09 | number of 9-membered rings | Ring descriptors | Basic descriptors | 
| 66 | nR10 | number of 10-membered rings | Ring descriptors | Basic descriptors | 
| 67 | nR11 | number of 11-membered rings | Ring descriptors | Basic descriptors | 
| 68 | nR12 | number of 12-membered rings | Ring descriptors | Basic descriptors | 
| 69 | nBnz | number of benzene-like rings | Ring descriptors | Basic descriptors | 
| 70 | ARR | aromatic ratio | Ring descriptors | Basic descriptors | 
| 71 | D/Dtr03 | distance/detour ring index of order 3 | Ring descriptors | Basic descriptors | 
| 72 | D/Dtr04 | distance/detour ring index of order 4 | Ring descriptors | Basic descriptors | 
| 73 | D/Dtr05 | distance/detour ring index of order 5 | Ring descriptors | Basic descriptors | 
| 74 | D/Dtr06 | distance/detour ring index of order 6 | Ring descriptors | Basic descriptors | 
| 75 | D/Dtr07 | distance/detour ring index of order 7 | Ring descriptors | Basic descriptors | 
| 76 | D/Dtr08 | distance/detour ring index of order 8 | Ring descriptors | Basic descriptors | 
| 77 | D/Dtr09 | distance/detour ring index of order 9 | Ring descriptors | Basic descriptors | 
| 78 | D/Dtr10 | distance/detour ring index of order 10 | Ring descriptors | Basic descriptors | 
| 79 | D/Dtr11 | distance/detour ring index of order 11 | Ring descriptors | Basic descriptors | 
| 80 | D/Dtr12 | distance/detour ring index of order 12 | Ring descriptors | Basic descriptors | 
| 81 | ZM1 | first Zagreb index | Topological indices | Vertex degree-based indices | 
| 82 | ZM1V | first Zagreb index by valence vertex degrees | Topological indices | Vertex degree-based indices | 
| 83 | ZM1Kup | first Zagreb index by Kupchik vertex degrees | Topological indices | Vertex degree-based indices | 
| 84 | ZM1Mad | first Zagreb index by Madan vertex degrees | Topological indices | Vertex degree-based indices | 
| 85 | ZM1Per | first Zagreb index by perturbation vertex degrees | Topological indices | Vertex degree-based indices | 
| 86 | ZM1MulPer | first Zagreb index by multiplicative perturbation vertex degrees | Topological indices | Vertex degree-based indices | 
| 87 | ZM2 | second Zagreb index | Topological indices | Vertex degree-based indices | 
| 88 | ZM2V | second Zagreb index by valence vertex degrees | Topological indices | Vertex degree-based indices | 
| 89 | ZM2Kup | second Zagreb index by Kupchik vertex degrees | Topological indices | Vertex degree-based indices | 
| 90 | ZM2Mad | second Zagreb index by Madan vertex degrees | Topological indices | Vertex degree-based indices | 
| 91 | ZM2Per | second Zagreb index by perturbation vertex degrees | Topological indices | Vertex degree-based indices | 
| 92 | ZM2MulPer | second Zagreb index by multiplicative perturbation vertex degrees | Topological indices | Vertex degree-based indices | 
| 93 | ON0 | overall modified Zagreb index of order 0 | Topological indices | Vertex degree-based indices | 
| 94 | ON0V | overall modified Zagreb index of order 0 by valence vertex degrees | Topological indices | Vertex degree-based indices | 
| 95 | ON1 | overall modified Zagreb index of order 1 | Topological indices | Vertex degree-based indices | 
| 96 | ON1V | overall modified Zagreb index of order 1 by valence vertex degrees | Topological indices | Vertex degree-based indices | 
| 97 | Qindex | quadratic index | Topological indices | Vertex degree-based indices | 
| 98 | BBI | Bertz branching index | Topological indices | Vertex degree-based indices | 
| 99 | DBI | Dragon branching index | Topological indices | Vertex degree-based indices | 
| 100 | SNar | Narumi simple topological index (log function) | Topological indices | Vertex degree-based indices | 
| 101 | HNar | Narumi harmonic topological index | Topological indices | Vertex degree-based indices | 
| 102 | GNar | Narumi geometric topological index | Topological indices | Vertex degree-based indices | 
| 103 | Xt | total structure connectivity index | Topological indices | Vertex degree-based indices | 
| 104 | Dz | Pogliani index | Topological indices | Vertex degree-based indices | 
| 105 | Ram | ramification index | Topological indices | Vertex degree-based indices | 
| 106 | BLI | Kier benzene-likeliness index | Topological indices | Vertex degree-based indices | 
| 107 | Pol | polarity number | Topological indices | Distance-based indices | 
| 108 | LPRS | log of product of row sums (PRS) | Topological indices | Distance-based indices | 
| 109 | MSD | mean square distance index (Balaban) | Topological indices | Distance-based indices | 
| 110 | SPI | superpendentic index | Topological indices | Distance-based indices | 
| 111 | PJI2 | 2D Petitjean shape index | Topological indices | Distance-based indices | 
| 112 | ECC | eccentricity | Topological indices | Distance-based indices | 
| 113 | AECC | average eccentricity | Topological indices | Distance-based indices | 
| 114 | DECC | eccentric | Topological indices | Distance-based indices | 
| 115 | MDDD | mean distance degree deviation | Topological indices | Distance-based indices | 
| 116 | UNIP | unipolarity | Topological indices | Distance-based indices | 
| 117 | CENT | centralization | Topological indices | Distance-based indices | 
| 118 | VAR | variation | Topological indices | Distance-based indices | 
| 119 | ICR | radial centric information index | Topological indices | Distance-based indices | 
| 120 | MaxTD | max topological distance | Topological indices | Distance-based indices | 
| 121 | MeanTD | mean pairwise topological distance | Topological indices | Distance-based indices | 
| 122 | MaxDD | max detour distance | Topological indices | Distance-based indices | 
| 123 | MeanDD | mean pairwise detour distance | Topological indices | Distance-based indices | 
| 124 | SMTI | Schultz Molecular Topological Index (MTI) | Topological indices | MTI indices | 
| 125 | SMTIV | Schultz Molecular Topological Index by valence vertex degrees | Topological indices | MTI indices | 
| 126 | GMTI | Gutman Molecular Topological Index | Topological indices | MTI indices | 
| 127 | GMTIV | Gutman Molecular Topological Index by valence vertex degrees | Topological indices | MTI indices | 
| 128 | Xu | Xu index | Topological indices | MTI indices | 
| 129 | CSI | eccentric connectivity index | Topological indices | MTI indices | 
| 130 | Wap | all-path Wiener index | Topological indices | Path/walk indices | 
| 131 | S1K | 1-path Kier alpha-modified shape index | Topological indices | Path/walk indices | 
| 132 | S2K | 2-path Kier alpha-modified shape index | Topological indices | Path/walk indices | 
| 133 | S3K | 3-path Kier alpha-modified shape index | Topological indices | Path/walk indices | 
| 134 | PHI | Kier flexibility index | Topological indices | Path/walk indices | 
| 135 | PW2 | path/walk 2 - Randic shape index | Topological indices | Path/walk indices | 
| 136 | PW3 | path/walk 3 - Randic shape index | Topological indices | Path/walk indices | 
| 137 | PW4 | path/walk 4 - Randic shape index | Topological indices | Path/walk indices | 
| 138 | PW5 | path/walk 5 - Randic shape index | Topological indices | Path/walk indices | 
| 139 | MAXDN | maximal electrotopological negative variation | Topological indices | E-state indices | 
| 140 | MAXDP | maximal electrotopological positive variation | Topological indices | E-state indices | 
| 141 | DELS | molecular electrotopological variation | Topological indices | E-state indices | 
| 142 | TIE | E-state topological parameter | Topological indices | E-state indices | 
| 143 | Psi_i_s | intrinsic state pseudoconnectivity index - type S | Topological indices | E-state indices | 
| 144 | Psi_i_A | intrinsic state pseudoconnectivity index - type S average | Topological indices | E-state indices | 
| 145 | Psi_i_0 | intrinsic state pseudoconnectivity index - type 0 | Topological indices | E-state indices | 
| 146 | Psi_i_1 | intrinsic state pseudoconnectivity index - type 1 | Topological indices | E-state indices | 
| 147 | Psi_i_t | intrinsic state pseudoconnectivity index - type T | Topological indices | E-state indices | 
| 148 | Psi_i_0d | intrinsic state pseudoconnectivity index - type 0d | Topological indices | E-state indices | 
| 149 | Psi_i_1d | intrinsic state pseudoconnectivity index - type 1d | Topological indices | E-state indices | 
| 150 | Psi_i_1s | intrinsic state pseudoconnectivity index - type 1s | Topological indices | E-state indices | 
| 151 | Psi_e_A | electrotopological state pseudoconnectivity index - type S average | Topological indices | E-state indices | 
| 152 | Psi_e_0 | electrotopological state pseudoconnectivity index - type 0 | Topological indices | E-state indices | 
| 153 | Psi_e_1 | electrotopological state pseudoconnectivity index - type 1 | Topological indices | E-state indices | 
| 154 | Psi_e_t | electrotopological state pseudoconnectivity index - type T | Topological indices | E-state indices | 
| 155 | Psi_e_0d | electrotopological state pseudoconnectivity index - type 0d | Topological indices | E-state indices | 
| 156 | Psi_e_1d | electrotopological state pseudoconnectivity index - type 1d | Topological indices | E-state indices | 
| 157 | Psi_e_1s | electrotopological state pseudoconnectivity index - type 1s | Topological indices | E-state indices | 
| 158 | BAC | Balaban centric index | Topological indices | Centric indices | 
| 159 | LOC | lopping centric index | Topological indices | Centric indices | 
| 160 | MWC01 | molecular walk count of order 1 | Walk and path counts | Walk counts | 
| 161 | MWC02 | molecular walk count of order 2 | Walk and path counts | Walk counts | 
| 162 | MWC03 | molecular walk count of order 3 | Walk and path counts | Walk counts | 
| 163 | MWC04 | molecular walk count of order 4 | Walk and path counts | Walk counts | 
| 164 | MWC05 | molecular walk count of order 5 | Walk and path counts | Walk counts | 
| 165 | MWC06 | molecular walk count of order 6 | Walk and path counts | Walk counts | 
| 166 | MWC07 | molecular walk count of order 7 | Walk and path counts | Walk counts | 
| 167 | MWC08 | molecular walk count of order 8 | Walk and path counts | Walk counts | 
| 168 | MWC09 | molecular walk count of order 9 | Walk and path counts | Walk counts | 
| 169 | MWC10 | molecular walk count of order 10 | Walk and path counts | Walk counts | 
| 170 | SRW02 | self-returning walk count of order 2 | Walk and path counts | Self-returning walk counts | 
| 171 | SRW03 | self-returning walk count of order 3 | Walk and path counts | Self-returning walk counts | 
| 172 | SRW04 | self-returning walk count of order 4 | Walk and path counts | Self-returning walk counts | 
| 173 | SRW05 | self-returning walk count of order 5 | Walk and path counts | Self-returning walk counts | 
| 174 | SRW06 | self-returning walk count of order 6 | Walk and path counts | Self-returning walk counts | 
| 175 | SRW07 | self-returning walk count of order 7 | Walk and path counts | Self-returning walk counts | 
| 176 | SRW08 | self-returning walk count of order 8 | Walk and path counts | Self-returning walk counts | 
| 177 | SRW09 | self-returning walk count of order 9 | Walk and path counts | Self-returning walk counts | 
| 178 | SRW10 | self-returning walk count of order 10 | Walk and path counts | Self-returning walk counts | 
| 179 | MPC01 | molecular path count of order 1 (no. of non-H bonds) | Walk and path counts | Path counts | 
| 180 | MPC02 | molecular path count of order 2 (Gordon-Scantlebury index) | Walk and path counts | Path counts | 
| 181 | MPC03 | molecular path count of order 3 | Walk and path counts | Path counts | 
| 182 | MPC04 | molecular path count of order 4 | Walk and path counts | Path counts | 
| 183 | MPC05 | molecular path count of order 5 | Walk and path counts | Path counts | 
| 184 | MPC06 | molecular path count of order 6 | Walk and path counts | Path counts | 
| 185 | MPC07 | molecular path count of order 7 | Walk and path counts | Path counts | 
| 186 | MPC08 | molecular path count of order 8 | Walk and path counts | Path counts | 
| 187 | MPC09 | molecular path count of order 9 | Walk and path counts | Path counts | 
| 188 | MPC10 | molecular path count of order 10 | Walk and path counts | Path counts | 
| 189 | piPC01 | molecular multiple path count of order 1 | Walk and path counts | Multiple path counts | 
| 190 | piPC02 | molecular multiple path count of order 2 | Walk and path counts | Multiple path counts | 
| 191 | piPC03 | molecular multiple path count of order 3 | Walk and path counts | Multiple path counts | 
| 192 | piPC04 | molecular multiple path count of order 4 | Walk and path counts | Multiple path counts | 
| 193 | piPC05 | molecular multiple path count of order 5 | Walk and path counts | Multiple path counts | 
| 194 | piPC06 | molecular multiple path count of order 6 | Walk and path counts | Multiple path counts | 
| 195 | piPC07 | molecular multiple path count of order 7 | Walk and path counts | Multiple path counts | 
| 196 | piPC08 | molecular multiple path count of order 8 | Walk and path counts | Multiple path counts | 
| 197 | piPC09 | molecular multiple path count of order 9 | Walk and path counts | Multiple path counts | 
| 198 | piPC10 | molecular multiple path count of order 10 | Walk and path counts | Multiple path counts | 
| 199 | TWC | total walk count | Walk and path counts | ID numbers | 
| 200 | TPC | total path count | Walk and path counts | ID numbers | 
| 201 | piID | conventional bond order ID number | Walk and path counts | ID numbers | 
| 202 | PCR | ratio of multiple path count over path count | Walk and path counts | ID numbers | 
| 203 | PCD | difference between multiple path count and path count | Walk and path counts | ID numbers | 
| 204 | CID | Randic ID number | Walk and path counts | ID numbers | 
| 205 | BID | Balaban ID number | Walk and path counts | ID numbers | 
| 206 | X0 | connectivity index of order 0 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 207 | X1 | connectivity index of order 1 (Randic connectivity index) | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 208 | X2 | connectivity index of order 2 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 209 | X3 | connectivity index of order 3 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 210 | X4 | connectivity index of order 4 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 211 | X5 | connectivity index of order 5 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 212 | X0A | average connectivity index of order 0 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 213 | X1A | average connectivity index of order 1 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 214 | X2A | average connectivity index of order 2 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 215 | X3A | average connectivity index of order 3 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 216 | X4A | average connectivity index of order 4 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 217 | X5A | average connectivity index of order 5 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 218 | X0v | valence connectivity index of order 0 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 219 | X1v | valence connectivity index of order 1 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 220 | X2v | valence connectivity index of order 2 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 221 | X3v | valence connectivity index of order 3 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 222 | X4v | valence connectivity index of order 4 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 223 | X5v | valence connectivity index of order 5 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 224 | X0Av | average valence connectivity index of order 0 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 225 | X1Av | average valence connectivity index of order 1 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 226 | X2Av | average valence connectivity index of order 2 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 227 | X3Av | average valence connectivity index of order 3 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 228 | X4Av | average valence connectivity index of order 4 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 229 | X5Av | average valence connectivity index of order 5 | Connectivity indices | Kier-Hall molecular connectivity indices | 
| 230 | X0sol | solvation connectivity index of order 0 | Connectivity indices | Solvation connectivity indices | 
| 231 | X1sol | solvation connectivity index of order 1 | Connectivity indices | Solvation connectivity indices | 
| 232 | X2sol | solvation connectivity index of order 2 | Connectivity indices | Solvation connectivity indices | 
| 233 | X3sol | solvation connectivity index of order 3 | Connectivity indices | Solvation connectivity indices | 
| 234 | X4sol | solvation connectivity index of order 4 | Connectivity indices | Solvation connectivity indices | 
| 235 | X5sol | solvation connectivity index of order 5 | Connectivity indices | Solvation connectivity indices | 
| 236 | XMOD | modified Randic index | Connectivity indices | Randic-like connectivity indices | 
| 237 | RDCHI | reciprocal distance sum Randic-like index | Connectivity indices | Randic-like connectivity indices | 
| 238 | RDSQ | reciprocal distance sum inverse Randic-like index | Connectivity indices | Randic-like connectivity indices | 
| 239 | X1Kup | Kupchik connectivity index | Connectivity indices | Randic-like connectivity indices | 
| 240 | X1Mad | connectivity topochemical index | Connectivity indices | Randic-like connectivity indices | 
| 241 | X1Per | perturbation connectivity index | Connectivity indices | Randic-like connectivity indices | 
| 242 | X1MulPer | multiplicative perturbation connectivity index | Connectivity indices | Randic-like connectivity indices | 
| 243 | ISIZ | information index on molecular size | Information indices | Basic descriptors | 
| 244 | IAC | total information index on atomic composition | Information indices | Basic descriptors | 
| 245 | AAC | mean information index on atomic composition | Information indices | Basic descriptors | 
| 246 | IDE | mean information content on the distance equality | Information indices | Basic descriptors | 
| 247 | IDM | mean information content on the distance magnitude | Information indices | Basic descriptors | 
| 248 | IDDE | mean information content on the distance degree equality | Information indices | Basic descriptors | 
| 249 | IDDM | mean information content on the distance degree magnitude | Information indices | Basic descriptors | 
| 250 | IDET | total information content on the distance equality | Information indices | Basic descriptors | 
| 251 | IDMT | total information content on the distance magnitude | Information indices | Basic descriptors | 
| 252 | IVDE | mean information content on the vertex degree equality | Information indices | Basic descriptors | 
| 253 | IVDM | mean information content on the vertex degree magnitude | Information indices | Basic descriptors | 
| 254 | Ges | Number of symmetry classes (based on electrotopological state) | Information indices | Basic descriptors | 
| 255 | rGes | Relative number of symmetry classes (based on electrotopological state) | Information indices | Basic descriptors | 
| 256 | S0K | Kier symmetry index | Information indices | Basic descriptors | 
| 257 | HVcpx | graph vertex complexity index | Information indices | Basic descriptors | 
| 258 | HDcpx | graph distance complexity index (log function) | Information indices | Basic descriptors | 
| 259 | Uindex | Balaban U index | Information indices | Basic descriptors | 
| 260 | Vindex | Balaban V index | Information indices | Basic descriptors | 
| 261 | Xindex | Balaban X index | Information indices | Basic descriptors | 
| 262 | Yindex | Balaban Y index | Information indices | Basic descriptors | 
| 263 | IC0 | Information Content index (neighborhood symmetry of 0-order) | Information indices | Indices of neighborhood symmetry | 
| 264 | IC1 | Information Content index (neighborhood symmetry of 1-order) | Information indices | Indices of neighborhood symmetry | 
| 265 | IC2 | Information Content index (neighborhood symmetry of 2-order) | Information indices | Indices of neighborhood symmetry | 
| 266 | IC3 | Information Content index (neighborhood symmetry of 3-order) | Information indices | Indices of neighborhood symmetry | 
| 267 | IC4 | Information Content index (neighborhood symmetry of 4-order) | Information indices | Indices of neighborhood symmetry | 
| 268 | IC5 | Information Content index (neighborhood symmetry of 5-order) | Information indices | Indices of neighborhood symmetry | 
| 269 | TIC0 | Total Information Content index (neighborhood symmetry of 0-order) | Information indices | Indices of neighborhood symmetry | 
| 270 | TIC1 | Total Information Content index (neighborhood symmetry of 1-order) | Information indices | Indices of neighborhood symmetry | 
| 271 | TIC2 | Total Information Content index (neighborhood symmetry of 2-order) | Information indices | Indices of neighborhood symmetry | 
| 272 | TIC3 | Total Information Content index (neighborhood symmetry of 3-order) | Information indices | Indices of neighborhood symmetry | 
| 273 | TIC4 | Total Information Content index (neighborhood symmetry of 4-order) | Information indices | Indices of neighborhood symmetry | 
| 274 | TIC5 | Total Information Content index (neighborhood symmetry of 5-order) | Information indices | Indices of neighborhood symmetry | 
| 275 | SIC0 | Structural Information Content index (neighborhood symmetry of 0-order) | Information indices | Indices of neighborhood symmetry | 
| 276 | SIC1 | Structural Information Content index (neighborhood symmetry of 1-order) | Information indices | Indices of neighborhood symmetry | 
| 277 | SIC2 | Structural Information Content index (neighborhood symmetry of 2-order) | Information indices | Indices of neighborhood symmetry | 
| 278 | SIC3 | Structural Information Content index (neighborhood symmetry of 3-order) | Information indices | Indices of neighborhood symmetry | 
| 279 | SIC4 | Structural Information Content index (neighborhood symmetry of 4-order) | Information indices | Indices of neighborhood symmetry | 
| 280 | SIC5 | Structural Information Content index (neighborhood symmetry of 5-order) | Information indices | Indices of neighborhood symmetry | 
| 281 | CIC0 | Complementary Information Content index (neighborhood symmetry of 0-order) | Information indices | Indices of neighborhood symmetry | 
| 282 | CIC1 | Complementary Information Content index (neighborhood symmetry of 1-order) | Information indices | Indices of neighborhood symmetry | 
| 283 | CIC2 | Complementary Information Content index (neighborhood symmetry of 2-order) | Information indices | Indices of neighborhood symmetry | 
| 284 | CIC3 | Complementary Information Content index (neighborhood symmetry of 3-order) | Information indices | Indices of neighborhood symmetry | 
| 285 | CIC4 | Complementary Information Content index (neighborhood symmetry of 4-order) | Information indices | Indices of neighborhood symmetry | 
| 286 | CIC5 | Complementary Information Content index (neighborhood symmetry of 5-order) | Information indices | Indices of neighborhood symmetry | 
| 287 | BIC0 | Bond Information Content index (neighborhood symmetry of 0-order) | Information indices | Indices of neighborhood symmetry | 
| 288 | BIC1 | Bond Information Content index (neighborhood symmetry of 1-order) | Information indices | Indices of neighborhood symmetry | 
| 289 | BIC2 | Bond Information Content index (neighborhood symmetry of 2-order) | Information indices | Indices of neighborhood symmetry | 
| 290 | BIC3 | Bond Information Content index (neighborhood symmetry of 3-order) | Information indices | Indices of neighborhood symmetry | 
| 291 | BIC4 | Bond Information Content index (neighborhood symmetry of 4-order) | Information indices | Indices of neighborhood symmetry | 
| 292 | BIC5 | Bond Information Content index (neighborhood symmetry of 5-order) | Information indices | Indices of neighborhood symmetry | 
| 293 | J_A | Balaban-like index from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 294 | SpPos_A | spectral positive sum from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 295 | SpPosA_A | normalized spectral positive sum from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 296 | SpPosLog_A | logarithmic spectral positive sum from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 297 | SpMax_A | leading eigenvalue from adjacency matrix (Lovasz-Pelikan index) | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 298 | SpMaxA_A | normalized leading eigenvalue from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 299 | SpDiam_A | spectral diameter from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 300 | SpAD_A | spectral absolute deviation from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 301 | SpMAD_A | spectral mean absolute deviation from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 302 | Ho_A | Hosoya-like index (log function) from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 303 | EE_A | Estrada-like index (log function) from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 304 | VE1_A | coefficient sum of the last eigenvector (absolute values) from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 305 | VE2_A | average coefficient of the last eigenvector (absolute values) from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 306 | VE3_A | logarithmic coefficient sum of the last eigenvector (absolute values) from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 307 | VE1sign_A | coefficient sum of the last eigenvector from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 308 | VE2sign_A | average coefficient of the last eigenvector from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 309 | VE3sign_A | logarithmic coefficient sum of the last eigenvector from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 310 | VR1_A | Randic-like eigenvector-based index from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 311 | VR2_A | normalized Randic-like eigenvector-based index from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 312 | VR3_A | logarithmic Randic-like eigenvector-based index from adjacency matrix | 2D matrix-based descriptors | Adjacency matrix (A) | 
| 313 | Wi_D | Wiener-like index from topological distance matrix (Wiener index) | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 314 | WiA_D | average Wiener-like index from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 315 | AVS_D | average vertex sum from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 316 | H_D | Harary-like index from topological distance matrix (Harary index) | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 317 | Chi_D | Randic-like index from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 318 | ChiA_D | average Randic-like index from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 319 | J_D | Balaban-like index from topological distance matrix (Balaban distance connectivity index) | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 320 | HyWi_D | hyper-Wiener-like index (log function) from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 321 | SpPos_D | spectral positive sum from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 322 | SpPosA_D | normalized spectral positive sum from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 323 | SpPosLog_D | logarithmic spectral positive sum from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 324 | SpMax_D | leading eigenvalue from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 325 | SpMaxA_D | normalized leading eigenvalue from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 326 | SpDiam_D | spectral diameter from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 327 | SpAD_D | spectral absolute deviation from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 328 | SpMAD_D | spectral mean absolute deviation from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 329 | Ho_D | Hosoya-like index (log function) from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 330 | EE_D | Estrada-like index (log function) from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 331 | SM2_D | spectral moment of order 2 from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 332 | SM3_D | spectral moment of order 3 from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 333 | SM4_D | spectral moment of order 4 from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 334 | SM5_D | spectral moment of order 5 from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 335 | SM6_D | spectral moment of order 6 from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 336 | VE1_D | coefficient sum of the last eigenvector (absolute values) from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 337 | VE2_D | average coefficient of the last eigenvector (absolute values) from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 338 | VE3_D | logarithmic coefficient sum of the last eigenvector (absolute values) from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 339 | VE1sign_D | coefficient sum of the last eigenvector from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 340 | VE2sign_D | average coefficient of the last eigenvector from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 341 | VE3sign_D | logarithmic coefficient sum of the last eigenvector from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 342 | VR1_D | Randic-like eigenvector-based index from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 343 | VR2_D | normalized Randic-like eigenvector-based index from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 344 | VR3_D | logarithmic Randic-like eigenvector-based index from topological distance matrix | 2D matrix-based descriptors | Topological distance matrix (D) | 
| 345 | QW_L | quasi-Wiener index (Kirchhoff number) from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 346 | TI1_L | first Mohar index from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 347 | TI2_L | second Mohar index from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 348 | STN_L | spanning tree number (log function) from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 349 | SpPos_L | spectral positive sum from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 350 | SpPosA_L | normalized spectral positive sum from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 351 | SpPosLog_L | logarithmic spectral positive sum from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 352 | SpMax_L | leading eigenvalue from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 353 | SpMaxA_L | normalized leading eigenvalue from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 354 | SpDiam_L | spectral diameter from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 355 | SpAD_L | spectral absolute deviation from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 356 | SpMAD_L | spectral mean absolute deviation from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 357 | Ho_L | Hosoya-like index (log function) from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 358 | EE_L | Estrada-like index (log function) from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 359 | SM2_L | spectral moment of order 2 from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 360 | SM3_L | spectral moment of order 3 from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 361 | SM4_L | spectral moment of order 4 from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 362 | SM5_L | spectral moment of order 5 from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 363 | SM6_L | spectral moment of order 6 from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 364 | VE1_L | coefficient sum of the last eigenvector (absolute values) from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 365 | VE2_L | average coefficient of the last eigenvector (absolute values) from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 366 | VE3_L | logarithmic coefficient sum of the last eigenvector (absolute values) from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 367 | VE1sign_L | coefficient sum of the last eigenvector from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 368 | VE2sign_L | average coefficient of the last eigenvector from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 369 | VE3sign_L | logarithmic coefficient sum of the last eigenvector from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 370 | VR1_L | Randic-like eigenvector-based index from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 371 | VR2_L | normalized Randic-like eigenvector-based index from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 372 | VR3_L | logarithmic Randic-like eigenvector-based index from Laplace matrix | 2D matrix-based descriptors | Laplace matrix (L) | 
| 373 | AVS_X | average vertex sum from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 374 | H_X | Harary-like index from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 375 | Chi_X | Randic-like index from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 376 | ChiA_X | average Randic-like index from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 377 | J_X | Balaban-like index from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 378 | HyWi_X | hyper-Wiener-like index (log function) from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 379 | SpPos_X | spectral positive sum from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 380 | SpPosA_X | normalized spectral positive sum from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 381 | SpPosLog_X | logarithmic spectral positive sum from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 382 | SpMax_X | leading eigenvalue from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 383 | SpMaxA_X | normalized leading eigenvalue from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 384 | SpDiam_X | spectral diameter from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 385 | SpAD_X | spectral absolute deviation from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 386 | SpMAD_X | spectral mean absolute deviation from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 387 | Ho_X | Hosoya-like index (log function) from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 388 | EE_X | Estrada-like index (log function) from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 389 | SM2_X | spectral moment of order 2 from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 390 | SM3_X | spectral moment of order 3 from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 391 | SM4_X | spectral moment of order 4 from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 392 | SM5_X | spectral moment of order 5 from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 393 | SM6_X | spectral moment of order 6 from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 394 | VE1_X | coefficient sum of the last eigenvector (absolute values) from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 395 | VE2_X | average coefficient of the last eigenvector (absolute values) from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 396 | VE3_X | logarithmic coefficient sum of the last eigenvector (absolute values) from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 397 | VE1sign_X | coefficient sum of the last eigenvector from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 398 | VE2sign_X | average coefficient of the last eigenvector from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 399 | VE3sign_X | logarithmic coefficient sum of the last eigenvector from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 400 | VR1_X | Randic-like eigenvector-based index from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 401 | VR2_X | normalized Randic-like eigenvector-based index from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 402 | VR3_X | logarithmic Randic-like eigenvector-based index from chi matrix | 2D matrix-based descriptors | Chi matrix (X) | 
| 403 | Wi_H2 | Wiener-like index from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 404 | WiA_H2 | average Wiener-like index from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 405 | AVS_H2 | average vertex sum from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 406 | Chi_H2 | Randic-like index from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 407 | ChiA_H2 | average Randic-like index from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 408 | J_H2 | Balaban-like index from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 409 | HyWi_H2 | hyper-Wiener-like index (log function) from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 410 | SpPos_H2 | spectral positive sum from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 411 | SpPosA_H2 | normalized spectral positive sum from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 412 | SpPosLog_H2 | logarithmic spectral positive sum from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 413 | SpMax_H2 | leading eigenvalue from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 414 | SpMaxA_H2 | normalized leading eigenvalue from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 415 | SpDiam_H2 | spectral diameter from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 416 | SpAD_H2 | spectral absolute deviation from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 417 | SpMAD_H2 | spectral mean absolute deviation from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 418 | Ho_H2 | Hosoya-like index (log function) from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 419 | EE_H2 | Estrada-like index (log function) from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 420 | SM2_H2 | spectral moment of order 2 from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 421 | SM3_H2 | spectral moment of order 3 from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 422 | SM4_H2 | spectral moment of order 4 from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 423 | SM5_H2 | spectral moment of order 5 from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 424 | SM6_H2 | spectral moment of order 6 from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 425 | VE1_H2 | coefficient sum of the last eigenvector (absolute values) from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 426 | VE2_H2 | average coefficient of the last eigenvector (absolute values) from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 427 | VE3_H2 | logarithmic coefficient sum of the last eigenvector (absolute values) from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 428 | VE1sign_H2 | coefficient sum of the last eigenvector from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 429 | VE2sign_H2 | average coefficient of the last eigenvector from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 430 | VE3sign_H2 | logarithmic coefficient sum of the last eigenvector from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 431 | VR1_H2 | Randic-like eigenvector-based index from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 432 | VR2_H2 | normalized Randic-like eigenvector-based index from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 433 | VR3_H2 | logarithmic Randic-like eigenvector-based index from reciprocal squared distance matrix | 2D matrix-based descriptors | Reciprocal squared distance matrix (H2) | 
| 434 | Wi_Dt | Wiener-like index from detour matrix (detour index) | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 435 | WiA_Dt | average Wiener-like index from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 436 | AVS_Dt | average vertex sum from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 437 | H_Dt | Harary-like index from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 438 | Chi_Dt | Randic-like index from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 439 | ChiA_Dt | average Randic-like index from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 440 | J_Dt | Balaban-like index from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 441 | HyWi_Dt | hyper-Wiener-like index (log function) from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 442 | SpPos_Dt | spectral positive sum from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 443 | SpPosA_Dt | normalized spectral positive sum from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 444 | SpPosLog_Dt | logarithmic spectral positive sum from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 445 | SpMax_Dt | leading eigenvalue from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 446 | SpMaxA_Dt | normalized leading eigenvalue from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 447 | SpDiam_Dt | spectral diameter from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 448 | SpAD_Dt | spectral absolute deviation from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 449 | SpMAD_Dt | spectral mean absolute deviation from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 450 | Ho_Dt | Hosoya-like index (log function) from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 451 | EE_Dt | Estrada-like index (log function) from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 452 | SM2_Dt | spectral moment of order 2 from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 453 | SM3_Dt | spectral moment of order 3 from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 454 | SM4_Dt | spectral moment of order 4 from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 455 | SM5_Dt | spectral moment of order 5 from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 456 | SM6_Dt | spectral moment of order 6 from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 457 | VE1_Dt | coefficient sum of the last eigenvector (absolute values) from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 458 | VE2_Dt | average coefficient of the last eigenvector (absolute values) from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 459 | VE3_Dt | logarithmic coefficient sum of the last eigenvector (absolute values) from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 460 | VE1sign_Dt | coefficient sum of the last eigenvector from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 461 | VE2sign_Dt | average coefficient of the last eigenvector from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 462 | VE3sign_Dt | logarithmic coefficient sum of the last eigenvector from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 463 | VR1_Dt | Randic-like eigenvector-based index from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 464 | VR2_Dt | normalized Randic-like eigenvector-based index from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 465 | VR3_Dt | logarithmic Randic-like eigenvector-based index from detour matrix | 2D matrix-based descriptors | Detour matrix (Dt) | 
| 466 | Wi_D/Dt | Wiener-like index from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 467 | WiA_D/Dt | average Wiener-like index from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 468 | AVS_D/Dt | average vertex sum from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 469 | H_D/Dt | Harary-like index from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 470 | Chi_D/Dt | Randic-like index from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 471 | ChiA_D/Dt | average Randic-like index from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 472 | J_D/Dt | Balaban-like index from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 473 | HyWi_D/Dt | hyper-Wiener-like index (log function) from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 474 | SpPos_D/Dt | spectral positive sum from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 475 | SpPosA_D/Dt | normalized spectral positive sum from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 476 | SpPosLog_D/Dt | logarithmic spectral positive sum from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 477 | SpMax_D/Dt | leading eigenvalue from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 478 | SpMaxA_D/Dt | normalized leading eigenvalue from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 479 | SpDiam_D/Dt | spectral diameter from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 480 | SpAD_D/Dt | spectral absolute deviation from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 481 | SpMAD_D/Dt | spectral mean absolute deviation from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 482 | Ho_D/Dt | Hosoya-like index (log function) from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 483 | EE_D/Dt | Estrada-like index (log function) from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 484 | SM2_D/Dt | spectral moment of order 2 from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 485 | SM3_D/Dt | spectral moment of order 3 from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 486 | SM4_D/Dt | spectral moment of order 4 from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 487 | SM5_D/Dt | spectral moment of order 5 from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 488 | SM6_D/Dt | spectral moment of order 6 from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 489 | VE1_D/Dt | coefficient sum of the last eigenvector (absolute values) from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 490 | VE2_D/Dt | average coefficient of the last eigenvector (absolute values) from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 491 | VE3_D/Dt | logarithmic coefficient sum of the last eigenvector (absolute values) from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 492 | VE1sign_D/Dt | coefficient sum of the last eigenvector from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 493 | VE2sign_D/Dt | average coefficient of the last eigenvector from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 494 | VE3sign_D/Dt | logarithmic coefficient sum of the last eigenvector from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 495 | VR1_D/Dt | Randic-like eigenvector-based index from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 496 | VR2_D/Dt | normalized Randic-like eigenvector-based index from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 497 | VR3_D/Dt | logarithmic Randic-like eigenvector-based index from distance/detour matrix | 2D matrix-based descriptors | Distance / detour matrix (D/Dt) | 
| 498 | Wi_Dz(Z) | Wiener-like index from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 499 | WiA_Dz(Z) | average Wiener-like index from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 500 | AVS_Dz(Z) | average vertex sum from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 501 | H_Dz(Z) | Harary-like index from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 502 | Chi_Dz(Z) | Randic-like index from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 503 | ChiA_Dz(Z) | average Randic-like index from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 504 | J_Dz(Z) | Balaban-like index from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 505 | HyWi_Dz(Z) | hyper-Wiener-like index (log function) from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 506 | SpAbs_Dz(Z) | graph energy from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 507 | SpPos_Dz(Z) | spectral positive sum from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 508 | SpPosA_Dz(Z) | normalized spectral positive sum from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 509 | SpPosLog_Dz(Z) | logarithmic spectral positive sum from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 510 | SpMax_Dz(Z) | leading eigenvalue from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 511 | SpMaxA_Dz(Z) | normalized leading eigenvalue from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 512 | SpDiam_Dz(Z) | spectral diameter from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 513 | SpAD_Dz(Z) | spectral absolute deviation from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 514 | SpMAD_Dz(Z) | spectral mean absolute deviation from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 515 | Ho_Dz(Z) | Hosoya-like index (log function) from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 516 | EE_Dz(Z) | Estrada-like index (log function) from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 517 | SM1_Dz(Z) | spectral moment of order 1 from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 518 | SM2_Dz(Z) | spectral moment of order 2 from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 519 | SM3_Dz(Z) | spectral moment of order 3 from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 520 | SM4_Dz(Z) | spectral moment of order 4 from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 521 | SM5_Dz(Z) | spectral moment of order 5 from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 522 | SM6_Dz(Z) | spectral moment of order 6 from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 523 | VE1_Dz(Z) | coefficient sum of the last eigenvector (absolute values) from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 524 | VE2_Dz(Z) | average coefficient of the last eigenvector (absolute values) from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 525 | VE3_Dz(Z) | logarithmic coefficient sum of the last eigenvector (absolute values) from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 526 | VE1sign_Dz(Z) | coefficient sum of the last eigenvector from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 527 | VE2sign_Dz(Z) | average coefficient of the last eigenvector from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 528 | VE3sign_Dz(Z) | logarithmic coefficient sum of the last eigenvector from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 529 | VR1_Dz(Z) | Randic-like eigenvector-based index from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 530 | VR2_Dz(Z) | normalized Randic-like eigenvector-based index from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 531 | VR3_Dz(Z) | logarithmic Randic-like eigenvector-based index from Barysz matrix weighted by atomic number | 2D matrix-based descriptors | Barysz matrix weighted by atomic number (Dz(Z)) | 
| 532 | Wi_Dz(m) | Wiener-like index from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 533 | WiA_Dz(m) | average Wiener-like index from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 534 | AVS_Dz(m) | average vertex sum from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 535 | H_Dz(m) | Harary-like index from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 536 | Chi_Dz(m) | Randic-like index from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 537 | ChiA_Dz(m) | average Randic-like index from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 538 | J_Dz(m) | Balaban-like index from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 539 | HyWi_Dz(m) | hyper-Wiener-like index (log function) from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 540 | SpAbs_Dz(m) | graph energy from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 541 | SpPos_Dz(m) | spectral positive sum from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 542 | SpPosA_Dz(m) | normalized spectral positive sum from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 543 | SpPosLog_Dz(m) | logarithmic spectral positive sum from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 544 | SpMax_Dz(m) | leading eigenvalue from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 545 | SpMaxA_Dz(m) | normalized leading eigenvalue from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 546 | SpDiam_Dz(m) | spectral diameter from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 547 | SpAD_Dz(m) | spectral absolute deviation from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 548 | SpMAD_Dz(m) | spectral mean absolute deviation from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 549 | Ho_Dz(m) | Hosoya-like index (log function) from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 550 | EE_Dz(m) | Estrada-like index (log function) from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 551 | SM1_Dz(m) | spectral moment of order 1 from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 552 | SM2_Dz(m) | spectral moment of order 2 from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 553 | SM3_Dz(m) | spectral moment of order 3 from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 554 | SM4_Dz(m) | spectral moment of order 4 from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 555 | SM5_Dz(m) | spectral moment of order 5 from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 556 | SM6_Dz(m) | spectral moment of order 6 from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 557 | VE1_Dz(m) | coefficient sum of the last eigenvector (absolute values) from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 558 | VE2_Dz(m) | average coefficient of the last eigenvector (absolute values) from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 559 | VE3_Dz(m) | logarithmic coefficient sum of the last eigenvector (absolute values) from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 560 | VE1sign_Dz(m) | coefficient sum of the last eigenvector from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 561 | VE2sign_Dz(m) | average coefficient of the last eigenvector from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 562 | VE3sign_Dz(m) | logarithmic coefficient sum of the last eigenvector from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 563 | VR1_Dz(m) | Randic-like eigenvector-based index from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 564 | VR2_Dz(m) | normalized Randic-like eigenvector-based index from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 565 | VR3_Dz(m) | logarithmic Randic-like eigenvector-based index from Barysz matrix weighted by mass | 2D matrix-based descriptors | Barysz matrix weighted by mass (Dz(m)) | 
| 566 | Wi_Dz(v) | Wiener-like index from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 567 | WiA_Dz(v) | average Wiener-like index from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 568 | AVS_Dz(v) | average vertex sum from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 569 | H_Dz(v) | Harary-like index from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 570 | Chi_Dz(v) | Randic-like index from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 571 | ChiA_Dz(v) | average Randic-like index from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 572 | J_Dz(v) | Balaban-like index from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 573 | HyWi_Dz(v) | hyper-Wiener-like index (log function) from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 574 | SpAbs_Dz(v) | graph energy from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 575 | SpPos_Dz(v) | spectral positive sum from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 576 | SpPosA_Dz(v) | normalized spectral positive sum from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 577 | SpPosLog_Dz(v) | logarithmic spectral positive sum from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 578 | SpMax_Dz(v) | leading eigenvalue from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 579 | SpMaxA_Dz(v) | normalized leading eigenvalue from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 580 | SpDiam_Dz(v) | spectral diameter from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 581 | SpAD_Dz(v) | spectral absolute deviation from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 582 | SpMAD_Dz(v) | spectral mean absolute deviation from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 583 | Ho_Dz(v) | Hosoya-like index (log function) from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 584 | EE_Dz(v) | Estrada-like index (log function) from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 585 | SM1_Dz(v) | spectral moment of order 1 from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 586 | SM2_Dz(v) | spectral moment of order 2 from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 587 | SM3_Dz(v) | spectral moment of order 3 from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 588 | SM4_Dz(v) | spectral moment of order 4 from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 589 | SM5_Dz(v) | spectral moment of order 5 from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 590 | SM6_Dz(v) | spectral moment of order 6 from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 591 | VE1_Dz(v) | coefficient sum of the last eigenvector (absolute values) from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 592 | VE2_Dz(v) | average coefficient of the last eigenvector (absolute values) from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 593 | VE3_Dz(v) | logarithmic coefficient sum of the last eigenvector (absolute values) from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 594 | VE1sign_Dz(v) | coefficient sum of the last eigenvector from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 595 | VE2sign_Dz(v) | average coefficient of the last eigenvector from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 596 | VE3sign_Dz(v) | logarithmic coefficient sum of the last eigenvector from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 597 | VR1_Dz(v) | Randic-like eigenvector-based index from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 598 | VR2_Dz(v) | normalized Randic-like eigenvector-based index from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 599 | VR3_Dz(v) | logarithmic Randic-like eigenvector-based index from Barysz matrix weighted by van der Waals volume | 2D matrix-based descriptors | Barysz matrix weighted by Van der Waals volume (Dz(v)) | 
| 600 | Wi_Dz(e) | Wiener-like index from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 601 | WiA_Dz(e) | average Wiener-like index from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 602 | AVS_Dz(e) | average vertex sum from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 603 | H_Dz(e) | Harary-like index from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 604 | Chi_Dz(e) | Randic-like index from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 605 | ChiA_Dz(e) | average Randic-like index from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 606 | J_Dz(e) | Balaban-like index from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 607 | HyWi_Dz(e) | hyper-Wiener-like index (log function) from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 608 | SpAbs_Dz(e) | graph energy from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 609 | SpPos_Dz(e) | spectral positive sum from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 610 | SpPosA_Dz(e) | normalized spectral positive sum from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 611 | SpPosLog_Dz(e) | logarithmic spectral positive sum from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 612 | SpMax_Dz(e) | leading eigenvalue from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 613 | SpMaxA_Dz(e) | normalized leading eigenvalue from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 614 | SpDiam_Dz(e) | spectral diameter from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 615 | SpAD_Dz(e) | spectral absolute deviation from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 616 | SpMAD_Dz(e) | spectral mean absolute deviation from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 617 | Ho_Dz(e) | Hosoya-like index (log function) from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 618 | EE_Dz(e) | Estrada-like index (log function) from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 619 | SM1_Dz(e) | spectral moment of order 1 from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 620 | SM2_Dz(e) | spectral moment of order 2 from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 621 | SM3_Dz(e) | spectral moment of order 3 from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 622 | SM4_Dz(e) | spectral moment of order 4 from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 623 | SM5_Dz(e) | spectral moment of order 5 from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 624 | SM6_Dz(e) | spectral moment of order 6 from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 625 | VE1_Dz(e) | coefficient sum of the last eigenvector (absolute values) from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 626 | VE2_Dz(e) | average coefficient of the last eigenvector (absolute values) from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 627 | VE3_Dz(e) | logarithmic coefficient sum of the last eigenvector (absolute values) from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 628 | VE1sign_Dz(e) | coefficient sum of the last eigenvector from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 629 | VE2sign_Dz(e) | average coefficient of the last eigenvector from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 630 | VE3sign_Dz(e) | logarithmic coefficient sum of the last eigenvector from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 631 | VR1_Dz(e) | Randic-like eigenvector-based index from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 632 | VR2_Dz(e) | normalized Randic-like eigenvector-based index from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 633 | VR3_Dz(e) | logarithmic Randic-like eigenvector-based index from Barysz matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Barysz matrix weighted by Sanderson electronegativity (Dz(e)) | 
| 634 | Wi_Dz(p) | Wiener-like index from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 635 | WiA_Dz(p) | average Wiener-like index from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 636 | AVS_Dz(p) | average vertex sum from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 637 | H_Dz(p) | Harary-like index from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 638 | Chi_Dz(p) | Randic-like index from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 639 | ChiA_Dz(p) | average Randic-like index from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 640 | J_Dz(p) | Balaban-like index from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 641 | HyWi_Dz(p) | hyper-Wiener-like index (log function) from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 642 | SpAbs_Dz(p) | graph energy from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 643 | SpPos_Dz(p) | spectral positive sum from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 644 | SpPosA_Dz(p) | normalized spectral positive sum from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 645 | SpPosLog_Dz(p) | logarithmic spectral positive sum from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 646 | SpMax_Dz(p) | leading eigenvalue from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 647 | SpMaxA_Dz(p) | normalized leading eigenvalue from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 648 | SpDiam_Dz(p) | spectral diameter from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 649 | SpAD_Dz(p) | spectral absolute deviation from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 650 | SpMAD_Dz(p) | spectral mean absolute deviation from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 651 | Ho_Dz(p) | Hosoya-like index (log function) from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 652 | EE_Dz(p) | Estrada-like index (log function) from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 653 | SM1_Dz(p) | spectral moment of order 1 from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 654 | SM2_Dz(p) | spectral moment of order 2 from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 655 | SM3_Dz(p) | spectral moment of order 3 from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 656 | SM4_Dz(p) | spectral moment of order 4 from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 657 | SM5_Dz(p) | spectral moment of order 5 from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 658 | SM6_Dz(p) | spectral moment of order 6 from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 659 | VE1_Dz(p) | coefficient sum of the last eigenvector (absolute values) from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 660 | VE2_Dz(p) | average coefficient of the last eigenvector (absolute values) from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 661 | VE3_Dz(p) | logarithmic coefficient sum of the last eigenvector (absolute values) from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 662 | VE1sign_Dz(p) | coefficient sum of the last eigenvector from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 663 | VE2sign_Dz(p) | average coefficient of the last eigenvector from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 664 | VE3sign_Dz(p) | logarithmic coefficient sum of the last eigenvector from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 665 | VR1_Dz(p) | Randic-like eigenvector-based index from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 666 | VR2_Dz(p) | normalized Randic-like eigenvector-based index from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 667 | VR3_Dz(p) | logarithmic Randic-like eigenvector-based index from Barysz matrix weighted by polarizability | 2D matrix-based descriptors | Barysz matrix weighted by polarizability (Dz(p)) | 
| 668 | Wi_Dz(i) | Wiener-like index from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 669 | WiA_Dz(i) | average Wiener-like index from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 670 | AVS_Dz(i) | average vertex sum from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 671 | H_Dz(i) | Harary-like index from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 672 | Chi_Dz(i) | Randic-like index from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 673 | ChiA_Dz(i) | average Randic-like index from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 674 | J_Dz(i) | Balaban-like index from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 675 | HyWi_Dz(i) | hyper-Wiener-like index (log function) from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 676 | SpAbs_Dz(i) | graph energy from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 677 | SpPos_Dz(i) | spectral positive sum from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 678 | SpPosA_Dz(i) | normalized spectral positive sum from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 679 | SpPosLog_Dz(i) | logarithmic spectral positive sum from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 680 | SpMax_Dz(i) | leading eigenvalue from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 681 | SpMaxA_Dz(i) | normalized leading eigenvalue from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 682 | SpDiam_Dz(i) | spectral diameter from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 683 | SpAD_Dz(i) | spectral absolute deviation from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 684 | SpMAD_Dz(i) | spectral mean absolute deviation from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 685 | Ho_Dz(i) | Hosoya-like index (log function) from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 686 | EE_Dz(i) | Estrada-like index (log function) from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 687 | SM1_Dz(i) | spectral moment of order 1 from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 688 | SM2_Dz(i) | spectral moment of order 2 from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 689 | SM3_Dz(i) | spectral moment of order 3 from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 690 | SM4_Dz(i) | spectral moment of order 4 from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 691 | SM5_Dz(i) | spectral moment of order 5 from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 692 | SM6_Dz(i) | spectral moment of order 6 from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 693 | VE1_Dz(i) | coefficient sum of the last eigenvector (absolute values) from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 694 | VE2_Dz(i) | average coefficient of the last eigenvector (absolute values) from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 695 | VE3_Dz(i) | logarithmic coefficient sum of the last eigenvector (absolute values) from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 696 | VE1sign_Dz(i) | coefficient sum of the last eigenvector from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 697 | VE2sign_Dz(i) | average coefficient of the last eigenvector from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 698 | VE3sign_Dz(i) | logarithmic coefficient sum of the last eigenvector from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 699 | VR1_Dz(i) | Randic-like eigenvector-based index from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 700 | VR2_Dz(i) | normalized Randic-like eigenvector-based index from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 701 | VR3_Dz(i) | logarithmic Randic-like eigenvector-based index from Barysz matrix weighted by ionization potential | 2D matrix-based descriptors | Barysz matrix weighted by ionization potential (Dz(i)) | 
| 702 | Wi_B(m) | Wiener-like index from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 703 | WiA_B(m) | average Wiener-like index from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 704 | AVS_B(m) | average vertex sum from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 705 | Chi_B(m) | Randic-like index from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 706 | ChiA_B(m) | average Randic-like index from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 707 | J_B(m) | Balaban-like index from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 708 | HyWi_B(m) | hyper-Wiener-like index (log function) from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 709 | SpAbs_B(m) | graph energy from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 710 | SpPos_B(m) | spectral positive sum from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 711 | SpPosA_B(m) | normalized spectral positive sum from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 712 | SpPosLog_B(m) | logarithmic spectral positive sum from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 713 | SpMax_B(m) | leading eigenvalue from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 714 | SpMaxA_B(m) | normalized leading eigenvalue from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 715 | SpDiam_B(m) | spectral diameter from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 716 | SpAD_B(m) | spectral absolute deviation from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 717 | SpMAD_B(m) | spectral mean absolute deviation from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 718 | Ho_B(m) | Hosoya-like index (log function) from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 719 | EE_B(m) | Estrada-like index (log function) from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 720 | SM1_B(m) | spectral moment of order 1 from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 721 | SM2_B(m) | spectral moment of order 2 from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 722 | SM3_B(m) | spectral moment of order 3 from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 723 | SM4_B(m) | spectral moment of order 4 from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 724 | SM5_B(m) | spectral moment of order 5 from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 725 | SM6_B(m) | spectral moment of order 6 from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 726 | VE1_B(m) | coefficient sum of the last eigenvector (absolute values) from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 727 | VE2_B(m) | average coefficient of the last eigenvector (absolute values) from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 728 | VE3_B(m) | logarithmic coefficient sum of the last eigenvector (absolute values) from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 729 | VE1sign_B(m) | coefficient sum of the last eigenvector from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 730 | VE2sign_B(m) | average coefficient of the last eigenvector from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 731 | VE3sign_B(m) | logarithmic coefficient sum of the last eigenvector from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 732 | VR1_B(m) | Randic-like eigenvector-based index from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 733 | VR2_B(m) | normalized Randic-like eigenvector-based index from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 734 | VR3_B(m) | logarithmic Randic-like eigenvector-based index from Burden matrix weighted by mass | 2D matrix-based descriptors | Burden matrix weighted by mass (B(m)) | 
| 735 | Wi_B(v) | Wiener-like index from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 736 | WiA_B(v) | average Wiener-like index from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 737 | AVS_B(v) | average vertex sum from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 738 | Chi_B(v) | Randic-like index from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 739 | ChiA_B(v) | average Randic-like index from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 740 | J_B(v) | Balaban-like index from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 741 | HyWi_B(v) | hyper-Wiener-like index (log function) from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 742 | SpAbs_B(v) | graph energy from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 743 | SpPos_B(v) | spectral positive sum from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 744 | SpPosA_B(v) | normalized spectral positive sum from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 745 | SpPosLog_B(v) | logarithmic spectral positive sum from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 746 | SpMax_B(v) | leading eigenvalue from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 747 | SpMaxA_B(v) | normalized leading eigenvalue from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 748 | SpDiam_B(v) | spectral diameter from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 749 | SpAD_B(v) | spectral absolute deviation from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 750 | SpMAD_B(v) | spectral mean absolute deviation from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 751 | Ho_B(v) | Hosoya-like index (log function) from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 752 | EE_B(v) | Estrada-like index (log function) from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 753 | SM1_B(v) | spectral moment of order 1 from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 754 | SM2_B(v) | spectral moment of order 2 from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 755 | SM3_B(v) | spectral moment of order 3 from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 756 | SM4_B(v) | spectral moment of order 4 from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 757 | SM5_B(v) | spectral moment of order 5 from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 758 | SM6_B(v) | spectral moment of order 6 from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 759 | VE1_B(v) | coefficient sum of the last eigenvector (absolute values) from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 760 | VE2_B(v) | average coefficient of the last eigenvector (absolute values) from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 761 | VE3_B(v) | logarithmic coefficient sum of the last eigenvector (absolute values) from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 762 | VE1sign_B(v) | coefficient sum of the last eigenvector from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 763 | VE2sign_B(v) | average coefficient of the last eigenvector from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 764 | VE3sign_B(v) | logarithmic coefficient sum of the last eigenvector from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 765 | VR1_B(v) | Randic-like eigenvector-based index from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 766 | VR2_B(v) | normalized Randic-like eigenvector-based index from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 767 | VR3_B(v) | logarithmic Randic-like eigenvector-based index from Burden matrix weighted by van der Waals volume | 2D matrix-based descriptors | Burden matrix weighted by Van der Waals volume (B(v)) | 
| 768 | Wi_B(e) | Wiener-like index from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 769 | WiA_B(e) | average Wiener-like index from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 770 | AVS_B(e) | average vertex sum from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 771 | Chi_B(e) | Randic-like index from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 772 | ChiA_B(e) | average Randic-like index from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 773 | J_B(e) | Balaban-like index from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 774 | HyWi_B(e) | hyper-Wiener-like index (log function) from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 775 | SpAbs_B(e) | graph energy from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 776 | SpPos_B(e) | spectral positive sum from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 777 | SpPosA_B(e) | normalized spectral positive sum from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 778 | SpPosLog_B(e) | logarithmic spectral positive sum from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 779 | SpMax_B(e) | leading eigenvalue from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 780 | SpMaxA_B(e) | normalized leading eigenvalue from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 781 | SpDiam_B(e) | spectral diameter from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 782 | SpAD_B(e) | spectral absolute deviation from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 783 | SpMAD_B(e) | spectral mean absolute deviation from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 784 | Ho_B(e) | Hosoya-like index (log function) from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 785 | EE_B(e) | Estrada-like index (log function) from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 786 | SM1_B(e) | spectral moment of order 1 from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 787 | SM2_B(e) | spectral moment of order 2 from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 788 | SM3_B(e) | spectral moment of order 3 from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 789 | SM4_B(e) | spectral moment of order 4 from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 790 | SM5_B(e) | spectral moment of order 5 from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 791 | SM6_B(e) | spectral moment of order 6 from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 792 | VE1_B(e) | coefficient sum of the last eigenvector (absolute values) from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 793 | VE2_B(e) | average coefficient of the last eigenvector (absolute values) from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 794 | VE3_B(e) | logarithmic coefficient sum of the last eigenvector (absolute values) from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 795 | VE1sign_B(e) | coefficient sum of the last eigenvector from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 796 | VE2sign_B(e) | average coefficient of the last eigenvector from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 797 | VE3sign_B(e) | logarithmic coefficient sum of the last eigenvector from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 798 | VR1_B(e) | Randic-like eigenvector-based index from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 799 | VR2_B(e) | normalized Randic-like eigenvector-based index from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 800 | VR3_B(e) | logarithmic Randic-like eigenvector-based index from Burden matrix weighted by Sanderson electronegativity | 2D matrix-based descriptors | Burden matrix weighted by Sanderson electronegativity (B(e)) | 
| 801 | Wi_B(p) | Wiener-like index from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 802 | WiA_B(p) | average Wiener-like index from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 803 | AVS_B(p) | average vertex sum from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 804 | Chi_B(p) | Randic-like index from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 805 | ChiA_B(p) | average Randic-like index from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 806 | J_B(p) | Balaban-like index from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 807 | HyWi_B(p) | hyper-Wiener-like index (log function) from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 808 | SpAbs_B(p) | graph energy from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 809 | SpPos_B(p) | spectral positive sum from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 810 | SpPosA_B(p) | normalized spectral positive sum from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 811 | SpPosLog_B(p) | logarithmic spectral positive sum from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 812 | SpMax_B(p) | leading eigenvalue from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 813 | SpMaxA_B(p) | normalized leading eigenvalue from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 814 | SpDiam_B(p) | spectral diameter from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 815 | SpAD_B(p) | spectral absolute deviation from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 816 | SpMAD_B(p) | spectral mean absolute deviation from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 817 | Ho_B(p) | Hosoya-like index (log function) from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 818 | EE_B(p) | Estrada-like index (log function) from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 819 | SM1_B(p) | spectral moment of order 1 from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 820 | SM2_B(p) | spectral moment of order 2 from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 821 | SM3_B(p) | spectral moment of order 3 from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 822 | SM4_B(p) | spectral moment of order 4 from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 823 | SM5_B(p) | spectral moment of order 5 from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 824 | SM6_B(p) | spectral moment of order 6 from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 825 | VE1_B(p) | coefficient sum of the last eigenvector (absolute values) from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 826 | VE2_B(p) | average coefficient of the last eigenvector (absolute values) from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 827 | VE3_B(p) | logarithmic coefficient sum of the last eigenvector (absolute values) from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 828 | VE1sign_B(p) | coefficient sum of the last eigenvector from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 829 | VE2sign_B(p) | average coefficient of the last eigenvector from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 830 | VE3sign_B(p) | logarithmic coefficient sum of the last eigenvector from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 831 | VR1_B(p) | Randic-like eigenvector-based index from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 832 | VR2_B(p) | normalized Randic-like eigenvector-based index from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 833 | VR3_B(p) | logarithmic Randic-like eigenvector-based index from Burden matrix weighted by polarizability | 2D matrix-based descriptors | Burden matrix weighted by polarizability (B(p)) | 
| 834 | Wi_B(i) | Wiener-like index from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 835 | WiA_B(i) | average Wiener-like index from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 836 | AVS_B(i) | average vertex sum from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 837 | Chi_B(i) | Randic-like index from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 838 | ChiA_B(i) | average Randic-like index from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 839 | J_B(i) | Balaban-like index from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 840 | HyWi_B(i) | hyper-Wiener-like index (log function) from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 841 | SpAbs_B(i) | graph energy from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 842 | SpPos_B(i) | spectral positive sum from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 843 | SpPosA_B(i) | normalized spectral positive sum from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 844 | SpPosLog_B(i) | logarithmic spectral positive sum from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 845 | SpMax_B(i) | leading eigenvalue from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 846 | SpMaxA_B(i) | normalized leading eigenvalue from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 847 | SpDiam_B(i) | spectral diameter from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 848 | SpAD_B(i) | spectral absolute deviation from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 849 | SpMAD_B(i) | spectral mean absolute deviation from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 850 | Ho_B(i) | Hosoya-like index (log function) from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 851 | EE_B(i) | Estrada-like index (log function) from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 852 | SM1_B(i) | spectral moment of order 1 from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 853 | SM2_B(i) | spectral moment of order 2 from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 854 | SM3_B(i) | spectral moment of order 3 from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 855 | SM4_B(i) | spectral moment of order 4 from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 856 | SM5_B(i) | spectral moment of order 5 from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 857 | SM6_B(i) | spectral moment of order 6 from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 858 | VE1_B(i) | coefficient sum of the last eigenvector (absolute values) from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 859 | VE2_B(i) | average coefficient of the last eigenvector (absolute values) from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 860 | VE3_B(i) | logarithmic coefficient sum of the last eigenvector (absolute values) from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 861 | VE1sign_B(i) | coefficient sum of the last eigenvector from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 862 | VE2sign_B(i) | average coefficient of the last eigenvector from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 863 | VE3sign_B(i) | logarithmic coefficient sum of the last eigenvector from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 864 | VR1_B(i) | Randic-like eigenvector-based index from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 865 | VR2_B(i) | normalized Randic-like eigenvector-based index from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 866 | VR3_B(i) | logarithmic Randic-like eigenvector-based index from Burden matrix weighted by ionization potential | 2D matrix-based descriptors | Burden matrix weighted by ionization potential (B(i)) | 
| 867 | Wi_B(s) | Wiener-like index from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 868 | WiA_B(s) | average Wiener-like index from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 869 | AVS_B(s) | average vertex sum from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 870 | Chi_B(s) | Randic-like index from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 871 | ChiA_B(s) | average Randic-like index from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 872 | J_B(s) | Balaban-like index from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 873 | HyWi_B(s) | hyper-Wiener-like index (log function) from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 874 | SpAbs_B(s) | graph energy from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 875 | SpPos_B(s) | spectral positive sum from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 876 | SpPosA_B(s) | normalized spectral positive sum from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 877 | SpPosLog_B(s) | logarithmic spectral positive sum from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 878 | SpMax_B(s) | leading eigenvalue from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 879 | SpMaxA_B(s) | normalized leading eigenvalue from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 880 | SpDiam_B(s) | spectral diameter from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 881 | SpAD_B(s) | spectral absolute deviation from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 882 | SpMAD_B(s) | spectral mean absolute deviation from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 883 | Ho_B(s) | Hosoya-like index (log function) from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 884 | EE_B(s) | Estrada-like index (log function) from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 885 | SM1_B(s) | spectral moment of order 1 from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 886 | SM2_B(s) | spectral moment of order 2 from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 887 | SM3_B(s) | spectral moment of order 3 from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 888 | SM4_B(s) | spectral moment of order 4 from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 889 | SM5_B(s) | spectral moment of order 5 from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 890 | SM6_B(s) | spectral moment of order 6 from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 891 | VE1_B(s) | coefficient sum of the last eigenvector (absolute values) from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 892 | VE2_B(s) | average coefficient of the last eigenvector (absolute values) from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 893 | VE3_B(s) | logarithmic coefficient sum of the last eigenvector (absolute values) from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 894 | VE1sign_B(s) | coefficient sum of the last eigenvector from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 895 | VE2sign_B(s) | average coefficient of the last eigenvector from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 896 | VE3sign_B(s) | logarithmic coefficient sum of the last eigenvector from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 897 | VR1_B(s) | Randic-like eigenvector-based index from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 898 | VR2_B(s) | normalized Randic-like eigenvector-based index from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 899 | VR3_B(s) | logarithmic Randic-like eigenvector-based index from Burden matrix weighted by I-State | 2D matrix-based descriptors | Burden matrix weighted by I-state (B(s)) | 
| 900 | ATS1m | Broto-Moreau autocorrelation of lag 1 (log function) weighted by mass | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 901 | ATS2m | Broto-Moreau autocorrelation of lag 2 (log function) weighted by mass | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 902 | ATS3m | Broto-Moreau autocorrelation of lag 3 (log function) weighted by mass | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 903 | ATS4m | Broto-Moreau autocorrelation of lag 4 (log function) weighted by mass | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 904 | ATS5m | Broto-Moreau autocorrelation of lag 5 (log function) weighted by mass | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 905 | ATS6m | Broto-Moreau autocorrelation of lag 6 (log function) weighted by mass | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 906 | ATS7m | Broto-Moreau autocorrelation of lag 7 (log function) weighted by mass | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 907 | ATS8m | Broto-Moreau autocorrelation of lag 8 (log function) weighted by mass | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 908 | ATS1v | Broto-Moreau autocorrelation of lag 1 (log function) weighted by van der Waals volume | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 909 | ATS2v | Broto-Moreau autocorrelation of lag 2 (log function) weighted by van der Waals volume | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 910 | ATS3v | Broto-Moreau autocorrelation of lag 3 (log function) weighted by van der Waals volume | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 911 | ATS4v | Broto-Moreau autocorrelation of lag 4 (log function) weighted by van der Waals volume | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 912 | ATS5v | Broto-Moreau autocorrelation of lag 5 (log function) weighted by van der Waals volume | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 913 | ATS6v | Broto-Moreau autocorrelation of lag 6 (log function) weighted by van der Waals volume | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 914 | ATS7v | Broto-Moreau autocorrelation of lag 7 (log function) weighted by van der Waals volume | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 915 | ATS8v | Broto-Moreau autocorrelation of lag 8 (log function) weighted by van der Waals volume | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 916 | ATS1e | Broto-Moreau autocorrelation of lag 1 (log function) weighted by Sanderson electronegativity | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 917 | ATS2e | Broto-Moreau autocorrelation of lag 2 (log function) weighted by Sanderson electronegativity | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 918 | ATS3e | Broto-Moreau autocorrelation of lag 3 (log function) weighted by Sanderson electronegativity | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 919 | ATS4e | Broto-Moreau autocorrelation of lag 4 (log function) weighted by Sanderson electronegativity | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 920 | ATS5e | Broto-Moreau autocorrelation of lag 5 (log function) weighted by Sanderson electronegativity | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 921 | ATS6e | Broto-Moreau autocorrelation of lag 6 (log function) weighted by Sanderson electronegativity | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 922 | ATS7e | Broto-Moreau autocorrelation of lag 7 (log function) weighted by Sanderson electronegativity | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 923 | ATS8e | Broto-Moreau autocorrelation of lag 8 (log function) weighted by Sanderson electronegativity | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 924 | ATS1p | Broto-Moreau autocorrelation of lag 1 (log function) weighted by polarizability | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 925 | ATS2p | Broto-Moreau autocorrelation of lag 2 (log function) weighted by polarizability | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 926 | ATS3p | Broto-Moreau autocorrelation of lag 3 (log function) weighted by polarizability | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 927 | ATS4p | Broto-Moreau autocorrelation of lag 4 (log function) weighted by polarizability | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 928 | ATS5p | Broto-Moreau autocorrelation of lag 5 (log function) weighted by polarizability | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 929 | ATS6p | Broto-Moreau autocorrelation of lag 6 (log function) weighted by polarizability | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 930 | ATS7p | Broto-Moreau autocorrelation of lag 7 (log function) weighted by polarizability | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 931 | ATS8p | Broto-Moreau autocorrelation of lag 8 (log function) weighted by polarizability | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 932 | ATS1i | Broto-Moreau autocorrelation of lag 1 (log function) weighted by ionization potential | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 933 | ATS2i | Broto-Moreau autocorrelation of lag 2 (log function) weighted by ionization potential | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 934 | ATS3i | Broto-Moreau autocorrelation of lag 3 (log function) weighted by ionization potential | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 935 | ATS4i | Broto-Moreau autocorrelation of lag 4 (log function) weighted by ionization potential | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 936 | ATS5i | Broto-Moreau autocorrelation of lag 5 (log function) weighted by ionization potential | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 937 | ATS6i | Broto-Moreau autocorrelation of lag 6 (log function) weighted by ionization potential | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 938 | ATS7i | Broto-Moreau autocorrelation of lag 7 (log function) weighted by ionization potential | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 939 | ATS8i | Broto-Moreau autocorrelation of lag 8 (log function) weighted by ionization potential | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 940 | ATS1s | Broto-Moreau autocorrelation of lag 1 (log function) weighted by I-state | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 941 | ATS2s | Broto-Moreau autocorrelation of lag 2 (log function) weighted by I-state | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 942 | ATS3s | Broto-Moreau autocorrelation of lag 3 (log function) weighted by I-state | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 943 | ATS4s | Broto-Moreau autocorrelation of lag 4 (log function) weighted by I-state | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 944 | ATS5s | Broto-Moreau autocorrelation of lag 5 (log function) weighted by I-state | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 945 | ATS6s | Broto-Moreau autocorrelation of lag 6 (log function) weighted by I-state | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 946 | ATS7s | Broto-Moreau autocorrelation of lag 7 (log function) weighted by I-state | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 947 | ATS8s | Broto-Moreau autocorrelation of lag 8 (log function) weighted by I-state | 2D autocorrelations | Broto-Moreau autocorrelations | 
| 948 | ATSC1m | Centred Broto-Moreau autocorrelation of lag 1 weighted by mass | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 949 | ATSC2m | Centred Broto-Moreau autocorrelation of lag 2 weighted by mass | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 950 | ATSC3m | Centred Broto-Moreau autocorrelation of lag 3 weighted by mass | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 951 | ATSC4m | Centred Broto-Moreau autocorrelation of lag 4 weighted by mass | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 952 | ATSC5m | Centred Broto-Moreau autocorrelation of lag 5 weighted by mass | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 953 | ATSC6m | Centred Broto-Moreau autocorrelation of lag 6 weighted by mass | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 954 | ATSC7m | Centred Broto-Moreau autocorrelation of lag 7 weighted by mass | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 955 | ATSC8m | Centred Broto-Moreau autocorrelation of lag 8 weighted by mass | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 956 | ATSC1v | Centred Broto-Moreau autocorrelation of lag 1 weighted by van der Waals volume | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 957 | ATSC2v | Centred Broto-Moreau autocorrelation of lag 2 weighted by van der Waals volume | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 958 | ATSC3v | Centred Broto-Moreau autocorrelation of lag 3 weighted by van der Waals volume | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 959 | ATSC4v | Centred Broto-Moreau autocorrelation of lag 4 weighted by van der Waals volume | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 960 | ATSC5v | Centred Broto-Moreau autocorrelation of lag 5 weighted by van der Waals volume | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 961 | ATSC6v | Centred Broto-Moreau autocorrelation of lag 6 weighted by van der Waals volume | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 962 | ATSC7v | Centred Broto-Moreau autocorrelation of lag 7 weighted by van der Waals volume | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 963 | ATSC8v | Centred Broto-Moreau autocorrelation of lag 8 weighted by van der Waals volume | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 964 | ATSC1e | Centred Broto-Moreau autocorrelation of lag 1 weighted by Sanderson electronegativity | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 965 | ATSC2e | Centred Broto-Moreau autocorrelation of lag 2 weighted by Sanderson electronegativity | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 966 | ATSC3e | Centred Broto-Moreau autocorrelation of lag 3 weighted by Sanderson electronegativity | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 967 | ATSC4e | Centred Broto-Moreau autocorrelation of lag 4 weighted by Sanderson electronegativity | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 968 | ATSC5e | Centred Broto-Moreau autocorrelation of lag 5 weighted by Sanderson electronegativity | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 969 | ATSC6e | Centred Broto-Moreau autocorrelation of lag 6 weighted by Sanderson electronegativity | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 970 | ATSC7e | Centred Broto-Moreau autocorrelation of lag 7 weighted by Sanderson electronegativity | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 971 | ATSC8e | Centred Broto-Moreau autocorrelation of lag 8 weighted by Sanderson electronegativity | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 972 | ATSC1p | Centred Broto-Moreau autocorrelation of lag 1 weighted by polarizability | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 973 | ATSC2p | Centred Broto-Moreau autocorrelation of lag 2 weighted by polarizability | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 974 | ATSC3p | Centred Broto-Moreau autocorrelation of lag 3 weighted by polarizability | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 975 | ATSC4p | Centred Broto-Moreau autocorrelation of lag 4 weighted by polarizability | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 976 | ATSC5p | Centred Broto-Moreau autocorrelation of lag 5 weighted by polarizability | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 977 | ATSC6p | Centred Broto-Moreau autocorrelation of lag 6 weighted by polarizability | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 978 | ATSC7p | Centred Broto-Moreau autocorrelation of lag 7 weighted by polarizability | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 979 | ATSC8p | Centred Broto-Moreau autocorrelation of lag 8 weighted by polarizability | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 980 | ATSC1i | Centred Broto-Moreau autocorrelation of lag 1 weighted by ionization potential | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 981 | ATSC2i | Centred Broto-Moreau autocorrelation of lag 2 weighted by ionization potential | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 982 | ATSC3i | Centred Broto-Moreau autocorrelation of lag 3 weighted by ionization potential | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 983 | ATSC4i | Centred Broto-Moreau autocorrelation of lag 4 weighted by ionization potential | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 984 | ATSC5i | Centred Broto-Moreau autocorrelation of lag 5 weighted by ionization potential | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 985 | ATSC6i | Centred Broto-Moreau autocorrelation of lag 6 weighted by ionization potential | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 986 | ATSC7i | Centred Broto-Moreau autocorrelation of lag 7 weighted by ionization potential | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 987 | ATSC8i | Centred Broto-Moreau autocorrelation of lag 8 weighted by ionization potential | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 988 | ATSC1s | Centred Broto-Moreau autocorrelation of lag 1 weighted by I-state | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 989 | ATSC2s | Centred Broto-Moreau autocorrelation of lag 2 weighted by I-state | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 990 | ATSC3s | Centred Broto-Moreau autocorrelation of lag 3 weighted by I-state | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 991 | ATSC4s | Centred Broto-Moreau autocorrelation of lag 4 weighted by I-state | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 992 | ATSC5s | Centred Broto-Moreau autocorrelation of lag 5 weighted by I-state | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 993 | ATSC6s | Centred Broto-Moreau autocorrelation of lag 6 weighted by I-state | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 994 | ATSC7s | Centred Broto-Moreau autocorrelation of lag 7 weighted by I-state | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 995 | ATSC8s | Centred Broto-Moreau autocorrelation of lag 8 weighted by I-state | 2D autocorrelations | Centred Broto-Moreau autocorrelations | 
| 996 | MATS1m | Moran autocorrelation of lag 1 weighted by mass | 2D autocorrelations | Moran autocorrelations | 
| 997 | MATS2m | Moran autocorrelation of lag 2 weighted by mass | 2D autocorrelations | Moran autocorrelations | 
| 998 | MATS3m | Moran autocorrelation of lag 3 weighted by mass | 2D autocorrelations | Moran autocorrelations | 
| 999 | MATS4m | Moran autocorrelation of lag 4 weighted by mass | 2D autocorrelations | Moran autocorrelations | 
| 1000 | MATS5m | Moran autocorrelation of lag 5 weighted by mass | 2D autocorrelations | Moran autocorrelations | 
| 1001 | MATS6m | Moran autocorrelation of lag 6 weighted by mass | 2D autocorrelations | Moran autocorrelations | 
| 1002 | MATS7m | Moran autocorrelation of lag 7 weighted by mass | 2D autocorrelations | Moran autocorrelations | 
| 1003 | MATS8m | Moran autocorrelation of lag 8 weighted by mass | 2D autocorrelations | Moran autocorrelations | 
| 1004 | MATS1v | Moran autocorrelation of lag 1 weighted by van der Waals volume | 2D autocorrelations | Moran autocorrelations | 
| 1005 | MATS2v | Moran autocorrelation of lag 2 weighted by van der Waals volume | 2D autocorrelations | Moran autocorrelations | 
| 1006 | MATS3v | Moran autocorrelation of lag 3 weighted by van der Waals volume | 2D autocorrelations | Moran autocorrelations | 
| 1007 | MATS4v | Moran autocorrelation of lag 4 weighted by van der Waals volume | 2D autocorrelations | Moran autocorrelations | 
| 1008 | MATS5v | Moran autocorrelation of lag 5 weighted by van der Waals volume | 2D autocorrelations | Moran autocorrelations | 
| 1009 | MATS6v | Moran autocorrelation of lag 6 weighted by van der Waals volume | 2D autocorrelations | Moran autocorrelations | 
| 1010 | MATS7v | Moran autocorrelation of lag 7 weighted by van der Waals volume | 2D autocorrelations | Moran autocorrelations | 
| 1011 | MATS8v | Moran autocorrelation of lag 8 weighted by van der Waals volume | 2D autocorrelations | Moran autocorrelations | 
| 1012 | MATS1e | Moran autocorrelation of lag 1 weighted by Sanderson electronegativity | 2D autocorrelations | Moran autocorrelations | 
| 1013 | MATS2e | Moran autocorrelation of lag 2 weighted by Sanderson electronegativity | 2D autocorrelations | Moran autocorrelations | 
| 1014 | MATS3e | Moran autocorrelation of lag 3 weighted by Sanderson electronegativity | 2D autocorrelations | Moran autocorrelations | 
| 1015 | MATS4e | Moran autocorrelation of lag 4 weighted by Sanderson electronegativity | 2D autocorrelations | Moran autocorrelations | 
| 1016 | MATS5e | Moran autocorrelation of lag 5 weighted by Sanderson electronegativity | 2D autocorrelations | Moran autocorrelations | 
| 1017 | MATS6e | Moran autocorrelation of lag 6 weighted by Sanderson electronegativity | 2D autocorrelations | Moran autocorrelations | 
| 1018 | MATS7e | Moran autocorrelation of lag 7 weighted by Sanderson electronegativity | 2D autocorrelations | Moran autocorrelations | 
| 1019 | MATS8e | Moran autocorrelation of lag 8 weighted by Sanderson electronegativity | 2D autocorrelations | Moran autocorrelations | 
| 1020 | MATS1p | Moran autocorrelation of lag 1 weighted by polarizability | 2D autocorrelations | Moran autocorrelations | 
| 1021 | MATS2p | Moran autocorrelation of lag 2 weighted by polarizability | 2D autocorrelations | Moran autocorrelations | 
| 1022 | MATS3p | Moran autocorrelation of lag 3 weighted by polarizability | 2D autocorrelations | Moran autocorrelations | 
| 1023 | MATS4p | Moran autocorrelation of lag 4 weighted by polarizability | 2D autocorrelations | Moran autocorrelations | 
| 1024 | MATS5p | Moran autocorrelation of lag 5 weighted by polarizability | 2D autocorrelations | Moran autocorrelations | 
| 1025 | MATS6p | Moran autocorrelation of lag 6 weighted by polarizability | 2D autocorrelations | Moran autocorrelations | 
| 1026 | MATS7p | Moran autocorrelation of lag 7 weighted by polarizability | 2D autocorrelations | Moran autocorrelations | 
| 1027 | MATS8p | Moran autocorrelation of lag 8 weighted by polarizability | 2D autocorrelations | Moran autocorrelations | 
| 1028 | MATS1i | Moran autocorrelation of lag 1 weighted by ionization potential | 2D autocorrelations | Moran autocorrelations | 
| 1029 | MATS2i | Moran autocorrelation of lag 2 weighted by ionization potential | 2D autocorrelations | Moran autocorrelations | 
| 1030 | MATS3i | Moran autocorrelation of lag 3 weighted by ionization potential | 2D autocorrelations | Moran autocorrelations | 
| 1031 | MATS4i | Moran autocorrelation of lag 4 weighted by ionization potential | 2D autocorrelations | Moran autocorrelations | 
| 1032 | MATS5i | Moran autocorrelation of lag 5 weighted by ionization potential | 2D autocorrelations | Moran autocorrelations | 
| 1033 | MATS6i | Moran autocorrelation of lag 6 weighted by ionization potential | 2D autocorrelations | Moran autocorrelations | 
| 1034 | MATS7i | Moran autocorrelation of lag 7 weighted by ionization potential | 2D autocorrelations | Moran autocorrelations | 
| 1035 | MATS8i | Moran autocorrelation of lag 8 weighted by ionization potential | 2D autocorrelations | Moran autocorrelations | 
| 1036 | MATS1s | Moran autocorrelation of lag 1 weighted by I-state | 2D autocorrelations | Moran autocorrelations | 
| 1037 | MATS2s | Moran autocorrelation of lag 2 weighted by I-state | 2D autocorrelations | Moran autocorrelations | 
| 1038 | MATS3s | Moran autocorrelation of lag 3 weighted by I-state | 2D autocorrelations | Moran autocorrelations | 
| 1039 | MATS4s | Moran autocorrelation of lag 4 weighted by I-state | 2D autocorrelations | Moran autocorrelations | 
| 1040 | MATS5s | Moran autocorrelation of lag 5 weighted by I-state | 2D autocorrelations | Moran autocorrelations | 
| 1041 | MATS6s | Moran autocorrelation of lag 6 weighted by I-state | 2D autocorrelations | Moran autocorrelations | 
| 1042 | MATS7s | Moran autocorrelation of lag 7 weighted by I-state | 2D autocorrelations | Moran autocorrelations | 
| 1043 | MATS8s | Moran autocorrelation of lag 8 weighted by I-state | 2D autocorrelations | Moran autocorrelations | 
| 1044 | GATS1m | Geary autocorrelation of lag 1 weighted by mass | 2D autocorrelations | Geary autocorrelations | 
| 1045 | GATS2m | Geary autocorrelation of lag 2 weighted by mass | 2D autocorrelations | Geary autocorrelations | 
| 1046 | GATS3m | Geary autocorrelation of lag 3 weighted by mass | 2D autocorrelations | Geary autocorrelations | 
| 1047 | GATS4m | Geary autocorrelation of lag 4 weighted by mass | 2D autocorrelations | Geary autocorrelations | 
| 1048 | GATS5m | Geary autocorrelation of lag 5 weighted by mass | 2D autocorrelations | Geary autocorrelations | 
| 1049 | GATS6m | Geary autocorrelation of lag 6 weighted by mass | 2D autocorrelations | Geary autocorrelations | 
| 1050 | GATS7m | Geary autocorrelation of lag 7 weighted by mass | 2D autocorrelations | Geary autocorrelations | 
| 1051 | GATS8m | Geary autocorrelation of lag 8 weighted by mass | 2D autocorrelations | Geary autocorrelations | 
| 1052 | GATS1v | Geary autocorrelation of lag 1 weighted by van der Waals volume | 2D autocorrelations | Geary autocorrelations | 
| 1053 | GATS2v | Geary autocorrelation of lag 2 weighted by van der Waals volume | 2D autocorrelations | Geary autocorrelations | 
| 1054 | GATS3v | Geary autocorrelation of lag 3 weighted by van der Waals volume | 2D autocorrelations | Geary autocorrelations | 
| 1055 | GATS4v | Geary autocorrelation of lag 4 weighted by van der Waals volume | 2D autocorrelations | Geary autocorrelations | 
| 1056 | GATS5v | Geary autocorrelation of lag 5 weighted by van der Waals volume | 2D autocorrelations | Geary autocorrelations | 
| 1057 | GATS6v | Geary autocorrelation of lag 6 weighted by van der Waals volume | 2D autocorrelations | Geary autocorrelations | 
| 1058 | GATS7v | Geary autocorrelation of lag 7 weighted by van der Waals volume | 2D autocorrelations | Geary autocorrelations | 
| 1059 | GATS8v | Geary autocorrelation of lag 8 weighted by van der Waals volume | 2D autocorrelations | Geary autocorrelations | 
| 1060 | GATS1e | Geary autocorrelation of lag 1 weighted by Sanderson electronegativity | 2D autocorrelations | Geary autocorrelations | 
| 1061 | GATS2e | Geary autocorrelation of lag 2 weighted by Sanderson electronegativity | 2D autocorrelations | Geary autocorrelations | 
| 1062 | GATS3e | Geary autocorrelation of lag 3 weighted by Sanderson electronegativity | 2D autocorrelations | Geary autocorrelations | 
| 1063 | GATS4e | Geary autocorrelation of lag 4 weighted by Sanderson electronegativity | 2D autocorrelations | Geary autocorrelations | 
| 1064 | GATS5e | Geary autocorrelation of lag 5 weighted by Sanderson electronegativity | 2D autocorrelations | Geary autocorrelations | 
| 1065 | GATS6e | Geary autocorrelation of lag 6 weighted by Sanderson electronegativity | 2D autocorrelations | Geary autocorrelations | 
| 1066 | GATS7e | Geary autocorrelation of lag 7 weighted by Sanderson electronegativity | 2D autocorrelations | Geary autocorrelations | 
| 1067 | GATS8e | Geary autocorrelation of lag 8 weighted by Sanderson electronegativity | 2D autocorrelations | Geary autocorrelations | 
| 1068 | GATS1p | Geary autocorrelation of lag 1 weighted by polarizability | 2D autocorrelations | Geary autocorrelations | 
| 1069 | GATS2p | Geary autocorrelation of lag 2 weighted by polarizability | 2D autocorrelations | Geary autocorrelations | 
| 1070 | GATS3p | Geary autocorrelation of lag 3 weighted by polarizability | 2D autocorrelations | Geary autocorrelations | 
| 1071 | GATS4p | Geary autocorrelation of lag 4 weighted by polarizability | 2D autocorrelations | Geary autocorrelations | 
| 1072 | GATS5p | Geary autocorrelation of lag 5 weighted by polarizability | 2D autocorrelations | Geary autocorrelations | 
| 1073 | GATS6p | Geary autocorrelation of lag 6 weighted by polarizability | 2D autocorrelations | Geary autocorrelations | 
| 1074 | GATS7p | Geary autocorrelation of lag 7 weighted by polarizability | 2D autocorrelations | Geary autocorrelations | 
| 1075 | GATS8p | Geary autocorrelation of lag 8 weighted by polarizability | 2D autocorrelations | Geary autocorrelations | 
| 1076 | GATS1i | Geary autocorrelation of lag 1 weighted by ionization potential | 2D autocorrelations | Geary autocorrelations | 
| 1077 | GATS2i | Geary autocorrelation of lag 2 weighted by ionization potential | 2D autocorrelations | Geary autocorrelations | 
| 1078 | GATS3i | Geary autocorrelation of lag 3 weighted by ionization potential | 2D autocorrelations | Geary autocorrelations | 
| 1079 | GATS4i | Geary autocorrelation of lag 4 weighted by ionization potential | 2D autocorrelations | Geary autocorrelations | 
| 1080 | GATS5i | Geary autocorrelation of lag 5 weighted by ionization potential | 2D autocorrelations | Geary autocorrelations | 
| 1081 | GATS6i | Geary autocorrelation of lag 6 weighted by ionization potential | 2D autocorrelations | Geary autocorrelations | 
| 1082 | GATS7i | Geary autocorrelation of lag 7 weighted by ionization potential | 2D autocorrelations | Geary autocorrelations | 
| 1083 | GATS8i | Geary autocorrelation of lag 8 weighted by ionization potential | 2D autocorrelations | Geary autocorrelations | 
| 1084 | GATS1s | Geary autocorrelation of lag 1 weighted by I-state | 2D autocorrelations | Geary autocorrelations | 
| 1085 | GATS2s | Geary autocorrelation of lag 2 weighted by I-state | 2D autocorrelations | Geary autocorrelations | 
| 1086 | GATS3s | Geary autocorrelation of lag 3 weighted by I-state | 2D autocorrelations | Geary autocorrelations | 
| 1087 | GATS4s | Geary autocorrelation of lag 4 weighted by I-state | 2D autocorrelations | Geary autocorrelations | 
| 1088 | GATS5s | Geary autocorrelation of lag 5 weighted by I-state | 2D autocorrelations | Geary autocorrelations | 
| 1089 | GATS6s | Geary autocorrelation of lag 6 weighted by I-state | 2D autocorrelations | Geary autocorrelations | 
| 1090 | GATS7s | Geary autocorrelation of lag 7 weighted by I-state | 2D autocorrelations | Geary autocorrelations | 
| 1091 | GATS8s | Geary autocorrelation of lag 8 weighted by I-state | 2D autocorrelations | Geary autocorrelations | 
| 1092 | GGI1 | topological charge index of order 1 | 2D autocorrelations | Topological charge autocorrelations | 
| 1093 | GGI2 | topological charge index of order 2 | 2D autocorrelations | Topological charge autocorrelations | 
| 1094 | GGI3 | topological charge index of order 3 | 2D autocorrelations | Topological charge autocorrelations | 
| 1095 | GGI4 | topological charge index of order 4 | 2D autocorrelations | Topological charge autocorrelations | 
| 1096 | GGI5 | topological charge index of order 5 | 2D autocorrelations | Topological charge autocorrelations | 
| 1097 | GGI6 | topological charge index of order 6 | 2D autocorrelations | Topological charge autocorrelations | 
| 1098 | GGI7 | topological charge index of order 7 | 2D autocorrelations | Topological charge autocorrelations | 
| 1099 | GGI8 | topological charge index of order 8 | 2D autocorrelations | Topological charge autocorrelations | 
| 1100 | GGI9 | topological charge index of order 9 | 2D autocorrelations | Topological charge autocorrelations | 
| 1101 | GGI10 | topological charge index of order 10 | 2D autocorrelations | Topological charge autocorrelations | 
| 1102 | JGI1 | mean topological charge index of order 1 | 2D autocorrelations | Topological charge autocorrelations | 
| 1103 | JGI2 | mean topological charge index of order 2 | 2D autocorrelations | Topological charge autocorrelations | 
| 1104 | JGI3 | mean topological charge index of order 3 | 2D autocorrelations | Topological charge autocorrelations | 
| 1105 | JGI4 | mean topological charge index of order 4 | 2D autocorrelations | Topological charge autocorrelations | 
| 1106 | JGI5 | mean topological charge index of order 5 | 2D autocorrelations | Topological charge autocorrelations | 
| 1107 | JGI6 | mean topological charge index of order 6 | 2D autocorrelations | Topological charge autocorrelations | 
| 1108 | JGI7 | mean topological charge index of order 7 | 2D autocorrelations | Topological charge autocorrelations | 
| 1109 | JGI8 | mean topological charge index of order 8 | 2D autocorrelations | Topological charge autocorrelations | 
| 1110 | JGI9 | mean topological charge index of order 9 | 2D autocorrelations | Topological charge autocorrelations | 
| 1111 | JGI10 | mean topological charge index of order 10 | 2D autocorrelations | Topological charge autocorrelations | 
| 1112 | JGT | global topological charge index | 2D autocorrelations | Topological charge autocorrelations | 
| 1113 | SpMax1_Bh(m) | largest eigenvalue n. 1 of Burden matrix weighted by mass | Burden eigenvalues | Largest eigenvalues | 
| 1114 | SpMax2_Bh(m) | largest eigenvalue n. 2 of Burden matrix weighted by mass | Burden eigenvalues | Largest eigenvalues | 
| 1115 | SpMax3_Bh(m) | largest eigenvalue n. 3 of Burden matrix weighted by mass | Burden eigenvalues | Largest eigenvalues | 
| 1116 | SpMax4_Bh(m) | largest eigenvalue n. 4 of Burden matrix weighted by mass | Burden eigenvalues | Largest eigenvalues | 
| 1117 | SpMax5_Bh(m) | largest eigenvalue n. 5 of Burden matrix weighted by mass | Burden eigenvalues | Largest eigenvalues | 
| 1118 | SpMax6_Bh(m) | largest eigenvalue n. 6 of Burden matrix weighted by mass | Burden eigenvalues | Largest eigenvalues | 
| 1119 | SpMax7_Bh(m) | largest eigenvalue n. 7 of Burden matrix weighted by mass | Burden eigenvalues | Largest eigenvalues | 
| 1120 | SpMax8_Bh(m) | largest eigenvalue n. 8 of Burden matrix weighted by mass | Burden eigenvalues | Largest eigenvalues | 
| 1121 | SpMax1_Bh(v) | largest eigenvalue n. 1 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Largest eigenvalues | 
| 1122 | SpMax2_Bh(v) | largest eigenvalue n. 2 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Largest eigenvalues | 
| 1123 | SpMax3_Bh(v) | largest eigenvalue n. 3 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Largest eigenvalues | 
| 1124 | SpMax4_Bh(v) | largest eigenvalue n. 4 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Largest eigenvalues | 
| 1125 | SpMax5_Bh(v) | largest eigenvalue n. 5 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Largest eigenvalues | 
| 1126 | SpMax6_Bh(v) | largest eigenvalue n. 6 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Largest eigenvalues | 
| 1127 | SpMax7_Bh(v) | largest eigenvalue n. 7 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Largest eigenvalues | 
| 1128 | SpMax8_Bh(v) | largest eigenvalue n. 8 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Largest eigenvalues | 
| 1129 | SpMax1_Bh(e) | largest eigenvalue n. 1 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Largest eigenvalues | 
| 1130 | SpMax2_Bh(e) | largest eigenvalue n. 2 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Largest eigenvalues | 
| 1131 | SpMax3_Bh(e) | largest eigenvalue n. 3 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Largest eigenvalues | 
| 1132 | SpMax4_Bh(e) | largest eigenvalue n. 4 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Largest eigenvalues | 
| 1133 | SpMax5_Bh(e) | largest eigenvalue n. 5 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Largest eigenvalues | 
| 1134 | SpMax6_Bh(e) | largest eigenvalue n. 6 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Largest eigenvalues | 
| 1135 | SpMax7_Bh(e) | largest eigenvalue n. 7 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Largest eigenvalues | 
| 1136 | SpMax8_Bh(e) | largest eigenvalue n. 8 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Largest eigenvalues | 
| 1137 | SpMax1_Bh(p) | largest eigenvalue n. 1 of Burden matrix weighted by polarizability | Burden eigenvalues | Largest eigenvalues | 
| 1138 | SpMax2_Bh(p) | largest eigenvalue n. 2 of Burden matrix weighted by polarizability | Burden eigenvalues | Largest eigenvalues | 
| 1139 | SpMax3_Bh(p) | largest eigenvalue n. 3 of Burden matrix weighted by polarizability | Burden eigenvalues | Largest eigenvalues | 
| 1140 | SpMax4_Bh(p) | largest eigenvalue n. 4 of Burden matrix weighted by polarizability | Burden eigenvalues | Largest eigenvalues | 
| 1141 | SpMax5_Bh(p) | largest eigenvalue n. 5 of Burden matrix weighted by polarizability | Burden eigenvalues | Largest eigenvalues | 
| 1142 | SpMax6_Bh(p) | largest eigenvalue n. 6 of Burden matrix weighted by polarizability | Burden eigenvalues | Largest eigenvalues | 
| 1143 | SpMax7_Bh(p) | largest eigenvalue n. 7 of Burden matrix weighted by polarizability | Burden eigenvalues | Largest eigenvalues | 
| 1144 | SpMax8_Bh(p) | largest eigenvalue n. 8 of Burden matrix weighted by polarizability | Burden eigenvalues | Largest eigenvalues | 
| 1145 | SpMax1_Bh(i) | largest eigenvalue n. 1 of Burden matrix weighted by ionization potential | Burden eigenvalues | Largest eigenvalues | 
| 1146 | SpMax2_Bh(i) | largest eigenvalue n. 2 of Burden matrix weighted by ionization potential | Burden eigenvalues | Largest eigenvalues | 
| 1147 | SpMax3_Bh(i) | largest eigenvalue n. 3 of Burden matrix weighted by ionization potential | Burden eigenvalues | Largest eigenvalues | 
| 1148 | SpMax4_Bh(i) | largest eigenvalue n. 4 of Burden matrix weighted by ionization potential | Burden eigenvalues | Largest eigenvalues | 
| 1149 | SpMax5_Bh(i) | largest eigenvalue n. 5 of Burden matrix weighted by ionization potential | Burden eigenvalues | Largest eigenvalues | 
| 1150 | SpMax6_Bh(i) | largest eigenvalue n. 6 of Burden matrix weighted by ionization potential | Burden eigenvalues | Largest eigenvalues | 
| 1151 | SpMax7_Bh(i) | largest eigenvalue n. 7 of Burden matrix weighted by ionization potential | Burden eigenvalues | Largest eigenvalues | 
| 1152 | SpMax8_Bh(i) | largest eigenvalue n. 8 of Burden matrix weighted by ionization potential | Burden eigenvalues | Largest eigenvalues | 
| 1153 | SpMax1_Bh(s) | largest eigenvalue n. 1 of Burden matrix weighted by I-state | Burden eigenvalues | Largest eigenvalues | 
| 1154 | SpMax2_Bh(s) | largest eigenvalue n. 2 of Burden matrix weighted by I-state | Burden eigenvalues | Largest eigenvalues | 
| 1155 | SpMax3_Bh(s) | largest eigenvalue n. 3 of Burden matrix weighted by I-state | Burden eigenvalues | Largest eigenvalues | 
| 1156 | SpMax4_Bh(s) | largest eigenvalue n. 4 of Burden matrix weighted by I-state | Burden eigenvalues | Largest eigenvalues | 
| 1157 | SpMax5_Bh(s) | largest eigenvalue n. 5 of Burden matrix weighted by I-state | Burden eigenvalues | Largest eigenvalues | 
| 1158 | SpMax6_Bh(s) | largest eigenvalue n. 6 of Burden matrix weighted by I-state | Burden eigenvalues | Largest eigenvalues | 
| 1159 | SpMax7_Bh(s) | largest eigenvalue n. 7 of Burden matrix weighted by I-state | Burden eigenvalues | Largest eigenvalues | 
| 1160 | SpMax8_Bh(s) | largest eigenvalue n. 8 of Burden matrix weighted by I-state | Burden eigenvalues | Largest eigenvalues | 
| 1161 | SpMin1_Bh(m) | smallest eigenvalue n. 1 of Burden matrix weighted by mass | Burden eigenvalues | Smallest eigenvalues | 
| 1162 | SpMin2_Bh(m) | smallest eigenvalue n. 2 of Burden matrix weighted by mass | Burden eigenvalues | Smallest eigenvalues | 
| 1163 | SpMin3_Bh(m) | smallest eigenvalue n. 3 of Burden matrix weighted by mass | Burden eigenvalues | Smallest eigenvalues | 
| 1164 | SpMin4_Bh(m) | smallest eigenvalue n. 4 of Burden matrix weighted by mass | Burden eigenvalues | Smallest eigenvalues | 
| 1165 | SpMin5_Bh(m) | smallest eigenvalue n. 5 of Burden matrix weighted by mass | Burden eigenvalues | Smallest eigenvalues | 
| 1166 | SpMin6_Bh(m) | smallest eigenvalue n. 6 of Burden matrix weighted by mass | Burden eigenvalues | Smallest eigenvalues | 
| 1167 | SpMin7_Bh(m) | smallest eigenvalue n. 7 of Burden matrix weighted by mass | Burden eigenvalues | Smallest eigenvalues | 
| 1168 | SpMin8_Bh(m) | smallest eigenvalue n. 8 of Burden matrix weighted by mass | Burden eigenvalues | Smallest eigenvalues | 
| 1169 | SpMin1_Bh(v) | smallest eigenvalue n. 1 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Smallest eigenvalues | 
| 1170 | SpMin2_Bh(v) | smallest eigenvalue n. 2 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Smallest eigenvalues | 
| 1171 | SpMin3_Bh(v) | smallest eigenvalue n. 3 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Smallest eigenvalues | 
| 1172 | SpMin4_Bh(v) | smallest eigenvalue n. 4 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Smallest eigenvalues | 
| 1173 | SpMin5_Bh(v) | smallest eigenvalue n. 5 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Smallest eigenvalues | 
| 1174 | SpMin6_Bh(v) | smallest eigenvalue n. 6 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Smallest eigenvalues | 
| 1175 | SpMin7_Bh(v) | smallest eigenvalue n. 7 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Smallest eigenvalues | 
| 1176 | SpMin8_Bh(v) | smallest eigenvalue n. 8 of Burden matrix weighted by van der Waals volume | Burden eigenvalues | Smallest eigenvalues | 
| 1177 | SpMin1_Bh(e) | smallest eigenvalue n. 1 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Smallest eigenvalues | 
| 1178 | SpMin2_Bh(e) | smallest eigenvalue n. 2 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Smallest eigenvalues | 
| 1179 | SpMin3_Bh(e) | smallest eigenvalue n. 3 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Smallest eigenvalues | 
| 1180 | SpMin4_Bh(e) | smallest eigenvalue n. 4 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Smallest eigenvalues | 
| 1181 | SpMin5_Bh(e) | smallest eigenvalue n. 5 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Smallest eigenvalues | 
| 1182 | SpMin6_Bh(e) | smallest eigenvalue n. 6 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Smallest eigenvalues | 
| 1183 | SpMin7_Bh(e) | smallest eigenvalue n. 7 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Smallest eigenvalues | 
| 1184 | SpMin8_Bh(e) | smallest eigenvalue n. 8 of Burden matrix weighted by Sanderson electronegativity | Burden eigenvalues | Smallest eigenvalues | 
| 1185 | SpMin1_Bh(p) | smallest eigenvalue n. 1 of Burden matrix weighted by polarizability | Burden eigenvalues | Smallest eigenvalues | 
| 1186 | SpMin2_Bh(p) | smallest eigenvalue n. 2 of Burden matrix weighted by polarizability | Burden eigenvalues | Smallest eigenvalues | 
| 1187 | SpMin3_Bh(p) | smallest eigenvalue n. 3 of Burden matrix weighted by polarizability | Burden eigenvalues | Smallest eigenvalues | 
| 1188 | SpMin4_Bh(p) | smallest eigenvalue n. 4 of Burden matrix weighted by polarizability | Burden eigenvalues | Smallest eigenvalues | 
| 1189 | SpMin5_Bh(p) | smallest eigenvalue n. 5 of Burden matrix weighted by polarizability | Burden eigenvalues | Smallest eigenvalues | 
| 1190 | SpMin6_Bh(p) | smallest eigenvalue n. 6 of Burden matrix weighted by polarizability | Burden eigenvalues | Smallest eigenvalues | 
| 1191 | SpMin7_Bh(p) | smallest eigenvalue n. 7 of Burden matrix weighted by polarizability | Burden eigenvalues | Smallest eigenvalues | 
| 1192 | SpMin8_Bh(p) | smallest eigenvalue n. 8 of Burden matrix weighted by polarizability | Burden eigenvalues | Smallest eigenvalues | 
| 1193 | SpMin1_Bh(i) | smallest eigenvalue n. 1 of Burden matrix weighted by ionization potential | Burden eigenvalues | Smallest eigenvalues | 
| 1194 | SpMin2_Bh(i) | smallest eigenvalue n. 2 of Burden matrix weighted by ionization potential | Burden eigenvalues | Smallest eigenvalues | 
| 1195 | SpMin3_Bh(i) | smallest eigenvalue n. 3 of Burden matrix weighted by ionization potential | Burden eigenvalues | Smallest eigenvalues | 
| 1196 | SpMin4_Bh(i) | smallest eigenvalue n. 4 of Burden matrix weighted by ionization potential | Burden eigenvalues | Smallest eigenvalues | 
| 1197 | SpMin5_Bh(i) | smallest eigenvalue n. 5 of Burden matrix weighted by ionization potential | Burden eigenvalues | Smallest eigenvalues | 
| 1198 | SpMin6_Bh(i) | smallest eigenvalue n. 6 of Burden matrix weighted by ionization potential | Burden eigenvalues | Smallest eigenvalues | 
| 1199 | SpMin7_Bh(i) | smallest eigenvalue n. 7 of Burden matrix weighted by ionization potential | Burden eigenvalues | Smallest eigenvalues | 
| 1200 | SpMin8_Bh(i) | smallest eigenvalue n. 8 of Burden matrix weighted by ionization potential | Burden eigenvalues | Smallest eigenvalues | 
| 1201 | SpMin1_Bh(s) | smallest eigenvalue n. 1 of Burden matrix weighted by I-state | Burden eigenvalues | Smallest eigenvalues | 
| 1202 | SpMin2_Bh(s) | smallest eigenvalue n. 2 of Burden matrix weighted by I-state | Burden eigenvalues | Smallest eigenvalues | 
| 1203 | SpMin3_Bh(s) | smallest eigenvalue n. 3 of Burden matrix weighted by I-state | Burden eigenvalues | Smallest eigenvalues | 
| 1204 | SpMin4_Bh(s) | smallest eigenvalue n. 4 of Burden matrix weighted by I-state | Burden eigenvalues | Smallest eigenvalues | 
| 1205 | SpMin5_Bh(s) | smallest eigenvalue n. 5 of Burden matrix weighted by I-state | Burden eigenvalues | Smallest eigenvalues | 
| 1206 | SpMin6_Bh(s) | smallest eigenvalue n. 6 of Burden matrix weighted by I-state | Burden eigenvalues | Smallest eigenvalues | 
| 1207 | SpMin7_Bh(s) | smallest eigenvalue n. 7 of Burden matrix weighted by I-state | Burden eigenvalues | Smallest eigenvalues | 
| 1208 | SpMin8_Bh(s) | smallest eigenvalue n. 8 of Burden matrix weighted by I-state | Burden eigenvalues | Smallest eigenvalues | 
| 1209 | P_VSA_LogP_1 | P_VSA-like on LogP, bin 1 | P_VSA-like descriptors | LogP | 
| 1210 | P_VSA_LogP_2 | P_VSA-like on LogP, bin 2 | P_VSA-like descriptors | LogP | 
| 1211 | P_VSA_LogP_3 | P_VSA-like on LogP, bin 3 | P_VSA-like descriptors | LogP | 
| 1212 | P_VSA_LogP_4 | P_VSA-like on LogP, bin 4 | P_VSA-like descriptors | LogP | 
| 1213 | P_VSA_LogP_5 | P_VSA-like on LogP, bin 5 | P_VSA-like descriptors | LogP | 
| 1214 | P_VSA_LogP_6 | P_VSA-like on LogP, bin 6 | P_VSA-like descriptors | LogP | 
| 1215 | P_VSA_LogP_7 | P_VSA-like on LogP, bin 7 | P_VSA-like descriptors | LogP | 
| 1216 | P_VSA_LogP_8 | P_VSA-like on LogP, bin 8 | P_VSA-like descriptors | LogP | 
| 1217 | P_VSA_MR_1 | P_VSA-like on Molar Refractivity, bin 1 | P_VSA-like descriptors | Molar Refractivity | 
| 1218 | P_VSA_MR_2 | P_VSA-like on Molar Refractivity, bin 2 | P_VSA-like descriptors | Molar Refractivity | 
| 1219 | P_VSA_MR_3 | P_VSA-like on Molar Refractivity, bin 3 | P_VSA-like descriptors | Molar Refractivity | 
| 1220 | P_VSA_MR_4 | P_VSA-like on Molar Refractivity, bin 4 | P_VSA-like descriptors | Molar Refractivity | 
| 1221 | P_VSA_MR_5 | P_VSA-like on Molar Refractivity, bin 5 | P_VSA-like descriptors | Molar Refractivity | 
| 1222 | P_VSA_MR_6 | P_VSA-like on Molar Refractivity, bin 6 | P_VSA-like descriptors | Molar Refractivity | 
| 1223 | P_VSA_MR_7 | P_VSA-like on Molar Refractivity, bin 7 | P_VSA-like descriptors | Molar Refractivity | 
| 1224 | P_VSA_MR_8 | P_VSA-like on Molar Refractivity, bin 8 | P_VSA-like descriptors | Molar Refractivity | 
| 1225 | P_VSA_m_1 | P_VSA-like on mass, bin 1 | P_VSA-like descriptors | Mass | 
| 1226 | P_VSA_m_2 | P_VSA-like on mass, bin 2 | P_VSA-like descriptors | Mass | 
| 1227 | P_VSA_m_3 | P_VSA-like on mass, bin 3 | P_VSA-like descriptors | Mass | 
| 1228 | P_VSA_m_4 | P_VSA-like on mass, bin 4 | P_VSA-like descriptors | Mass | 
| 1229 | P_VSA_m_5 | P_VSA-like on mass, bin 5 | P_VSA-like descriptors | Mass | 
| 1230 | P_VSA_v_1 | P_VSA-like on van der Waals volume, bin 1 | P_VSA-like descriptors | Van der Waals volume | 
| 1231 | P_VSA_v_2 | P_VSA-like on van der Waals volume, bin 2 | P_VSA-like descriptors | Van der Waals volume | 
| 1232 | P_VSA_v_3 | P_VSA-like on van der Waals volume, bin 3 | P_VSA-like descriptors | Van der Waals volume | 
| 1233 | P_VSA_v_4 | P_VSA-like on van der Waals volume, bin 4 | P_VSA-like descriptors | Van der Waals volume | 
| 1234 | P_VSA_e_1 | P_VSA-like on Sanderson electronegativity, bin 1 | P_VSA-like descriptors | Sanderson electronegativity | 
| 1235 | P_VSA_e_2 | P_VSA-like on Sanderson electronegativity, bin 2 | P_VSA-like descriptors | Sanderson electronegativity | 
| 1236 | P_VSA_e_3 | P_VSA-like on Sanderson electronegativity, bin 3 | P_VSA-like descriptors | Sanderson electronegativity | 
| 1237 | P_VSA_e_4 | P_VSA-like on Sanderson electronegativity, bin 4 | P_VSA-like descriptors | Sanderson electronegativity | 
| 1238 | P_VSA_e_5 | P_VSA-like on Sanderson electronegativity, bin 5 | P_VSA-like descriptors | Sanderson electronegativity | 
| 1239 | P_VSA_e_6 | P_VSA-like on Sanderson electronegativity, bin 6 | P_VSA-like descriptors | Sanderson electronegativity | 
| 1240 | P_VSA_p_1 | P_VSA-like on polarizability, bin 1 | P_VSA-like descriptors | Polarizability | 
| 1241 | P_VSA_p_2 | P_VSA-like on polarizability, bin 2 | P_VSA-like descriptors | Polarizability | 
| 1242 | P_VSA_p_3 | P_VSA-like on polarizability, bin 3 | P_VSA-like descriptors | Polarizability | 
| 1243 | P_VSA_p_4 | P_VSA-like on polarizability, bin 4 | P_VSA-like descriptors | Polarizability | 
| 1244 | P_VSA_i_1 | P_VSA-like on ionization potential, bin 1 | P_VSA-like descriptors | Ionization Potential | 
| 1245 | P_VSA_i_2 | P_VSA-like on ionization potential, bin 2 | P_VSA-like descriptors | Ionization Potential | 
| 1246 | P_VSA_i_3 | P_VSA-like on ionization potential, bin 3 | P_VSA-like descriptors | Ionization Potential | 
| 1247 | P_VSA_i_4 | P_VSA-like on ionization potential, bin 4 | P_VSA-like descriptors | Ionization Potential | 
| 1248 | P_VSA_s_1 | P_VSA-like on I-state, bin 1 | P_VSA-like descriptors | Intrinsic State | 
| 1249 | P_VSA_s_2 | P_VSA-like on I-state, bin 2 | P_VSA-like descriptors | Intrinsic State | 
| 1250 | P_VSA_s_3 | P_VSA-like on I-state, bin 3 | P_VSA-like descriptors | Intrinsic State | 
| 1251 | P_VSA_s_4 | P_VSA-like on I-state, bin 4 | P_VSA-like descriptors | Intrinsic State | 
| 1252 | P_VSA_s_5 | P_VSA-like on I-state, bin 5 | P_VSA-like descriptors | Intrinsic State | 
| 1253 | P_VSA_s_6 | P_VSA-like on I-state, bin 6 | P_VSA-like descriptors | Intrinsic State | 
| 1254 | P_VSA_ppp_L | P_VSA-like on potential pharmacophore points, L - lipophilic | P_VSA-like descriptors | Potential Pharmacophore Points | 
| 1255 | P_VSA_ppp_P | P_VSA-like on potential pharmacophore points, P - positive | P_VSA-like descriptors | Potential Pharmacophore Points | 
| 1256 | P_VSA_ppp_N | P_VSA-like on potential pharmacophore points, N - negative | P_VSA-like descriptors | Potential Pharmacophore Points | 
| 1257 | P_VSA_ppp_D | P_VSA-like on potential pharmacophore points, D - hydrogen-bond donor | P_VSA-like descriptors | Potential Pharmacophore Points | 
| 1258 | P_VSA_ppp_A | P_VSA-like on potential pharmacophore points, A - hydrogen-bond acceptor | P_VSA-like descriptors | Potential Pharmacophore Points | 
| 1259 | P_VSA_ppp_ar | P_VSA-like on potential pharmacophore points, ar - aromatic atoms | P_VSA-like descriptors | Potential Pharmacophore Points | 
| 1260 | P_VSA_ppp_con | P_VSA-like on potential pharmacophore points, con - conjugated atoms | P_VSA-like descriptors | Potential Pharmacophore Points | 
| 1261 | P_VSA_ppp_hal | P_VSA-like on potential pharmacophore points, hal - halogen atoms | P_VSA-like descriptors | Potential Pharmacophore Points | 
| 1262 | P_VSA_ppp_cyc | P_VSA-like on potential pharmacophore points, cyc - atoms belonging to cycles | P_VSA-like descriptors | Potential Pharmacophore Points | 
| 1263 | P_VSA_ppp_ter | P_VSA-like on potential pharmacophore points, ter - terminal atoms | P_VSA-like descriptors | Potential Pharmacophore Points | 
| 1264 | Eta_alpha | eta core count | ETA indices | Basic descriptors | 
| 1265 | Eta_alpha_A | eta average core count | ETA indices | Basic descriptors | 
| 1266 | Eta_epsi | eta electronegativity measure | ETA indices | Basic descriptors | 
| 1267 | Eta_epsi_A | eta average electronegativity measure | ETA indices | Basic descriptors | 
| 1268 | Eta_betaS | eta sigma VEM count | ETA indices | Basic descriptors | 
| 1269 | Eta_betaS_A | eta sigma average VEM coun | ETA indices | Basic descriptors | 
| 1270 | Eta_betaP | eta pi and lone pair VEM count | ETA indices | Basic descriptors | 
| 1271 | Eta_betaP_A | eta pi and lone pair average VEM count | ETA indices | Basic descriptors | 
| 1272 | Eta_beta | eta VEM count | ETA indices | Basic descriptors | 
| 1273 | Eta_beta_A | eta average VEM count | ETA indices | Basic descriptors | 
| 1274 | Eta_C | eta composite index | ETA indices | Basic descriptors | 
| 1275 | Eta_C_A | eta average composite index | ETA indices | Basic descriptors | 
| 1276 | Eta_L | eta local composite index | ETA indices | Basic descriptors | 
| 1277 | Eta_L_A | eta average local composite index | ETA indices | Basic descriptors | 
| 1278 | Eta_F | eta functionality index | ETA indices | Basic descriptors | 
| 1279 | Eta_F_A | eta average functionality index | ETA indices | Basic descriptors | 
| 1280 | Eta_FL | eta local functionality index | ETA indices | Basic descriptors | 
| 1281 | Eta_FL_A | eta average local functionality index | ETA indices | Basic descriptors | 
| 1282 | Eta_B | eta branching index | ETA indices | Basic descriptors | 
| 1283 | Eta_B_A | eta average branching index | ETA indices | Basic descriptors | 
| 1284 | Eta_sh_p | eta p shape index | ETA indices | Basic descriptors | 
| 1285 | Eta_sh_y | eta y shape index | ETA indices | Basic descriptors | 
| 1286 | Eta_sh_x | eta x shape index | ETA indices | Basic descriptors | 
| 1287 | Eta_D_AlphaA | eta delta alpha a index | ETA indices | Basic descriptors | 
| 1288 | Eta_D_AlphaB | eta delta alpha b index | ETA indices | Basic descriptors | 
| 1289 | Eta_epsi_2 | eta electronegativity measure 2 | ETA indices | Basic descriptors | 
| 1290 | Eta_epsi_3 | eta electronegativity measure 3 | ETA indices | Basic descriptors | 
| 1291 | Eta_epsi_4 | eta electronegativity measure 4 | ETA indices | Basic descriptors | 
| 1292 | Eta_epsi_5 | eta electronegativity measure 5 | ETA indices | Basic descriptors | 
| 1293 | Eta_D_epsiA | eta measure of unsaturation and electronegative atom count | ETA indices | Basic descriptors | 
| 1294 | Eta_D_epsiB | eta measure of unsaturation | ETA indices | Basic descriptors | 
| 1295 | Eta_D_epsiC | eta measure of electronegativity | ETA indices | Basic descriptors | 
| 1296 | Eta_D_epsiD | eta measure of hydrogen bond donor atoms | ETA indices | Basic descriptors | 
| 1297 | Eta_psi1 | eta measure of hydrogen bonding propensity and/or polar surface area | ETA indices | Basic descriptors | 
| 1298 | Eta_D_psiA | eta measure of hydrogen bonding propensity | ETA indices | Basic descriptors | 
| 1299 | Eta_D_psiB | eta measure of hydrogen bonding propensity | ETA indices | Basic descriptors | 
| 1300 | Eta_D_beta | eta measure of electronic features | ETA indices | Basic descriptors | 
| 1301 | Eta_D_beta_A | eta average measure of electronic features | ETA indices | Basic descriptors | 
| 1302 | SpMax_EA | leading eigenvalue from edge adjacency mat. | Edge adjacency indices | Spectral indices | 
| 1303 | SpMaxA_EA | normalized leading eigenvalue from edge adjacency mat. | Edge adjacency indices | Spectral indices | 
| 1304 | SpDiam_EA | spectral diameter from edge adjacency mat. | Edge adjacency indices | Spectral indices | 
| 1305 | SpAD_EA | spectral absolute deviation from edge adjacency mat. | Edge adjacency indices | Spectral indices | 
| 1306 | SpMAD_EA | spectral mean absolute deviation from edge adjacency mat. | Edge adjacency indices | Spectral indices | 
| 1307 | SpMax_EA(ed) | leading eigenvalue from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral indices | 
| 1308 | SpMaxA_EA(ed) | normalized leading eigenvalue from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral indices | 
| 1309 | SpDiam_EA(ed) | spectral diameter from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral indices | 
| 1310 | SpAD_EA(ed) | spectral absolute deviation from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral indices | 
| 1311 | SpMAD_EA(ed) | spectral mean absolute deviation from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral indices | 
| 1312 | SpMax_EA(bo) | leading eigenvalue from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral indices | 
| 1313 | SpMaxA_EA(bo) | normalized leading eigenvalue from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral indices | 
| 1314 | SpDiam_EA(bo) | spectral diameter from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral indices | 
| 1315 | SpAD_EA(bo) | spectral absolute deviation from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral indices | 
| 1316 | SpMAD_EA(bo) | spectral mean absolute deviation from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral indices | 
| 1317 | SpMax_EA(dm) | leading eigenvalue from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral indices | 
| 1318 | SpMaxA_EA(dm) | normalized leading eigenvalue from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral indices | 
| 1319 | SpDiam_EA(dm) | spectral diameter from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral indices | 
| 1320 | SpAD_EA(dm) | spectral absolute deviation from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral indices | 
| 1321 | SpMAD_EA(dm) | spectral mean absolute deviation from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral indices | 
| 1322 | SpMax_EA(ri) | leading eigenvalue from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral indices | 
| 1323 | SpMaxA_EA(ri) | normalized leading eigenvalue from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral indices | 
| 1324 | SpDiam_EA(ri) | spectral diameter from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral indices | 
| 1325 | SpAD_EA(ri) | spectral absolute deviation from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral indices | 
| 1326 | SpMAD_EA(ri) | spectral mean absolute deviation from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral indices | 
| 1327 | SpMax_AEA(ed) | leading eigenvalue from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral indices | 
| 1328 | SpMaxA_AEA(ed) | normalized leading eigenvalue from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral indices | 
| 1329 | SpDiam_AEA(ed) | spectral diameter from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral indices | 
| 1330 | SpAD_AEA(ed) | spectral absolute deviation from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral indices | 
| 1331 | SpMAD_AEA(ed) | spectral mean absolute deviation from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral indices | 
| 1332 | SpMax_AEA(bo) | leading eigenvalue from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral indices | 
| 1333 | SpMaxA_AEA(bo) | normalized leading eigenvalue from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral indices | 
| 1334 | SpDiam_AEA(bo) | spectral diameter from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral indices | 
| 1335 | SpAD_AEA(bo) | spectral absolute deviation from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral indices | 
| 1336 | SpMAD_AEA(bo) | spectral mean absolute deviation from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral indices | 
| 1337 | SpMax_AEA(dm) | leading eigenvalue from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral indices | 
| 1338 | SpMaxA_AEA(dm) | normalized leading eigenvalue from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral indices | 
| 1339 | SpDiam_AEA(dm) | spectral diameter from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral indices | 
| 1340 | SpAD_AEA(dm) | spectral absolute deviation from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral indices | 
| 1341 | SpMAD_AEA(dm) | spectral mean absolute deviation from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral indices | 
| 1342 | SpMax_AEA(ri) | leading eigenvalue from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral indices | 
| 1343 | SpMaxA_AEA(ri) | normalized leading eigenvalue from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral indices | 
| 1344 | SpDiam_AEA(ri) | spectral diameter from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral indices | 
| 1345 | SpAD_AEA(ri) | spectral absolute deviation from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral indices | 
| 1346 | SpMAD_AEA(ri) | spectral mean absolute deviation from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral indices | 
| 1347 | Chi0_EA | connectivity-like index of order 0 from edge adjacency mat. | Edge adjacency indices | Connectivity-like indices | 
| 1348 | Chi1_EA | connectivity-like index of order 1 from edge adjacency mat. | Edge adjacency indices | Connectivity-like indices | 
| 1349 | Chi0_EA(ed) | connectivity-like index of order 0 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Connectivity-like indices | 
| 1350 | Chi1_EA(ed) | connectivity-like index of order 1 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Connectivity-like indices | 
| 1351 | Chi0_EA(bo) | connectivity-like index of order 0 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Connectivity-like indices | 
| 1352 | Chi1_EA(bo) | connectivity-like index of order 1 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Connectivity-like indices | 
| 1353 | Chi0_EA(dm) | connectivity-like index of order 0 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Connectivity-like indices | 
| 1354 | Chi1_EA(dm) | connectivity-like index of order 1 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Connectivity-like indices | 
| 1355 | Chi0_EA(ri) | connectivity-like index of order 0 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Connectivity-like indices | 
| 1356 | Chi1_EA(ri) | connectivity-like index of order 1 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Connectivity-like indices | 
| 1357 | Chi0_AEA(ed) | connectivity-like index of order 0 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Connectivity-like indices | 
| 1358 | Chi1_AEA(ed) | connectivity-like index of order 1 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Connectivity-like indices | 
| 1359 | Chi0_AEA(bo) | connectivity-like index of order 0 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Connectivity-like indices | 
| 1360 | Chi1_AEA(bo) | connectivity-like index of order 1 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Connectivity-like indices | 
| 1361 | Chi0_AEA(dm) | connectivity-like index of order 0 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Connectivity-like indices | 
| 1362 | Chi1_AEA(dm) | connectivity-like index of order 1 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Connectivity-like indices | 
| 1363 | Chi0_AEA(ri) | connectivity-like index of order 0 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Connectivity-like indices | 
| 1364 | Chi1_AEA(ri) | connectivity-like index of order 1 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Connectivity-like indices | 
| 1365 | SM02_EA | spectral moment of order 2 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1366 | SM03_EA | spectral moment of order 3 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1367 | SM04_EA | spectral moment of order 4 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1368 | SM05_EA | spectral moment of order 5 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1369 | SM06_EA | spectral moment of order 6 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1370 | SM07_EA | spectral moment of order 7 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1371 | SM08_EA | spectral moment of order 8 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1372 | SM09_EA | spectral moment of order 9 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1373 | SM10_EA | spectral moment of order 10 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1374 | SM11_EA | spectral moment of order 11 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1375 | SM12_EA | spectral moment of order 12 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1376 | SM13_EA | spectral moment of order 13 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1377 | SM14_EA | spectral moment of order 14 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1378 | SM15_EA | spectral moment of order 15 from edge adjacency mat. | Edge adjacency indices | Spectral moments | 
| 1379 | SM02_EA(ed) | spectral moment of order 2 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1380 | SM03_EA(ed) | spectral moment of order 3 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1381 | SM04_EA(ed) | spectral moment of order 4 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1382 | SM05_EA(ed) | spectral moment of order 5 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1383 | SM06_EA(ed) | spectral moment of order 6 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1384 | SM07_EA(ed) | spectral moment of order 7 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1385 | SM08_EA(ed) | spectral moment of order 8 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1386 | SM09_EA(ed) | spectral moment of order 9 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1387 | SM10_EA(ed) | spectral moment of order 10 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1388 | SM11_EA(ed) | spectral moment of order 11 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1389 | SM12_EA(ed) | spectral moment of order 12 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1390 | SM13_EA(ed) | spectral moment of order 13 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1391 | SM14_EA(ed) | spectral moment of order 14 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1392 | SM15_EA(ed) | spectral moment of order 15 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1393 | SM02_EA(bo) | spectral moment of order 2 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1394 | SM03_EA(bo) | spectral moment of order 3 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1395 | SM04_EA(bo) | spectral moment of order 4 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1396 | SM05_EA(bo) | spectral moment of order 5 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1397 | SM06_EA(bo) | spectral moment of order 6 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1398 | SM07_EA(bo) | spectral moment of order 7 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1399 | SM08_EA(bo) | spectral moment of order 8 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1400 | SM09_EA(bo) | spectral moment of order 9 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1401 | SM10_EA(bo) | spectral moment of order 10 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1402 | SM11_EA(bo) | spectral moment of order 11 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1403 | SM12_EA(bo) | spectral moment of order 12 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1404 | SM13_EA(bo) | spectral moment of order 13 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1405 | SM14_EA(bo) | spectral moment of order 14 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1406 | SM15_EA(bo) | spectral moment of order 15 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1407 | SM02_EA(dm) | spectral moment of order 2 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1408 | SM03_EA(dm) | spectral moment of order 3 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1409 | SM04_EA(dm) | spectral moment of order 4 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1410 | SM05_EA(dm) | spectral moment of order 5 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1411 | SM06_EA(dm) | spectral moment of order 6 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1412 | SM07_EA(dm) | spectral moment of order 7 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1413 | SM08_EA(dm) | spectral moment of order 8 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1414 | SM09_EA(dm) | spectral moment of order 9 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1415 | SM10_EA(dm) | spectral moment of order 10 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1416 | SM11_EA(dm) | spectral moment of order 11 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1417 | SM12_EA(dm) | spectral moment of order 12 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1418 | SM13_EA(dm) | spectral moment of order 13 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1419 | SM14_EA(dm) | spectral moment of order 14 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1420 | SM15_EA(dm) | spectral moment of order 15 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1421 | SM02_EA(ri) | spectral moment of order 2 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1422 | SM03_EA(ri) | spectral moment of order 3 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1423 | SM04_EA(ri) | spectral moment of order 4 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1424 | SM05_EA(ri) | spectral moment of order 5 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1425 | SM06_EA(ri) | spectral moment of order 6 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1426 | SM07_EA(ri) | spectral moment of order 7 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1427 | SM08_EA(ri) | spectral moment of order 8 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1428 | SM09_EA(ri) | spectral moment of order 9 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1429 | SM10_EA(ri) | spectral moment of order 10 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1430 | SM11_EA(ri) | spectral moment of order 11 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1431 | SM12_EA(ri) | spectral moment of order 12 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1432 | SM13_EA(ri) | spectral moment of order 13 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1433 | SM14_EA(ri) | spectral moment of order 14 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1434 | SM15_EA(ri) | spectral moment of order 15 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1435 | SM02_AEA(ed) | spectral moment of order 2 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1436 | SM03_AEA(ed) | spectral moment of order 3 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1437 | SM04_AEA(ed) | spectral moment of order 4 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1438 | SM05_AEA(ed) | spectral moment of order 5 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1439 | SM06_AEA(ed) | spectral moment of order 6 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1440 | SM07_AEA(ed) | spectral moment of order 7 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1441 | SM08_AEA(ed) | spectral moment of order 8 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1442 | SM09_AEA(ed) | spectral moment of order 9 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1443 | SM10_AEA(ed) | spectral moment of order 10 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1444 | SM11_AEA(ed) | spectral moment of order 11 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1445 | SM12_AEA(ed) | spectral moment of order 12 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1446 | SM13_AEA(ed) | spectral moment of order 13 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1447 | SM14_AEA(ed) | spectral moment of order 14 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1448 | SM15_AEA(ed) | spectral moment of order 15 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Spectral moments | 
| 1449 | SM02_AEA(bo) | spectral moment of order 2 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1450 | SM03_AEA(bo) | spectral moment of order 3 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1451 | SM04_AEA(bo) | spectral moment of order 4 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1452 | SM05_AEA(bo) | spectral moment of order 5 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1453 | SM06_AEA(bo) | spectral moment of order 6 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1454 | SM07_AEA(bo) | spectral moment of order 7 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1455 | SM08_AEA(bo) | spectral moment of order 8 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1456 | SM09_AEA(bo) | spectral moment of order 9 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1457 | SM10_AEA(bo) | spectral moment of order 10 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1458 | SM11_AEA(bo) | spectral moment of order 11 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1459 | SM12_AEA(bo) | spectral moment of order 12 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1460 | SM13_AEA(bo) | spectral moment of order 13 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1461 | SM14_AEA(bo) | spectral moment of order 14 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1462 | SM15_AEA(bo) | spectral moment of order 15 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Spectral moments | 
| 1463 | SM02_AEA(dm) | spectral moment of order 2 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1464 | SM03_AEA(dm) | spectral moment of order 3 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1465 | SM04_AEA(dm) | spectral moment of order 4 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1466 | SM05_AEA(dm) | spectral moment of order 5 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1467 | SM06_AEA(dm) | spectral moment of order 6 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1468 | SM07_AEA(dm) | spectral moment of order 7 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1469 | SM08_AEA(dm) | spectral moment of order 8 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1470 | SM09_AEA(dm) | spectral moment of order 9 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1471 | SM10_AEA(dm) | spectral moment of order 10 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1472 | SM11_AEA(dm) | spectral moment of order 11 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1473 | SM12_AEA(dm) | spectral moment of order 12 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1474 | SM13_AEA(dm) | spectral moment of order 13 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1475 | SM14_AEA(dm) | spectral moment of order 14 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1476 | SM15_AEA(dm) | spectral moment of order 15 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Spectral moments | 
| 1477 | SM02_AEA(ri) | spectral moment of order 2 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1478 | SM03_AEA(ri) | spectral moment of order 3 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1479 | SM04_AEA(ri) | spectral moment of order 4 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1480 | SM05_AEA(ri) | spectral moment of order 5 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1481 | SM06_AEA(ri) | spectral moment of order 6 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1482 | SM07_AEA(ri) | spectral moment of order 7 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1483 | SM08_AEA(ri) | spectral moment of order 8 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1484 | SM09_AEA(ri) | spectral moment of order 9 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1485 | SM10_AEA(ri) | spectral moment of order 10 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1486 | SM11_AEA(ri) | spectral moment of order 11 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1487 | SM12_AEA(ri) | spectral moment of order 12 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1488 | SM13_AEA(ri) | spectral moment of order 13 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1489 | SM14_AEA(ri) | spectral moment of order 14 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1490 | SM15_AEA(ri) | spectral moment of order 15 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Spectral moments | 
| 1491 | Eig01_EA | eigenvalue n. 1 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1492 | Eig02_EA | eigenvalue n. 2 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1493 | Eig03_EA | eigenvalue n. 3 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1494 | Eig04_EA | eigenvalue n. 4 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1495 | Eig05_EA | eigenvalue n. 5 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1496 | Eig06_EA | eigenvalue n. 6 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1497 | Eig07_EA | eigenvalue n. 7 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1498 | Eig08_EA | eigenvalue n. 8 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1499 | Eig09_EA | eigenvalue n. 9 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1500 | Eig10_EA | eigenvalue n. 10 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1501 | Eig11_EA | eigenvalue n. 11 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1502 | Eig12_EA | eigenvalue n. 12 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1503 | Eig13_EA | eigenvalue n. 13 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1504 | Eig14_EA | eigenvalue n. 14 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1505 | Eig15_EA | eigenvalue n. 15 from edge adjacency mat. | Edge adjacency indices | Eigenvalues | 
| 1506 | Eig01_EA(ed) | eigenvalue n. 1 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1507 | Eig02_EA(ed) | eigenvalue n. 2 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1508 | Eig03_EA(ed) | eigenvalue n. 3 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1509 | Eig04_EA(ed) | eigenvalue n. 4 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1510 | Eig05_EA(ed) | eigenvalue n. 5 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1511 | Eig06_EA(ed) | eigenvalue n. 6 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1512 | Eig07_EA(ed) | eigenvalue n. 7 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1513 | Eig08_EA(ed) | eigenvalue n. 8 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1514 | Eig09_EA(ed) | eigenvalue n. 9 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1515 | Eig10_EA(ed) | eigenvalue n. 10 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1516 | Eig11_EA(ed) | eigenvalue n. 11 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1517 | Eig12_EA(ed) | eigenvalue n. 12 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1518 | Eig13_EA(ed) | eigenvalue n. 13 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1519 | Eig14_EA(ed) | eigenvalue n. 14 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1520 | Eig15_EA(ed) | eigenvalue n. 15 from edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1521 | Eig01_EA(bo) | eigenvalue n. 1 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1522 | Eig02_EA(bo) | eigenvalue n. 2 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1523 | Eig03_EA(bo) | eigenvalue n. 3 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1524 | Eig04_EA(bo) | eigenvalue n. 4 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1525 | Eig05_EA(bo) | eigenvalue n. 5 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1526 | Eig06_EA(bo) | eigenvalue n. 6 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1527 | Eig07_EA(bo) | eigenvalue n. 7 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1528 | Eig08_EA(bo) | eigenvalue n. 8 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1529 | Eig09_EA(bo) | eigenvalue n. 9 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1530 | Eig10_EA(bo) | eigenvalue n. 10 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1531 | Eig11_EA(bo) | eigenvalue n. 11 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1532 | Eig12_EA(bo) | eigenvalue n. 12 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1533 | Eig13_EA(bo) | eigenvalue n. 13 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1534 | Eig14_EA(bo) | eigenvalue n. 14 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1535 | Eig15_EA(bo) | eigenvalue n. 15 from edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1536 | Eig01_EA(dm) | eigenvalue n. 1 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1537 | Eig02_EA(dm) | eigenvalue n. 2 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1538 | Eig03_EA(dm) | eigenvalue n. 3 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1539 | Eig04_EA(dm) | eigenvalue n. 4 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1540 | Eig05_EA(dm) | eigenvalue n. 5 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1541 | Eig06_EA(dm) | eigenvalue n. 6 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1542 | Eig07_EA(dm) | eigenvalue n. 7 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1543 | Eig08_EA(dm) | eigenvalue n. 8 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1544 | Eig09_EA(dm) | eigenvalue n. 9 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1545 | Eig10_EA(dm) | eigenvalue n. 10 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1546 | Eig11_EA(dm) | eigenvalue n. 11 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1547 | Eig12_EA(dm) | eigenvalue n. 12 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1548 | Eig13_EA(dm) | eigenvalue n. 13 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1549 | Eig14_EA(dm) | eigenvalue n. 14 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1550 | Eig15_EA(dm) | eigenvalue n. 15 from edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1551 | Eig01_EA(ri) | eigenvalue n. 1 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1552 | Eig02_EA(ri) | eigenvalue n. 2 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1553 | Eig03_EA(ri) | eigenvalue n. 3 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1554 | Eig04_EA(ri) | eigenvalue n. 4 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1555 | Eig05_EA(ri) | eigenvalue n. 5 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1556 | Eig06_EA(ri) | eigenvalue n. 6 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1557 | Eig07_EA(ri) | eigenvalue n. 7 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1558 | Eig08_EA(ri) | eigenvalue n. 8 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1559 | Eig09_EA(ri) | eigenvalue n. 9 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1560 | Eig10_EA(ri) | eigenvalue n. 10 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1561 | Eig11_EA(ri) | eigenvalue n. 11 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1562 | Eig12_EA(ri) | eigenvalue n. 12 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1563 | Eig13_EA(ri) | eigenvalue n. 13 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1564 | Eig14_EA(ri) | eigenvalue n. 14 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1565 | Eig15_EA(ri) | eigenvalue n. 15 from edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1566 | Eig01_AEA(ed) | eigenvalue n. 1 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1567 | Eig02_AEA(ed) | eigenvalue n. 2 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1568 | Eig03_AEA(ed) | eigenvalue n. 3 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1569 | Eig04_AEA(ed) | eigenvalue n. 4 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1570 | Eig05_AEA(ed) | eigenvalue n. 5 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1571 | Eig06_AEA(ed) | eigenvalue n. 6 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1572 | Eig07_AEA(ed) | eigenvalue n. 7 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1573 | Eig08_AEA(ed) | eigenvalue n. 8 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1574 | Eig09_AEA(ed) | eigenvalue n. 9 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1575 | Eig10_AEA(ed) | eigenvalue n. 10 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1576 | Eig11_AEA(ed) | eigenvalue n. 11 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1577 | Eig12_AEA(ed) | eigenvalue n. 12 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1578 | Eig13_AEA(ed) | eigenvalue n. 13 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1579 | Eig14_AEA(ed) | eigenvalue n. 14 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1580 | Eig15_AEA(ed) | eigenvalue n. 15 from augmented edge adjacency mat. weighted by edge degree | Edge adjacency indices | Eigenvalues | 
| 1581 | Eig01_AEA(bo) | eigenvalue n. 1 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1582 | Eig02_AEA(bo) | eigenvalue n. 2 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1583 | Eig03_AEA(bo) | eigenvalue n. 3 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1584 | Eig04_AEA(bo) | eigenvalue n. 4 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1585 | Eig05_AEA(bo) | eigenvalue n. 5 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1586 | Eig06_AEA(bo) | eigenvalue n. 6 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1587 | Eig07_AEA(bo) | eigenvalue n. 7 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1588 | Eig08_AEA(bo) | eigenvalue n. 8 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1589 | Eig09_AEA(bo) | eigenvalue n. 9 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1590 | Eig10_AEA(bo) | eigenvalue n. 10 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1591 | Eig11_AEA(bo) | eigenvalue n. 11 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1592 | Eig12_AEA(bo) | eigenvalue n. 12 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1593 | Eig13_AEA(bo) | eigenvalue n. 13 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1594 | Eig14_AEA(bo) | eigenvalue n. 14 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1595 | Eig15_AEA(bo) | eigenvalue n. 15 from augmented edge adjacency mat. weighted by bond order | Edge adjacency indices | Eigenvalues | 
| 1596 | Eig01_AEA(dm) | eigenvalue n. 1 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1597 | Eig02_AEA(dm) | eigenvalue n. 2 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1598 | Eig03_AEA(dm) | eigenvalue n. 3 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1599 | Eig04_AEA(dm) | eigenvalue n. 4 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1600 | Eig05_AEA(dm) | eigenvalue n. 5 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1601 | Eig06_AEA(dm) | eigenvalue n. 6 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1602 | Eig07_AEA(dm) | eigenvalue n. 7 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1603 | Eig08_AEA(dm) | eigenvalue n. 8 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1604 | Eig09_AEA(dm) | eigenvalue n. 9 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1605 | Eig10_AEA(dm) | eigenvalue n. 10 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1606 | Eig11_AEA(dm) | eigenvalue n. 11 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1607 | Eig12_AEA(dm) | eigenvalue n. 12 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1608 | Eig13_AEA(dm) | eigenvalue n. 13 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1609 | Eig14_AEA(dm) | eigenvalue n. 14 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1610 | Eig15_AEA(dm) | eigenvalue n. 15 from augmented edge adjacency mat. weighted by dipole moment | Edge adjacency indices | Eigenvalues | 
| 1611 | Eig01_AEA(ri) | eigenvalue n. 1 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1612 | Eig02_AEA(ri) | eigenvalue n. 2 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1613 | Eig03_AEA(ri) | eigenvalue n. 3 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1614 | Eig04_AEA(ri) | eigenvalue n. 4 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1615 | Eig05_AEA(ri) | eigenvalue n. 5 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1616 | Eig06_AEA(ri) | eigenvalue n. 6 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1617 | Eig07_AEA(ri) | eigenvalue n. 7 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1618 | Eig08_AEA(ri) | eigenvalue n. 8 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1619 | Eig09_AEA(ri) | eigenvalue n. 9 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1620 | Eig10_AEA(ri) | eigenvalue n. 10 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1621 | Eig11_AEA(ri) | eigenvalue n. 11 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1622 | Eig12_AEA(ri) | eigenvalue n. 12 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1623 | Eig13_AEA(ri) | eigenvalue n. 13 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1624 | Eig14_AEA(ri) | eigenvalue n. 14 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1625 | Eig15_AEA(ri) | eigenvalue n. 15 from augmented edge adjacency mat. weighted by resonance integral | Edge adjacency indices | Eigenvalues | 
| 1626 | G1 | gravitational index G1 | Geometrical descriptors | Size indices | 
| 1627 | G2 | gravitational index G2 (bond-restricted) | Geometrical descriptors | Size indices | 
| 1628 | RGyr | radius of gyration (mass weighted) | Geometrical descriptors | Size indices | 
| 1629 | SPAN | span R | Geometrical descriptors | Size indices | 
| 1630 | SPAM | average span R | Geometrical descriptors | Shape indices | 
| 1631 | MEcc | molecular eccentricity | Geometrical descriptors | Shape indices | 
| 1632 | SPH | spherosity | Geometrical descriptors | Shape indices | 
| 1633 | ASP | asphericity | Geometrical descriptors | Shape indices | 
| 1634 | PJI3 | 3D Petitjean shape index | Geometrical descriptors | Shape indices | 
| 1635 | L/Bw | length-to-breadth ratio by WHIM | Geometrical descriptors | Shape indices | 
| 1636 | HOMA | Harmonic Oscillator Model of Aromaticity index | Geometrical descriptors | Delocalization-degree indices | 
| 1637 | CMBL | conjugated maximum bond length | Geometrical descriptors | Delocalization-degree indices | 
| 1638 | AROM | aromaticity index | Geometrical descriptors | Delocalization-degree indices | 
| 1639 | HOMT | HOMA total | Geometrical descriptors | Delocalization-degree indices | 
| 1640 | DISPm | displacement value / weighted by mass | Geometrical descriptors | COMMA descriptors | 
| 1641 | QXXm | quadrupole x-component value / weighted by mass | Geometrical descriptors | COMMA descriptors | 
| 1642 | QYYm | quadrupole y-component value / weighted by mass | Geometrical descriptors | COMMA descriptors | 
| 1643 | QZZm | quadrupole z-component value / weighted by mass | Geometrical descriptors | COMMA descriptors | 
| 1644 | DISPv | displacement value / weighted by van der Waals volume | Geometrical descriptors | COMMA descriptors | 
| 1645 | QXXv | quadrupole x-component value / weighted by van der Waals volume | Geometrical descriptors | COMMA descriptors | 
| 1646 | QYYv | quadrupole y-component value / weighted by van der Waals volume | Geometrical descriptors | COMMA descriptors | 
| 1647 | QZZv | quadrupole z-component value / weighted by van der Waals volume | Geometrical descriptors | COMMA descriptors | 
| 1648 | DISPe | displacement value / weighted by Sanderson electronegativity | Geometrical descriptors | COMMA descriptors | 
| 1649 | QXXe | quadrupole x-component value / weighted by Sanderson electronegativity | Geometrical descriptors | COMMA descriptors | 
| 1650 | QYYe | quadrupole y-component value / weighted by Sanderson electronegativity | Geometrical descriptors | COMMA descriptors | 
| 1651 | QZZe | quadrupole z-component value / weighted by Sanderson electronegativity | Geometrical descriptors | COMMA descriptors | 
| 1652 | DISPp | displacement value / weighted by polarizability | Geometrical descriptors | COMMA descriptors | 
| 1653 | QXXp | quadrupole x-component value / weighted by polarizability | Geometrical descriptors | COMMA descriptors | 
| 1654 | QYYp | quadrupole y-component value / weighted by polarizability | Geometrical descriptors | COMMA descriptors | 
| 1655 | QZZp | quadrupole z-component value / weighted by polarizability | Geometrical descriptors | COMMA descriptors | 
| 1656 | DISPi | displacement value / weighted by ionization potential | Geometrical descriptors | COMMA descriptors | 
| 1657 | QXXi | quadrupole x-component value / weighted by ionization potential | Geometrical descriptors | COMMA descriptors | 
| 1658 | QYYi | quadrupole y-component value / weighted by ionization potential | Geometrical descriptors | COMMA descriptors | 
| 1659 | QZZi | quadrupole z-component value / weighted by ionization potential | Geometrical descriptors | COMMA descriptors | 
| 1660 | DISPs | displacement value / weighted by I-state | Geometrical descriptors | COMMA descriptors | 
| 1661 | QXXs | quadrupole x-component value / weighted by I-state | Geometrical descriptors | COMMA descriptors | 
| 1662 | QYYs | quadrupole y-component value / weighted by I-state | Geometrical descriptors | COMMA descriptors | 
| 1663 | QZZs | quadrupole z-component value / weighted by I-state | Geometrical descriptors | COMMA descriptors | 
| 1664 | Wi_G | Wiener-like index from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1665 | WiA_G | average Wiener-like index from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1666 | AVS_G | average vertex sum from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1667 | H_G | Harary-like index from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1668 | Chi_G | Randic-like index from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1669 | ChiA_G | average Randic-like index from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1670 | J_G | Balaban-like index from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1671 | HyWi_G | hyper-Wiener-like index from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1672 | SpAbs_G | graph energy from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1673 | SpPos_G | spectral positive sum from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1674 | SpPosA_G | normalized spectral positive sum from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1675 | SpPosLog_G | logarithmic spectral positive sum from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1676 | SpMax_G | leading eigenvalue from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1677 | SpMaxA_G | normalized leading eigenvalue from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1678 | SpDiam_G | spectral diameter from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1679 | SpAD_G | spectral absolute deviation from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1680 | SpMAD_G | spectral mean absolute deviation from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1681 | Ho_G | Hosoya-like index (log function) from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1682 | EE_G | Estrada-like index (log function) from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1683 | SM2_G | spectral moment of order 2 from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1684 | SM3_G | spectral moment of order 3 from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1685 | SM4_G | spectral moment of order 4 from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1686 | SM5_G | spectral moment of order 5 from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1687 | SM6_G | spectral moment of order 6 from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1688 | VE1_G | coefficient sum of the last eigenvector (absolute values) from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1689 | VE2_G | average coefficient of the last eigenvector (absolute values) from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1690 | VE3_G | logarithmic coefficient sum of the last eigenvector (absolute values) from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1691 | VE1sign_G | coefficient sum of the last eigenvector from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1692 | VE2sign_G | average coefficient of the last eigenvector from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1693 | VE3sign_G | logarithmic coefficient sum of the last eigenvector from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1694 | VR1_G | Randic-like eigenvector-based index from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1695 | VR2_G | normalized Randic-like eigenvector-based index from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1696 | VR3_G | logarithmic Randic-like eigenvector-based index from geometrical matrix | 3D matrix-based descriptors | Geometrical distance matrix (G) | 
| 1697 | Wi_RG | Wiener-like index from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1698 | WiA_RG | average Wiener-like index from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1699 | AVS_RG | average vertex sum from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1700 | H_RG | Harary-like index from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1701 | Chi_RG | Randic-like index from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1702 | ChiA_RG | average Randic-like index from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1703 | J_RG | Balaban-like index from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1704 | HyWi_RG | hyper-Wiener-like index from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1705 | SpAbs_RG | graph energy from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1706 | SpPos_RG | spectral positive sum from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1707 | SpPosA_RG | normalized spectral positive sum from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1708 | SpPosLog_RG | logarithmic spectral positive sum from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1709 | SpMax_RG | leading eigenvalue from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1710 | SpMaxA_RG | normalized leading eigenvalue from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1711 | SpDiam_RG | spectral diameter from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1712 | SpAD_RG | spectral absolute deviation from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1713 | SpMAD_RG | spectral mean absolute deviation from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1714 | Ho_RG | Hosoya-like index (log function) from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1715 | EE_RG | Estrada-like index (log function) from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1716 | SM2_RG | spectral moment of order 2 from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1717 | SM3_RG | spectral moment of order 3 from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1718 | SM4_RG | spectral moment of order 4 from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1719 | SM5_RG | spectral moment of order 5 from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1720 | SM6_RG | spectral moment of order 6 from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1721 | VE1_RG | coefficient sum of the last eigenvector (absolute values) from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1722 | VE2_RG | average coefficient of the last eigenvector (absolute values) from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1723 | VE3_RG | logarithmic coefficient sum of the last eigenvector (absolute values) from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1724 | VE1sign_RG | coefficient sum of the last eigenvector from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1725 | VE2sign_RG | average coefficient of the last eigenvector from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1726 | VE3sign_RG | logarithmic coefficient sum of the last eigenvector from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1727 | VR1_RG | Randic-like eigenvector-based index from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1728 | VR2_RG | normalized Randic-like eigenvector-based index from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1729 | VR3_RG | logarithmic Randic-like eigenvector-based index from reciprocal squared geometrical matrix | 3D matrix-based descriptors | Reciprocal squared geometrical distance matrix (RG) | 
| 1730 | Wi_G/D | Wiener-like index from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1731 | WiA_G/D | average Wiener-like index from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1732 | AVS_G/D | average vertex sum from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1733 | H_G/D | Harary-like index from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1734 | Chi_G/D | Randic-like index from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1735 | ChiA_G/D | average Randic-like index from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1736 | J_G/D | Balaban-like index from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1737 | HyWi_G/D | hyper-Wiener-like index from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1738 | SpAbs_G/D | graph energy from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1739 | SpPos_G/D | spectral positive sum from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1740 | SpPosA_G/D | normalized spectral positive sum from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1741 | SpPosLog_G/D | logarithmic spectral positive sum from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1742 | SpMax_G/D | leading eigenvalue from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1743 | SpMaxA_G/D | normalized leading eigenvalue from distance/distance matrix (folding degree index) | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1744 | SpDiam_G/D | spectral diameter from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1745 | SpAD_G/D | spectral absolute deviation from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1746 | SpMAD_G/D | spectral mean absolute deviation from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1747 | Ho_G/D | Hosoya-like index (log function) from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1748 | EE_G/D | Estrada-like index (log function) from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1749 | SM2_G/D | spectral moment of order 2 from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1750 | SM3_G/D | spectral moment of order 3 from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1751 | SM4_G/D | spectral moment of order 4 from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1752 | SM5_G/D | spectral moment of order 5 from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1753 | SM6_G/D | spectral moment of order 6 from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1754 | VE1_G/D | coefficient sum of the last eigenvector (absolute values) from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1755 | VE2_G/D | average coefficient of the last eigenvector (absolute values) from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1756 | VE3_G/D | logarithmic coefficient sum of the last eigenvector (absolute values) from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1757 | VE1sign_G/D | coefficient sum of the last eigenvector from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1758 | VE2sign_G/D | average coefficient of the last eigenvector from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1759 | VE3sign_G/D | logarithmic coefficient sum of the last eigenvector from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1760 | VR1_G/D | Randic-like eigenvector-based index from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1761 | VR2_G/D | normalized Randic-like eigenvector-based index from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1762 | VR3_G/D | logarithmic Randic-like eigenvector-based index from distance/distance matrix | 3D matrix-based descriptors | Distance/distance matrix (G/D) | 
| 1763 | TDB01u | 3D Topological distance based descriptors - lag 1 unweighted | 3D autocorrelations | TDB autocorrelations | 
| 1764 | TDB02u | 3D Topological distance based descriptors - lag 2 unweighted | 3D autocorrelations | TDB autocorrelations | 
| 1765 | TDB03u | 3D Topological distance based descriptors - lag 3 unweighted | 3D autocorrelations | TDB autocorrelations | 
| 1766 | TDB04u | 3D Topological distance based descriptors - lag 4 unweighted | 3D autocorrelations | TDB autocorrelations | 
| 1767 | TDB05u | 3D Topological distance based descriptors - lag 5 unweighted | 3D autocorrelations | TDB autocorrelations | 
| 1768 | TDB06u | 3D Topological distance based descriptors - lag 6 unweighted | 3D autocorrelations | TDB autocorrelations | 
| 1769 | TDB07u | 3D Topological distance based descriptors - lag 7 unweighted | 3D autocorrelations | TDB autocorrelations | 
| 1770 | TDB08u | 3D Topological distance based descriptors - lag 8 unweighted | 3D autocorrelations | TDB autocorrelations | 
| 1771 | TDB09u | 3D Topological distance based descriptors - lag 9 unweighted | 3D autocorrelations | TDB autocorrelations | 
| 1772 | TDB10u | 3D Topological distance based descriptors - lag 10 unweighted | 3D autocorrelations | TDB autocorrelations | 
| 1773 | TDB01m | 3D Topological distance based descriptors - lag 1 weighted by mass | 3D autocorrelations | TDB autocorrelations | 
| 1774 | TDB02m | 3D Topological distance based descriptors - lag 2 weighted by mass | 3D autocorrelations | TDB autocorrelations | 
| 1775 | TDB03m | 3D Topological distance based descriptors - lag 3 weighted by mass | 3D autocorrelations | TDB autocorrelations | 
| 1776 | TDB04m | 3D Topological distance based descriptors - lag 4 weighted by mass | 3D autocorrelations | TDB autocorrelations | 
| 1777 | TDB05m | 3D Topological distance based descriptors - lag 5 weighted by mass | 3D autocorrelations | TDB autocorrelations | 
| 1778 | TDB06m | 3D Topological distance based descriptors - lag 6 weighted by mass | 3D autocorrelations | TDB autocorrelations | 
| 1779 | TDB07m | 3D Topological distance based descriptors - lag 7 weighted by mass | 3D autocorrelations | TDB autocorrelations | 
| 1780 | TDB08m | 3D Topological distance based descriptors - lag 8 weighted by mass | 3D autocorrelations | TDB autocorrelations | 
| 1781 | TDB09m | 3D Topological distance based descriptors - lag 9 weighted by mass | 3D autocorrelations | TDB autocorrelations | 
| 1782 | TDB10m | 3D Topological distance based descriptors - lag 10 weighted by mass | 3D autocorrelations | TDB autocorrelations | 
| 1783 | TDB01v | 3D Topological distance based descriptors - lag 1 weighted by van der Waals volume | 3D autocorrelations | TDB autocorrelations | 
| 1784 | TDB02v | 3D Topological distance based descriptors - lag 2 weighted by van der Waals volume | 3D autocorrelations | TDB autocorrelations | 
| 1785 | TDB03v | 3D Topological distance based descriptors - lag 3 weighted by van der Waals volume | 3D autocorrelations | TDB autocorrelations | 
| 1786 | TDB04v | 3D Topological distance based descriptors - lag 4 weighted by van der Waals volume | 3D autocorrelations | TDB autocorrelations | 
| 1787 | TDB05v | 3D Topological distance based descriptors - lag 5 weighted by van der Waals volume | 3D autocorrelations | TDB autocorrelations | 
| 1788 | TDB06v | 3D Topological distance based descriptors - lag 6 weighted by van der Waals volume | 3D autocorrelations | TDB autocorrelations | 
| 1789 | TDB07v | 3D Topological distance based descriptors - lag 7 weighted by van der Waals volume | 3D autocorrelations | TDB autocorrelations | 
| 1790 | TDB08v | 3D Topological distance based descriptors - lag 8 weighted by van der Waals volume | 3D autocorrelations | TDB autocorrelations | 
| 1791 | TDB09v | 3D Topological distance based descriptors - lag 9 weighted by van der Waals volume | 3D autocorrelations | TDB autocorrelations | 
| 1792 | TDB10v | 3D Topological distance based descriptors - lag 10 weighted by van der Waals volume | 3D autocorrelations | TDB autocorrelations | 
| 1793 | TDB01e | 3D Topological distance based descriptors - lag 1 weighted by Sanderson electronegativity | 3D autocorrelations | TDB autocorrelations | 
| 1794 | TDB02e | 3D Topological distance based descriptors - lag 2 weighted by Sanderson electronegativity | 3D autocorrelations | TDB autocorrelations | 
| 1795 | TDB03e | 3D Topological distance based descriptors - lag 3 weighted by Sanderson electronegativity | 3D autocorrelations | TDB autocorrelations | 
| 1796 | TDB04e | 3D Topological distance based descriptors - lag 4 weighted by Sanderson electronegativity | 3D autocorrelations | TDB autocorrelations | 
| 1797 | TDB05e | 3D Topological distance based descriptors - lag 5 weighted by Sanderson electronegativity | 3D autocorrelations | TDB autocorrelations | 
| 1798 | TDB06e | 3D Topological distance based descriptors - lag 6 weighted by Sanderson electronegativity | 3D autocorrelations | TDB autocorrelations | 
| 1799 | TDB07e | 3D Topological distance based descriptors - lag 7 weighted by Sanderson electronegativity | 3D autocorrelations | TDB autocorrelations | 
| 1800 | TDB08e | 3D Topological distance based descriptors - lag 8 weighted by Sanderson electronegativity | 3D autocorrelations | TDB autocorrelations | 
| 1801 | TDB09e | 3D Topological distance based descriptors - lag 9 weighted by Sanderson electronegativity | 3D autocorrelations | TDB autocorrelations | 
| 1802 | TDB10e | 3D Topological distance based descriptors - lag 10 weighted by Sanderson electronegativity | 3D autocorrelations | TDB autocorrelations | 
| 1803 | TDB01p | 3D Topological distance based descriptors - lag 1 weighted by polarizability | 3D autocorrelations | TDB autocorrelations | 
| 1804 | TDB02p | 3D Topological distance based descriptors - lag 2 weighted by polarizability | 3D autocorrelations | TDB autocorrelations | 
| 1805 | TDB03p | 3D Topological distance based descriptors - lag 3 weighted by polarizability | 3D autocorrelations | TDB autocorrelations | 
| 1806 | TDB04p | 3D Topological distance based descriptors - lag 4 weighted by polarizability | 3D autocorrelations | TDB autocorrelations | 
| 1807 | TDB05p | 3D Topological distance based descriptors - lag 5 weighted by polarizability | 3D autocorrelations | TDB autocorrelations | 
| 1808 | TDB06p | 3D Topological distance based descriptors - lag 6 weighted by polarizability | 3D autocorrelations | TDB autocorrelations | 
| 1809 | TDB07p | 3D Topological distance based descriptors - lag 7 weighted by polarizability | 3D autocorrelations | TDB autocorrelations | 
| 1810 | TDB08p | 3D Topological distance based descriptors - lag 8 weighted by polarizability | 3D autocorrelations | TDB autocorrelations | 
| 1811 | TDB09p | 3D Topological distance based descriptors - lag 9 weighted by polarizability | 3D autocorrelations | TDB autocorrelations | 
| 1812 | TDB10p | 3D Topological distance based descriptors - lag 10 weighted by polarizability | 3D autocorrelations | TDB autocorrelations | 
| 1813 | TDB01i | 3D Topological distance based descriptors - lag 1 weighted by ionization potential | 3D autocorrelations | TDB autocorrelations | 
| 1814 | TDB02i | 3D Topological distance based descriptors - lag 2 weighted by ionization potential | 3D autocorrelations | TDB autocorrelations | 
| 1815 | TDB03i | 3D Topological distance based descriptors - lag 3 weighted by ionization potential | 3D autocorrelations | TDB autocorrelations | 
| 1816 | TDB04i | 3D Topological distance based descriptors - lag 4 weighted by ionization potential | 3D autocorrelations | TDB autocorrelations | 
| 1817 | TDB05i | 3D Topological distance based descriptors - lag 5 weighted by ionization potential | 3D autocorrelations | TDB autocorrelations | 
| 1818 | TDB06i | 3D Topological distance based descriptors - lag 6 weighted by ionization potential | 3D autocorrelations | TDB autocorrelations | 
| 1819 | TDB07i | 3D Topological distance based descriptors - lag 7 weighted by ionization potential | 3D autocorrelations | TDB autocorrelations | 
| 1820 | TDB08i | 3D Topological distance based descriptors - lag 8 weighted by ionization potential | 3D autocorrelations | TDB autocorrelations | 
| 1821 | TDB09i | 3D Topological distance based descriptors - lag 9 weighted by ionization potential | 3D autocorrelations | TDB autocorrelations | 
| 1822 | TDB10i | 3D Topological distance based descriptors - lag 10 weighted by ionization potential | 3D autocorrelations | TDB autocorrelations | 
| 1823 | TDB01s | 3D Topological distance based descriptors - lag 1 weighted by I-state | 3D autocorrelations | TDB autocorrelations | 
| 1824 | TDB02s | 3D Topological distance based descriptors - lag 2 weighted by I-state | 3D autocorrelations | TDB autocorrelations | 
| 1825 | TDB03s | 3D Topological distance based descriptors - lag 3 weighted by I-state | 3D autocorrelations | TDB autocorrelations | 
| 1826 | TDB04s | 3D Topological distance based descriptors - lag 4 weighted by I-state | 3D autocorrelations | TDB autocorrelations | 
| 1827 | TDB05s | 3D Topological distance based descriptors - lag 5 weighted by I-state | 3D autocorrelations | TDB autocorrelations | 
| 1828 | TDB06s | 3D Topological distance based descriptors - lag 6 weighted by I-state | 3D autocorrelations | TDB autocorrelations | 
| 1829 | TDB07s | 3D Topological distance based descriptors - lag 7 weighted by I-state | 3D autocorrelations | TDB autocorrelations | 
| 1830 | TDB08s | 3D Topological distance based descriptors - lag 8 weighted by I-state | 3D autocorrelations | TDB autocorrelations | 
| 1831 | TDB09s | 3D Topological distance based descriptors - lag 9 weighted by I-state | 3D autocorrelations | TDB autocorrelations | 
| 1832 | TDB10s | 3D Topological distance based descriptors - lag 10 weighted by I-state | 3D autocorrelations | TDB autocorrelations | 
| 1833 | TDB01r | 3D Topological distance based descriptors - lag 1 weighted by covalent radius | 3D autocorrelations | TDB autocorrelations | 
| 1834 | TDB02r | 3D Topological distance based descriptors - lag 2 weighted by covalent radius | 3D autocorrelations | TDB autocorrelations | 
| 1835 | TDB03r | 3D Topological distance based descriptors - lag 3 weighted by covalent radius | 3D autocorrelations | TDB autocorrelations | 
| 1836 | TDB04r | 3D Topological distance based descriptors - lag 4 weighted by covalent radius | 3D autocorrelations | TDB autocorrelations | 
| 1837 | TDB05r | 3D Topological distance based descriptors - lag 5 weighted by covalent radius | 3D autocorrelations | TDB autocorrelations | 
| 1838 | TDB06r | 3D Topological distance based descriptors - lag 6 weighted by covalent radius | 3D autocorrelations | TDB autocorrelations | 
| 1839 | TDB07r | 3D Topological distance based descriptors - lag 7 weighted by covalent radius | 3D autocorrelations | TDB autocorrelations | 
| 1840 | TDB08r | 3D Topological distance based descriptors - lag 8 weighted by covalent radius | 3D autocorrelations | TDB autocorrelations | 
| 1841 | TDB09r | 3D Topological distance based descriptors - lag 9 weighted by covalent radius | 3D autocorrelations | TDB autocorrelations | 
| 1842 | TDB10r | 3D Topological distance based descriptors - lag 10 weighted by covalent radius | 3D autocorrelations | TDB autocorrelations | 
| 1843 | RDF010u | Radial Distribution Function - 010 / unweighted | RDF descriptors | Unweighted | 
| 1844 | RDF015u | Radial Distribution Function - 015 / unweighted | RDF descriptors | Unweighted | 
| 1845 | RDF020u | Radial Distribution Function - 020 / unweighted | RDF descriptors | Unweighted | 
| 1846 | RDF025u | Radial Distribution Function - 025 / unweighted | RDF descriptors | Unweighted | 
| 1847 | RDF030u | Radial Distribution Function - 030 / unweighted | RDF descriptors | Unweighted | 
| 1848 | RDF035u | Radial Distribution Function - 035 / unweighted | RDF descriptors | Unweighted | 
| 1849 | RDF040u | Radial Distribution Function - 040 / unweighted | RDF descriptors | Unweighted | 
| 1850 | RDF045u | Radial Distribution Function - 045 / unweighted | RDF descriptors | Unweighted | 
| 1851 | RDF050u | Radial Distribution Function - 050 / unweighted | RDF descriptors | Unweighted | 
| 1852 | RDF055u | Radial Distribution Function - 055 / unweighted | RDF descriptors | Unweighted | 
| 1853 | RDF060u | Radial Distribution Function - 060 / unweighted | RDF descriptors | Unweighted | 
| 1854 | RDF065u | Radial Distribution Function - 065 / unweighted | RDF descriptors | Unweighted | 
| 1855 | RDF070u | Radial Distribution Function - 070 / unweighted | RDF descriptors | Unweighted | 
| 1856 | RDF075u | Radial Distribution Function - 075 / unweighted | RDF descriptors | Unweighted | 
| 1857 | RDF080u | Radial Distribution Function - 080 / unweighted | RDF descriptors | Unweighted | 
| 1858 | RDF085u | Radial Distribution Function - 085 / unweighted | RDF descriptors | Unweighted | 
| 1859 | RDF090u | Radial Distribution Function - 090 / unweighted | RDF descriptors | Unweighted | 
| 1860 | RDF095u | Radial Distribution Function - 095 / unweighted | RDF descriptors | Unweighted | 
| 1861 | RDF100u | Radial Distribution Function - 100 / unweighted | RDF descriptors | Unweighted | 
| 1862 | RDF105u | Radial Distribution Function - 105 / unweighted | RDF descriptors | Unweighted | 
| 1863 | RDF110u | Radial Distribution Function - 110 / unweighted | RDF descriptors | Unweighted | 
| 1864 | RDF115u | Radial Distribution Function - 115 / unweighted | RDF descriptors | Unweighted | 
| 1865 | RDF120u | Radial Distribution Function - 120 / unweighted | RDF descriptors | Unweighted | 
| 1866 | RDF125u | Radial Distribution Function - 125 / unweighted | RDF descriptors | Unweighted | 
| 1867 | RDF130u | Radial Distribution Function - 130 / unweighted | RDF descriptors | Unweighted | 
| 1868 | RDF135u | Radial Distribution Function - 135 / unweighted | RDF descriptors | Unweighted | 
| 1869 | RDF140u | Radial Distribution Function - 140 / unweighted | RDF descriptors | Unweighted | 
| 1870 | RDF145u | Radial Distribution Function - 145 / unweighted | RDF descriptors | Unweighted | 
| 1871 | RDF150u | Radial Distribution Function - 150 / unweighted | RDF descriptors | Unweighted | 
| 1872 | RDF155u | Radial Distribution Function - 155 / unweighted | RDF descriptors | Unweighted | 
| 1873 | RDF010m | Radial Distribution Function - 010 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1874 | RDF015m | Radial Distribution Function - 015 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1875 | RDF020m | Radial Distribution Function - 020 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1876 | RDF025m | Radial Distribution Function - 025 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1877 | RDF030m | Radial Distribution Function - 030 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1878 | RDF035m | Radial Distribution Function - 035 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1879 | RDF040m | Radial Distribution Function - 040 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1880 | RDF045m | Radial Distribution Function - 045 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1881 | RDF050m | Radial Distribution Function - 050 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1882 | RDF055m | Radial Distribution Function - 055 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1883 | RDF060m | Radial Distribution Function - 060 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1884 | RDF065m | Radial Distribution Function - 065 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1885 | RDF070m | Radial Distribution Function - 070 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1886 | RDF075m | Radial Distribution Function - 075 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1887 | RDF080m | Radial Distribution Function - 080 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1888 | RDF085m | Radial Distribution Function - 085 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1889 | RDF090m | Radial Distribution Function - 090 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1890 | RDF095m | Radial Distribution Function - 095 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1891 | RDF100m | Radial Distribution Function - 100 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1892 | RDF105m | Radial Distribution Function - 105 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1893 | RDF110m | Radial Distribution Function - 110 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1894 | RDF115m | Radial Distribution Function - 115 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1895 | RDF120m | Radial Distribution Function - 120 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1896 | RDF125m | Radial Distribution Function - 125 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1897 | RDF130m | Radial Distribution Function - 130 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1898 | RDF135m | Radial Distribution Function - 135 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1899 | RDF140m | Radial Distribution Function - 140 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1900 | RDF145m | Radial Distribution Function - 145 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1901 | RDF150m | Radial Distribution Function - 150 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1902 | RDF155m | Radial Distribution Function - 155 / weighted by mass | RDF descriptors | Weighted by mass | 
| 1903 | RDF010v | Radial Distribution Function - 010 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1904 | RDF015v | Radial Distribution Function - 015 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1905 | RDF020v | Radial Distribution Function - 020 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1906 | RDF025v | Radial Distribution Function - 025 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1907 | RDF030v | Radial Distribution Function - 030 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1908 | RDF035v | Radial Distribution Function - 035 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1909 | RDF040v | Radial Distribution Function - 040 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1910 | RDF045v | Radial Distribution Function - 045 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1911 | RDF050v | Radial Distribution Function - 050 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1912 | RDF055v | Radial Distribution Function - 055 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1913 | RDF060v | Radial Distribution Function - 060 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1914 | RDF065v | Radial Distribution Function - 065 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1915 | RDF070v | Radial Distribution Function - 070 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1916 | RDF075v | Radial Distribution Function - 075 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1917 | RDF080v | Radial Distribution Function - 080 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1918 | RDF085v | Radial Distribution Function - 085 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1919 | RDF090v | Radial Distribution Function - 090 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1920 | RDF095v | Radial Distribution Function - 095 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1921 | RDF100v | Radial Distribution Function - 100 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1922 | RDF105v | Radial Distribution Function - 105 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1923 | RDF110v | Radial Distribution Function - 110 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1924 | RDF115v | Radial Distribution Function - 115 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1925 | RDF120v | Radial Distribution Function - 120 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1926 | RDF125v | Radial Distribution Function - 125 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1927 | RDF130v | Radial Distribution Function - 130 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1928 | RDF135v | Radial Distribution Function - 135 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1929 | RDF140v | Radial Distribution Function - 140 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1930 | RDF145v | Radial Distribution Function - 145 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1931 | RDF150v | Radial Distribution Function - 150 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1932 | RDF155v | Radial Distribution Function - 155 / weighted by van der Waals volume | RDF descriptors | Weighted by van der Waals volume | 
| 1933 | RDF010e | Radial Distribution Function - 010 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1934 | RDF015e | Radial Distribution Function - 015 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1935 | RDF020e | Radial Distribution Function - 020 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1936 | RDF025e | Radial Distribution Function - 025 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1937 | RDF030e | Radial Distribution Function - 030 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1938 | RDF035e | Radial Distribution Function - 035 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1939 | RDF040e | Radial Distribution Function - 040 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1940 | RDF045e | Radial Distribution Function - 045 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1941 | RDF050e | Radial Distribution Function - 050 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1942 | RDF055e | Radial Distribution Function - 055 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1943 | RDF060e | Radial Distribution Function - 060 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1944 | RDF065e | Radial Distribution Function - 065 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1945 | RDF070e | Radial Distribution Function - 070 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1946 | RDF075e | Radial Distribution Function - 075 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1947 | RDF080e | Radial Distribution Function - 080 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1948 | RDF085e | Radial Distribution Function - 085 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1949 | RDF090e | Radial Distribution Function - 090 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1950 | RDF095e | Radial Distribution Function - 095 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1951 | RDF100e | Radial Distribution Function - 100 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1952 | RDF105e | Radial Distribution Function - 105 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1953 | RDF110e | Radial Distribution Function - 110 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1954 | RDF115e | Radial Distribution Function - 115 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1955 | RDF120e | Radial Distribution Function - 120 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1956 | RDF125e | Radial Distribution Function - 125 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1957 | RDF130e | Radial Distribution Function - 130 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1958 | RDF135e | Radial Distribution Function - 135 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1959 | RDF140e | Radial Distribution Function - 140 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1960 | RDF145e | Radial Distribution Function - 145 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1961 | RDF150e | Radial Distribution Function - 150 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1962 | RDF155e | Radial Distribution Function - 155 / weighted by Sanderson electronegativity | RDF descriptors | Weighted by Sanderson electronegativity | 
| 1963 | RDF010p | Radial Distribution Function - 010 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1964 | RDF015p | Radial Distribution Function - 015 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1965 | RDF020p | Radial Distribution Function - 020 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1966 | RDF025p | Radial Distribution Function - 025 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1967 | RDF030p | Radial Distribution Function - 030 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1968 | RDF035p | Radial Distribution Function - 035 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1969 | RDF040p | Radial Distribution Function - 040 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1970 | RDF045p | Radial Distribution Function - 045 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1971 | RDF050p | Radial Distribution Function - 050 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1972 | RDF055p | Radial Distribution Function - 055 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1973 | RDF060p | Radial Distribution Function - 060 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1974 | RDF065p | Radial Distribution Function - 065 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1975 | RDF070p | Radial Distribution Function - 070 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1976 | RDF075p | Radial Distribution Function - 075 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1977 | RDF080p | Radial Distribution Function - 080 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1978 | RDF085p | Radial Distribution Function - 085 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1979 | RDF090p | Radial Distribution Function - 090 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1980 | RDF095p | Radial Distribution Function - 095 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1981 | RDF100p | Radial Distribution Function - 100 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1982 | RDF105p | Radial Distribution Function - 105 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1983 | RDF110p | Radial Distribution Function - 110 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1984 | RDF115p | Radial Distribution Function - 115 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1985 | RDF120p | Radial Distribution Function - 120 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1986 | RDF125p | Radial Distribution Function - 125 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1987 | RDF130p | Radial Distribution Function - 130 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1988 | RDF135p | Radial Distribution Function - 135 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1989 | RDF140p | Radial Distribution Function - 140 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1990 | RDF145p | Radial Distribution Function - 145 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1991 | RDF150p | Radial Distribution Function - 150 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1992 | RDF155p | Radial Distribution Function - 155 / weighted by polarizability | RDF descriptors | Weighted by polarizability | 
| 1993 | RDF010i | Radial Distribution Function - 010 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 1994 | RDF015i | Radial Distribution Function - 015 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 1995 | RDF020i | Radial Distribution Function - 020 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 1996 | RDF025i | Radial Distribution Function - 025 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 1997 | RDF030i | Radial Distribution Function - 030 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 1998 | RDF035i | Radial Distribution Function - 035 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 1999 | RDF040i | Radial Distribution Function - 040 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2000 | RDF045i | Radial Distribution Function - 045 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2001 | RDF050i | Radial Distribution Function - 050 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2002 | RDF055i | Radial Distribution Function - 055 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2003 | RDF060i | Radial Distribution Function - 060 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2004 | RDF065i | Radial Distribution Function - 065 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2005 | RDF070i | Radial Distribution Function - 070 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2006 | RDF075i | Radial Distribution Function - 075 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2007 | RDF080i | Radial Distribution Function - 080 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2008 | RDF085i | Radial Distribution Function - 085 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2009 | RDF090i | Radial Distribution Function - 090 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2010 | RDF095i | Radial Distribution Function - 095 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2011 | RDF100i | Radial Distribution Function - 100 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2012 | RDF105i | Radial Distribution Function - 105 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2013 | RDF110i | Radial Distribution Function - 110 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2014 | RDF115i | Radial Distribution Function - 115 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2015 | RDF120i | Radial Distribution Function - 120 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2016 | RDF125i | Radial Distribution Function - 125 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2017 | RDF130i | Radial Distribution Function - 130 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2018 | RDF135i | Radial Distribution Function - 135 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2019 | RDF140i | Radial Distribution Function - 140 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2020 | RDF145i | Radial Distribution Function - 145 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2021 | RDF150i | Radial Distribution Function - 150 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2022 | RDF155i | Radial Distribution Function - 155 / weighted by ionization potential | RDF descriptors | Weighted by ionization potential | 
| 2023 | RDF010s | Radial Distribution Function - 010 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2024 | RDF015s | Radial Distribution Function - 015 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2025 | RDF020s | Radial Distribution Function - 020 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2026 | RDF025s | Radial Distribution Function - 025 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2027 | RDF030s | Radial Distribution Function - 030 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2028 | RDF035s | Radial Distribution Function - 035 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2029 | RDF040s | Radial Distribution Function - 040 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2030 | RDF045s | Radial Distribution Function - 045 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2031 | RDF050s | Radial Distribution Function - 050 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2032 | RDF055s | Radial Distribution Function - 055 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2033 | RDF060s | Radial Distribution Function - 060 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2034 | RDF065s | Radial Distribution Function - 065 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2035 | RDF070s | Radial Distribution Function - 070 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2036 | RDF075s | Radial Distribution Function - 075 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2037 | RDF080s | Radial Distribution Function - 080 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2038 | RDF085s | Radial Distribution Function - 085 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2039 | RDF090s | Radial Distribution Function - 090 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2040 | RDF095s | Radial Distribution Function - 095 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2041 | RDF100s | Radial Distribution Function - 100 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2042 | RDF105s | Radial Distribution Function - 105 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2043 | RDF110s | Radial Distribution Function - 110 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2044 | RDF115s | Radial Distribution Function - 115 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2045 | RDF120s | Radial Distribution Function - 120 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2046 | RDF125s | Radial Distribution Function - 125 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2047 | RDF130s | Radial Distribution Function - 130 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2048 | RDF135s | Radial Distribution Function - 135 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2049 | RDF140s | Radial Distribution Function - 140 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2050 | RDF145s | Radial Distribution Function - 145 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2051 | RDF150s | Radial Distribution Function - 150 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2052 | RDF155s | Radial Distribution Function - 155 / weighted by I-state | RDF descriptors | Weighted by I-state | 
| 2053 | Mor01u | signal 01 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2054 | Mor02u | signal 02 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2055 | Mor03u | signal 03 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2056 | Mor04u | signal 04 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2057 | Mor05u | signal 05 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2058 | Mor06u | signal 06 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2059 | Mor07u | signal 07 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2060 | Mor08u | signal 08 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2061 | Mor09u | signal 09 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2062 | Mor10u | signal 10 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2063 | Mor11u | signal 11 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2064 | Mor12u | signal 12 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2065 | Mor13u | signal 13 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2066 | Mor14u | signal 14 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2067 | Mor15u | signal 15 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2068 | Mor16u | signal 16 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2069 | Mor17u | signal 17 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2070 | Mor18u | signal 18 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2071 | Mor19u | signal 19 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2072 | Mor20u | signal 20 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2073 | Mor21u | signal 21 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2074 | Mor22u | signal 22 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2075 | Mor23u | signal 23 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2076 | Mor24u | signal 24 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2077 | Mor25u | signal 25 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2078 | Mor26u | signal 26 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2079 | Mor27u | signal 27 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2080 | Mor28u | signal 28 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2081 | Mor29u | signal 29 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2082 | Mor30u | signal 30 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2083 | Mor31u | signal 31 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2084 | Mor32u | signal 32 / unweighted | 3D-MoRSE descriptors | Unweighted | 
| 2085 | Mor01m | signal 01 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2086 | Mor02m | signal 02 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2087 | Mor03m | signal 03 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2088 | Mor04m | signal 04 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2089 | Mor05m | signal 05 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2090 | Mor06m | signal 06 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2091 | Mor07m | signal 07 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2092 | Mor08m | signal 08 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2093 | Mor09m | signal 09 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2094 | Mor10m | signal 10 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2095 | Mor11m | signal 11 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2096 | Mor12m | signal 12 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2097 | Mor13m | signal 13 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2098 | Mor14m | signal 14 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2099 | Mor15m | signal 15 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2100 | Mor16m | signal 16 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2101 | Mor17m | signal 17 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2102 | Mor18m | signal 18 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2103 | Mor19m | signal 19 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2104 | Mor20m | signal 20 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2105 | Mor21m | signal 21 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2106 | Mor22m | signal 22 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2107 | Mor23m | signal 23 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2108 | Mor24m | signal 24 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2109 | Mor25m | signal 25 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2110 | Mor26m | signal 26 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2111 | Mor27m | signal 27 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2112 | Mor28m | signal 28 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2113 | Mor29m | signal 29 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2114 | Mor30m | signal 30 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2115 | Mor31m | signal 31 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2116 | Mor32m | signal 32 / weighted by mass | 3D-MoRSE descriptors | Weighted by mass | 
| 2117 | Mor01v | signal 01 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2118 | Mor02v | signal 02 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2119 | Mor03v | signal 03 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2120 | Mor04v | signal 04 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2121 | Mor05v | signal 05 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2122 | Mor06v | signal 06 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2123 | Mor07v | signal 07 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2124 | Mor08v | signal 08 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2125 | Mor09v | signal 09 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2126 | Mor10v | signal 10 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2127 | Mor11v | signal 11 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2128 | Mor12v | signal 12 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2129 | Mor13v | signal 13 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2130 | Mor14v | signal 14 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2131 | Mor15v | signal 15 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2132 | Mor16v | signal 16 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2133 | Mor17v | signal 17 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2134 | Mor18v | signal 18 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2135 | Mor19v | signal 19 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2136 | Mor20v | signal 20 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2137 | Mor21v | signal 21 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2138 | Mor22v | signal 22 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2139 | Mor23v | signal 23 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2140 | Mor24v | signal 24 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2141 | Mor25v | signal 25 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2142 | Mor26v | signal 26 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2143 | Mor27v | signal 27 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2144 | Mor28v | signal 28 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2145 | Mor29v | signal 29 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2146 | Mor30v | signal 30 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2147 | Mor31v | signal 31 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2148 | Mor32v | signal 32 / weighted by van der Waals volume | 3D-MoRSE descriptors | Weighted by van der Waals volume | 
| 2149 | Mor01e | signal 01 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2150 | Mor02e | signal 02 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2151 | Mor03e | signal 03 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2152 | Mor04e | signal 04 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2153 | Mor05e | signal 05 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2154 | Mor06e | signal 06 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2155 | Mor07e | signal 07 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2156 | Mor08e | signal 08 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2157 | Mor09e | signal 09 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2158 | Mor10e | signal 10 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2159 | Mor11e | signal 11 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2160 | Mor12e | signal 12 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2161 | Mor13e | signal 13 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2162 | Mor14e | signal 14 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2163 | Mor15e | signal 15 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2164 | Mor16e | signal 16 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2165 | Mor17e | signal 17 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2166 | Mor18e | signal 18 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2167 | Mor19e | signal 19 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2168 | Mor20e | signal 20 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2169 | Mor21e | signal 21 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2170 | Mor22e | signal 22 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2171 | Mor23e | signal 23 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2172 | Mor24e | signal 24 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2173 | Mor25e | signal 25 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2174 | Mor26e | signal 26 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2175 | Mor27e | signal 27 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2176 | Mor28e | signal 28 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2177 | Mor29e | signal 29 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2178 | Mor30e | signal 30 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2179 | Mor31e | signal 31 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2180 | Mor32e | signal 32 / weighted by Sanderson electronegativity | 3D-MoRSE descriptors | Weighted by Sanderson electronegativity | 
| 2181 | Mor01p | signal 01 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2182 | Mor02p | signal 02 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2183 | Mor03p | signal 03 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2184 | Mor04p | signal 04 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2185 | Mor05p | signal 05 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2186 | Mor06p | signal 06 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2187 | Mor07p | signal 07 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2188 | Mor08p | signal 08 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2189 | Mor09p | signal 09 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2190 | Mor10p | signal 10 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2191 | Mor11p | signal 11 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2192 | Mor12p | signal 12 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2193 | Mor13p | signal 13 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2194 | Mor14p | signal 14 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2195 | Mor15p | signal 15 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2196 | Mor16p | signal 16 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2197 | Mor17p | signal 17 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2198 | Mor18p | signal 18 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2199 | Mor19p | signal 19 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2200 | Mor20p | signal 20 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2201 | Mor21p | signal 21 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2202 | Mor22p | signal 22 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2203 | Mor23p | signal 23 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2204 | Mor24p | signal 24 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2205 | Mor25p | signal 25 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2206 | Mor26p | signal 26 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2207 | Mor27p | signal 27 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2208 | Mor28p | signal 28 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2209 | Mor29p | signal 29 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2210 | Mor30p | signal 30 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2211 | Mor31p | signal 31 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2212 | Mor32p | signal 32 / weighted by polarizability | 3D-MoRSE descriptors | Weighted by polarizability | 
| 2213 | Mor01i | signal 01 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2214 | Mor02i | signal 02 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2215 | Mor03i | signal 03 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2216 | Mor04i | signal 04 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2217 | Mor05i | signal 05 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2218 | Mor06i | signal 06 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2219 | Mor07i | signal 07 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2220 | Mor08i | signal 08 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2221 | Mor09i | signal 09 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2222 | Mor10i | signal 10 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2223 | Mor11i | signal 11 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2224 | Mor12i | signal 12 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2225 | Mor13i | signal 13 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2226 | Mor14i | signal 14 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2227 | Mor15i | signal 15 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2228 | Mor16i | signal 16 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2229 | Mor17i | signal 17 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2230 | Mor18i | signal 18 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2231 | Mor19i | signal 19 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2232 | Mor20i | signal 20 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2233 | Mor21i | signal 21 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2234 | Mor22i | signal 22 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2235 | Mor23i | signal 23 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2236 | Mor24i | signal 24 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2237 | Mor25i | signal 25 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2238 | Mor26i | signal 26 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2239 | Mor27i | signal 27 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2240 | Mor28i | signal 28 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2241 | Mor29i | signal 29 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2242 | Mor30i | signal 30 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2243 | Mor31i | signal 31 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2244 | Mor32i | signal 32 / weighted by ionization potential | 3D-MoRSE descriptors | Weighted by ionization potential | 
| 2245 | Mor01s | signal 01 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2246 | Mor02s | signal 02 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2247 | Mor03s | signal 03 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2248 | Mor04s | signal 04 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2249 | Mor05s | signal 05 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2250 | Mor06s | signal 06 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2251 | Mor07s | signal 07 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2252 | Mor08s | signal 08 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2253 | Mor09s | signal 09 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2254 | Mor10s | signal 10 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2255 | Mor11s | signal 11 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2256 | Mor12s | signal 12 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2257 | Mor13s | signal 13 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2258 | Mor14s | signal 14 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2259 | Mor15s | signal 15 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2260 | Mor16s | signal 16 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2261 | Mor17s | signal 17 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2262 | Mor18s | signal 18 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2263 | Mor19s | signal 19 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2264 | Mor20s | signal 20 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2265 | Mor21s | signal 21 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2266 | Mor22s | signal 22 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2267 | Mor23s | signal 23 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2268 | Mor24s | signal 24 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2269 | Mor25s | signal 25 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2270 | Mor26s | signal 26 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2271 | Mor27s | signal 27 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2272 | Mor28s | signal 28 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2273 | Mor29s | signal 29 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2274 | Mor30s | signal 30 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2275 | Mor31s | signal 31 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2276 | Mor32s | signal 32 / weighted by I-state | 3D-MoRSE descriptors | Weighted by I-state | 
| 2277 | L1u | 1st component size directional WHIM index / unweighted | WHIM descriptors | Directional descriptors | 
| 2278 | L2u | 2nd component size directional WHIM index / unweighted | WHIM descriptors | Directional descriptors | 
| 2279 | L3u | 3rd component size directional WHIM index / unweighted | WHIM descriptors | Directional descriptors | 
| 2280 | P1u | 1st component shape directional WHIM index / unweighted | WHIM descriptors | Directional descriptors | 
| 2281 | P2u | 2nd component shape directional WHIM index / unweighted | WHIM descriptors | Directional descriptors | 
| 2282 | G1u | 1st component symmetry directional WHIM index / unweighted | WHIM descriptors | Directional descriptors | 
| 2283 | G2u | 2nd component symmetry directional WHIM index / unweighted | WHIM descriptors | Directional descriptors | 
| 2284 | G3u | 3rd component symmetry directional WHIM index / unweighted | WHIM descriptors | Directional descriptors | 
| 2285 | E1u | 1st component accessibility directional WHIM index / unweighted | WHIM descriptors | Directional descriptors | 
| 2286 | E2u | 2nd component accessibility directional WHIM index / unweighted | WHIM descriptors | Directional descriptors | 
| 2287 | E3u | 3rd component accessibility directional WHIM index / unweighted | WHIM descriptors | Directional descriptors | 
| 2288 | L1m | 1st component size directional WHIM index / weighted by mass | WHIM descriptors | Directional descriptors | 
| 2289 | L2m | 2nd component size directional WHIM index / weighted by mass | WHIM descriptors | Directional descriptors | 
| 2290 | L3m | 3rd component size directional WHIM index / weighted by mass | WHIM descriptors | Directional descriptors | 
| 2291 | P1m | 1st component shape directional WHIM index / weighted by mass | WHIM descriptors | Directional descriptors | 
| 2292 | P2m | 2nd component shape directional WHIM index / weighted by mass | WHIM descriptors | Directional descriptors | 
| 2293 | G1m | 1st component symmetry directional WHIM index / weighted by mass | WHIM descriptors | Directional descriptors | 
| 2294 | G2m | 2nd component symmetry directional WHIM index / weighted by mass | WHIM descriptors | Directional descriptors | 
| 2295 | G3m | 3rd component symmetry directional WHIM index / weighted by mass | WHIM descriptors | Directional descriptors | 
| 2296 | E1m | 1st component accessibility directional WHIM index / weighted by mass | WHIM descriptors | Directional descriptors | 
| 2297 | E2m | 2nd component accessibility directional WHIM index / weighted by mass | WHIM descriptors | Directional descriptors | 
| 2298 | E3m | 3rd component accessibility directional WHIM index / weighted by mass | WHIM descriptors | Directional descriptors | 
| 2299 | L1v | 1st component size directional WHIM index / weighted by van der Waals volume | WHIM descriptors | Directional descriptors | 
| 2300 | L2v | 2nd component size directional WHIM index / weighted by van der Waals volume | WHIM descriptors | Directional descriptors | 
| 2301 | L3v | 3rd component size directional WHIM index / weighted by van der Waals volume | WHIM descriptors | Directional descriptors | 
| 2302 | P1v | 1st component shape directional WHIM index / weighted by van der Waals volume | WHIM descriptors | Directional descriptors | 
| 2303 | P2v | 2nd component shape directional WHIM index / weighted by van der Waals volume | WHIM descriptors | Directional descriptors | 
| 2304 | G1v | 1st component symmetry directional WHIM index / weighted by van der Waals volume | WHIM descriptors | Directional descriptors | 
| 2305 | G2v | 2nd component symmetry directional WHIM index / weighted by van der Waals volume | WHIM descriptors | Directional descriptors | 
| 2306 | G3v | 3rd component symmetry directional WHIM index / weighted by van der Waals volume | WHIM descriptors | Directional descriptors | 
| 2307 | E1v | 1st component accessibility directional WHIM index / weighted by van der Waals volume | WHIM descriptors | Directional descriptors | 
| 2308 | E2v | 2nd component accessibility directional WHIM index / weighted by van der Waals volume | WHIM descriptors | Directional descriptors | 
| 2309 | E3v | 3rd component accessibility directional WHIM index / weighted by van der Waals volume | WHIM descriptors | Directional descriptors | 
| 2310 | L1e | 1st component size directional WHIM index / weighted by Sanderson electronegativity | WHIM descriptors | Directional descriptors | 
| 2311 | L2e | 2nd component size directional WHIM index / weighted by Sanderson electronegativity | WHIM descriptors | Directional descriptors | 
| 2312 | L3e | 3rd component size directional WHIM index / weighted by Sanderson electronegativity | WHIM descriptors | Directional descriptors | 
| 2313 | P1e | 1st component shape directional WHIM index / weighted by Sanderson electronegativity | WHIM descriptors | Directional descriptors | 
| 2314 | P2e | 2nd component shape directional WHIM index / weighted by Sanderson electronegativity | WHIM descriptors | Directional descriptors | 
| 2315 | G1e | 1st component symmetry directional WHIM index / weighted by Sanderson electronegativity | WHIM descriptors | Directional descriptors | 
| 2316 | G2e | 2nd component symmetry directional WHIM index / weighted by Sanderson electronegativity | WHIM descriptors | Directional descriptors | 
| 2317 | G3e | 3rd component symmetry directional WHIM index / weighted by Sanderson electronegativity | WHIM descriptors | Directional descriptors | 
| 2318 | E1e | 1st component accessibility directional WHIM index / weighted by Sanderson electronegativity | WHIM descriptors | Directional descriptors | 
| 2319 | E2e | 2nd component accessibility directional WHIM index / weighted by Sanderson electronegativity | WHIM descriptors | Directional descriptors | 
| 2320 | E3e | 3rd component accessibility directional WHIM index / weighted by Sanderson electronegativity | WHIM descriptors | Directional descriptors | 
| 2321 | L1p | 1st component size directional WHIM index / weighted by polarizability | WHIM descriptors | Directional descriptors | 
| 2322 | L2p | 2nd component size directional WHIM index / weighted by polarizability | WHIM descriptors | Directional descriptors | 
| 2323 | L3p | 3rd component size directional WHIM index / weighted by polarizability | WHIM descriptors | Directional descriptors | 
| 2324 | P1p | 1st component shape directional WHIM index / weighted by polarizability | WHIM descriptors | Directional descriptors | 
| 2325 | P2p | 2nd component shape directional WHIM index / weighted by polarizability | WHIM descriptors | Directional descriptors | 
| 2326 | G1p | 1st component symmetry directional WHIM index / weighted by polarizability | WHIM descriptors | Directional descriptors | 
| 2327 | G2p | 2nd component symmetry directional WHIM index / weighted by polarizability | WHIM descriptors | Directional descriptors | 
| 2328 | G3p | 3rd component symmetry directional WHIM index / weighted by polarizability | WHIM descriptors | Directional descriptors | 
| 2329 | E1p | 1st component accessibility directional WHIM index / weighted by polarizability | WHIM descriptors | Directional descriptors | 
| 2330 | E2p | 2nd component accessibility directional WHIM index / weighted by polarizability | WHIM descriptors | Directional descriptors | 
| 2331 | E3p | 3rd component accessibility directional WHIM index / weighted by polarizability | WHIM descriptors | Directional descriptors | 
| 2332 | L1i | 1st component size directional WHIM index / weighted by ionization potential | WHIM descriptors | Directional descriptors | 
| 2333 | L2i | 2nd component size directional WHIM index / weighted by ionization potential | WHIM descriptors | Directional descriptors | 
| 2334 | L3i | 3rd component size directional WHIM index / weighted by ionization potential | WHIM descriptors | Directional descriptors | 
| 2335 | P1i | 1st component shape directional WHIM index / weighted by ionization potential | WHIM descriptors | Directional descriptors | 
| 2336 | P2i | 2nd component shape directional WHIM index / weighted by ionization potential | WHIM descriptors | Directional descriptors | 
| 2337 | G1i | 1st component symmetry directional WHIM index / weighted by ionization potential | WHIM descriptors | Directional descriptors | 
| 2338 | G2i | 2nd component symmetry directional WHIM index / weighted by ionization potential | WHIM descriptors | Directional descriptors | 
| 2339 | G3i | 3rd component symmetry directional WHIM index / weighted by ionization potential | WHIM descriptors | Directional descriptors | 
| 2340 | E1i | 1st component accessibility directional WHIM index / weighted by ionization potential | WHIM descriptors | Directional descriptors | 
| 2341 | E2i | 2nd component accessibility directional WHIM index / weighted by ionization potential | WHIM descriptors | Directional descriptors | 
| 2342 | E3i | 3rd component accessibility directional WHIM index / weighted by ionization potential | WHIM descriptors | Directional descriptors | 
| 2343 | L1s | 1st component size directional WHIM index / weighted by I-state | WHIM descriptors | Directional descriptors | 
| 2344 | L2s | 2nd component size directional WHIM index / weighted by I-state | WHIM descriptors | Directional descriptors | 
| 2345 | L3s | 3rd component size directional WHIM index / weighted by I-state | WHIM descriptors | Directional descriptors | 
| 2346 | P1s | 1st component shape directional WHIM index / weighted by I-state | WHIM descriptors | Directional descriptors | 
| 2347 | P2s | 2nd component shape directional WHIM index / weighted by I-state | WHIM descriptors | Directional descriptors | 
| 2348 | G1s | 1st component symmetry directional WHIM index / weighted by I-state | WHIM descriptors | Directional descriptors | 
| 2349 | G2s | 2nd component symmetry directional WHIM index / weighted by I-state | WHIM descriptors | Directional descriptors | 
| 2350 | G3s | 3rd component symmetry directional WHIM index / weighted by I-state | WHIM descriptors | Directional descriptors | 
| 2351 | E1s | 1st component accessibility directional WHIM index / weighted by I-state | WHIM descriptors | Directional descriptors | 
| 2352 | E2s | 2nd component accessibility directional WHIM index / weighted by I-state | WHIM descriptors | Directional descriptors | 
| 2353 | E3s | 3rd component accessibility directional WHIM index / weighted by I-state | WHIM descriptors | Directional descriptors | 
| 2354 | Tu | T total size index / unweighted | WHIM descriptors | Global descriptors | 
| 2355 | Tm | T total size index / weighted by mass | WHIM descriptors | Global descriptors | 
| 2356 | Tv | T total size index / weighted by van der Waals volume | WHIM descriptors | Global descriptors | 
| 2357 | Te | T total size index / weighted by Sanderson electronegativity | WHIM descriptors | Global descriptors | 
| 2358 | Tp | T total size index / weighted by polarizability | WHIM descriptors | Global descriptors | 
| 2359 | Ti | T total size index / weighted by ionization potential | WHIM descriptors | Global descriptors | 
| 2360 | Ts | T total size index / weighted by I-state | WHIM descriptors | Global descriptors | 
| 2361 | Au | A total size index / unweighted | WHIM descriptors | Global descriptors | 
| 2362 | Am | A total size index / weighted by mass | WHIM descriptors | Global descriptors | 
| 2363 | Av | A total size index / weighted by van der Waals volume | WHIM descriptors | Global descriptors | 
| 2364 | Ae | A total size index / weighted by Sanderson electronegativity | WHIM descriptors | Global descriptors | 
| 2365 | Ap | A total size index / weighted by polarizability | WHIM descriptors | Global descriptors | 
| 2366 | Ai | A total size index / weighted by ionization potential | WHIM descriptors | Global descriptors | 
| 2367 | As | A total size index / weighted by I-state | WHIM descriptors | Global descriptors | 
| 2368 | Gu | total symmetry index / unweighted | WHIM descriptors | Global descriptors | 
| 2369 | Gm | total symmetry index / weighted by mass | WHIM descriptors | Global descriptors | 
| 2370 | Ku | K global shape index / unweighted | WHIM descriptors | Global descriptors | 
| 2371 | Km | K global shape index / weighted by mass | WHIM descriptors | Global descriptors | 
| 2372 | Kv | K global shape index / weighted by van der Waals volume | WHIM descriptors | Global descriptors | 
| 2373 | Ke | K global shape index / weighted by Sanderson electronegativity | WHIM descriptors | Global descriptors | 
| 2374 | Kp | K global shape index / weighted by polarizability | WHIM descriptors | Global descriptors | 
| 2375 | Ki | K global shape index / weighted by ionization potential | WHIM descriptors | Global descriptors | 
| 2376 | Ks | K global shape index / weighted by I-state | WHIM descriptors | Global descriptors | 
| 2377 | Du | D total accessibility index / unweighted | WHIM descriptors | Global descriptors | 
| 2378 | Dm | D total accessibility index / weighted by mass | WHIM descriptors | Global descriptors | 
| 2379 | Dv | D total accessibility index / weighted by van der Waals volume | WHIM descriptors | Global descriptors | 
| 2380 | De | D total accessibility index / weighted by Sanderson electronegativity | WHIM descriptors | Global descriptors | 
| 2381 | Dp | D total accessibility index / weighted by polarizability | WHIM descriptors | Global descriptors | 
| 2382 | Di | D total accessibility index / weighted by ionization potential | WHIM descriptors | Global descriptors | 
| 2383 | Ds | D total accessibility index / weighted by I-state | WHIM descriptors | Global descriptors | 
| 2384 | Vu | V total size index / unweighted | WHIM descriptors | Global descriptors | 
| 2385 | Vm | V total size index / weighted by mass | WHIM descriptors | Global descriptors | 
| 2386 | Vv | V total size index / weighted by van der Waals volume | WHIM descriptors | Global descriptors | 
| 2387 | Ve | V total size index / weighted by Sanderson electronegativity | WHIM descriptors | Global descriptors | 
| 2388 | Vp | V total size index / weighted by polarizability | WHIM descriptors | Global descriptors | 
| 2389 | Vi | V total size index / weighted by ionization potential | WHIM descriptors | Global descriptors | 
| 2390 | Vs | V total size index / weighted by I-state | WHIM descriptors | Global descriptors | 
| 2391 | ITH | total information content on the leverage equality | GETAWAY descriptors | Basic descriptors | 
| 2392 | ISH | standardized information content on the leverage equality | GETAWAY descriptors | Basic descriptors | 
| 2393 | HIC | mean information content on the leverage magnitude | GETAWAY descriptors | Basic descriptors | 
| 2394 | HGM | geometric mean on the leverage magnitude | GETAWAY descriptors | Basic descriptors | 
| 2395 | H0u | H autocorrelation of lag 0 / unweighted | GETAWAY descriptors | H-indices | 
| 2396 | H1u | H autocorrelation of lag 1 / unweighted | GETAWAY descriptors | H-indices | 
| 2397 | H2u | H autocorrelation of lag 2 / unweighted | GETAWAY descriptors | H-indices | 
| 2398 | H3u | H autocorrelation of lag 3 / unweighted | GETAWAY descriptors | H-indices | 
| 2399 | H4u | H autocorrelation of lag 4 / unweighted | GETAWAY descriptors | H-indices | 
| 2400 | H5u | H autocorrelation of lag 5 / unweighted | GETAWAY descriptors | H-indices | 
| 2401 | H6u | H autocorrelation of lag 6 / unweighted | GETAWAY descriptors | H-indices | 
| 2402 | H7u | H autocorrelation of lag 7 / unweighted | GETAWAY descriptors | H-indices | 
| 2403 | H8u | H autocorrelation of lag 8 / unweighted | GETAWAY descriptors | H-indices | 
| 2404 | HTu | H total index / unweighted | GETAWAY descriptors | H-indices | 
| 2405 | HATS0u | leverage-weighted autocorrelation of lag 0 / unweighted | GETAWAY descriptors | H-indices | 
| 2406 | HATS1u | leverage-weighted autocorrelation of lag 1 / unweighted | GETAWAY descriptors | H-indices | 
| 2407 | HATS2u | leverage-weighted autocorrelation of lag 2 / unweighted | GETAWAY descriptors | H-indices | 
| 2408 | HATS3u | leverage-weighted autocorrelation of lag 3 / unweighted | GETAWAY descriptors | H-indices | 
| 2409 | HATS4u | leverage-weighted autocorrelation of lag 4 / unweighted | GETAWAY descriptors | H-indices | 
| 2410 | HATS5u | leverage-weighted autocorrelation of lag 5 / unweighted | GETAWAY descriptors | H-indices | 
| 2411 | HATS6u | leverage-weighted autocorrelation of lag 6 / unweighted | GETAWAY descriptors | H-indices | 
| 2412 | HATS7u | leverage-weighted autocorrelation of lag 7 / unweighted | GETAWAY descriptors | H-indices | 
| 2413 | HATS8u | leverage-weighted autocorrelation of lag 8 / unweighted | GETAWAY descriptors | H-indices | 
| 2414 | HATSu | leverage-weighted total index / unweighted | GETAWAY descriptors | H-indices | 
| 2415 | H0m | H autocorrelation of lag 0 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2416 | H1m | H autocorrelation of lag 1 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2417 | H2m | H autocorrelation of lag 2 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2418 | H3m | H autocorrelation of lag 3 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2419 | H4m | H autocorrelation of lag 4 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2420 | H5m | H autocorrelation of lag 5 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2421 | H6m | H autocorrelation of lag 6 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2422 | H7m | H autocorrelation of lag 7 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2423 | H8m | H autocorrelation of lag 8 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2424 | HTm | H total index / weighted by mass | GETAWAY descriptors | H-indices | 
| 2425 | HATS0m | leverage-weighted autocorrelation of lag 0 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2426 | HATS1m | leverage-weighted autocorrelation of lag 1 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2427 | HATS2m | leverage-weighted autocorrelation of lag 2 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2428 | HATS3m | leverage-weighted autocorrelation of lag 3 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2429 | HATS4m | leverage-weighted autocorrelation of lag 4 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2430 | HATS5m | leverage-weighted autocorrelation of lag 5 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2431 | HATS6m | leverage-weighted autocorrelation of lag 6 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2432 | HATS7m | leverage-weighted autocorrelation of lag 7 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2433 | HATS8m | leverage-weighted autocorrelation of lag 8 / weighted by mass | GETAWAY descriptors | H-indices | 
| 2434 | HATSm | leverage-weighted total index / weighted by mass | GETAWAY descriptors | H-indices | 
| 2435 | H0v | H autocorrelation of lag 0 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2436 | H1v | H autocorrelation of lag 1 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2437 | H2v | H autocorrelation of lag 2 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2438 | H3v | H autocorrelation of lag 3 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2439 | H4v | H autocorrelation of lag 4 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2440 | H5v | H autocorrelation of lag 5 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2441 | H6v | H autocorrelation of lag 6 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2442 | H7v | H autocorrelation of lag 7 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2443 | H8v | H autocorrelation of lag 8 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2444 | HTv | H total index / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2445 | HATS0v | leverage-weighted autocorrelation of lag 0 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2446 | HATS1v | leverage-weighted autocorrelation of lag 1 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2447 | HATS2v | leverage-weighted autocorrelation of lag 2 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2448 | HATS3v | leverage-weighted autocorrelation of lag 3 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2449 | HATS4v | leverage-weighted autocorrelation of lag 4 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2450 | HATS5v | leverage-weighted autocorrelation of lag 5 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2451 | HATS6v | leverage-weighted autocorrelation of lag 6 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2452 | HATS7v | leverage-weighted autocorrelation of lag 7 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2453 | HATS8v | leverage-weighted autocorrelation of lag 8 / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2454 | HATSv | leverage-weighted total index / weighted by van der Waals volume | GETAWAY descriptors | H-indices | 
| 2455 | H0e | H autocorrelation of lag 0 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2456 | H1e | H autocorrelation of lag 1 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2457 | H2e | H autocorrelation of lag 2 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2458 | H3e | H autocorrelation of lag 3 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2459 | H4e | H autocorrelation of lag 4 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2460 | H5e | H autocorrelation of lag 5 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2461 | H6e | H autocorrelation of lag 6 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2462 | H7e | H autocorrelation of lag 7 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2463 | H8e | H autocorrelation of lag 8 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2464 | HTe | H total index / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2465 | HATS0e | leverage-weighted autocorrelation of lag 0 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2466 | HATS1e | leverage-weighted autocorrelation of lag 1 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2467 | HATS2e | leverage-weighted autocorrelation of lag 2 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2468 | HATS3e | leverage-weighted autocorrelation of lag 3 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2469 | HATS4e | leverage-weighted autocorrelation of lag 4 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2470 | HATS5e | leverage-weighted autocorrelation of lag 5 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2471 | HATS6e | leverage-weighted autocorrelation of lag 6 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2472 | HATS7e | leverage-weighted autocorrelation of lag 7 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2473 | HATS8e | leverage-weighted autocorrelation of lag 8 / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2474 | HATSe | leverage-weighted total index / weighted by Sanderson electronegativity | GETAWAY descriptors | H-indices | 
| 2475 | H0p | H autocorrelation of lag 0 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2476 | H1p | H autocorrelation of lag 1 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2477 | H2p | H autocorrelation of lag 2 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2478 | H3p | H autocorrelation of lag 3 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2479 | H4p | H autocorrelation of lag 4 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2480 | H5p | H autocorrelation of lag 5 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2481 | H6p | H autocorrelation of lag 6 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2482 | H7p | H autocorrelation of lag 7 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2483 | H8p | H autocorrelation of lag 8 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2484 | HTp | H total index / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2485 | HATS0p | leverage-weighted autocorrelation of lag 0 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2486 | HATS1p | leverage-weighted autocorrelation of lag 1 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2487 | HATS2p | leverage-weighted autocorrelation of lag 2 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2488 | HATS3p | leverage-weighted autocorrelation of lag 3 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2489 | HATS4p | leverage-weighted autocorrelation of lag 4 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2490 | HATS5p | leverage-weighted autocorrelation of lag 5 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2491 | HATS6p | leverage-weighted autocorrelation of lag 6 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2492 | HATS7p | leverage-weighted autocorrelation of lag 7 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2493 | HATS8p | leverage-weighted autocorrelation of lag 8 / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2494 | HATSp | leverage-weighted total index / weighted by polarizability | GETAWAY descriptors | H-indices | 
| 2495 | H0i | H autocorrelation of lag 0 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2496 | H1i | H autocorrelation of lag 1 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2497 | H2i | H autocorrelation of lag 2 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2498 | H3i | H autocorrelation of lag 3 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2499 | H4i | H autocorrelation of lag 4 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2500 | H5i | H autocorrelation of lag 5 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2501 | H6i | H autocorrelation of lag 6 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2502 | H7i | H autocorrelation of lag 7 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2503 | H8i | H autocorrelation of lag 8 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2504 | HTi | H total index / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2505 | HATS0i | leverage-weighted autocorrelation of lag 0 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2506 | HATS1i | leverage-weighted autocorrelation of lag 1 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2507 | HATS2i | leverage-weighted autocorrelation of lag 2 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2508 | HATS3i | leverage-weighted autocorrelation of lag 3 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2509 | HATS4i | leverage-weighted autocorrelation of lag 4 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2510 | HATS5i | leverage-weighted autocorrelation of lag 5 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2511 | HATS6i | leverage-weighted autocorrelation of lag 6 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2512 | HATS7i | leverage-weighted autocorrelation of lag 7 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2513 | HATS8i | leverage-weighted autocorrelation of lag 8 / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2514 | HATSi | leverage-weighted total index / weighted by ionization potential | GETAWAY descriptors | H-indices | 
| 2515 | H0s | H autocorrelation of lag 0 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2516 | H1s | H autocorrelation of lag 1 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2517 | H2s | H autocorrelation of lag 2 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2518 | H3s | H autocorrelation of lag 3 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2519 | H4s | H autocorrelation of lag 4 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2520 | H5s | H autocorrelation of lag 5 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2521 | H6s | H autocorrelation of lag 6 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2522 | H7s | H autocorrelation of lag 7 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2523 | H8s | H autocorrelation of lag 8 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2524 | HTs | H total index / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2525 | HATS0s | leverage-weighted autocorrelation of lag 0 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2526 | HATS1s | leverage-weighted autocorrelation of lag 1 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2527 | HATS2s | leverage-weighted autocorrelation of lag 2 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2528 | HATS3s | leverage-weighted autocorrelation of lag 3 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2529 | HATS4s | leverage-weighted autocorrelation of lag 4 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2530 | HATS5s | leverage-weighted autocorrelation of lag 5 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2531 | HATS6s | leverage-weighted autocorrelation of lag 6 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2532 | HATS7s | leverage-weighted autocorrelation of lag 7 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2533 | HATS8s | leverage-weighted autocorrelation of lag 8 / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2534 | HATSs | leverage-weighted total index / weighted by I-state | GETAWAY descriptors | H-indices | 
| 2535 | RCON | Randic-type R matrix connectivity | GETAWAY descriptors | R-indices | 
| 2536 | RARS | R matrix average row sum | GETAWAY descriptors | R-indices | 
| 2537 | REIG | first eigenvalue of the R matrix | GETAWAY descriptors | R-indices | 
| 2538 | R1u | R autocorrelation of lag 1 / unweighted | GETAWAY descriptors | R-indices | 
| 2539 | R2u | R autocorrelation of lag 2 / unweighted | GETAWAY descriptors | R-indices | 
| 2540 | R3u | R autocorrelation of lag 3 / unweighted | GETAWAY descriptors | R-indices | 
| 2541 | R4u | R autocorrelation of lag 4 / unweighted | GETAWAY descriptors | R-indices | 
| 2542 | R5u | R autocorrelation of lag 5 / unweighted | GETAWAY descriptors | R-indices | 
| 2543 | R6u | R autocorrelation of lag 6 / unweighted | GETAWAY descriptors | R-indices | 
| 2544 | R7u | R autocorrelation of lag 7 / unweighted | GETAWAY descriptors | R-indices | 
| 2545 | R8u | R autocorrelation of lag 8 / unweighted | GETAWAY descriptors | R-indices | 
| 2546 | RTu | R total index / unweighted | GETAWAY descriptors | R-indices | 
| 2547 | R1u+ | R maximal autocorrelation of lag 1 / unweighted | GETAWAY descriptors | R-indices | 
| 2548 | R2u+ | R maximal autocorrelation of lag 2 / unweighted | GETAWAY descriptors | R-indices | 
| 2549 | R3u+ | R maximal autocorrelation of lag 3 / unweighted | GETAWAY descriptors | R-indices | 
| 2550 | R4u+ | R maximal autocorrelation of lag 4 / unweighted | GETAWAY descriptors | R-indices | 
| 2551 | R5u+ | R maximal autocorrelation of lag 5 / unweighted | GETAWAY descriptors | R-indices | 
| 2552 | R6u+ | R maximal autocorrelation of lag 6 / unweighted | GETAWAY descriptors | R-indices | 
| 2553 | R7u+ | R maximal autocorrelation of lag 7 / unweighted | GETAWAY descriptors | R-indices | 
| 2554 | R8u+ | R maximal autocorrelation of lag 8 / unweighted | GETAWAY descriptors | R-indices | 
| 2555 | RTu+ | R maximal index / unweighted | GETAWAY descriptors | R-indices | 
| 2556 | R1m | R autocorrelation of lag 1 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2557 | R2m | R autocorrelation of lag 2 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2558 | R3m | R autocorrelation of lag 3 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2559 | R4m | R autocorrelation of lag 4 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2560 | R5m | R autocorrelation of lag 5 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2561 | R6m | R autocorrelation of lag 6 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2562 | R7m | R autocorrelation of lag 7 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2563 | R8m | R autocorrelation of lag 8 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2564 | RTm | R total index / weighted by mass | GETAWAY descriptors | R-indices | 
| 2565 | R1m+ | R maximal autocorrelation of lag 1 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2566 | R2m+ | R maximal autocorrelation of lag 2 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2567 | R3m+ | R maximal autocorrelation of lag 3 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2568 | R4m+ | R maximal autocorrelation of lag 4 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2569 | R5m+ | R maximal autocorrelation of lag 5 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2570 | R6m+ | R maximal autocorrelation of lag 6 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2571 | R7m+ | R maximal autocorrelation of lag 7 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2572 | R8m+ | R maximal autocorrelation of lag 8 / weighted by mass | GETAWAY descriptors | R-indices | 
| 2573 | RTm+ | R maximal index / weighted by mass | GETAWAY descriptors | R-indices | 
| 2574 | R1v | R autocorrelation of lag 1 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2575 | R2v | R autocorrelation of lag 2 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2576 | R3v | R autocorrelation of lag 3 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2577 | R4v | R autocorrelation of lag 4 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2578 | R5v | R autocorrelation of lag 5 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2579 | R6v | R autocorrelation of lag 6 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2580 | R7v | R autocorrelation of lag 7 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2581 | R8v | R autocorrelation of lag 8 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2582 | RTv | R total index / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2583 | R1v+ | R maximal autocorrelation of lag 1 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2584 | R2v+ | R maximal autocorrelation of lag 2 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2585 | R3v+ | R maximal autocorrelation of lag 3 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2586 | R4v+ | R maximal autocorrelation of lag 4 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2587 | R5v+ | R maximal autocorrelation of lag 5 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2588 | R6v+ | R maximal autocorrelation of lag 6 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2589 | R7v+ | R maximal autocorrelation of lag 7 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2590 | R8v+ | R maximal autocorrelation of lag 8 / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2591 | RTv+ | R maximal index / weighted by van der Waals volume | GETAWAY descriptors | R-indices | 
| 2592 | R1e | R autocorrelation of lag 1 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2593 | R2e | R autocorrelation of lag 2 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2594 | R3e | R autocorrelation of lag 3 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2595 | R4e | R autocorrelation of lag 4 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2596 | R5e | R autocorrelation of lag 5 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2597 | R6e | R autocorrelation of lag 6 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2598 | R7e | R autocorrelation of lag 7 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2599 | R8e | R autocorrelation of lag 8 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2600 | RTe | R total index / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2601 | R1e+ | R maximal autocorrelation of lag 1 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2602 | R2e+ | R maximal autocorrelation of lag 2 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2603 | R3e+ | R maximal autocorrelation of lag 3 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2604 | R4e+ | R maximal autocorrelation of lag 4 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2605 | R5e+ | R maximal autocorrelation of lag 5 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2606 | R6e+ | R maximal autocorrelation of lag 6 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2607 | R7e+ | R maximal autocorrelation of lag 7 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2608 | R8e+ | R maximal autocorrelation of lag 8 / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2609 | RTe+ | R maximal index / weighted by Sanderson electronegativity | GETAWAY descriptors | R-indices | 
| 2610 | R1p | R autocorrelation of lag 1 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2611 | R2p | R autocorrelation of lag 2 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2612 | R3p | R autocorrelation of lag 3 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2613 | R4p | R autocorrelation of lag 4 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2614 | R5p | R autocorrelation of lag 5 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2615 | R6p | R autocorrelation of lag 6 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2616 | R7p | R autocorrelation of lag 7 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2617 | R8p | R autocorrelation of lag 8 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2618 | RTp | R total index / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2619 | R1p+ | R maximal autocorrelation of lag 1 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2620 | R2p+ | R maximal autocorrelation of lag 2 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2621 | R3p+ | R maximal autocorrelation of lag 3 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2622 | R4p+ | R maximal autocorrelation of lag 4 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2623 | R5p+ | R maximal autocorrelation of lag 5 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2624 | R6p+ | R maximal autocorrelation of lag 6 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2625 | R7p+ | R maximal autocorrelation of lag 7 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2626 | R8p+ | R maximal autocorrelation of lag 8 / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2627 | RTp+ | R maximal index / weighted by polarizability | GETAWAY descriptors | R-indices | 
| 2628 | R1i | R autocorrelation of lag 1 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2629 | R2i | R autocorrelation of lag 2 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2630 | R3i | R autocorrelation of lag 3 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2631 | R4i | R autocorrelation of lag 4 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2632 | R5i | R autocorrelation of lag 5 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2633 | R6i | R autocorrelation of lag 6 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2634 | R7i | R autocorrelation of lag 7 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2635 | R8i | R autocorrelation of lag 8 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2636 | RTi | R total index / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2637 | R1i+ | R maximal autocorrelation of lag 1 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2638 | R2i+ | R maximal autocorrelation of lag 2 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2639 | R3i+ | R maximal autocorrelation of lag 3 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2640 | R4i+ | R maximal autocorrelation of lag 4 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2641 | R5i+ | R maximal autocorrelation of lag 5 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2642 | R6i+ | R maximal autocorrelation of lag 6 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2643 | R7i+ | R maximal autocorrelation of lag 7 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2644 | R8i+ | R maximal autocorrelation of lag 8 / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2645 | RTi+ | R maximal index / weighted by ionization potential | GETAWAY descriptors | R-indices | 
| 2646 | R1s | R autocorrelation of lag 1 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2647 | R2s | R autocorrelation of lag 2 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2648 | R3s | R autocorrelation of lag 3 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2649 | R4s | R autocorrelation of lag 4 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2650 | R5s | R autocorrelation of lag 5 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2651 | R6s | R autocorrelation of lag 6 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2652 | R7s | R autocorrelation of lag 7 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2653 | R8s | R autocorrelation of lag 8 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2654 | RTs | R total index / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2655 | R1s+ | R maximal autocorrelation of lag 1 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2656 | R2s+ | R maximal autocorrelation of lag 2 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2657 | R3s+ | R maximal autocorrelation of lag 3 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2658 | R4s+ | R maximal autocorrelation of lag 4 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2659 | R5s+ | R maximal autocorrelation of lag 5 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2660 | R6s+ | R maximal autocorrelation of lag 6 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2661 | R7s+ | R maximal autocorrelation of lag 7 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2662 | R8s+ | R maximal autocorrelation of lag 8 / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2663 | RTs+ | R maximal index / weighted by I-state | GETAWAY descriptors | R-indices | 
| 2664 | DP01 | molecular profile no. 1 | Randic molecular profiles | Molecular profiles | 
| 2665 | DP02 | molecular profile no. 2 | Randic molecular profiles | Molecular profiles | 
| 2666 | DP03 | molecular profile no. 3 | Randic molecular profiles | Molecular profiles | 
| 2667 | DP04 | molecular profile no. 4 | Randic molecular profiles | Molecular profiles | 
| 2668 | DP05 | molecular profile no. 5 | Randic molecular profiles | Molecular profiles | 
| 2669 | DP06 | molecular profile no. 6 | Randic molecular profiles | Molecular profiles | 
| 2670 | DP07 | molecular profile no. 7 | Randic molecular profiles | Molecular profiles | 
| 2671 | DP08 | molecular profile no. 8 | Randic molecular profiles | Molecular profiles | 
| 2672 | DP09 | molecular profile no. 9 | Randic molecular profiles | Molecular profiles | 
| 2673 | DP10 | molecular profile no. 10 | Randic molecular profiles | Molecular profiles | 
| 2674 | DP11 | molecular profile no. 11 | Randic molecular profiles | Molecular profiles | 
| 2675 | DP12 | molecular profile no. 12 | Randic molecular profiles | Molecular profiles | 
| 2676 | DP13 | molecular profile no. 13 | Randic molecular profiles | Molecular profiles | 
| 2677 | DP14 | molecular profile no. 14 | Randic molecular profiles | Molecular profiles | 
| 2678 | DP15 | molecular profile no. 15 | Randic molecular profiles | Molecular profiles | 
| 2679 | DP16 | molecular profile no. 16 | Randic molecular profiles | Molecular profiles | 
| 2680 | DP17 | molecular profile no. 17 | Randic molecular profiles | Molecular profiles | 
| 2681 | DP18 | molecular profile no. 18 | Randic molecular profiles | Molecular profiles | 
| 2682 | DP19 | molecular profile no. 19 | Randic molecular profiles | Molecular profiles | 
| 2683 | DP20 | molecular profile no. 20 | Randic molecular profiles | Molecular profiles | 
| 2684 | SP01 | shape profile no. 1 | Randic molecular profiles | Shape profiles | 
| 2685 | SP02 | shape profile no. 2 | Randic molecular profiles | Shape profiles | 
| 2686 | SP03 | shape profile no. 3 | Randic molecular profiles | Shape profiles | 
| 2687 | SP04 | shape profile no. 4 | Randic molecular profiles | Shape profiles | 
| 2688 | SP05 | shape profile no. 5 | Randic molecular profiles | Shape profiles | 
| 2689 | SP06 | shape profile no. 6 | Randic molecular profiles | Shape profiles | 
| 2690 | SP07 | shape profile no. 7 | Randic molecular profiles | Shape profiles | 
| 2691 | SP08 | shape profile no. 8 | Randic molecular profiles | Shape profiles | 
| 2692 | SP09 | shape profile no. 9 | Randic molecular profiles | Shape profiles | 
| 2693 | SP10 | shape profile no. 10 | Randic molecular profiles | Shape profiles | 
| 2694 | SP11 | shape profile no. 11 | Randic molecular profiles | Shape profiles | 
| 2695 | SP12 | shape profile no. 12 | Randic molecular profiles | Shape profiles | 
| 2696 | SP13 | shape profile no. 13 | Randic molecular profiles | Shape profiles | 
| 2697 | SP14 | shape profile no. 14 | Randic molecular profiles | Shape profiles | 
| 2698 | SP15 | shape profile no. 15 | Randic molecular profiles | Shape profiles | 
| 2699 | SP16 | shape profile no. 16 | Randic molecular profiles | Shape profiles | 
| 2700 | SP17 | shape profile no. 17 | Randic molecular profiles | Shape profiles | 
| 2701 | SP18 | shape profile no. 18 | Randic molecular profiles | Shape profiles | 
| 2702 | SP19 | shape profile no. 19 | Randic molecular profiles | Shape profiles | 
| 2703 | SP20 | shape profile no. 20 | Randic molecular profiles | Shape profiles | 
| 2704 | SHP2 | average shape profile index of order 2 | Randic molecular profiles | Shape profiles | 
| 2705 | nCp | number of terminal primary C(sp3) | Functional group counts | Basic descriptors | 
| 2706 | nCs | number of total secondary C(sp3) | Functional group counts | Basic descriptors | 
| 2707 | nCt | number of total tertiary C(sp3) | Functional group counts | Basic descriptors | 
| 2708 | nCq | number of total quaternary C(sp3) | Functional group counts | Basic descriptors | 
| 2709 | nCrs | number of ring secondary C(sp3) | Functional group counts | Basic descriptors | 
| 2710 | nCrt | number of ring tertiary C(sp3) | Functional group counts | Basic descriptors | 
| 2711 | nCrq | number of ring quaternary C(sp3) | Functional group counts | Basic descriptors | 
| 2712 | nCar | number of aromatic C(sp2) | Functional group counts | Basic descriptors | 
| 2713 | nCbH | number of unsubstituted benzene C(sp2) | Functional group counts | Basic descriptors | 
| 2714 | nCb- | number of substituted benzene C(sp2) | Functional group counts | Basic descriptors | 
| 2715 | nCconj | number of non-aromatic conjugated C(sp2) | Functional group counts | Basic descriptors | 
| 2716 | nR=Cp | number of terminal primary C(sp2) | Functional group counts | Basic descriptors | 
| 2717 | nR=Cs | number of aliphatic secondary C(sp2) | Functional group counts | Basic descriptors | 
| 2718 | nR=Ct | number of aliphatic tertiary C(sp2) | Functional group counts | Basic descriptors | 
| 2719 | n=C= | number of allenes groups | Functional group counts | Basic descriptors | 
| 2720 | nR#CH/X | number of terminal C(sp) | Functional group counts | Basic descriptors | 
| 2721 | nR#C- | number of non-terminal C(sp) | Functional group counts | Basic descriptors | 
| 2722 | nROCN | number of cyanates (aliphatic) | Functional group counts | Basic descriptors | 
| 2723 | nArOCN | number of cyanates (aromatic) | Functional group counts | Basic descriptors | 
| 2724 | nRNCO | number of isocyanates (aliphatic) | Functional group counts | Basic descriptors | 
| 2725 | nArNCO | number of isocyanates (aromatic) | Functional group counts | Basic descriptors | 
| 2726 | nRSCN | number of thiocyanates (aliphatic) | Functional group counts | Basic descriptors | 
| 2727 | nArSCN | number of thiocyanates (aromatic) | Functional group counts | Basic descriptors | 
| 2728 | nRNCS | number of isothiocyanates (aliphatic) | Functional group counts | Basic descriptors | 
| 2729 | nArNCS | number of isothiocyanates (aromatic) | Functional group counts | Basic descriptors | 
| 2730 | nRCOOH | number of carboxylic acids (aliphatic) | Functional group counts | Basic descriptors | 
| 2731 | nArCOOH | number of carboxylic acids (aromatic) | Functional group counts | Basic descriptors | 
| 2732 | nRCOOR | number of esters (aliphatic) | Functional group counts | Basic descriptors | 
| 2733 | nArCOOR | number of esters (aromatic) | Functional group counts | Basic descriptors | 
| 2734 | nRCONH2 | number of primary amides (aliphatic) | Functional group counts | Basic descriptors | 
| 2735 | nArCONH2 | number of primary amides (aromatic) | Functional group counts | Basic descriptors | 
| 2736 | nRCONHR | number of secondary amides (aliphatic) | Functional group counts | Basic descriptors | 
| 2737 | nArCONHR | number of secondary amides (aromatic) | Functional group counts | Basic descriptors | 
| 2738 | nRCONR2 | number of tertiary amides (aliphatic) | Functional group counts | Basic descriptors | 
| 2739 | nArCONR2 | number of tertiary amides (aromatic) | Functional group counts | Basic descriptors | 
| 2740 | nROCON | number of (thio-) carbamates (aliphatic) | Functional group counts | Basic descriptors | 
| 2741 | nArOCON | number of (thio-) carbamates (aromatic) | Functional group counts | Basic descriptors | 
| 2742 | nRCOX | number of acyl halogenides (aliphatic) | Functional group counts | Basic descriptors | 
| 2743 | nArCOX | number of acyl halogenides (aromatic) | Functional group counts | Basic descriptors | 
| 2744 | nRCSOH | number of thioacids (aliphatic) | Functional group counts | Basic descriptors | 
| 2745 | nArCSOH | number of thioacids (aromatic) | Functional group counts | Basic descriptors | 
| 2746 | nRCSSH | number of dithioacids (aliphatic) | Functional group counts | Basic descriptors | 
| 2747 | nArCSSH | number of dithioacids (aromatic) | Functional group counts | Basic descriptors | 
| 2748 | nRCOSR | number of thioesters (aliphatic) | Functional group counts | Basic descriptors | 
| 2749 | nArCOSR | number of thioesters (aromatic) | Functional group counts | Basic descriptors | 
| 2750 | nRCSSR | number of dithioesters (aliphatic) | Functional group counts | Basic descriptors | 
| 2751 | nArCSSR | number of dithioesters (aromatic) | Functional group counts | Basic descriptors | 
| 2752 | nRCHO | number of aldehydes (aliphatic) | Functional group counts | Basic descriptors | 
| 2753 | nArCHO | number of aldehydes (aromatic) | Functional group counts | Basic descriptors | 
| 2754 | nRCO | number of ketones (aliphatic) | Functional group counts | Basic descriptors | 
| 2755 | nArCO | number of ketones (aromatic) | Functional group counts | Basic descriptors | 
| 2756 | nCONN | number of urea (-thio) derivatives | Functional group counts | Basic descriptors | 
| 2757 | nC=O(O)2 | number of carbonate (-thio) derivatives | Functional group counts | Basic descriptors | 
| 2758 | nN=C-N< | number of amidine derivatives | Functional group counts | Basic descriptors | 
| 2759 | nC(=N)N2 | number of guanidine derivatives | Functional group counts | Basic descriptors | 
| 2760 | nRC=N | number of imines (aliphatic) | Functional group counts | Basic descriptors | 
| 2761 | nArC=N | number of imines (aromatic) | Functional group counts | Basic descriptors | 
| 2762 | nRCNO | number of oximes (aliphatic) | Functional group counts | Basic descriptors | 
| 2763 | nArCNO | number of oximes (aromatic) | Functional group counts | Basic descriptors | 
| 2764 | nRNH2 | number of primary amines (aliphatic) | Functional group counts | Basic descriptors | 
| 2765 | nArNH2 | number of primary amines (aromatic) | Functional group counts | Basic descriptors | 
| 2766 | nRNHR | number of secondary amines (aliphatic) | Functional group counts | Basic descriptors | 
| 2767 | nArNHR | number of secondary amines (aromatic) | Functional group counts | Basic descriptors | 
| 2768 | nRNR2 | number of tertiary amines (aliphatic) | Functional group counts | Basic descriptors | 
| 2769 | nArNR2 | number of tertiary amines (aromatic) | Functional group counts | Basic descriptors | 
| 2770 | nN-N | number of N hydrazines | Functional group counts | Basic descriptors | 
| 2771 | nN=N | number of N azo-derivatives | Functional group counts | Basic descriptors | 
| 2772 | nRCN | number of nitriles (aliphatic) | Functional group counts | Basic descriptors | 
| 2773 | nArCN | number of nitriles (aromatic) | Functional group counts | Basic descriptors | 
| 2774 | nN+ | number of positively charged N | Functional group counts | Basic descriptors | 
| 2775 | nNq | number of quaternary N | Functional group counts | Basic descriptors | 
| 2776 | nRNHO | number of hydroxylamines (aliphatic) | Functional group counts | Basic descriptors | 
| 2777 | nArNHO | number of hydroxylamines (aromatic) | Functional group counts | Basic descriptors | 
| 2778 | nRNNOx | number of N-nitroso groups (aliphatic) | Functional group counts | Basic descriptors | 
| 2779 | nArNNOx | number of N-nitroso groups (aromatic) | Functional group counts | Basic descriptors | 
| 2780 | nRNO | number of nitroso groups (aliphatic) | Functional group counts | Basic descriptors | 
| 2781 | nArNO | number of nitroso groups (aromatic) | Functional group counts | Basic descriptors | 
| 2782 | nRNO2 | number of nitro groups (aliphatic) | Functional group counts | Basic descriptors | 
| 2783 | nArNO2 | number of nitro groups (aromatic) | Functional group counts | Basic descriptors | 
| 2784 | nN(CO)2 | number of imides (-thio) | Functional group counts | Basic descriptors | 
| 2785 | nC=N-N< | number of hydrazones | Functional group counts | Basic descriptors | 
| 2786 | nROH | number of hydroxyl groups | Functional group counts | Basic descriptors | 
| 2787 | nArOH | number of aromatic hydroxyls | Functional group counts | Basic descriptors | 
| 2788 | nOHp | number of primary alcohols | Functional group counts | Basic descriptors | 
| 2789 | nOHs | number of secondary alcohols | Functional group counts | Basic descriptors | 
| 2790 | nOHt | number of tertiary alcohols | Functional group counts | Basic descriptors | 
| 2791 | nROR | number of ethers (aliphatic) | Functional group counts | Basic descriptors | 
| 2792 | nArOR | number of ethers (aromatic) | Functional group counts | Basic descriptors | 
| 2793 | nROX | number of hypohalogenides (aliphatic) | Functional group counts | Basic descriptors | 
| 2794 | nArOX | number of hypohalogenides (aromatic) | Functional group counts | Basic descriptors | 
| 2795 | nO(C=O)2 | number of anhydrides (-thio) | Functional group counts | Basic descriptors | 
| 2796 | nH2O | number of water molecules | Functional group counts | Basic descriptors | 
| 2797 | nSH | number of thiols | Functional group counts | Basic descriptors | 
| 2798 | nC=S | number of thioketones | Functional group counts | Basic descriptors | 
| 2799 | nRSR | number of sulfides | Functional group counts | Basic descriptors | 
| 2800 | nRSSR | number of disulfides | Functional group counts | Basic descriptors | 
| 2801 | nSO | number of sulfoxides | Functional group counts | Basic descriptors | 
| 2802 | nS(=O)2 | number of sulfones | Functional group counts | Basic descriptors | 
| 2803 | nSOH | number of sulfenic (thio-) acids | Functional group counts | Basic descriptors | 
| 2804 | nSOOH | number of sulfinic (thio-/dithio-) acids | Functional group counts | Basic descriptors | 
| 2805 | nSO2OH | number of sulfonic (thio-/dithio-) acids | Functional group counts | Basic descriptors | 
| 2806 | nSO3OH | number of sulfuric (thio-/dithio-) acids | Functional group counts | Basic descriptors | 
| 2807 | nSO2 | number of sulfites (thio-/dithio-) | Functional group counts | Basic descriptors | 
| 2808 | nSO3 | number of sulfonates (thio-/dithio-) | Functional group counts | Basic descriptors | 
| 2809 | nSO4 | number of sulfates (thio-/dithio-) | Functional group counts | Basic descriptors | 
| 2810 | nSO2N | number of sulfonamides (thio-/dithio-) | Functional group counts | Basic descriptors | 
| 2811 | nPO3 | number of phosphites/thiophosphites | Functional group counts | Basic descriptors | 
| 2812 | nPO4 | number of phosphates/thiophosphates | Functional group counts | Basic descriptors | 
| 2813 | nPR3 | number of phosphanes | Functional group counts | Basic descriptors | 
| 2814 | nP(=O)O2R | number of phosphonates (thio-) | Functional group counts | Basic descriptors | 
| 2815 | nP(=O)R3/nPR5 | number of phosphoranes (thio-) | Functional group counts | Basic descriptors | 
| 2816 | nCH2RX | number of CH2RX | Functional group counts | Basic descriptors | 
| 2817 | nCHR2X | number of CHR2X | Functional group counts | Basic descriptors | 
| 2818 | nCR3X | number of CR3X | Functional group counts | Basic descriptors | 
| 2819 | nR=CHX | number of R=CHX | Functional group counts | Basic descriptors | 
| 2820 | nR=CRX | number of R=CRX | Functional group counts | Basic descriptors | 
| 2821 | nR#CX | number of R#CX | Functional group counts | Basic descriptors | 
| 2822 | nCHRX2 | number of CHRX2 | Functional group counts | Basic descriptors | 
| 2823 | nCR2X2 | number of CR2X2 | Functional group counts | Basic descriptors | 
| 2824 | nR=CX2 | number of R=CX2 | Functional group counts | Basic descriptors | 
| 2825 | nCRX3 | number of CRX3 | Functional group counts | Basic descriptors | 
| 2826 | nArX | number of X on aromatic ring | Functional group counts | Basic descriptors | 
| 2827 | nCXr | number of X on ring C(sp3) | Functional group counts | Basic descriptors | 
| 2828 | nCXr= | number of X on ring C(sp2) | Functional group counts | Basic descriptors | 
| 2829 | nCconjX | number of X on exo-conjugated C | Functional group counts | Basic descriptors | 
| 2830 | nAziridines | number of Aziridines | Functional group counts | Basic descriptors | 
| 2831 | nOxiranes | number of Oxiranes | Functional group counts | Basic descriptors | 
| 2832 | nThiranes | number of Thiranes | Functional group counts | Basic descriptors | 
| 2833 | nAzetidines | number of Azetidines | Functional group counts | Basic descriptors | 
| 2834 | nOxetanes | number of Oxetanes | Functional group counts | Basic descriptors | 
| 2835 | nThioethanes | number of Thioethanes | Functional group counts | Basic descriptors | 
| 2836 | nBeta-Lactams | number of Beta-Lactams | Functional group counts | Basic descriptors | 
| 2837 | nPyrrolidines | number of Pyrrolidines | Functional group counts | Basic descriptors | 
| 2838 | nOxolanes | number of Oxolanes | Functional group counts | Basic descriptors | 
| 2839 | ntH-Thiophenes | number of tetrahydro-thiophenes | Functional group counts | Basic descriptors | 
| 2840 | nPyrroles | number of Pyrroles | Functional group counts | Basic descriptors | 
| 2841 | nPyrazoles | number of Pyrazoles | Functional group counts | Basic descriptors | 
| 2842 | nImidazoles | number of Imidazoles | Functional group counts | Basic descriptors | 
| 2843 | nFuranes | number of Furanes | Functional group counts | Basic descriptors | 
| 2844 | nThiophenes | number of Thiophenes | Functional group counts | Basic descriptors | 
| 2845 | nOxazoles | number of Oxazoles | Functional group counts | Basic descriptors | 
| 2846 | nIsoxazoles | number of Isoxazoles | Functional group counts | Basic descriptors | 
| 2847 | nThiazoles | number of Thiazoles | Functional group counts | Basic descriptors | 
| 2848 | nIsothiazoles | number of Isothiazoles | Functional group counts | Basic descriptors | 
| 2849 | nTriazoles | number of Triazoles | Functional group counts | Basic descriptors | 
| 2850 | nPyridines | number of Pyridines | Functional group counts | Basic descriptors | 
| 2851 | nPyridazines | number of Pyridazines | Functional group counts | Basic descriptors | 
| 2852 | nPyrimidines | number of Pyrimidines | Functional group counts | Basic descriptors | 
| 2853 | nPyrazines | number of Pyrazines | Functional group counts | Basic descriptors | 
| 2854 | n135-Triazines | number of 1-3-5-Triazines | Functional group counts | Basic descriptors | 
| 2855 | n124-Triazines | number of 1-2-4-Triazines | Functional group counts | Basic descriptors | 
| 2856 | nHDon | number of donor atoms for H-bonds (N and O) | Functional group counts | Basic descriptors | 
| 2857 | nHAcc | number of acceptor atoms for H-bonds (N,O,F) | Functional group counts | Basic descriptors | 
| 2858 | nHBonds | number of intramolecular H-bonds (with N,O,F) | Functional group counts | Basic descriptors | 
| 2859 | C-001 | CH3R / CH4 | Atom-centred fragments | Basic descriptors | 
| 2860 | C-002 | CH2R2 | Atom-centred fragments | Basic descriptors | 
| 2861 | C-003 | CHR3 | Atom-centred fragments | Basic descriptors | 
| 2862 | C-004 | CR4 | Atom-centred fragments | Basic descriptors | 
| 2863 | C-005 | CH3X | Atom-centred fragments | Basic descriptors | 
| 2864 | C-006 | CH2RX | Atom-centred fragments | Basic descriptors | 
| 2865 | C-007 | CH2X2 | Atom-centred fragments | Basic descriptors | 
| 2866 | C-008 | CHR2X | Atom-centred fragments | Basic descriptors | 
| 2867 | C-009 | CHRX2 | Atom-centred fragments | Basic descriptors | 
| 2868 | C-010 | CHX3 | Atom-centred fragments | Basic descriptors | 
| 2869 | C-011 | CR3X | Atom-centred fragments | Basic descriptors | 
| 2870 | C-012 | CR2X2 | Atom-centred fragments | Basic descriptors | 
| 2871 | C-013 | CRX3 | Atom-centred fragments | Basic descriptors | 
| 2872 | C-014 | CX4 | Atom-centred fragments | Basic descriptors | 
| 2873 | C-015 | =CH2 | Atom-centred fragments | Basic descriptors | 
| 2874 | C-016 | =CHR | Atom-centred fragments | Basic descriptors | 
| 2875 | C-017 | =CR2 | Atom-centred fragments | Basic descriptors | 
| 2876 | C-018 | =CHX | Atom-centred fragments | Basic descriptors | 
| 2877 | C-019 | =CRX | Atom-centred fragments | Basic descriptors | 
| 2878 | C-020 | =CX2 | Atom-centred fragments | Basic descriptors | 
| 2879 | C-021 | #CH | Atom-centred fragments | Basic descriptors | 
| 2880 | C-022 | #CR / R=C=R | Atom-centred fragments | Basic descriptors | 
| 2881 | C-023 | #CX | Atom-centred fragments | Basic descriptors | 
| 2882 | C-024 | R--CH--R | Atom-centred fragments | Basic descriptors | 
| 2883 | C-025 | R--CR--R | Atom-centred fragments | Basic descriptors | 
| 2884 | C-026 | R--CX--R | Atom-centred fragments | Basic descriptors | 
| 2885 | C-027 | R--CH--X | Atom-centred fragments | Basic descriptors | 
| 2886 | C-028 | R--CR--X | Atom-centred fragments | Basic descriptors | 
| 2887 | C-029 | R--CX--X | Atom-centred fragments | Basic descriptors | 
| 2888 | C-030 | X--CH--X | Atom-centred fragments | Basic descriptors | 
| 2889 | C-031 | X--CR--X | Atom-centred fragments | Basic descriptors | 
| 2890 | C-032 | X--CX--X | Atom-centred fragments | Basic descriptors | 
| 2891 | C-033 | R--CH..X | Atom-centred fragments | Basic descriptors | 
| 2892 | C-034 | R--CR..X | Atom-centred fragments | Basic descriptors | 
| 2893 | C-035 | R--CX..X | Atom-centred fragments | Basic descriptors | 
| 2894 | C-036 | Al-CH=X | Atom-centred fragments | Basic descriptors | 
| 2895 | C-037 | Ar-CH=X | Atom-centred fragments | Basic descriptors | 
| 2896 | C-038 | Al-C(=X)-Al | Atom-centred fragments | Basic descriptors | 
| 2897 | C-039 | Ar-C(=X)-R | Atom-centred fragments | Basic descriptors | 
| 2898 | C-040 | R-C(=X)-X / R-C#X / X=C=X | Atom-centred fragments | Basic descriptors | 
| 2899 | C-041 | X-C(=X)-X | Atom-centred fragments | Basic descriptors | 
| 2900 | C-042 | X--CH..X | Atom-centred fragments | Basic descriptors | 
| 2901 | C-043 | X--CR..X | Atom-centred fragments | Basic descriptors | 
| 2902 | C-044 | X--CX..X | Atom-centred fragments | Basic descriptors | 
| 2903 | H-046 | H attached to C0(sp3) no X attached to next C | Atom-centred fragments | Basic descriptors | 
| 2904 | H-047 | H attached to C1(sp3)/C0(sp2) | Atom-centred fragments | Basic descriptors | 
| 2905 | H-048 | H attached to C2(sp3)/C1(sp2)/C0(sp) | Atom-centred fragments | Basic descriptors | 
| 2906 | H-049 | H attached to C3(sp3)/C2(sp2)/C3(sp2)/C3(sp) | Atom-centred fragments | Basic descriptors | 
| 2907 | H-050 | H attached to heteroatom | Atom-centred fragments | Basic descriptors | 
| 2908 | H-051 | H attached to alpha-C | Atom-centred fragments | Basic descriptors | 
| 2909 | H-052 | H attached to C0(sp3) with 1X attached to next C | Atom-centred fragments | Basic descriptors | 
| 2910 | H-053 | H attached to C0(sp3) with 2X attached to next C | Atom-centred fragments | Basic descriptors | 
| 2911 | H-054 | H attached to C0(sp3) with 3X attached to next C | Atom-centred fragments | Basic descriptors | 
| 2912 | H-055 | H attached to C0(sp3) with 4X attached to next C | Atom-centred fragments | Basic descriptors | 
| 2913 | O-056 | alcohol | Atom-centred fragments | Basic descriptors | 
| 2914 | O-057 | phenol / enol / carboxyl OH | Atom-centred fragments | Basic descriptors | 
| 2915 | O-058 | #NAME? | Atom-centred fragments | Basic descriptors | 
| 2916 | O-059 | Al-O-Al | Atom-centred fragments | Basic descriptors | 
| 2917 | O-060 | Al-O-Ar / Ar-O-Ar / R..O..R / R-O-C=X | Atom-centred fragments | Basic descriptors | 
| 2918 | O-061 | O-- | Atom-centred fragments | Basic descriptors | 
| 2919 | O-062 | O- (negatively charged) | Atom-centred fragments | Basic descriptors | 
| 2920 | O-063 | R-O-O-R | Atom-centred fragments | Basic descriptors | 
| 2921 | Se-064 | Any-Se-Any | Atom-centred fragments | Basic descriptors | 
| 2922 | Se-065 | #NAME? | Atom-centred fragments | Basic descriptors | 
| 2923 | N-066 | Al-NH2 | Atom-centred fragments | Basic descriptors | 
| 2924 | N-067 | Al2-NH | Atom-centred fragments | Basic descriptors | 
| 2925 | N-068 | Al3-N | Atom-centred fragments | Basic descriptors | 
| 2926 | N-069 | Ar-NH2 / X-NH2 | Atom-centred fragments | Basic descriptors | 
| 2927 | N-070 | Ar-NH-Al | Atom-centred fragments | Basic descriptors | 
| 2928 | N-071 | Ar-NAl2 | Atom-centred fragments | Basic descriptors | 
| 2929 | N-072 | RCO-N< / >N-X=X | Atom-centred fragments | Basic descriptors | 
| 2930 | N-073 | Ar2NH / Ar3N / Ar2N-Al / R..N..R | Atom-centred fragments | Basic descriptors | 
| 2931 | N-074 | R#N / R=N- | Atom-centred fragments | Basic descriptors | 
| 2932 | N-075 | R--N--R / R--N--X | Atom-centred fragments | Basic descriptors | 
| 2933 | N-076 | Ar-NO2 / R--N(--R)--O / RO-NO | Atom-centred fragments | Basic descriptors | 
| 2934 | N-077 | Al-NO2 | Atom-centred fragments | Basic descriptors | 
| 2935 | N-078 | Ar-N=X / X-N=X | Atom-centred fragments | Basic descriptors | 
| 2936 | N-079 | N+ (positively charged) | Atom-centred fragments | Basic descriptors | 
| 2937 | F-081 | F attached to C1(sp3) | Atom-centred fragments | Basic descriptors | 
| 2938 | F-082 | F attached to C2(sp3) | Atom-centred fragments | Basic descriptors | 
| 2939 | F-083 | F attached to C3(sp3) | Atom-centred fragments | Basic descriptors | 
| 2940 | F-084 | F attached to C1(sp2) | Atom-centred fragments | Basic descriptors | 
| 2941 | F-085 | F attached to C2(sp2)-C4(sp2)/C1(sp)/C4(sp3)/X | Atom-centred fragments | Basic descriptors | 
| 2942 | Cl-086 | Cl attached to C1(sp3) | Atom-centred fragments | Basic descriptors | 
| 2943 | Cl-087 | Cl attached to C2(sp3) | Atom-centred fragments | Basic descriptors | 
| 2944 | Cl-088 | Cl attached to C3(sp3) | Atom-centred fragments | Basic descriptors | 
| 2945 | Cl-089 | Cl attached to C1(sp2) | Atom-centred fragments | Basic descriptors | 
| 2946 | Cl-090 | Cl attached to C2(sp2)-C4(sp2)/C1(sp)/C4(sp3)/X | Atom-centred fragments | Basic descriptors | 
| 2947 | Br-091 | Br attached to C1(sp3) | Atom-centred fragments | Basic descriptors | 
| 2948 | Br-092 | Br attached to C2(sp3) | Atom-centred fragments | Basic descriptors | 
| 2949 | Br-093 | Br attached to C3(sp3) | Atom-centred fragments | Basic descriptors | 
| 2950 | Br-094 | Br attached to C1(sp2) | Atom-centred fragments | Basic descriptors | 
| 2951 | Br-095 | Br attached to C2(sp2)-C4(sp2)/C1(sp)/C4(sp3)/X | Atom-centred fragments | Basic descriptors | 
| 2952 | I-096 | I attached to C1(sp3) | Atom-centred fragments | Basic descriptors | 
| 2953 | I-097 | I attached to C2(sp3) | Atom-centred fragments | Basic descriptors | 
| 2954 | I-098 | I attached to C3(sp3) | Atom-centred fragments | Basic descriptors | 
| 2955 | I-099 | I attached to C1(sp2) | Atom-centred fragments | Basic descriptors | 
| 2956 | I-100 | I attached to C2(sp2)-C4(sp2)/C1(sp)/C4(sp3)/X | Atom-centred fragments | Basic descriptors | 
| 2957 | F-101 | fluoride ion | Atom-centred fragments | Basic descriptors | 
| 2958 | Cl-102 | chloride ion | Atom-centred fragments | Basic descriptors | 
| 2959 | Br-103 | bromide ion | Atom-centred fragments | Basic descriptors | 
| 2960 | I-104 | iodide ion | Atom-centred fragments | Basic descriptors | 
| 2961 | S-106 | R-SH | Atom-centred fragments | Basic descriptors | 
| 2962 | S-107 | R2S / RS-SR | Atom-centred fragments | Basic descriptors | 
| 2963 | S-108 | R=S | Atom-centred fragments | Basic descriptors | 
| 2964 | S-109 | R-SO-R | Atom-centred fragments | Basic descriptors | 
| 2965 | S-110 | R-SO2-R | Atom-centred fragments | Basic descriptors | 
| 2966 | Si-111 | >Si< | Atom-centred fragments | Basic descriptors | 
| 2967 | B-112 | >B- as in boranes | Atom-centred fragments | Basic descriptors | 
| 2968 | P-115 | P ylids | Atom-centred fragments | Basic descriptors | 
| 2969 | P-116 | R3-P=X | Atom-centred fragments | Basic descriptors | 
| 2970 | P-117 | X3-P=X (phosphate) | Atom-centred fragments | Basic descriptors | 
| 2971 | P-118 | PX3 (phosphite) | Atom-centred fragments | Basic descriptors | 
| 2972 | P-119 | PR3 (phosphine) | Atom-centred fragments | Basic descriptors | 
| 2973 | P-120 | C-P(X)2=X (phosphonate) | Atom-centred fragments | Basic descriptors | 
| 2974 | SsCH3 | Sum of sCH3 E-states | Atom-type E-state indices | E-State sums | 
| 2975 | SdCH2 | Sum of dCH2 E-states | Atom-type E-state indices | E-State sums | 
| 2976 | SssCH2 | Sum of ssCH2 E-states | Atom-type E-state indices | E-State sums | 
| 2977 | StCH | Sum of tCH E-states | Atom-type E-state indices | E-State sums | 
| 2978 | SdsCH | Sum of dsCH E-states | Atom-type E-state indices | E-State sums | 
| 2979 | SaaCH | Sum of aaCH E-states | Atom-type E-state indices | E-State sums | 
| 2980 | SsssCH | Sum of sssCH E-states | Atom-type E-state indices | E-State sums | 
| 2981 | SddC | Sum of ddC E-states | Atom-type E-state indices | E-State sums | 
| 2982 | StsC | Sum of tsC E-states | Atom-type E-state indices | E-State sums | 
| 2983 | SdssC | Sum of dssC E-states | Atom-type E-state indices | E-State sums | 
| 2984 | SaasC | Sum of aasC E-states | Atom-type E-state indices | E-State sums | 
| 2985 | SaaaC | Sum of aaaC E-states | Atom-type E-state indices | E-State sums | 
| 2986 | SssssC | Sum of ssssC E-states | Atom-type E-state indices | E-State sums | 
| 2987 | SsNH2 | Sum of sNH2 E-states | Atom-type E-state indices | E-State sums | 
| 2988 | SssNH | Sum of ssNH E-states | Atom-type E-state indices | E-State sums | 
| 2989 | SdNH | Sum of dNH E-states | Atom-type E-state indices | E-State sums | 
| 2990 | SsssN | Sum of sssN E-states | Atom-type E-state indices | E-State sums | 
| 2991 | SdsN | Sum of dsN E-states | Atom-type E-state indices | E-State sums | 
| 2992 | SaaN | Sum of aaN E-states | Atom-type E-state indices | E-State sums | 
| 2993 | StN | Sum of tN E-states | Atom-type E-state indices | E-State sums | 
| 2994 | SsNH3+ | Sum of sNH3+ E-states | Atom-type E-state indices | E-State sums | 
| 2995 | SssNH2+ | Sum of ssNH2+ E-states | Atom-type E-state indices | E-State sums | 
| 2996 | SdNH2+ | Sum of dNH2+ E-states | Atom-type E-state indices | E-State sums | 
| 2997 | SsssNH+ | Sum of sssNH+ E-states | Atom-type E-state indices | E-State sums | 
| 2998 | SssssN+ | Sum of ssssN+ E-states | Atom-type E-state indices | E-State sums | 
| 2999 | SddsN | Sum of ddsN E-states | Atom-type E-state indices | E-State sums | 
| 3000 | SaadN | Sum of aadN E-states | Atom-type E-state indices | E-State sums | 
| 3001 | SaasN | Sum of aasN E-states | Atom-type E-state indices | E-State sums | 
| 3002 | SaaNH | Sum of aaNH E-states | Atom-type E-state indices | E-State sums | 
| 3003 | SsOH | Sum of sOH E-states | Atom-type E-state indices | E-State sums | 
| 3004 | SdO | Sum of dO E-states | Atom-type E-state indices | E-State sums | 
| 3005 | SssO | Sum of ssO E-states | Atom-type E-state indices | E-State sums | 
| 3006 | SaaO | Sum of aaO E-states | Atom-type E-state indices | E-State sums | 
| 3007 | SsPH2 | Sum of sPH2 E-states | Atom-type E-state indices | E-State sums | 
| 3008 | SssPH | Sum of ssPH E-states | Atom-type E-state indices | E-State sums | 
| 3009 | SsssP | Sum of sssP E-states | Atom-type E-state indices | E-State sums | 
| 3010 | SdsssP | Sum of dsssP E-states | Atom-type E-state indices | E-State sums | 
| 3011 | SddsP | Sum of ddsP E-states | Atom-type E-state indices | E-State sums | 
| 3012 | SsssssP | Sum of sssssP E-states | Atom-type E-state indices | E-State sums | 
| 3013 | SsSH | Sum of sSH E-states | Atom-type E-state indices | E-State sums | 
| 3014 | SdS | Sum of dS E-states | Atom-type E-state indices | E-State sums | 
| 3015 | SssS | Sum of ssS E-states | Atom-type E-state indices | E-State sums | 
| 3016 | SaaS | Sum of aaS E-states | Atom-type E-state indices | E-State sums | 
| 3017 | SdssS | Sum of dssS E-states | Atom-type E-state indices | E-State sums | 
| 3018 | SddssS | Sum of ddssS E-states | Atom-type E-state indices | E-State sums | 
| 3019 | SssssssS | Sum of ssssssS E-states | Atom-type E-state indices | E-State sums | 
| 3020 | SsF | Sum of sF E-states | Atom-type E-state indices | E-State sums | 
| 3021 | SsCl | Sum of sCl E-states | Atom-type E-state indices | E-State sums | 
| 3022 | SsBr | Sum of sBr E-states | Atom-type E-state indices | E-State sums | 
| 3023 | SsI | Sum of sI E-states | Atom-type E-state indices | E-State sums | 
| 3024 | SsLi | Sum of sLi E-states | Atom-type E-state indices | E-State sums | 
| 3025 | SssBe | Sum of ssBe E-states | Atom-type E-state indices | E-State sums | 
| 3026 | SssssBe- | Sum of ssssBe- E-states | Atom-type E-state indices | E-State sums | 
| 3027 | SsBH2 | Sum of sBH2 E-states | Atom-type E-state indices | E-State sums | 
| 3028 | SssBH | Sum of ssBH E-states | Atom-type E-state indices | E-State sums | 
| 3029 | SsssB | Sum of sssB E-states | Atom-type E-state indices | E-State sums | 
| 3030 | SssssB- | Sum of ssssB- E-states | Atom-type E-state indices | E-State sums | 
| 3031 | SsGeH3 | Sum of sGeH3 E-states | Atom-type E-state indices | E-State sums | 
| 3032 | SssGeH2 | Sum of ssGeH2 E-states | Atom-type E-state indices | E-State sums | 
| 3033 | SsssGeH | Sum of sssGeH E-states | Atom-type E-state indices | E-State sums | 
| 3034 | SssssGe | Sum of ssssGe E-states | Atom-type E-state indices | E-State sums | 
| 3035 | SsAsH2 | Sum of sAsH2 E-states | Atom-type E-state indices | E-State sums | 
| 3036 | SssAsH | Sum of ssAsH E-states | Atom-type E-state indices | E-State sums | 
| 3037 | SsssAs | Sum of sssAs E-states | Atom-type E-state indices | E-State sums | 
| 3038 | SsssssAs | Sum of sssssAs E-states | Atom-type E-state indices | E-State sums | 
| 3039 | SdsssAs | Sum of dsssAs E-states | Atom-type E-state indices | E-State sums | 
| 3040 | SddsAs | Sum of ddsAs E-states | Atom-type E-state indices | E-State sums | 
| 3041 | SsSeH | Sum of sSeH E-states | Atom-type E-state indices | E-State sums | 
| 3042 | SdSe | Sum of dSe E-states | Atom-type E-state indices | E-State sums | 
| 3043 | SssSe | Sum of ssSe E-states | Atom-type E-state indices | E-State sums | 
| 3044 | SaaSe | Sum of aaSe E-states | Atom-type E-state indices | E-State sums | 
| 3045 | SdssSe | Sum of dssSe E-states | Atom-type E-state indices | E-State sums | 
| 3046 | SssssssSe | Sum of ssssssSe E-states | Atom-type E-state indices | E-State sums | 
| 3047 | SddssSe | Sum of ddssSe E-states | Atom-type E-state indices | E-State sums | 
| 3048 | SsSnH3 | Sum of sSnH3 E-states | Atom-type E-state indices | E-State sums | 
| 3049 | SssSnH2 | Sum of ssSnH2 E-states | Atom-type E-state indices | E-State sums | 
| 3050 | SsssSnH | Sum of sssSnH E-states | Atom-type E-state indices | E-State sums | 
| 3051 | SssssSn | Sum of ssssSn E-states | Atom-type E-state indices | E-State sums | 
| 3052 | SsPbH3 | Sum of sPbH3 E-states | Atom-type E-state indices | E-State sums | 
| 3053 | SssPbH2 | Sum of ssPbH2 E-states | Atom-type E-state indices | E-State sums | 
| 3054 | SsssPbH | Sum of sssPbH E-states | Atom-type E-state indices | E-State sums | 
| 3055 | SssssPb | Sum of ssssPb E-states | Atom-type E-state indices | E-State sums | 
| 3056 | SsSiH3 | Sum of sSiH3 E-states | Atom-type E-state indices | E-State sums | 
| 3057 | SssSiH2 | Sum of ssSiH2 E-states | Atom-type E-state indices | E-State sums | 
| 3058 | SsssSiH | Sum of sssSiH E-states | Atom-type E-state indices | E-State sums | 
| 3059 | SssssSi | Sum of ssssSi E-states | Atom-type E-state indices | E-State sums | 
| 3060 | NsCH3 | Number of atoms of type sCH3 | Atom-type E-state indices | Atom-type counts | 
| 3061 | NdCH2 | Number of atoms of type dCH2 | Atom-type E-state indices | Atom-type counts | 
| 3062 | NssCH2 | Number of atoms of type ssCH2 | Atom-type E-state indices | Atom-type counts | 
| 3063 | NtCH | Number of atoms of type tCH | Atom-type E-state indices | Atom-type counts | 
| 3064 | NdsCH | Number of atoms of type dsCH | Atom-type E-state indices | Atom-type counts | 
| 3065 | NaaCH | Number of atoms of type aaCH | Atom-type E-state indices | Atom-type counts | 
| 3066 | NsssCH | Number of atoms of type sssCH | Atom-type E-state indices | Atom-type counts | 
| 3067 | NddC | Number of atoms of type ddC | Atom-type E-state indices | Atom-type counts | 
| 3068 | NtsC | Number of atoms of type tsC | Atom-type E-state indices | Atom-type counts | 
| 3069 | NdssC | Number of atoms of type dssC | Atom-type E-state indices | Atom-type counts | 
| 3070 | NaasC | Number of atoms of type aasC | Atom-type E-state indices | Atom-type counts | 
| 3071 | NaaaC | Number of atoms of type aaaC | Atom-type E-state indices | Atom-type counts | 
| 3072 | NssssC | Number of atoms of type ssssC | Atom-type E-state indices | Atom-type counts | 
| 3073 | NsNH2 | Number of atoms of type sNH2 | Atom-type E-state indices | Atom-type counts | 
| 3074 | NssNH | Number of atoms of type ssNH | Atom-type E-state indices | Atom-type counts | 
| 3075 | NdNH | Number of atoms of type dNH | Atom-type E-state indices | Atom-type counts | 
| 3076 | NsssN | Number of atoms of type sssN | Atom-type E-state indices | Atom-type counts | 
| 3077 | NdsN | Number of atoms of type dsN | Atom-type E-state indices | Atom-type counts | 
| 3078 | NaaN | Number of atoms of type aaN | Atom-type E-state indices | Atom-type counts | 
| 3079 | NtN | Number of atoms of type tN | Atom-type E-state indices | Atom-type counts | 
| 3080 | NsNH3+ | Number of atoms of type sNH3+ | Atom-type E-state indices | Atom-type counts | 
| 3081 | NssNH2+ | Number of atoms of type ssNH2+ | Atom-type E-state indices | Atom-type counts | 
| 3082 | NdNH2+ | Number of atoms of type dNH2+ | Atom-type E-state indices | Atom-type counts | 
| 3083 | NsssNH+ | Number of atoms of type sssNH+ | Atom-type E-state indices | Atom-type counts | 
| 3084 | NssssN+ | Number of atoms of type ssssN+ | Atom-type E-state indices | Atom-type counts | 
| 3085 | NddsN | Number of atoms of type ddsN | Atom-type E-state indices | Atom-type counts | 
| 3086 | NaadN | Number of atoms of type aadN | Atom-type E-state indices | Atom-type counts | 
| 3087 | NaasN | Number of atoms of type aasN | Atom-type E-state indices | Atom-type counts | 
| 3088 | NaaNH | Number of atoms of type aaNH | Atom-type E-state indices | Atom-type counts | 
| 3089 | NsOH | Number of atoms of type sOH | Atom-type E-state indices | Atom-type counts | 
| 3090 | NdO | Number of atoms of type dO | Atom-type E-state indices | Atom-type counts | 
| 3091 | NssO | Number of atoms of type ssO | Atom-type E-state indices | Atom-type counts | 
| 3092 | NaaO | Number of atoms of type aaO | Atom-type E-state indices | Atom-type counts | 
| 3093 | NsPH2 | Number of atoms of type sPH2 | Atom-type E-state indices | Atom-type counts | 
| 3094 | NssPH | Number of atoms of type ssPH | Atom-type E-state indices | Atom-type counts | 
| 3095 | NsssP | Number of atoms of type sssP | Atom-type E-state indices | Atom-type counts | 
| 3096 | NdsssP | Number of atoms of type dsssP | Atom-type E-state indices | Atom-type counts | 
| 3097 | NddsP | Number of atoms of type ddsP | Atom-type E-state indices | Atom-type counts | 
| 3098 | NsssssP | Number of atoms of type sssssP | Atom-type E-state indices | Atom-type counts | 
| 3099 | NsSH | Number of atoms of type sSH | Atom-type E-state indices | Atom-type counts | 
| 3100 | NdS | Number of atoms of type dS | Atom-type E-state indices | Atom-type counts | 
| 3101 | NssS | Number of atoms of type ssS | Atom-type E-state indices | Atom-type counts | 
| 3102 | NaaS | Number of atoms of type aaS | Atom-type E-state indices | Atom-type counts | 
| 3103 | NdssS | Number of atoms of type dssS | Atom-type E-state indices | Atom-type counts | 
| 3104 | NddssS | Number of atoms of type ddssS | Atom-type E-state indices | Atom-type counts | 
| 3105 | NssssssS | Number of atoms of type ssssssS | Atom-type E-state indices | Atom-type counts | 
| 3106 | NsF | Number of atoms of type sF | Atom-type E-state indices | Atom-type counts | 
| 3107 | NsCl | Number of atoms of type sCl | Atom-type E-state indices | Atom-type counts | 
| 3108 | NsBr | Number of atoms of type sBr | Atom-type E-state indices | Atom-type counts | 
| 3109 | NsI | Number of atoms of type sI | Atom-type E-state indices | Atom-type counts | 
| 3110 | NsLi | Number of atoms of type sLi | Atom-type E-state indices | Atom-type counts | 
| 3111 | NssBe | Number of atoms of type ssBe | Atom-type E-state indices | Atom-type counts | 
| 3112 | NssssBe- | Number of atoms of type ssssBe- | Atom-type E-state indices | Atom-type counts | 
| 3113 | NsBH2 | Number of atoms of type sBH2 | Atom-type E-state indices | Atom-type counts | 
| 3114 | NssBH | Number of atoms of type ssBH | Atom-type E-state indices | Atom-type counts | 
| 3115 | NsssB | Number of atoms of type sssB | Atom-type E-state indices | Atom-type counts | 
| 3116 | NssssB- | Number of atoms of type ssssB- | Atom-type E-state indices | Atom-type counts | 
| 3117 | NsGeH3 | Number of atoms of type sGeH3 | Atom-type E-state indices | Atom-type counts | 
| 3118 | NssGeH2 | Number of atoms of type ssGeH2 | Atom-type E-state indices | Atom-type counts | 
| 3119 | NsssGeH | Number of atoms of type sssGeH | Atom-type E-state indices | Atom-type counts | 
| 3120 | NssssGe | Number of atoms of type ssssGe | Atom-type E-state indices | Atom-type counts | 
| 3121 | NsAsH2 | Number of atoms of type sAsH2 | Atom-type E-state indices | Atom-type counts | 
| 3122 | NssAsH | Number of atoms of type ssAsH | Atom-type E-state indices | Atom-type counts | 
| 3123 | NsssAs | Number of atoms of type sssAs | Atom-type E-state indices | Atom-type counts | 
| 3124 | NsssssAs | Number of atoms of type sssssAs | Atom-type E-state indices | Atom-type counts | 
| 3125 | NdsssAs | Number of atoms of type dsssAs | Atom-type E-state indices | Atom-type counts | 
| 3126 | NddsAs | Number of atoms of type ddsAs | Atom-type E-state indices | Atom-type counts | 
| 3127 | NsSeH | Number of atoms of type sSeH | Atom-type E-state indices | Atom-type counts | 
| 3128 | NdSe | Number of atoms of type dSe | Atom-type E-state indices | Atom-type counts | 
| 3129 | NssSe | Number of atoms of type ssSe | Atom-type E-state indices | Atom-type counts | 
| 3130 | NaaSe | Number of atoms of type aaSe | Atom-type E-state indices | Atom-type counts | 
| 3131 | NdssSe | Number of atoms of type dssSe | Atom-type E-state indices | Atom-type counts | 
| 3132 | NssssssSe | Number of atoms of type ssssssSe | Atom-type E-state indices | Atom-type counts | 
| 3133 | NddssSe | Number of atoms of type ddssSe | Atom-type E-state indices | Atom-type counts | 
| 3134 | NsSnH3 | Number of atoms of type sSnH3 | Atom-type E-state indices | Atom-type counts | 
| 3135 | NssSnH2 | Number of atoms of type ssSnH2 | Atom-type E-state indices | Atom-type counts | 
| 3136 | NsssSnH | Number of atoms of type sssSnH | Atom-type E-state indices | Atom-type counts | 
| 3137 | NssssSn | Number of atoms of type ssssSn | Atom-type E-state indices | Atom-type counts | 
| 3138 | NsPbH3 | Number of atoms of type sPbH3 | Atom-type E-state indices | Atom-type counts | 
| 3139 | NssPbH2 | Number of atoms of type ssPbH2 | Atom-type E-state indices | Atom-type counts | 
| 3140 | NsssPbH | Number of atoms of type sssPbH | Atom-type E-state indices | Atom-type counts | 
| 3141 | NssssPb | Number of atoms of type ssssPb | Atom-type E-state indices | Atom-type counts | 
| 3142 | NsSiH3 | Number of atoms of type sSiH3 | Atom-type E-state indices | Atom-type counts | 
| 3143 | NssSiH2 | Number of atoms of type ssSiH2 | Atom-type E-state indices | Atom-type counts | 
| 3144 | NsssSiH | Number of atoms of type sssSiH | Atom-type E-state indices | Atom-type counts | 
| 3145 | NssssSi | Number of atoms of type ssssSi | Atom-type E-state indices | Atom-type counts | 
| 3146 | CATS2D_00_DD | CATS2D Donor-Donor at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3147 | CATS2D_01_DD | CATS2D Donor-Donor at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3148 | CATS2D_02_DD | CATS2D Donor-Donor at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3149 | CATS2D_03_DD | CATS2D Donor-Donor at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3150 | CATS2D_04_DD | CATS2D Donor-Donor at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3151 | CATS2D_05_DD | CATS2D Donor-Donor at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3152 | CATS2D_06_DD | CATS2D Donor-Donor at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3153 | CATS2D_07_DD | CATS2D Donor-Donor at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3154 | CATS2D_08_DD | CATS2D Donor-Donor at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3155 | CATS2D_09_DD | CATS2D Donor-Donor at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3156 | CATS2D_00_DA | CATS2D Donor-Acceptor at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3157 | CATS2D_01_DA | CATS2D Donor-Acceptor at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3158 | CATS2D_02_DA | CATS2D Donor-Acceptor at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3159 | CATS2D_03_DA | CATS2D Donor-Acceptor at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3160 | CATS2D_04_DA | CATS2D Donor-Acceptor at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3161 | CATS2D_05_DA | CATS2D Donor-Acceptor at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3162 | CATS2D_06_DA | CATS2D Donor-Acceptor at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3163 | CATS2D_07_DA | CATS2D Donor-Acceptor at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3164 | CATS2D_08_DA | CATS2D Donor-Acceptor at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3165 | CATS2D_09_DA | CATS2D Donor-Acceptor at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3166 | CATS2D_00_DP | CATS2D Donor-Positive at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3167 | CATS2D_01_DP | CATS2D Donor-Positive at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3168 | CATS2D_02_DP | CATS2D Donor-Positive at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3169 | CATS2D_03_DP | CATS2D Donor-Positive at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3170 | CATS2D_04_DP | CATS2D Donor-Positive at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3171 | CATS2D_05_DP | CATS2D Donor-Positive at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3172 | CATS2D_06_DP | CATS2D Donor-Positive at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3173 | CATS2D_07_DP | CATS2D Donor-Positive at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3174 | CATS2D_08_DP | CATS2D Donor-Positive at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3175 | CATS2D_09_DP | CATS2D Donor-Positive at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3176 | CATS2D_00_DN | CATS2D Donor-Negative at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3177 | CATS2D_01_DN | CATS2D Donor-Negative at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3178 | CATS2D_02_DN | CATS2D Donor-Negative at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3179 | CATS2D_03_DN | CATS2D Donor-Negative at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3180 | CATS2D_04_DN | CATS2D Donor-Negative at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3181 | CATS2D_05_DN | CATS2D Donor-Negative at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3182 | CATS2D_06_DN | CATS2D Donor-Negative at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3183 | CATS2D_07_DN | CATS2D Donor-Negative at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3184 | CATS2D_08_DN | CATS2D Donor-Negative at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3185 | CATS2D_09_DN | CATS2D Donor-Negative at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3186 | CATS2D_00_DL | CATS2D Donor-Lipophilic at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3187 | CATS2D_01_DL | CATS2D Donor-Lipophilic at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3188 | CATS2D_02_DL | CATS2D Donor-Lipophilic at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3189 | CATS2D_03_DL | CATS2D Donor-Lipophilic at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3190 | CATS2D_04_DL | CATS2D Donor-Lipophilic at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3191 | CATS2D_05_DL | CATS2D Donor-Lipophilic at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3192 | CATS2D_06_DL | CATS2D Donor-Lipophilic at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3193 | CATS2D_07_DL | CATS2D Donor-Lipophilic at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3194 | CATS2D_08_DL | CATS2D Donor-Lipophilic at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3195 | CATS2D_09_DL | CATS2D Donor-Lipophilic at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3196 | CATS2D_00_AA | CATS2D Acceptor-Acceptor at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3197 | CATS2D_01_AA | CATS2D Acceptor-Acceptor at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3198 | CATS2D_02_AA | CATS2D Acceptor-Acceptor at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3199 | CATS2D_03_AA | CATS2D Acceptor-Acceptor at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3200 | CATS2D_04_AA | CATS2D Acceptor-Acceptor at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3201 | CATS2D_05_AA | CATS2D Acceptor-Acceptor at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3202 | CATS2D_06_AA | CATS2D Acceptor-Acceptor at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3203 | CATS2D_07_AA | CATS2D Acceptor-Acceptor at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3204 | CATS2D_08_AA | CATS2D Acceptor-Acceptor at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3205 | CATS2D_09_AA | CATS2D Acceptor-Acceptor at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3206 | CATS2D_00_AP | CATS2D Acceptor-Positive at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3207 | CATS2D_01_AP | CATS2D Acceptor-Positive at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3208 | CATS2D_02_AP | CATS2D Acceptor-Positive at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3209 | CATS2D_03_AP | CATS2D Acceptor-Positive at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3210 | CATS2D_04_AP | CATS2D Acceptor-Positive at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3211 | CATS2D_05_AP | CATS2D Acceptor-Positive at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3212 | CATS2D_06_AP | CATS2D Acceptor-Positive at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3213 | CATS2D_07_AP | CATS2D Acceptor-Positive at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3214 | CATS2D_08_AP | CATS2D Acceptor-Positive at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3215 | CATS2D_09_AP | CATS2D Acceptor-Positive at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3216 | CATS2D_00_AN | CATS2D Acceptor-Negative at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3217 | CATS2D_01_AN | CATS2D Acceptor-Negative at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3218 | CATS2D_02_AN | CATS2D Acceptor-Negative at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3219 | CATS2D_03_AN | CATS2D Acceptor-Negative at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3220 | CATS2D_04_AN | CATS2D Acceptor-Negative at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3221 | CATS2D_05_AN | CATS2D Acceptor-Negative at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3222 | CATS2D_06_AN | CATS2D Acceptor-Negative at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3223 | CATS2D_07_AN | CATS2D Acceptor-Negative at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3224 | CATS2D_08_AN | CATS2D Acceptor-Negative at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3225 | CATS2D_09_AN | CATS2D Acceptor-Negative at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3226 | CATS2D_00_AL | CATS2D Acceptor-Lipophilic at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3227 | CATS2D_01_AL | CATS2D Acceptor-Lipophilic at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3228 | CATS2D_02_AL | CATS2D Acceptor-Lipophilic at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3229 | CATS2D_03_AL | CATS2D Acceptor-Lipophilic at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3230 | CATS2D_04_AL | CATS2D Acceptor-Lipophilic at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3231 | CATS2D_05_AL | CATS2D Acceptor-Lipophilic at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3232 | CATS2D_06_AL | CATS2D Acceptor-Lipophilic at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3233 | CATS2D_07_AL | CATS2D Acceptor-Lipophilic at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3234 | CATS2D_08_AL | CATS2D Acceptor-Lipophilic at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3235 | CATS2D_09_AL | CATS2D Acceptor-Lipophilic at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3236 | CATS2D_00_PP | CATS2D Positive-Positive at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3237 | CATS2D_01_PP | CATS2D Positive-Positive at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3238 | CATS2D_02_PP | CATS2D Positive-Positive at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3239 | CATS2D_03_PP | CATS2D Positive-Positive at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3240 | CATS2D_04_PP | CATS2D Positive-Positive at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3241 | CATS2D_05_PP | CATS2D Positive-Positive at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3242 | CATS2D_06_PP | CATS2D Positive-Positive at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3243 | CATS2D_07_PP | CATS2D Positive-Positive at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3244 | CATS2D_08_PP | CATS2D Positive-Positive at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3245 | CATS2D_09_PP | CATS2D Positive-Positive at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3246 | CATS2D_00_PN | CATS2D Positive-Negative at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3247 | CATS2D_01_PN | CATS2D Positive-Negative at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3248 | CATS2D_02_PN | CATS2D Positive-Negative at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3249 | CATS2D_03_PN | CATS2D Positive-Negative at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3250 | CATS2D_04_PN | CATS2D Positive-Negative at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3251 | CATS2D_05_PN | CATS2D Positive-Negative at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3252 | CATS2D_06_PN | CATS2D Positive-Negative at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3253 | CATS2D_07_PN | CATS2D Positive-Negative at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3254 | CATS2D_08_PN | CATS2D Positive-Negative at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3255 | CATS2D_09_PN | CATS2D Positive-Negative at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3256 | CATS2D_00_PL | CATS2D Positive-Lipophilic at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3257 | CATS2D_01_PL | CATS2D Positive-Lipophilic at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3258 | CATS2D_02_PL | CATS2D Positive-Lipophilic at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3259 | CATS2D_03_PL | CATS2D Positive-Lipophilic at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3260 | CATS2D_04_PL | CATS2D Positive-Lipophilic at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3261 | CATS2D_05_PL | CATS2D Positive-Lipophilic at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3262 | CATS2D_06_PL | CATS2D Positive-Lipophilic at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3263 | CATS2D_07_PL | CATS2D Positive-Lipophilic at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3264 | CATS2D_08_PL | CATS2D Positive-Lipophilic at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3265 | CATS2D_09_PL | CATS2D Positive-Lipophilic at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3266 | CATS2D_00_NN | CATS2D Negative-Negative at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3267 | CATS2D_01_NN | CATS2D Negative-Negative at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3268 | CATS2D_02_NN | CATS2D Negative-Negative at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3269 | CATS2D_03_NN | CATS2D Negative-Negative at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3270 | CATS2D_04_NN | CATS2D Negative-Negative at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3271 | CATS2D_05_NN | CATS2D Negative-Negative at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3272 | CATS2D_06_NN | CATS2D Negative-Negative at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3273 | CATS2D_07_NN | CATS2D Negative-Negative at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3274 | CATS2D_08_NN | CATS2D Negative-Negative at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3275 | CATS2D_09_NN | CATS2D Negative-Negative at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3276 | CATS2D_00_NL | CATS2D Negative-Lipophilic at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3277 | CATS2D_01_NL | CATS2D Negative-Lipophilic at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3278 | CATS2D_02_NL | CATS2D Negative-Lipophilic at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3279 | CATS2D_03_NL | CATS2D Negative-Lipophilic at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3280 | CATS2D_04_NL | CATS2D Negative-Lipophilic at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3281 | CATS2D_05_NL | CATS2D Negative-Lipophilic at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3282 | CATS2D_06_NL | CATS2D Negative-Lipophilic at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3283 | CATS2D_07_NL | CATS2D Negative-Lipophilic at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3284 | CATS2D_08_NL | CATS2D Negative-Lipophilic at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3285 | CATS2D_09_NL | CATS2D Negative-Lipophilic at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3286 | CATS2D_00_LL | CATS2D Lipophilic-Lipophilic at lag 00 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3287 | CATS2D_01_LL | CATS2D Lipophilic-Lipophilic at lag 01 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3288 | CATS2D_02_LL | CATS2D Lipophilic-Lipophilic at lag 02 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3289 | CATS2D_03_LL | CATS2D Lipophilic-Lipophilic at lag 03 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3290 | CATS2D_04_LL | CATS2D Lipophilic-Lipophilic at lag 04 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3291 | CATS2D_05_LL | CATS2D Lipophilic-Lipophilic at lag 05 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3292 | CATS2D_06_LL | CATS2D Lipophilic-Lipophilic at lag 06 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3293 | CATS2D_07_LL | CATS2D Lipophilic-Lipophilic at lag 07 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3294 | CATS2D_08_LL | CATS2D Lipophilic-Lipophilic at lag 08 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3295 | CATS2D_09_LL | CATS2D Lipophilic-Lipophilic at lag 09 | Pharmacophore descriptors | CATS 2D descriptors | 
| 3296 | SHED_DD | SHED Donor-Donor | Pharmacophore descriptors | SHED descriptors | 
| 3297 | SHED_DA | SHED Donor-Acceptor | Pharmacophore descriptors | SHED descriptors | 
| 3298 | SHED_DP | SHED Donor-Positive | Pharmacophore descriptors | SHED descriptors | 
| 3299 | SHED_DN | SHED Donor-Negative | Pharmacophore descriptors | SHED descriptors | 
| 3300 | SHED_DL | SHED Donor-Lipophilic | Pharmacophore descriptors | SHED descriptors | 
| 3301 | SHED_AA | SHED Acceptor-Acceptor | Pharmacophore descriptors | SHED descriptors | 
| 3302 | SHED_AP | SHED Acceptor-Positive | Pharmacophore descriptors | SHED descriptors | 
| 3303 | SHED_AN | SHED Acceptor-Negative | Pharmacophore descriptors | SHED descriptors | 
| 3304 | SHED_AL | SHED Acceptor-Lipophilic | Pharmacophore descriptors | SHED descriptors | 
| 3305 | SHED_PP | SHED Positive-Positive | Pharmacophore descriptors | SHED descriptors | 
| 3306 | SHED_PN | SHED Positive-Negative | Pharmacophore descriptors | SHED descriptors | 
| 3307 | SHED_PL | SHED Positive-Lipophilic | Pharmacophore descriptors | SHED descriptors | 
| 3308 | SHED_NN | SHED Negative-Negative | Pharmacophore descriptors | SHED descriptors | 
| 3309 | SHED_NL | SHED Negative-Lipophilic | Pharmacophore descriptors | SHED descriptors | 
| 3310 | SHED_LL | SHED Lipophilic-Lipophilic | Pharmacophore descriptors | SHED descriptors | 
| 3311 | T(N..N) | sum of topological distances between N..N | 2D Atom Pairs | Weighted topological atom pairs | 
| 3312 | T(N..O) | sum of topological distances between N..O | 2D Atom Pairs | Weighted topological atom pairs | 
| 3313 | T(N..S) | sum of topological distances between N..S | 2D Atom Pairs | Weighted topological atom pairs | 
| 3314 | T(N..P) | sum of topological distances between N..P | 2D Atom Pairs | Weighted topological atom pairs | 
| 3315 | T(N..F) | sum of topological distances between N..F | 2D Atom Pairs | Weighted topological atom pairs | 
| 3316 | T(N..Cl) | sum of topological distances between N..Cl | 2D Atom Pairs | Weighted topological atom pairs | 
| 3317 | T(N..Br) | sum of topological distances between N..Br | 2D Atom Pairs | Weighted topological atom pairs | 
| 3318 | T(N..I) | sum of topological distances between N..I | 2D Atom Pairs | Weighted topological atom pairs | 
| 3319 | T(O..O) | sum of topological distances between O..O | 2D Atom Pairs | Weighted topological atom pairs | 
| 3320 | T(O..S) | sum of topological distances between O..S | 2D Atom Pairs | Weighted topological atom pairs | 
| 3321 | T(O..P) | sum of topological distances between O..P | 2D Atom Pairs | Weighted topological atom pairs | 
| 3322 | T(O..F) | sum of topological distances between O..F | 2D Atom Pairs | Weighted topological atom pairs | 
| 3323 | T(O..Cl) | sum of topological distances between O..Cl | 2D Atom Pairs | Weighted topological atom pairs | 
| 3324 | T(O..Br) | sum of topological distances between O..Br | 2D Atom Pairs | Weighted topological atom pairs | 
| 3325 | T(O..I) | sum of topological distances between O..I | 2D Atom Pairs | Weighted topological atom pairs | 
| 3326 | T(S..S) | sum of topological distances between S..S | 2D Atom Pairs | Weighted topological atom pairs | 
| 3327 | T(S..P) | sum of topological distances between S..P | 2D Atom Pairs | Weighted topological atom pairs | 
| 3328 | T(S..F) | sum of topological distances between S..F | 2D Atom Pairs | Weighted topological atom pairs | 
| 3329 | T(S..Cl) | sum of topological distances between S..Cl | 2D Atom Pairs | Weighted topological atom pairs | 
| 3330 | T(S..Br) | sum of topological distances between S..Br | 2D Atom Pairs | Weighted topological atom pairs | 
| 3331 | T(S..I) | sum of topological distances between S..I | 2D Atom Pairs | Weighted topological atom pairs | 
| 3332 | T(P..P) | sum of topological distances between P..P | 2D Atom Pairs | Weighted topological atom pairs | 
| 3333 | T(P..F) | sum of topological distances between P..F | 2D Atom Pairs | Weighted topological atom pairs | 
| 3334 | T(P..Cl) | sum of topological distances between P..Cl | 2D Atom Pairs | Weighted topological atom pairs | 
| 3335 | T(P..Br) | sum of topological distances between P..Br | 2D Atom Pairs | Weighted topological atom pairs | 
| 3336 | T(P..I) | sum of topological distances between P..I | 2D Atom Pairs | Weighted topological atom pairs | 
| 3337 | T(F..F) | sum of topological distances between F..F | 2D Atom Pairs | Weighted topological atom pairs | 
| 3338 | T(F..Cl) | sum of topological distances between F..Cl | 2D Atom Pairs | Weighted topological atom pairs | 
| 3339 | T(F..Br) | sum of topological distances between F..Br | 2D Atom Pairs | Weighted topological atom pairs | 
| 3340 | T(F..I) | sum of topological distances between F..I | 2D Atom Pairs | Weighted topological atom pairs | 
| 3341 | T(Cl..Cl) | sum of topological distances between Cl..Cl | 2D Atom Pairs | Weighted topological atom pairs | 
| 3342 | T(Cl..Br) | sum of topological distances between Cl..Br | 2D Atom Pairs | Weighted topological atom pairs | 
| 3343 | T(Cl..I) | sum of topological distances between Cl..I | 2D Atom Pairs | Weighted topological atom pairs | 
| 3344 | T(Br..Br) | sum of topological distances between Br..Br | 2D Atom Pairs | Weighted topological atom pairs | 
| 3345 | T(Br..I) | sum of topological distances between Br..I | 2D Atom Pairs | Weighted topological atom pairs | 
| 3346 | T(I..I) | sum of topological distances between I..I | 2D Atom Pairs | Weighted topological atom pairs | 
| 3347 | B01[C-C] | Presence/absence of C - C at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3348 | B01[C-N] | Presence/absence of C - N at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3349 | B01[C-O] | Presence/absence of C - O at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3350 | B01[C-S] | Presence/absence of C - S at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3351 | B01[C-P] | Presence/absence of C - P at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3352 | B01[C-F] | Presence/absence of C - F at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3353 | B01[C-Cl] | Presence/absence of C - Cl at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3354 | B01[C-Br] | Presence/absence of C - Br at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3355 | B01[C-I] | Presence/absence of C - I at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3356 | B01[C-B] | Presence/absence of C - B at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3357 | B01[C-Si] | Presence/absence of C - Si at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3358 | B01[C-X] | Presence/absence of C - X at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3359 | B01[N-N] | Presence/absence of N - N at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3360 | B01[N-O] | Presence/absence of N - O at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3361 | B01[N-S] | Presence/absence of N - S at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3362 | B01[N-P] | Presence/absence of N - P at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3363 | B01[N-F] | Presence/absence of N - F at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3364 | B01[N-Cl] | Presence/absence of N - Cl at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3365 | B01[N-Br] | Presence/absence of N - Br at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3366 | B01[N-I] | Presence/absence of N - I at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3367 | B01[N-B] | Presence/absence of N - B at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3368 | B01[N-Si] | Presence/absence of N - Si at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3369 | B01[N-X] | Presence/absence of N - X at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3370 | B01[O-O] | Presence/absence of O - O at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3371 | B01[O-S] | Presence/absence of O - S at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3372 | B01[O-P] | Presence/absence of O - P at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3373 | B01[O-F] | Presence/absence of O - F at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3374 | B01[O-Cl] | Presence/absence of O - Cl at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3375 | B01[O-Br] | Presence/absence of O - Br at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3376 | B01[O-I] | Presence/absence of O - I at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3377 | B01[O-B] | Presence/absence of O - B at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3378 | B01[O-Si] | Presence/absence of O - Si at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3379 | B01[O-X] | Presence/absence of O - X at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3380 | B01[S-S] | Presence/absence of S - S at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3381 | B01[S-P] | Presence/absence of S - P at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3382 | B01[S-F] | Presence/absence of S - F at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3383 | B01[S-Cl] | Presence/absence of S - Cl at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3384 | B01[S-Br] | Presence/absence of S - Br at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3385 | B01[S-I] | Presence/absence of S - I at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3386 | B01[S-B] | Presence/absence of S - B at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3387 | B01[S-Si] | Presence/absence of S - Si at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3388 | B01[S-X] | Presence/absence of S - X at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3389 | B01[P-P] | Presence/absence of P - P at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3390 | B01[P-F] | Presence/absence of P - F at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3391 | B01[P-Cl] | Presence/absence of P - Cl at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3392 | B01[P-Br] | Presence/absence of P - Br at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3393 | B01[P-I] | Presence/absence of P - I at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3394 | B01[P-B] | Presence/absence of P - B at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3395 | B01[P-Si] | Presence/absence of P - Si at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3396 | B01[P-X] | Presence/absence of P - X at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3397 | B01[F-F] | Presence/absence of F - F at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3398 | B01[F-Cl] | Presence/absence of F - Cl at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3399 | B01[F-Br] | Presence/absence of F - Br at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3400 | B01[F-I] | Presence/absence of F - I at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3401 | B01[F-B] | Presence/absence of F - B at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3402 | B01[F-Si] | Presence/absence of F - Si at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3403 | B01[F-X] | Presence/absence of F - X at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3404 | B01[Cl-Cl] | Presence/absence of Cl - Cl at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3405 | B01[Cl-Br] | Presence/absence of Cl - Br at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3406 | B01[Cl-I] | Presence/absence of Cl - I at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3407 | B01[Cl-B] | Presence/absence of Cl - B at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3408 | B01[Cl-Si] | Presence/absence of Cl - Si at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3409 | B01[Cl-X] | Presence/absence of Cl - X at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3410 | B01[Br-Br] | Presence/absence of Br - Br at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3411 | B01[Br-I] | Presence/absence of Br - I at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3412 | B01[Br-B] | Presence/absence of Br - B at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3413 | B01[Br-Si] | Presence/absence of Br - Si at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3414 | B01[Br-X] | Presence/absence of Br - X at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3415 | B01[I-I] | Presence/absence of I - I at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3416 | B01[I-B] | Presence/absence of I - B at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3417 | B01[I-Si] | Presence/absence of I - Si at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3418 | B01[I-X] | Presence/absence of I - X at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3419 | B01[B-B] | Presence/absence of B - B at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3420 | B01[B-Si] | Presence/absence of B - Si at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3421 | B01[B-X] | Presence/absence of B - X at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3422 | B01[Si-Si] | Presence/absence of Si - Si at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3423 | B01[Si-X] | Presence/absence of Si - X at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3424 | B01[X-X] | Presence/absence of X - X at topological distance 1 | 2D Atom Pairs | Binary Atom Pairs of order 1 | 
| 3425 | B02[C-C] | Presence/absence of C - C at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3426 | B02[C-N] | Presence/absence of C - N at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3427 | B02[C-O] | Presence/absence of C - O at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3428 | B02[C-S] | Presence/absence of C - S at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3429 | B02[C-P] | Presence/absence of C - P at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3430 | B02[C-F] | Presence/absence of C - F at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3431 | B02[C-Cl] | Presence/absence of C - Cl at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3432 | B02[C-Br] | Presence/absence of C - Br at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3433 | B02[C-I] | Presence/absence of C - I at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3434 | B02[C-B] | Presence/absence of C - B at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3435 | B02[C-Si] | Presence/absence of C - Si at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3436 | B02[C-X] | Presence/absence of C - X at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3437 | B02[N-N] | Presence/absence of N - N at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3438 | B02[N-O] | Presence/absence of N - O at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3439 | B02[N-S] | Presence/absence of N - S at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3440 | B02[N-P] | Presence/absence of N - P at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3441 | B02[N-F] | Presence/absence of N - F at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3442 | B02[N-Cl] | Presence/absence of N - Cl at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3443 | B02[N-Br] | Presence/absence of N - Br at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3444 | B02[N-I] | Presence/absence of N - I at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3445 | B02[N-B] | Presence/absence of N - B at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3446 | B02[N-Si] | Presence/absence of N - Si at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3447 | B02[N-X] | Presence/absence of N - X at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3448 | B02[O-O] | Presence/absence of O - O at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3449 | B02[O-S] | Presence/absence of O - S at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3450 | B02[O-P] | Presence/absence of O - P at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3451 | B02[O-F] | Presence/absence of O - F at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3452 | B02[O-Cl] | Presence/absence of O - Cl at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3453 | B02[O-Br] | Presence/absence of O - Br at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3454 | B02[O-I] | Presence/absence of O - I at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3455 | B02[O-B] | Presence/absence of O - B at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3456 | B02[O-Si] | Presence/absence of O - Si at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3457 | B02[O-X] | Presence/absence of O - X at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3458 | B02[S-S] | Presence/absence of S - S at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3459 | B02[S-P] | Presence/absence of S - P at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3460 | B02[S-F] | Presence/absence of S - F at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3461 | B02[S-Cl] | Presence/absence of S - Cl at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3462 | B02[S-Br] | Presence/absence of S - Br at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3463 | B02[S-I] | Presence/absence of S - I at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3464 | B02[S-B] | Presence/absence of S - B at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3465 | B02[S-Si] | Presence/absence of S - Si at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3466 | B02[S-X] | Presence/absence of S - X at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3467 | B02[P-P] | Presence/absence of P - P at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3468 | B02[P-F] | Presence/absence of P - F at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3469 | B02[P-Cl] | Presence/absence of P - Cl at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3470 | B02[P-Br] | Presence/absence of P - Br at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3471 | B02[P-I] | Presence/absence of P - I at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3472 | B02[P-B] | Presence/absence of P - B at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3473 | B02[P-Si] | Presence/absence of P - Si at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3474 | B02[P-X] | Presence/absence of P - X at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3475 | B02[F-F] | Presence/absence of F - F at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3476 | B02[F-Cl] | Presence/absence of F - Cl at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3477 | B02[F-Br] | Presence/absence of F - Br at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3478 | B02[F-I] | Presence/absence of F - I at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3479 | B02[F-B] | Presence/absence of F - B at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3480 | B02[F-Si] | Presence/absence of F - Si at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3481 | B02[F-X] | Presence/absence of F - X at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3482 | B02[Cl-Cl] | Presence/absence of Cl - Cl at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3483 | B02[Cl-Br] | Presence/absence of Cl - Br at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3484 | B02[Cl-I] | Presence/absence of Cl - I at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3485 | B02[Cl-B] | Presence/absence of Cl - B at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3486 | B02[Cl-Si] | Presence/absence of Cl - Si at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3487 | B02[Cl-X] | Presence/absence of Cl - X at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3488 | B02[Br-Br] | Presence/absence of Br - Br at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3489 | B02[Br-I] | Presence/absence of Br - I at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3490 | B02[Br-B] | Presence/absence of Br - B at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3491 | B02[Br-Si] | Presence/absence of Br - Si at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3492 | B02[Br-X] | Presence/absence of Br - X at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3493 | B02[I-I] | Presence/absence of I - I at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3494 | B02[I-B] | Presence/absence of I - B at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3495 | B02[I-Si] | Presence/absence of I - Si at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3496 | B02[I-X] | Presence/absence of I - X at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3497 | B02[B-B] | Presence/absence of B - B at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3498 | B02[B-Si] | Presence/absence of B - Si at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3499 | B02[B-X] | Presence/absence of B - X at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3500 | B02[Si-Si] | Presence/absence of Si - Si at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3501 | B02[Si-X] | Presence/absence of Si - X at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3502 | B02[X-X] | Presence/absence of X - X at topological distance 2 | 2D Atom Pairs | Binary Atom Pairs of order 2 | 
| 3503 | B03[C-C] | Presence/absence of C - C at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3504 | B03[C-N] | Presence/absence of C - N at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3505 | B03[C-O] | Presence/absence of C - O at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3506 | B03[C-S] | Presence/absence of C - S at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3507 | B03[C-P] | Presence/absence of C - P at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3508 | B03[C-F] | Presence/absence of C - F at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3509 | B03[C-Cl] | Presence/absence of C - Cl at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3510 | B03[C-Br] | Presence/absence of C - Br at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3511 | B03[C-I] | Presence/absence of C - I at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3512 | B03[C-B] | Presence/absence of C - B at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3513 | B03[C-Si] | Presence/absence of C - Si at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3514 | B03[C-X] | Presence/absence of C - X at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3515 | B03[N-N] | Presence/absence of N - N at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3516 | B03[N-O] | Presence/absence of N - O at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3517 | B03[N-S] | Presence/absence of N - S at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3518 | B03[N-P] | Presence/absence of N - P at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3519 | B03[N-F] | Presence/absence of N - F at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3520 | B03[N-Cl] | Presence/absence of N - Cl at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3521 | B03[N-Br] | Presence/absence of N - Br at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3522 | B03[N-I] | Presence/absence of N - I at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3523 | B03[N-B] | Presence/absence of N - B at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3524 | B03[N-Si] | Presence/absence of N - Si at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3525 | B03[N-X] | Presence/absence of N - X at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3526 | B03[O-O] | Presence/absence of O - O at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3527 | B03[O-S] | Presence/absence of O - S at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3528 | B03[O-P] | Presence/absence of O - P at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3529 | B03[O-F] | Presence/absence of O - F at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3530 | B03[O-Cl] | Presence/absence of O - Cl at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3531 | B03[O-Br] | Presence/absence of O - Br at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3532 | B03[O-I] | Presence/absence of O - I at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3533 | B03[O-B] | Presence/absence of O - B at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3534 | B03[O-Si] | Presence/absence of O - Si at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3535 | B03[O-X] | Presence/absence of O - X at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3536 | B03[S-S] | Presence/absence of S - S at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3537 | B03[S-P] | Presence/absence of S - P at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3538 | B03[S-F] | Presence/absence of S - F at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3539 | B03[S-Cl] | Presence/absence of S - Cl at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3540 | B03[S-Br] | Presence/absence of S - Br at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3541 | B03[S-I] | Presence/absence of S - I at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3542 | B03[S-B] | Presence/absence of S - B at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3543 | B03[S-Si] | Presence/absence of S - Si at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3544 | B03[S-X] | Presence/absence of S - X at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3545 | B03[P-P] | Presence/absence of P - P at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3546 | B03[P-F] | Presence/absence of P - F at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3547 | B03[P-Cl] | Presence/absence of P - Cl at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3548 | B03[P-Br] | Presence/absence of P - Br at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3549 | B03[P-I] | Presence/absence of P - I at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3550 | B03[P-B] | Presence/absence of P - B at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3551 | B03[P-Si] | Presence/absence of P - Si at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3552 | B03[P-X] | Presence/absence of P - X at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3553 | B03[F-F] | Presence/absence of F - F at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3554 | B03[F-Cl] | Presence/absence of F - Cl at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3555 | B03[F-Br] | Presence/absence of F - Br at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3556 | B03[F-I] | Presence/absence of F - I at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3557 | B03[F-B] | Presence/absence of F - B at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3558 | B03[F-Si] | Presence/absence of F - Si at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3559 | B03[F-X] | Presence/absence of F - X at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3560 | B03[Cl-Cl] | Presence/absence of Cl - Cl at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3561 | B03[Cl-Br] | Presence/absence of Cl - Br at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3562 | B03[Cl-I] | Presence/absence of Cl - I at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3563 | B03[Cl-B] | Presence/absence of Cl - B at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3564 | B03[Cl-Si] | Presence/absence of Cl - Si at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3565 | B03[Cl-X] | Presence/absence of Cl - X at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3566 | B03[Br-Br] | Presence/absence of Br - Br at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3567 | B03[Br-I] | Presence/absence of Br - I at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3568 | B03[Br-B] | Presence/absence of Br - B at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3569 | B03[Br-Si] | Presence/absence of Br - Si at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3570 | B03[Br-X] | Presence/absence of Br - X at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3571 | B03[I-I] | Presence/absence of I - I at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3572 | B03[I-B] | Presence/absence of I - B at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3573 | B03[I-Si] | Presence/absence of I - Si at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3574 | B03[I-X] | Presence/absence of I - X at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3575 | B03[B-B] | Presence/absence of B - B at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3576 | B03[B-Si] | Presence/absence of B - Si at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3577 | B03[B-X] | Presence/absence of B - X at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3578 | B03[Si-Si] | Presence/absence of Si - Si at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3579 | B03[Si-X] | Presence/absence of Si - X at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3580 | B03[X-X] | Presence/absence of X - X at topological distance 3 | 2D Atom Pairs | Binary Atom Pairs of order 3 | 
| 3581 | B04[C-C] | Presence/absence of C - C at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3582 | B04[C-N] | Presence/absence of C - N at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3583 | B04[C-O] | Presence/absence of C - O at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3584 | B04[C-S] | Presence/absence of C - S at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3585 | B04[C-P] | Presence/absence of C - P at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3586 | B04[C-F] | Presence/absence of C - F at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3587 | B04[C-Cl] | Presence/absence of C - Cl at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3588 | B04[C-Br] | Presence/absence of C - Br at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3589 | B04[C-I] | Presence/absence of C - I at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3590 | B04[C-B] | Presence/absence of C - B at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3591 | B04[C-Si] | Presence/absence of C - Si at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3592 | B04[C-X] | Presence/absence of C - X at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3593 | B04[N-N] | Presence/absence of N - N at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3594 | B04[N-O] | Presence/absence of N - O at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3595 | B04[N-S] | Presence/absence of N - S at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3596 | B04[N-P] | Presence/absence of N - P at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3597 | B04[N-F] | Presence/absence of N - F at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3598 | B04[N-Cl] | Presence/absence of N - Cl at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3599 | B04[N-Br] | Presence/absence of N - Br at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3600 | B04[N-I] | Presence/absence of N - I at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3601 | B04[N-B] | Presence/absence of N - B at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3602 | B04[N-Si] | Presence/absence of N - Si at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3603 | B04[N-X] | Presence/absence of N - X at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3604 | B04[O-O] | Presence/absence of O - O at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3605 | B04[O-S] | Presence/absence of O - S at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3606 | B04[O-P] | Presence/absence of O - P at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3607 | B04[O-F] | Presence/absence of O - F at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3608 | B04[O-Cl] | Presence/absence of O - Cl at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3609 | B04[O-Br] | Presence/absence of O - Br at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3610 | B04[O-I] | Presence/absence of O - I at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3611 | B04[O-B] | Presence/absence of O - B at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3612 | B04[O-Si] | Presence/absence of O - Si at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3613 | B04[O-X] | Presence/absence of O - X at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3614 | B04[S-S] | Presence/absence of S - S at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3615 | B04[S-P] | Presence/absence of S - P at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3616 | B04[S-F] | Presence/absence of S - F at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3617 | B04[S-Cl] | Presence/absence of S - Cl at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3618 | B04[S-Br] | Presence/absence of S - Br at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3619 | B04[S-I] | Presence/absence of S - I at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3620 | B04[S-B] | Presence/absence of S - B at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3621 | B04[S-Si] | Presence/absence of S - Si at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3622 | B04[S-X] | Presence/absence of S - X at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3623 | B04[P-P] | Presence/absence of P - P at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3624 | B04[P-F] | Presence/absence of P - F at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3625 | B04[P-Cl] | Presence/absence of P - Cl at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3626 | B04[P-Br] | Presence/absence of P - Br at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3627 | B04[P-I] | Presence/absence of P - I at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3628 | B04[P-B] | Presence/absence of P - B at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3629 | B04[P-Si] | Presence/absence of P - Si at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3630 | B04[P-X] | Presence/absence of P - X at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3631 | B04[F-F] | Presence/absence of F - F at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3632 | B04[F-Cl] | Presence/absence of F - Cl at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3633 | B04[F-Br] | Presence/absence of F - Br at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3634 | B04[F-I] | Presence/absence of F - I at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3635 | B04[F-B] | Presence/absence of F - B at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3636 | B04[F-Si] | Presence/absence of F - Si at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3637 | B04[F-X] | Presence/absence of F - X at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3638 | B04[Cl-Cl] | Presence/absence of Cl - Cl at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3639 | B04[Cl-Br] | Presence/absence of Cl - Br at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3640 | B04[Cl-I] | Presence/absence of Cl - I at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3641 | B04[Cl-B] | Presence/absence of Cl - B at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3642 | B04[Cl-Si] | Presence/absence of Cl - Si at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3643 | B04[Cl-X] | Presence/absence of Cl - X at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3644 | B04[Br-Br] | Presence/absence of Br - Br at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3645 | B04[Br-I] | Presence/absence of Br - I at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3646 | B04[Br-B] | Presence/absence of Br - B at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3647 | B04[Br-Si] | Presence/absence of Br - Si at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3648 | B04[Br-X] | Presence/absence of Br - X at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3649 | B04[I-I] | Presence/absence of I - I at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3650 | B04[I-B] | Presence/absence of I - B at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3651 | B04[I-Si] | Presence/absence of I - Si at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3652 | B04[I-X] | Presence/absence of I - X at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3653 | B04[B-B] | Presence/absence of B - B at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3654 | B04[B-Si] | Presence/absence of B - Si at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3655 | B04[B-X] | Presence/absence of B - X at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3656 | B04[Si-Si] | Presence/absence of Si - Si at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3657 | B04[Si-X] | Presence/absence of Si - X at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3658 | B04[X-X] | Presence/absence of X - X at topological distance 4 | 2D Atom Pairs | Binary Atom Pairs of order 4 | 
| 3659 | B05[C-C] | Presence/absence of C - C at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3660 | B05[C-N] | Presence/absence of C - N at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3661 | B05[C-O] | Presence/absence of C - O at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3662 | B05[C-S] | Presence/absence of C - S at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3663 | B05[C-P] | Presence/absence of C - P at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3664 | B05[C-F] | Presence/absence of C - F at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3665 | B05[C-Cl] | Presence/absence of C - Cl at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3666 | B05[C-Br] | Presence/absence of C - Br at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3667 | B05[C-I] | Presence/absence of C - I at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3668 | B05[C-B] | Presence/absence of C - B at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3669 | B05[C-Si] | Presence/absence of C - Si at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3670 | B05[C-X] | Presence/absence of C - X at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3671 | B05[N-N] | Presence/absence of N - N at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3672 | B05[N-O] | Presence/absence of N - O at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3673 | B05[N-S] | Presence/absence of N - S at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3674 | B05[N-P] | Presence/absence of N - P at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3675 | B05[N-F] | Presence/absence of N - F at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3676 | B05[N-Cl] | Presence/absence of N - Cl at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3677 | B05[N-Br] | Presence/absence of N - Br at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3678 | B05[N-I] | Presence/absence of N - I at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3679 | B05[N-B] | Presence/absence of N - B at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3680 | B05[N-Si] | Presence/absence of N - Si at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3681 | B05[N-X] | Presence/absence of N - X at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3682 | B05[O-O] | Presence/absence of O - O at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3683 | B05[O-S] | Presence/absence of O - S at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3684 | B05[O-P] | Presence/absence of O - P at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3685 | B05[O-F] | Presence/absence of O - F at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3686 | B05[O-Cl] | Presence/absence of O - Cl at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3687 | B05[O-Br] | Presence/absence of O - Br at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3688 | B05[O-I] | Presence/absence of O - I at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3689 | B05[O-B] | Presence/absence of O - B at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3690 | B05[O-Si] | Presence/absence of O - Si at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3691 | B05[O-X] | Presence/absence of O - X at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3692 | B05[S-S] | Presence/absence of S - S at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3693 | B05[S-P] | Presence/absence of S - P at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3694 | B05[S-F] | Presence/absence of S - F at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3695 | B05[S-Cl] | Presence/absence of S - Cl at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3696 | B05[S-Br] | Presence/absence of S - Br at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3697 | B05[S-I] | Presence/absence of S - I at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3698 | B05[S-B] | Presence/absence of S - B at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3699 | B05[S-Si] | Presence/absence of S - Si at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3700 | B05[S-X] | Presence/absence of S - X at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3701 | B05[P-P] | Presence/absence of P - P at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3702 | B05[P-F] | Presence/absence of P - F at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3703 | B05[P-Cl] | Presence/absence of P - Cl at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3704 | B05[P-Br] | Presence/absence of P - Br at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3705 | B05[P-I] | Presence/absence of P - I at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3706 | B05[P-B] | Presence/absence of P - B at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3707 | B05[P-Si] | Presence/absence of P - Si at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3708 | B05[P-X] | Presence/absence of P - X at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3709 | B05[F-F] | Presence/absence of F - F at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3710 | B05[F-Cl] | Presence/absence of F - Cl at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3711 | B05[F-Br] | Presence/absence of F - Br at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3712 | B05[F-I] | Presence/absence of F - I at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3713 | B05[F-B] | Presence/absence of F - B at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3714 | B05[F-Si] | Presence/absence of F - Si at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3715 | B05[F-X] | Presence/absence of F - X at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3716 | B05[Cl-Cl] | Presence/absence of Cl - Cl at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3717 | B05[Cl-Br] | Presence/absence of Cl - Br at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3718 | B05[Cl-I] | Presence/absence of Cl - I at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3719 | B05[Cl-B] | Presence/absence of Cl - B at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3720 | B05[Cl-Si] | Presence/absence of Cl - Si at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3721 | B05[Cl-X] | Presence/absence of Cl - X at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3722 | B05[Br-Br] | Presence/absence of Br - Br at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3723 | B05[Br-I] | Presence/absence of Br - I at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3724 | B05[Br-B] | Presence/absence of Br - B at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3725 | B05[Br-Si] | Presence/absence of Br - Si at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3726 | B05[Br-X] | Presence/absence of Br - X at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3727 | B05[I-I] | Presence/absence of I - I at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3728 | B05[I-B] | Presence/absence of I - B at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3729 | B05[I-Si] | Presence/absence of I - Si at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3730 | B05[I-X] | Presence/absence of I - X at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3731 | B05[B-B] | Presence/absence of B - B at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3732 | B05[B-Si] | Presence/absence of B - Si at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3733 | B05[B-X] | Presence/absence of B - X at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3734 | B05[Si-Si] | Presence/absence of Si - Si at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3735 | B05[Si-X] | Presence/absence of Si - X at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3736 | B05[X-X] | Presence/absence of X - X at topological distance 5 | 2D Atom Pairs | Binary Atom Pairs of order 5 | 
| 3737 | B06[C-C] | Presence/absence of C - C at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3738 | B06[C-N] | Presence/absence of C - N at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3739 | B06[C-O] | Presence/absence of C - O at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3740 | B06[C-S] | Presence/absence of C - S at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3741 | B06[C-P] | Presence/absence of C - P at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3742 | B06[C-F] | Presence/absence of C - F at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3743 | B06[C-Cl] | Presence/absence of C - Cl at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3744 | B06[C-Br] | Presence/absence of C - Br at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3745 | B06[C-I] | Presence/absence of C - I at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3746 | B06[C-B] | Presence/absence of C - B at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3747 | B06[C-Si] | Presence/absence of C - Si at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3748 | B06[C-X] | Presence/absence of C - X at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3749 | B06[N-N] | Presence/absence of N - N at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3750 | B06[N-O] | Presence/absence of N - O at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3751 | B06[N-S] | Presence/absence of N - S at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3752 | B06[N-P] | Presence/absence of N - P at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3753 | B06[N-F] | Presence/absence of N - F at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3754 | B06[N-Cl] | Presence/absence of N - Cl at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3755 | B06[N-Br] | Presence/absence of N - Br at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3756 | B06[N-I] | Presence/absence of N - I at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3757 | B06[N-B] | Presence/absence of N - B at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3758 | B06[N-Si] | Presence/absence of N - Si at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3759 | B06[N-X] | Presence/absence of N - X at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3760 | B06[O-O] | Presence/absence of O - O at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3761 | B06[O-S] | Presence/absence of O - S at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3762 | B06[O-P] | Presence/absence of O - P at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3763 | B06[O-F] | Presence/absence of O - F at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3764 | B06[O-Cl] | Presence/absence of O - Cl at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3765 | B06[O-Br] | Presence/absence of O - Br at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3766 | B06[O-I] | Presence/absence of O - I at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3767 | B06[O-B] | Presence/absence of O - B at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3768 | B06[O-Si] | Presence/absence of O - Si at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3769 | B06[O-X] | Presence/absence of O - X at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3770 | B06[S-S] | Presence/absence of S - S at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3771 | B06[S-P] | Presence/absence of S - P at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3772 | B06[S-F] | Presence/absence of S - F at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3773 | B06[S-Cl] | Presence/absence of S - Cl at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3774 | B06[S-Br] | Presence/absence of S - Br at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3775 | B06[S-I] | Presence/absence of S - I at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3776 | B06[S-B] | Presence/absence of S - B at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3777 | B06[S-Si] | Presence/absence of S - Si at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3778 | B06[S-X] | Presence/absence of S - X at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3779 | B06[P-P] | Presence/absence of P - P at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3780 | B06[P-F] | Presence/absence of P - F at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3781 | B06[P-Cl] | Presence/absence of P - Cl at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3782 | B06[P-Br] | Presence/absence of P - Br at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3783 | B06[P-I] | Presence/absence of P - I at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3784 | B06[P-B] | Presence/absence of P - B at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3785 | B06[P-Si] | Presence/absence of P - Si at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3786 | B06[P-X] | Presence/absence of P - X at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3787 | B06[F-F] | Presence/absence of F - F at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3788 | B06[F-Cl] | Presence/absence of F - Cl at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3789 | B06[F-Br] | Presence/absence of F - Br at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3790 | B06[F-I] | Presence/absence of F - I at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3791 | B06[F-B] | Presence/absence of F - B at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3792 | B06[F-Si] | Presence/absence of F - Si at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3793 | B06[F-X] | Presence/absence of F - X at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3794 | B06[Cl-Cl] | Presence/absence of Cl - Cl at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3795 | B06[Cl-Br] | Presence/absence of Cl - Br at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3796 | B06[Cl-I] | Presence/absence of Cl - I at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3797 | B06[Cl-B] | Presence/absence of Cl - B at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3798 | B06[Cl-Si] | Presence/absence of Cl - Si at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3799 | B06[Cl-X] | Presence/absence of Cl - X at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3800 | B06[Br-Br] | Presence/absence of Br - Br at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3801 | B06[Br-I] | Presence/absence of Br - I at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3802 | B06[Br-B] | Presence/absence of Br - B at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3803 | B06[Br-Si] | Presence/absence of Br - Si at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3804 | B06[Br-X] | Presence/absence of Br - X at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3805 | B06[I-I] | Presence/absence of I - I at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3806 | B06[I-B] | Presence/absence of I - B at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3807 | B06[I-Si] | Presence/absence of I - Si at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3808 | B06[I-X] | Presence/absence of I - X at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3809 | B06[B-B] | Presence/absence of B - B at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3810 | B06[B-Si] | Presence/absence of B - Si at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3811 | B06[B-X] | Presence/absence of B - X at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3812 | B06[Si-Si] | Presence/absence of Si - Si at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3813 | B06[Si-X] | Presence/absence of Si - X at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3814 | B06[X-X] | Presence/absence of X - X at topological distance 6 | 2D Atom Pairs | Binary Atom Pairs of order 6 | 
| 3815 | B07[C-C] | Presence/absence of C - C at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3816 | B07[C-N] | Presence/absence of C - N at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3817 | B07[C-O] | Presence/absence of C - O at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3818 | B07[C-S] | Presence/absence of C - S at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3819 | B07[C-P] | Presence/absence of C - P at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3820 | B07[C-F] | Presence/absence of C - F at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3821 | B07[C-Cl] | Presence/absence of C - Cl at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3822 | B07[C-Br] | Presence/absence of C - Br at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3823 | B07[C-I] | Presence/absence of C - I at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3824 | B07[C-B] | Presence/absence of C - B at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3825 | B07[C-Si] | Presence/absence of C - Si at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3826 | B07[C-X] | Presence/absence of C - X at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3827 | B07[N-N] | Presence/absence of N - N at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3828 | B07[N-O] | Presence/absence of N - O at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3829 | B07[N-S] | Presence/absence of N - S at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3830 | B07[N-P] | Presence/absence of N - P at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3831 | B07[N-F] | Presence/absence of N - F at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3832 | B07[N-Cl] | Presence/absence of N - Cl at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3833 | B07[N-Br] | Presence/absence of N - Br at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3834 | B07[N-I] | Presence/absence of N - I at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3835 | B07[N-B] | Presence/absence of N - B at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3836 | B07[N-Si] | Presence/absence of N - Si at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3837 | B07[N-X] | Presence/absence of N - X at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3838 | B07[O-O] | Presence/absence of O - O at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3839 | B07[O-S] | Presence/absence of O - S at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3840 | B07[O-P] | Presence/absence of O - P at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3841 | B07[O-F] | Presence/absence of O - F at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3842 | B07[O-Cl] | Presence/absence of O - Cl at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3843 | B07[O-Br] | Presence/absence of O - Br at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3844 | B07[O-I] | Presence/absence of O - I at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3845 | B07[O-B] | Presence/absence of O - B at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3846 | B07[O-Si] | Presence/absence of O - Si at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3847 | B07[O-X] | Presence/absence of O - X at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3848 | B07[S-S] | Presence/absence of S - S at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3849 | B07[S-P] | Presence/absence of S - P at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3850 | B07[S-F] | Presence/absence of S - F at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3851 | B07[S-Cl] | Presence/absence of S - Cl at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3852 | B07[S-Br] | Presence/absence of S - Br at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3853 | B07[S-I] | Presence/absence of S - I at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3854 | B07[S-B] | Presence/absence of S - B at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3855 | B07[S-Si] | Presence/absence of S - Si at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3856 | B07[S-X] | Presence/absence of S - X at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3857 | B07[P-P] | Presence/absence of P - P at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3858 | B07[P-F] | Presence/absence of P - F at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3859 | B07[P-Cl] | Presence/absence of P - Cl at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3860 | B07[P-Br] | Presence/absence of P - Br at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3861 | B07[P-I] | Presence/absence of P - I at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3862 | B07[P-B] | Presence/absence of P - B at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3863 | B07[P-Si] | Presence/absence of P - Si at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3864 | B07[P-X] | Presence/absence of P - X at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3865 | B07[F-F] | Presence/absence of F - F at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3866 | B07[F-Cl] | Presence/absence of F - Cl at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3867 | B07[F-Br] | Presence/absence of F - Br at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3868 | B07[F-I] | Presence/absence of F - I at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3869 | B07[F-B] | Presence/absence of F - B at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3870 | B07[F-Si] | Presence/absence of F - Si at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3871 | B07[F-X] | Presence/absence of F - X at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3872 | B07[Cl-Cl] | Presence/absence of Cl - Cl at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3873 | B07[Cl-Br] | Presence/absence of Cl - Br at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3874 | B07[Cl-I] | Presence/absence of Cl - I at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3875 | B07[Cl-B] | Presence/absence of Cl - B at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3876 | B07[Cl-Si] | Presence/absence of Cl - Si at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3877 | B07[Cl-X] | Presence/absence of Cl - X at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3878 | B07[Br-Br] | Presence/absence of Br - Br at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3879 | B07[Br-I] | Presence/absence of Br - I at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3880 | B07[Br-B] | Presence/absence of Br - B at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3881 | B07[Br-Si] | Presence/absence of Br - Si at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3882 | B07[Br-X] | Presence/absence of Br - X at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3883 | B07[I-I] | Presence/absence of I - I at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3884 | B07[I-B] | Presence/absence of I - B at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3885 | B07[I-Si] | Presence/absence of I - Si at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3886 | B07[I-X] | Presence/absence of I - X at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3887 | B07[B-B] | Presence/absence of B - B at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3888 | B07[B-Si] | Presence/absence of B - Si at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3889 | B07[B-X] | Presence/absence of B - X at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3890 | B07[Si-Si] | Presence/absence of Si - Si at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3891 | B07[Si-X] | Presence/absence of Si - X at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3892 | B07[X-X] | Presence/absence of X - X at topological distance 7 | 2D Atom Pairs | Binary Atom Pairs of order 7 | 
| 3893 | B08[C-C] | Presence/absence of C - C at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3894 | B08[C-N] | Presence/absence of C - N at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3895 | B08[C-O] | Presence/absence of C - O at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3896 | B08[C-S] | Presence/absence of C - S at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3897 | B08[C-P] | Presence/absence of C - P at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3898 | B08[C-F] | Presence/absence of C - F at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3899 | B08[C-Cl] | Presence/absence of C - Cl at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3900 | B08[C-Br] | Presence/absence of C - Br at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3901 | B08[C-I] | Presence/absence of C - I at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3902 | B08[C-B] | Presence/absence of C - B at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3903 | B08[C-Si] | Presence/absence of C - Si at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3904 | B08[C-X] | Presence/absence of C - X at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3905 | B08[N-N] | Presence/absence of N - N at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3906 | B08[N-O] | Presence/absence of N - O at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3907 | B08[N-S] | Presence/absence of N - S at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3908 | B08[N-P] | Presence/absence of N - P at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3909 | B08[N-F] | Presence/absence of N - F at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3910 | B08[N-Cl] | Presence/absence of N - Cl at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3911 | B08[N-Br] | Presence/absence of N - Br at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3912 | B08[N-I] | Presence/absence of N - I at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3913 | B08[N-B] | Presence/absence of N - B at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3914 | B08[N-Si] | Presence/absence of N - Si at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3915 | B08[N-X] | Presence/absence of N - X at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3916 | B08[O-O] | Presence/absence of O - O at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3917 | B08[O-S] | Presence/absence of O - S at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3918 | B08[O-P] | Presence/absence of O - P at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3919 | B08[O-F] | Presence/absence of O - F at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3920 | B08[O-Cl] | Presence/absence of O - Cl at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3921 | B08[O-Br] | Presence/absence of O - Br at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3922 | B08[O-I] | Presence/absence of O - I at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3923 | B08[O-B] | Presence/absence of O - B at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3924 | B08[O-Si] | Presence/absence of O - Si at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3925 | B08[O-X] | Presence/absence of O - X at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3926 | B08[S-S] | Presence/absence of S - S at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3927 | B08[S-P] | Presence/absence of S - P at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3928 | B08[S-F] | Presence/absence of S - F at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3929 | B08[S-Cl] | Presence/absence of S - Cl at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3930 | B08[S-Br] | Presence/absence of S - Br at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3931 | B08[S-I] | Presence/absence of S - I at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3932 | B08[S-B] | Presence/absence of S - B at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3933 | B08[S-Si] | Presence/absence of S - Si at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3934 | B08[S-X] | Presence/absence of S - X at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3935 | B08[P-P] | Presence/absence of P - P at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3936 | B08[P-F] | Presence/absence of P - F at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3937 | B08[P-Cl] | Presence/absence of P - Cl at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3938 | B08[P-Br] | Presence/absence of P - Br at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3939 | B08[P-I] | Presence/absence of P - I at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3940 | B08[P-B] | Presence/absence of P - B at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3941 | B08[P-Si] | Presence/absence of P - Si at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3942 | B08[P-X] | Presence/absence of P - X at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3943 | B08[F-F] | Presence/absence of F - F at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3944 | B08[F-Cl] | Presence/absence of F - Cl at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3945 | B08[F-Br] | Presence/absence of F - Br at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3946 | B08[F-I] | Presence/absence of F - I at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3947 | B08[F-B] | Presence/absence of F - B at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3948 | B08[F-Si] | Presence/absence of F - Si at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3949 | B08[F-X] | Presence/absence of F - X at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3950 | B08[Cl-Cl] | Presence/absence of Cl - Cl at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3951 | B08[Cl-Br] | Presence/absence of Cl - Br at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3952 | B08[Cl-I] | Presence/absence of Cl - I at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3953 | B08[Cl-B] | Presence/absence of Cl - B at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3954 | B08[Cl-Si] | Presence/absence of Cl - Si at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3955 | B08[Cl-X] | Presence/absence of Cl - X at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3956 | B08[Br-Br] | Presence/absence of Br - Br at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3957 | B08[Br-I] | Presence/absence of Br - I at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3958 | B08[Br-B] | Presence/absence of Br - B at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3959 | B08[Br-Si] | Presence/absence of Br - Si at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3960 | B08[Br-X] | Presence/absence of Br - X at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3961 | B08[I-I] | Presence/absence of I - I at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3962 | B08[I-B] | Presence/absence of I - B at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3963 | B08[I-Si] | Presence/absence of I - Si at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3964 | B08[I-X] | Presence/absence of I - X at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3965 | B08[B-B] | Presence/absence of B - B at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3966 | B08[B-Si] | Presence/absence of B - Si at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3967 | B08[B-X] | Presence/absence of B - X at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3968 | B08[Si-Si] | Presence/absence of Si - Si at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3969 | B08[Si-X] | Presence/absence of Si - X at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3970 | B08[X-X] | Presence/absence of X - X at topological distance 8 | 2D Atom Pairs | Binary Atom Pairs of order 8 | 
| 3971 | B09[C-C] | Presence/absence of C - C at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3972 | B09[C-N] | Presence/absence of C - N at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3973 | B09[C-O] | Presence/absence of C - O at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3974 | B09[C-S] | Presence/absence of C - S at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3975 | B09[C-P] | Presence/absence of C - P at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3976 | B09[C-F] | Presence/absence of C - F at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3977 | B09[C-Cl] | Presence/absence of C - Cl at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3978 | B09[C-Br] | Presence/absence of C - Br at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3979 | B09[C-I] | Presence/absence of C - I at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3980 | B09[C-B] | Presence/absence of C - B at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3981 | B09[C-Si] | Presence/absence of C - Si at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3982 | B09[C-X] | Presence/absence of C - X at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3983 | B09[N-N] | Presence/absence of N - N at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3984 | B09[N-O] | Presence/absence of N - O at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3985 | B09[N-S] | Presence/absence of N - S at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3986 | B09[N-P] | Presence/absence of N - P at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3987 | B09[N-F] | Presence/absence of N - F at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3988 | B09[N-Cl] | Presence/absence of N - Cl at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3989 | B09[N-Br] | Presence/absence of N - Br at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3990 | B09[N-I] | Presence/absence of N - I at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3991 | B09[N-B] | Presence/absence of N - B at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3992 | B09[N-Si] | Presence/absence of N - Si at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3993 | B09[N-X] | Presence/absence of N - X at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3994 | B09[O-O] | Presence/absence of O - O at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3995 | B09[O-S] | Presence/absence of O - S at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3996 | B09[O-P] | Presence/absence of O - P at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3997 | B09[O-F] | Presence/absence of O - F at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3998 | B09[O-Cl] | Presence/absence of O - Cl at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 3999 | B09[O-Br] | Presence/absence of O - Br at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4000 | B09[O-I] | Presence/absence of O - I at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4001 | B09[O-B] | Presence/absence of O - B at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4002 | B09[O-Si] | Presence/absence of O - Si at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4003 | B09[O-X] | Presence/absence of O - X at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4004 | B09[S-S] | Presence/absence of S - S at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4005 | B09[S-P] | Presence/absence of S - P at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4006 | B09[S-F] | Presence/absence of S - F at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4007 | B09[S-Cl] | Presence/absence of S - Cl at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4008 | B09[S-Br] | Presence/absence of S - Br at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4009 | B09[S-I] | Presence/absence of S - I at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4010 | B09[S-B] | Presence/absence of S - B at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4011 | B09[S-Si] | Presence/absence of S - Si at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4012 | B09[S-X] | Presence/absence of S - X at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4013 | B09[P-P] | Presence/absence of P - P at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4014 | B09[P-F] | Presence/absence of P - F at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4015 | B09[P-Cl] | Presence/absence of P - Cl at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4016 | B09[P-Br] | Presence/absence of P - Br at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4017 | B09[P-I] | Presence/absence of P - I at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4018 | B09[P-B] | Presence/absence of P - B at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4019 | B09[P-Si] | Presence/absence of P - Si at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4020 | B09[P-X] | Presence/absence of P - X at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4021 | B09[F-F] | Presence/absence of F - F at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4022 | B09[F-Cl] | Presence/absence of F - Cl at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4023 | B09[F-Br] | Presence/absence of F - Br at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4024 | B09[F-I] | Presence/absence of F - I at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4025 | B09[F-B] | Presence/absence of F - B at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4026 | B09[F-Si] | Presence/absence of F - Si at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4027 | B09[F-X] | Presence/absence of F - X at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4028 | B09[Cl-Cl] | Presence/absence of Cl - Cl at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4029 | B09[Cl-Br] | Presence/absence of Cl - Br at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4030 | B09[Cl-I] | Presence/absence of Cl - I at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4031 | B09[Cl-B] | Presence/absence of Cl - B at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4032 | B09[Cl-Si] | Presence/absence of Cl - Si at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4033 | B09[Cl-X] | Presence/absence of Cl - X at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4034 | B09[Br-Br] | Presence/absence of Br - Br at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4035 | B09[Br-I] | Presence/absence of Br - I at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4036 | B09[Br-B] | Presence/absence of Br - B at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4037 | B09[Br-Si] | Presence/absence of Br - Si at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4038 | B09[Br-X] | Presence/absence of Br - X at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4039 | B09[I-I] | Presence/absence of I - I at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4040 | B09[I-B] | Presence/absence of I - B at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4041 | B09[I-Si] | Presence/absence of I - Si at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4042 | B09[I-X] | Presence/absence of I - X at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4043 | B09[B-B] | Presence/absence of B - B at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4044 | B09[B-Si] | Presence/absence of B - Si at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4045 | B09[B-X] | Presence/absence of B - X at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4046 | B09[Si-Si] | Presence/absence of Si - Si at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4047 | B09[Si-X] | Presence/absence of Si - X at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4048 | B09[X-X] | Presence/absence of X - X at topological distance 9 | 2D Atom Pairs | Binary Atom Pairs of order 9 | 
| 4049 | B10[C-C] | Presence/absence of C - C at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4050 | B10[C-N] | Presence/absence of C - N at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4051 | B10[C-O] | Presence/absence of C - O at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4052 | B10[C-S] | Presence/absence of C - S at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4053 | B10[C-P] | Presence/absence of C - P at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4054 | B10[C-F] | Presence/absence of C - F at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4055 | B10[C-Cl] | Presence/absence of C - Cl at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4056 | B10[C-Br] | Presence/absence of C - Br at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4057 | B10[C-I] | Presence/absence of C - I at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4058 | B10[C-B] | Presence/absence of C - B at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4059 | B10[C-Si] | Presence/absence of C - Si at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4060 | B10[C-X] | Presence/absence of C - X at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4061 | B10[N-N] | Presence/absence of N - N at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4062 | B10[N-O] | Presence/absence of N - O at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4063 | B10[N-S] | Presence/absence of N - S at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4064 | B10[N-P] | Presence/absence of N - P at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4065 | B10[N-F] | Presence/absence of N - F at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4066 | B10[N-Cl] | Presence/absence of N - Cl at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4067 | B10[N-Br] | Presence/absence of N - Br at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4068 | B10[N-I] | Presence/absence of N - I at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4069 | B10[N-B] | Presence/absence of N - B at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4070 | B10[N-Si] | Presence/absence of N - Si at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4071 | B10[N-X] | Presence/absence of N - X at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4072 | B10[O-O] | Presence/absence of O - O at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4073 | B10[O-S] | Presence/absence of O - S at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4074 | B10[O-P] | Presence/absence of O - P at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4075 | B10[O-F] | Presence/absence of O - F at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4076 | B10[O-Cl] | Presence/absence of O - Cl at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4077 | B10[O-Br] | Presence/absence of O - Br at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4078 | B10[O-I] | Presence/absence of O - I at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4079 | B10[O-B] | Presence/absence of O - B at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4080 | B10[O-Si] | Presence/absence of O - Si at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4081 | B10[O-X] | Presence/absence of O - X at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4082 | B10[S-S] | Presence/absence of S - S at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4083 | B10[S-P] | Presence/absence of S - P at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4084 | B10[S-F] | Presence/absence of S - F at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4085 | B10[S-Cl] | Presence/absence of S - Cl at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4086 | B10[S-Br] | Presence/absence of S - Br at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4087 | B10[S-I] | Presence/absence of S - I at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4088 | B10[S-B] | Presence/absence of S - B at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4089 | B10[S-Si] | Presence/absence of S - Si at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4090 | B10[S-X] | Presence/absence of S - X at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4091 | B10[P-P] | Presence/absence of P - P at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4092 | B10[P-F] | Presence/absence of P - F at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4093 | B10[P-Cl] | Presence/absence of P - Cl at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4094 | B10[P-Br] | Presence/absence of P - Br at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4095 | B10[P-I] | Presence/absence of P - I at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4096 | B10[P-B] | Presence/absence of P - B at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4097 | B10[P-Si] | Presence/absence of P - Si at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4098 | B10[P-X] | Presence/absence of P - X at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4099 | B10[F-F] | Presence/absence of F - F at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4100 | B10[F-Cl] | Presence/absence of F - Cl at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4101 | B10[F-Br] | Presence/absence of F - Br at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4102 | B10[F-I] | Presence/absence of F - I at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4103 | B10[F-B] | Presence/absence of F - B at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4104 | B10[F-Si] | Presence/absence of F - Si at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4105 | B10[F-X] | Presence/absence of F - X at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4106 | B10[Cl-Cl] | Presence/absence of Cl - Cl at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4107 | B10[Cl-Br] | Presence/absence of Cl - Br at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4108 | B10[Cl-I] | Presence/absence of Cl - I at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4109 | B10[Cl-B] | Presence/absence of Cl - B at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4110 | B10[Cl-Si] | Presence/absence of Cl - Si at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4111 | B10[Cl-X] | Presence/absence of Cl - X at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4112 | B10[Br-Br] | Presence/absence of Br - Br at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4113 | B10[Br-I] | Presence/absence of Br - I at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4114 | B10[Br-B] | Presence/absence of Br - B at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4115 | B10[Br-Si] | Presence/absence of Br - Si at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4116 | B10[Br-X] | Presence/absence of Br - X at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4117 | B10[I-I] | Presence/absence of I - I at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4118 | B10[I-B] | Presence/absence of I - B at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4119 | B10[I-Si] | Presence/absence of I - Si at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4120 | B10[I-X] | Presence/absence of I - X at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4121 | B10[B-B] | Presence/absence of B - B at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4122 | B10[B-Si] | Presence/absence of B - Si at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4123 | B10[B-X] | Presence/absence of B - X at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4124 | B10[Si-Si] | Presence/absence of Si - Si at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4125 | B10[Si-X] | Presence/absence of Si - X at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4126 | B10[X-X] | Presence/absence of X - X at topological distance 10 | 2D Atom Pairs | Binary Atom Pairs of order 10 | 
| 4127 | F01[C-C] | Frequency of C - C at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4128 | F01[C-N] | Frequency of C - N at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4129 | F01[C-O] | Frequency of C - O at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4130 | F01[C-S] | Frequency of C - S at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4131 | F01[C-P] | Frequency of C - P at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4132 | F01[C-F] | Frequency of C - F at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4133 | F01[C-Cl] | Frequency of C - Cl at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4134 | F01[C-Br] | Frequency of C - Br at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4135 | F01[C-I] | Frequency of C - I at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4136 | F01[C-B] | Frequency of C - B at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4137 | F01[C-Si] | Frequency of C - Si at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4138 | F01[C-X] | Frequency of C - X at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4139 | F01[N-N] | Frequency of N - N at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4140 | F01[N-O] | Frequency of N - O at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4141 | F01[N-S] | Frequency of N - S at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4142 | F01[N-P] | Frequency of N - P at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4143 | F01[N-F] | Frequency of N - F at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4144 | F01[N-Cl] | Frequency of N - Cl at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4145 | F01[N-Br] | Frequency of N - Br at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4146 | F01[N-I] | Frequency of N - I at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4147 | F01[N-B] | Frequency of N - B at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4148 | F01[N-Si] | Frequency of N - Si at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4149 | F01[N-X] | Frequency of N - X at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4150 | F01[O-O] | Frequency of O - O at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4151 | F01[O-S] | Frequency of O - S at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4152 | F01[O-P] | Frequency of O - P at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4153 | F01[O-F] | Frequency of O - F at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4154 | F01[O-Cl] | Frequency of O - Cl at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4155 | F01[O-Br] | Frequency of O - Br at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4156 | F01[O-I] | Frequency of O - I at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4157 | F01[O-B] | Frequency of O - B at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4158 | F01[O-Si] | Frequency of O - Si at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4159 | F01[O-X] | Frequency of O - X at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4160 | F01[S-S] | Frequency of S - S at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4161 | F01[S-P] | Frequency of S - P at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4162 | F01[S-F] | Frequency of S - F at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4163 | F01[S-Cl] | Frequency of S - Cl at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4164 | F01[S-Br] | Frequency of S - Br at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4165 | F01[S-I] | Frequency of S - I at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4166 | F01[S-B] | Frequency of S - B at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4167 | F01[S-Si] | Frequency of S - Si at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4168 | F01[S-X] | Frequency of S - X at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4169 | F01[P-P] | Frequency of P - P at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4170 | F01[P-F] | Frequency of P - F at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4171 | F01[P-Cl] | Frequency of P - Cl at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4172 | F01[P-Br] | Frequency of P - Br at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4173 | F01[P-I] | Frequency of P - I at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4174 | F01[P-B] | Frequency of P - B at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4175 | F01[P-Si] | Frequency of P - Si at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4176 | F01[P-X] | Frequency of P - X at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4177 | F01[F-F] | Frequency of F - F at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4178 | F01[F-Cl] | Frequency of F - Cl at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4179 | F01[F-Br] | Frequency of F - Br at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4180 | F01[F-I] | Frequency of F - I at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4181 | F01[F-B] | Frequency of F - B at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4182 | F01[F-Si] | Frequency of F - Si at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4183 | F01[F-X] | Frequency of F - X at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4184 | F01[Cl-Cl] | Frequency of Cl - Cl at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4185 | F01[Cl-Br] | Frequency of Cl - Br at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4186 | F01[Cl-I] | Frequency of Cl - I at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4187 | F01[Cl-B] | Frequency of Cl - B at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4188 | F01[Cl-Si] | Frequency of Cl - Si at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4189 | F01[Cl-X] | Frequency of Cl - X at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4190 | F01[Br-Br] | Frequency of Br - Br at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4191 | F01[Br-I] | Frequency of Br - I at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4192 | F01[Br-B] | Frequency of Br - B at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4193 | F01[Br-Si] | Frequency of Br - Si at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4194 | F01[Br-X] | Frequency of Br - X at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4195 | F01[I-I] | Frequency of I - I at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4196 | F01[I-B] | Frequency of I - B at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4197 | F01[I-Si] | Frequency of I - Si at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4198 | F01[I-X] | Frequency of I - X at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4199 | F01[B-B] | Frequency of B - B at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4200 | F01[B-Si] | Frequency of B - Si at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4201 | F01[B-X] | Frequency of B - X at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4202 | F01[Si-Si] | Frequency of Si - Si at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4203 | F01[Si-X] | Frequency of Si - X at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4204 | F01[X-X] | Frequency of X - X at topological distance 1 | 2D Atom Pairs | Frequency Atom Pairs of order 1 | 
| 4205 | F02[C-C] | Frequency of C - C at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4206 | F02[C-N] | Frequency of C - N at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4207 | F02[C-O] | Frequency of C - O at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4208 | F02[C-S] | Frequency of C - S at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4209 | F02[C-P] | Frequency of C - P at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4210 | F02[C-F] | Frequency of C - F at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4211 | F02[C-Cl] | Frequency of C - Cl at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4212 | F02[C-Br] | Frequency of C - Br at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4213 | F02[C-I] | Frequency of C - I at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4214 | F02[C-B] | Frequency of C - B at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4215 | F02[C-Si] | Frequency of C - Si at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4216 | F02[C-X] | Frequency of C - X at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4217 | F02[N-N] | Frequency of N - N at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4218 | F02[N-O] | Frequency of N - O at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4219 | F02[N-S] | Frequency of N - S at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4220 | F02[N-P] | Frequency of N - P at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4221 | F02[N-F] | Frequency of N - F at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4222 | F02[N-Cl] | Frequency of N - Cl at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4223 | F02[N-Br] | Frequency of N - Br at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4224 | F02[N-I] | Frequency of N - I at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4225 | F02[N-B] | Frequency of N - B at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4226 | F02[N-Si] | Frequency of N - Si at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4227 | F02[N-X] | Frequency of N - X at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4228 | F02[O-O] | Frequency of O - O at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4229 | F02[O-S] | Frequency of O - S at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4230 | F02[O-P] | Frequency of O - P at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4231 | F02[O-F] | Frequency of O - F at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4232 | F02[O-Cl] | Frequency of O - Cl at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4233 | F02[O-Br] | Frequency of O - Br at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4234 | F02[O-I] | Frequency of O - I at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4235 | F02[O-B] | Frequency of O - B at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4236 | F02[O-Si] | Frequency of O - Si at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4237 | F02[O-X] | Frequency of O - X at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4238 | F02[S-S] | Frequency of S - S at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4239 | F02[S-P] | Frequency of S - P at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4240 | F02[S-F] | Frequency of S - F at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4241 | F02[S-Cl] | Frequency of S - Cl at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4242 | F02[S-Br] | Frequency of S - Br at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4243 | F02[S-I] | Frequency of S - I at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4244 | F02[S-B] | Frequency of S - B at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4245 | F02[S-Si] | Frequency of S - Si at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4246 | F02[S-X] | Frequency of S - X at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4247 | F02[P-P] | Frequency of P - P at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4248 | F02[P-F] | Frequency of P - F at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4249 | F02[P-Cl] | Frequency of P - Cl at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4250 | F02[P-Br] | Frequency of P - Br at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4251 | F02[P-I] | Frequency of P - I at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4252 | F02[P-B] | Frequency of P - B at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4253 | F02[P-Si] | Frequency of P - Si at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4254 | F02[P-X] | Frequency of P - X at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4255 | F02[F-F] | Frequency of F - F at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4256 | F02[F-Cl] | Frequency of F - Cl at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4257 | F02[F-Br] | Frequency of F - Br at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4258 | F02[F-I] | Frequency of F - I at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4259 | F02[F-B] | Frequency of F - B at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4260 | F02[F-Si] | Frequency of F - Si at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4261 | F02[F-X] | Frequency of F - X at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4262 | F02[Cl-Cl] | Frequency of Cl - Cl at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4263 | F02[Cl-Br] | Frequency of Cl - Br at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4264 | F02[Cl-I] | Frequency of Cl - I at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4265 | F02[Cl-B] | Frequency of Cl - B at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4266 | F02[Cl-Si] | Frequency of Cl - Si at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4267 | F02[Cl-X] | Frequency of Cl - X at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4268 | F02[Br-Br] | Frequency of Br - Br at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4269 | F02[Br-I] | Frequency of Br - I at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4270 | F02[Br-B] | Frequency of Br - B at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4271 | F02[Br-Si] | Frequency of Br - Si at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4272 | F02[Br-X] | Frequency of Br - X at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4273 | F02[I-I] | Frequency of I - I at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4274 | F02[I-B] | Frequency of I - B at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4275 | F02[I-Si] | Frequency of I - Si at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4276 | F02[I-X] | Frequency of I - X at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4277 | F02[B-B] | Frequency of B - B at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4278 | F02[B-Si] | Frequency of B - Si at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4279 | F02[B-X] | Frequency of B - X at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4280 | F02[Si-Si] | Frequency of Si - Si at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4281 | F02[Si-X] | Frequency of Si - X at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4282 | F02[X-X] | Frequency of X - X at topological distance 2 | 2D Atom Pairs | Frequency Atom Pairs of order 2 | 
| 4283 | F03[C-C] | Frequency of C - C at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4284 | F03[C-N] | Frequency of C - N at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4285 | F03[C-O] | Frequency of C - O at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4286 | F03[C-S] | Frequency of C - S at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4287 | F03[C-P] | Frequency of C - P at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4288 | F03[C-F] | Frequency of C - F at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4289 | F03[C-Cl] | Frequency of C - Cl at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4290 | F03[C-Br] | Frequency of C - Br at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4291 | F03[C-I] | Frequency of C - I at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4292 | F03[C-B] | Frequency of C - B at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4293 | F03[C-Si] | Frequency of C - Si at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4294 | F03[C-X] | Frequency of C - X at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4295 | F03[N-N] | Frequency of N - N at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4296 | F03[N-O] | Frequency of N - O at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4297 | F03[N-S] | Frequency of N - S at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4298 | F03[N-P] | Frequency of N - P at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4299 | F03[N-F] | Frequency of N - F at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4300 | F03[N-Cl] | Frequency of N - Cl at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4301 | F03[N-Br] | Frequency of N - Br at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4302 | F03[N-I] | Frequency of N - I at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4303 | F03[N-B] | Frequency of N - B at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4304 | F03[N-Si] | Frequency of N - Si at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4305 | F03[N-X] | Frequency of N - X at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4306 | F03[O-O] | Frequency of O - O at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4307 | F03[O-S] | Frequency of O - S at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4308 | F03[O-P] | Frequency of O - P at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4309 | F03[O-F] | Frequency of O - F at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4310 | F03[O-Cl] | Frequency of O - Cl at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4311 | F03[O-Br] | Frequency of O - Br at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4312 | F03[O-I] | Frequency of O - I at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4313 | F03[O-B] | Frequency of O - B at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4314 | F03[O-Si] | Frequency of O - Si at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4315 | F03[O-X] | Frequency of O - X at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4316 | F03[S-S] | Frequency of S - S at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4317 | F03[S-P] | Frequency of S - P at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4318 | F03[S-F] | Frequency of S - F at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4319 | F03[S-Cl] | Frequency of S - Cl at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4320 | F03[S-Br] | Frequency of S - Br at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4321 | F03[S-I] | Frequency of S - I at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4322 | F03[S-B] | Frequency of S - B at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4323 | F03[S-Si] | Frequency of S - Si at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4324 | F03[S-X] | Frequency of S - X at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4325 | F03[P-P] | Frequency of P - P at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4326 | F03[P-F] | Frequency of P - F at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4327 | F03[P-Cl] | Frequency of P - Cl at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4328 | F03[P-Br] | Frequency of P - Br at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4329 | F03[P-I] | Frequency of P - I at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4330 | F03[P-B] | Frequency of P - B at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4331 | F03[P-Si] | Frequency of P - Si at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4332 | F03[P-X] | Frequency of P - X at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4333 | F03[F-F] | Frequency of F - F at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4334 | F03[F-Cl] | Frequency of F - Cl at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4335 | F03[F-Br] | Frequency of F - Br at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4336 | F03[F-I] | Frequency of F - I at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4337 | F03[F-B] | Frequency of F - B at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4338 | F03[F-Si] | Frequency of F - Si at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4339 | F03[F-X] | Frequency of F - X at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4340 | F03[Cl-Cl] | Frequency of Cl - Cl at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4341 | F03[Cl-Br] | Frequency of Cl - Br at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4342 | F03[Cl-I] | Frequency of Cl - I at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4343 | F03[Cl-B] | Frequency of Cl - B at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4344 | F03[Cl-Si] | Frequency of Cl - Si at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4345 | F03[Cl-X] | Frequency of Cl - X at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4346 | F03[Br-Br] | Frequency of Br - Br at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4347 | F03[Br-I] | Frequency of Br - I at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4348 | F03[Br-B] | Frequency of Br - B at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4349 | F03[Br-Si] | Frequency of Br - Si at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4350 | F03[Br-X] | Frequency of Br - X at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4351 | F03[I-I] | Frequency of I - I at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4352 | F03[I-B] | Frequency of I - B at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4353 | F03[I-Si] | Frequency of I - Si at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4354 | F03[I-X] | Frequency of I - X at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4355 | F03[B-B] | Frequency of B - B at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4356 | F03[B-Si] | Frequency of B - Si at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4357 | F03[B-X] | Frequency of B - X at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4358 | F03[Si-Si] | Frequency of Si - Si at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4359 | F03[Si-X] | Frequency of Si - X at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4360 | F03[X-X] | Frequency of X - X at topological distance 3 | 2D Atom Pairs | Frequency Atom Pairs of order 3 | 
| 4361 | F04[C-C] | Frequency of C - C at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4362 | F04[C-N] | Frequency of C - N at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4363 | F04[C-O] | Frequency of C - O at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4364 | F04[C-S] | Frequency of C - S at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4365 | F04[C-P] | Frequency of C - P at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4366 | F04[C-F] | Frequency of C - F at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4367 | F04[C-Cl] | Frequency of C - Cl at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4368 | F04[C-Br] | Frequency of C - Br at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4369 | F04[C-I] | Frequency of C - I at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4370 | F04[C-B] | Frequency of C - B at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4371 | F04[C-Si] | Frequency of C - Si at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4372 | F04[C-X] | Frequency of C - X at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4373 | F04[N-N] | Frequency of N - N at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4374 | F04[N-O] | Frequency of N - O at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4375 | F04[N-S] | Frequency of N - S at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4376 | F04[N-P] | Frequency of N - P at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4377 | F04[N-F] | Frequency of N - F at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4378 | F04[N-Cl] | Frequency of N - Cl at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4379 | F04[N-Br] | Frequency of N - Br at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4380 | F04[N-I] | Frequency of N - I at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4381 | F04[N-B] | Frequency of N - B at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4382 | F04[N-Si] | Frequency of N - Si at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4383 | F04[N-X] | Frequency of N - X at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4384 | F04[O-O] | Frequency of O - O at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4385 | F04[O-S] | Frequency of O - S at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4386 | F04[O-P] | Frequency of O - P at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4387 | F04[O-F] | Frequency of O - F at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4388 | F04[O-Cl] | Frequency of O - Cl at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4389 | F04[O-Br] | Frequency of O - Br at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4390 | F04[O-I] | Frequency of O - I at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4391 | F04[O-B] | Frequency of O - B at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4392 | F04[O-Si] | Frequency of O - Si at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4393 | F04[O-X] | Frequency of O - X at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4394 | F04[S-S] | Frequency of S - S at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4395 | F04[S-P] | Frequency of S - P at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4396 | F04[S-F] | Frequency of S - F at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4397 | F04[S-Cl] | Frequency of S - Cl at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4398 | F04[S-Br] | Frequency of S - Br at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4399 | F04[S-I] | Frequency of S - I at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4400 | F04[S-B] | Frequency of S - B at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4401 | F04[S-Si] | Frequency of S - Si at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4402 | F04[S-X] | Frequency of S - X at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4403 | F04[P-P] | Frequency of P - P at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4404 | F04[P-F] | Frequency of P - F at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4405 | F04[P-Cl] | Frequency of P - Cl at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4406 | F04[P-Br] | Frequency of P - Br at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4407 | F04[P-I] | Frequency of P - I at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4408 | F04[P-B] | Frequency of P - B at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4409 | F04[P-Si] | Frequency of P - Si at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4410 | F04[P-X] | Frequency of P - X at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4411 | F04[F-F] | Frequency of F - F at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4412 | F04[F-Cl] | Frequency of F - Cl at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4413 | F04[F-Br] | Frequency of F - Br at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4414 | F04[F-I] | Frequency of F - I at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4415 | F04[F-B] | Frequency of F - B at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4416 | F04[F-Si] | Frequency of F - Si at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4417 | F04[F-X] | Frequency of F - X at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4418 | F04[Cl-Cl] | Frequency of Cl - Cl at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4419 | F04[Cl-Br] | Frequency of Cl - Br at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4420 | F04[Cl-I] | Frequency of Cl - I at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4421 | F04[Cl-B] | Frequency of Cl - B at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4422 | F04[Cl-Si] | Frequency of Cl - Si at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4423 | F04[Cl-X] | Frequency of Cl - X at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4424 | F04[Br-Br] | Frequency of Br - Br at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4425 | F04[Br-I] | Frequency of Br - I at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4426 | F04[Br-B] | Frequency of Br - B at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4427 | F04[Br-Si] | Frequency of Br - Si at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4428 | F04[Br-X] | Frequency of Br - X at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4429 | F04[I-I] | Frequency of I - I at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4430 | F04[I-B] | Frequency of I - B at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4431 | F04[I-Si] | Frequency of I - Si at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4432 | F04[I-X] | Frequency of I - X at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4433 | F04[B-B] | Frequency of B - B at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4434 | F04[B-Si] | Frequency of B - Si at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4435 | F04[B-X] | Frequency of B - X at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4436 | F04[Si-Si] | Frequency of Si - Si at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4437 | F04[Si-X] | Frequency of Si - X at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4438 | F04[X-X] | Frequency of X - X at topological distance 4 | 2D Atom Pairs | Frequency Atom Pairs of order 4 | 
| 4439 | F05[C-C] | Frequency of C - C at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4440 | F05[C-N] | Frequency of C - N at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4441 | F05[C-O] | Frequency of C - O at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4442 | F05[C-S] | Frequency of C - S at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4443 | F05[C-P] | Frequency of C - P at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4444 | F05[C-F] | Frequency of C - F at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4445 | F05[C-Cl] | Frequency of C - Cl at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4446 | F05[C-Br] | Frequency of C - Br at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4447 | F05[C-I] | Frequency of C - I at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4448 | F05[C-B] | Frequency of C - B at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4449 | F05[C-Si] | Frequency of C - Si at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4450 | F05[C-X] | Frequency of C - X at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4451 | F05[N-N] | Frequency of N - N at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4452 | F05[N-O] | Frequency of N - O at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4453 | F05[N-S] | Frequency of N - S at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4454 | F05[N-P] | Frequency of N - P at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4455 | F05[N-F] | Frequency of N - F at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4456 | F05[N-Cl] | Frequency of N - Cl at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4457 | F05[N-Br] | Frequency of N - Br at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4458 | F05[N-I] | Frequency of N - I at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4459 | F05[N-B] | Frequency of N - B at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4460 | F05[N-Si] | Frequency of N - Si at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4461 | F05[N-X] | Frequency of N - X at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4462 | F05[O-O] | Frequency of O - O at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4463 | F05[O-S] | Frequency of O - S at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4464 | F05[O-P] | Frequency of O - P at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4465 | F05[O-F] | Frequency of O - F at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4466 | F05[O-Cl] | Frequency of O - Cl at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4467 | F05[O-Br] | Frequency of O - Br at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4468 | F05[O-I] | Frequency of O - I at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4469 | F05[O-B] | Frequency of O - B at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4470 | F05[O-Si] | Frequency of O - Si at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4471 | F05[O-X] | Frequency of O - X at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4472 | F05[S-S] | Frequency of S - S at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4473 | F05[S-P] | Frequency of S - P at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4474 | F05[S-F] | Frequency of S - F at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4475 | F05[S-Cl] | Frequency of S - Cl at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4476 | F05[S-Br] | Frequency of S - Br at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4477 | F05[S-I] | Frequency of S - I at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4478 | F05[S-B] | Frequency of S - B at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4479 | F05[S-Si] | Frequency of S - Si at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4480 | F05[S-X] | Frequency of S - X at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4481 | F05[P-P] | Frequency of P - P at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4482 | F05[P-F] | Frequency of P - F at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4483 | F05[P-Cl] | Frequency of P - Cl at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4484 | F05[P-Br] | Frequency of P - Br at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4485 | F05[P-I] | Frequency of P - I at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4486 | F05[P-B] | Frequency of P - B at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4487 | F05[P-Si] | Frequency of P - Si at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4488 | F05[P-X] | Frequency of P - X at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4489 | F05[F-F] | Frequency of F - F at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4490 | F05[F-Cl] | Frequency of F - Cl at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4491 | F05[F-Br] | Frequency of F - Br at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4492 | F05[F-I] | Frequency of F - I at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4493 | F05[F-B] | Frequency of F - B at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4494 | F05[F-Si] | Frequency of F - Si at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4495 | F05[F-X] | Frequency of F - X at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4496 | F05[Cl-Cl] | Frequency of Cl - Cl at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4497 | F05[Cl-Br] | Frequency of Cl - Br at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4498 | F05[Cl-I] | Frequency of Cl - I at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4499 | F05[Cl-B] | Frequency of Cl - B at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4500 | F05[Cl-Si] | Frequency of Cl - Si at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4501 | F05[Cl-X] | Frequency of Cl - X at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4502 | F05[Br-Br] | Frequency of Br - Br at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4503 | F05[Br-I] | Frequency of Br - I at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4504 | F05[Br-B] | Frequency of Br - B at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4505 | F05[Br-Si] | Frequency of Br - Si at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4506 | F05[Br-X] | Frequency of Br - X at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4507 | F05[I-I] | Frequency of I - I at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4508 | F05[I-B] | Frequency of I - B at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4509 | F05[I-Si] | Frequency of I - Si at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4510 | F05[I-X] | Frequency of I - X at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4511 | F05[B-B] | Frequency of B - B at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4512 | F05[B-Si] | Frequency of B - Si at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4513 | F05[B-X] | Frequency of B - X at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4514 | F05[Si-Si] | Frequency of Si - Si at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4515 | F05[Si-X] | Frequency of Si - X at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4516 | F05[X-X] | Frequency of X - X at topological distance 5 | 2D Atom Pairs | Frequency Atom Pairs of order 5 | 
| 4517 | F06[C-C] | Frequency of C - C at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4518 | F06[C-N] | Frequency of C - N at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4519 | F06[C-O] | Frequency of C - O at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4520 | F06[C-S] | Frequency of C - S at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4521 | F06[C-P] | Frequency of C - P at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4522 | F06[C-F] | Frequency of C - F at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4523 | F06[C-Cl] | Frequency of C - Cl at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4524 | F06[C-Br] | Frequency of C - Br at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4525 | F06[C-I] | Frequency of C - I at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4526 | F06[C-B] | Frequency of C - B at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4527 | F06[C-Si] | Frequency of C - Si at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4528 | F06[C-X] | Frequency of C - X at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4529 | F06[N-N] | Frequency of N - N at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4530 | F06[N-O] | Frequency of N - O at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4531 | F06[N-S] | Frequency of N - S at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4532 | F06[N-P] | Frequency of N - P at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4533 | F06[N-F] | Frequency of N - F at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4534 | F06[N-Cl] | Frequency of N - Cl at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4535 | F06[N-Br] | Frequency of N - Br at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4536 | F06[N-I] | Frequency of N - I at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4537 | F06[N-B] | Frequency of N - B at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4538 | F06[N-Si] | Frequency of N - Si at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4539 | F06[N-X] | Frequency of N - X at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4540 | F06[O-O] | Frequency of O - O at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4541 | F06[O-S] | Frequency of O - S at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4542 | F06[O-P] | Frequency of O - P at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4543 | F06[O-F] | Frequency of O - F at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4544 | F06[O-Cl] | Frequency of O - Cl at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4545 | F06[O-Br] | Frequency of O - Br at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4546 | F06[O-I] | Frequency of O - I at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4547 | F06[O-B] | Frequency of O - B at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4548 | F06[O-Si] | Frequency of O - Si at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4549 | F06[O-X] | Frequency of O - X at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4550 | F06[S-S] | Frequency of S - S at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4551 | F06[S-P] | Frequency of S - P at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4552 | F06[S-F] | Frequency of S - F at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4553 | F06[S-Cl] | Frequency of S - Cl at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4554 | F06[S-Br] | Frequency of S - Br at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4555 | F06[S-I] | Frequency of S - I at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4556 | F06[S-B] | Frequency of S - B at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4557 | F06[S-Si] | Frequency of S - Si at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4558 | F06[S-X] | Frequency of S - X at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4559 | F06[P-P] | Frequency of P - P at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4560 | F06[P-F] | Frequency of P - F at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4561 | F06[P-Cl] | Frequency of P - Cl at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4562 | F06[P-Br] | Frequency of P - Br at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4563 | F06[P-I] | Frequency of P - I at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4564 | F06[P-B] | Frequency of P - B at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4565 | F06[P-Si] | Frequency of P - Si at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4566 | F06[P-X] | Frequency of P - X at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4567 | F06[F-F] | Frequency of F - F at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4568 | F06[F-Cl] | Frequency of F - Cl at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4569 | F06[F-Br] | Frequency of F - Br at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4570 | F06[F-I] | Frequency of F - I at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4571 | F06[F-B] | Frequency of F - B at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4572 | F06[F-Si] | Frequency of F - Si at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4573 | F06[F-X] | Frequency of F - X at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4574 | F06[Cl-Cl] | Frequency of Cl - Cl at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4575 | F06[Cl-Br] | Frequency of Cl - Br at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4576 | F06[Cl-I] | Frequency of Cl - I at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4577 | F06[Cl-B] | Frequency of Cl - B at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4578 | F06[Cl-Si] | Frequency of Cl - Si at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4579 | F06[Cl-X] | Frequency of Cl - X at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4580 | F06[Br-Br] | Frequency of Br - Br at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4581 | F06[Br-I] | Frequency of Br - I at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4582 | F06[Br-B] | Frequency of Br - B at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4583 | F06[Br-Si] | Frequency of Br - Si at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4584 | F06[Br-X] | Frequency of Br - X at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4585 | F06[I-I] | Frequency of I - I at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4586 | F06[I-B] | Frequency of I - B at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4587 | F06[I-Si] | Frequency of I - Si at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4588 | F06[I-X] | Frequency of I - X at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4589 | F06[B-B] | Frequency of B - B at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4590 | F06[B-Si] | Frequency of B - Si at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4591 | F06[B-X] | Frequency of B - X at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4592 | F06[Si-Si] | Frequency of Si - Si at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4593 | F06[Si-X] | Frequency of Si - X at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4594 | F06[X-X] | Frequency of X - X at topological distance 6 | 2D Atom Pairs | Frequency Atom Pairs of order 6 | 
| 4595 | F07[C-C] | Frequency of C - C at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4596 | F07[C-N] | Frequency of C - N at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4597 | F07[C-O] | Frequency of C - O at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4598 | F07[C-S] | Frequency of C - S at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4599 | F07[C-P] | Frequency of C - P at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4600 | F07[C-F] | Frequency of C - F at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4601 | F07[C-Cl] | Frequency of C - Cl at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4602 | F07[C-Br] | Frequency of C - Br at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4603 | F07[C-I] | Frequency of C - I at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4604 | F07[C-B] | Frequency of C - B at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4605 | F07[C-Si] | Frequency of C - Si at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4606 | F07[C-X] | Frequency of C - X at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4607 | F07[N-N] | Frequency of N - N at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4608 | F07[N-O] | Frequency of N - O at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4609 | F07[N-S] | Frequency of N - S at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4610 | F07[N-P] | Frequency of N - P at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4611 | F07[N-F] | Frequency of N - F at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4612 | F07[N-Cl] | Frequency of N - Cl at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4613 | F07[N-Br] | Frequency of N - Br at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4614 | F07[N-I] | Frequency of N - I at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4615 | F07[N-B] | Frequency of N - B at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4616 | F07[N-Si] | Frequency of N - Si at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4617 | F07[N-X] | Frequency of N - X at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4618 | F07[O-O] | Frequency of O - O at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4619 | F07[O-S] | Frequency of O - S at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4620 | F07[O-P] | Frequency of O - P at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4621 | F07[O-F] | Frequency of O - F at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4622 | F07[O-Cl] | Frequency of O - Cl at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4623 | F07[O-Br] | Frequency of O - Br at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4624 | F07[O-I] | Frequency of O - I at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4625 | F07[O-B] | Frequency of O - B at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4626 | F07[O-Si] | Frequency of O - Si at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4627 | F07[O-X] | Frequency of O - X at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4628 | F07[S-S] | Frequency of S - S at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4629 | F07[S-P] | Frequency of S - P at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4630 | F07[S-F] | Frequency of S - F at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4631 | F07[S-Cl] | Frequency of S - Cl at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4632 | F07[S-Br] | Frequency of S - Br at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4633 | F07[S-I] | Frequency of S - I at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4634 | F07[S-B] | Frequency of S - B at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4635 | F07[S-Si] | Frequency of S - Si at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4636 | F07[S-X] | Frequency of S - X at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4637 | F07[P-P] | Frequency of P - P at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4638 | F07[P-F] | Frequency of P - F at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4639 | F07[P-Cl] | Frequency of P - Cl at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4640 | F07[P-Br] | Frequency of P - Br at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4641 | F07[P-I] | Frequency of P - I at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4642 | F07[P-B] | Frequency of P - B at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4643 | F07[P-Si] | Frequency of P - Si at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4644 | F07[P-X] | Frequency of P - X at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4645 | F07[F-F] | Frequency of F - F at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4646 | F07[F-Cl] | Frequency of F - Cl at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4647 | F07[F-Br] | Frequency of F - Br at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4648 | F07[F-I] | Frequency of F - I at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4649 | F07[F-B] | Frequency of F - B at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4650 | F07[F-Si] | Frequency of F - Si at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4651 | F07[F-X] | Frequency of F - X at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4652 | F07[Cl-Cl] | Frequency of Cl - Cl at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4653 | F07[Cl-Br] | Frequency of Cl - Br at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4654 | F07[Cl-I] | Frequency of Cl - I at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4655 | F07[Cl-B] | Frequency of Cl - B at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4656 | F07[Cl-Si] | Frequency of Cl - Si at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4657 | F07[Cl-X] | Frequency of Cl - X at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4658 | F07[Br-Br] | Frequency of Br - Br at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4659 | F07[Br-I] | Frequency of Br - I at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4660 | F07[Br-B] | Frequency of Br - B at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4661 | F07[Br-Si] | Frequency of Br - Si at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4662 | F07[Br-X] | Frequency of Br - X at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4663 | F07[I-I] | Frequency of I - I at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4664 | F07[I-B] | Frequency of I - B at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4665 | F07[I-Si] | Frequency of I - Si at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4666 | F07[I-X] | Frequency of I - X at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4667 | F07[B-B] | Frequency of B - B at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4668 | F07[B-Si] | Frequency of B - Si at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4669 | F07[B-X] | Frequency of B - X at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4670 | F07[Si-Si] | Frequency of Si - Si at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4671 | F07[Si-X] | Frequency of Si - X at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4672 | F07[X-X] | Frequency of X - X at topological distance 7 | 2D Atom Pairs | Frequency Atom Pairs of order 7 | 
| 4673 | F08[C-C] | Frequency of C - C at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4674 | F08[C-N] | Frequency of C - N at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4675 | F08[C-O] | Frequency of C - O at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4676 | F08[C-S] | Frequency of C - S at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4677 | F08[C-P] | Frequency of C - P at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4678 | F08[C-F] | Frequency of C - F at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4679 | F08[C-Cl] | Frequency of C - Cl at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4680 | F08[C-Br] | Frequency of C - Br at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4681 | F08[C-I] | Frequency of C - I at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4682 | F08[C-B] | Frequency of C - B at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4683 | F08[C-Si] | Frequency of C - Si at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4684 | F08[C-X] | Frequency of C - X at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4685 | F08[N-N] | Frequency of N - N at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4686 | F08[N-O] | Frequency of N - O at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4687 | F08[N-S] | Frequency of N - S at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4688 | F08[N-P] | Frequency of N - P at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4689 | F08[N-F] | Frequency of N - F at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4690 | F08[N-Cl] | Frequency of N - Cl at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4691 | F08[N-Br] | Frequency of N - Br at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4692 | F08[N-I] | Frequency of N - I at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4693 | F08[N-B] | Frequency of N - B at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4694 | F08[N-Si] | Frequency of N - Si at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4695 | F08[N-X] | Frequency of N - X at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4696 | F08[O-O] | Frequency of O - O at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4697 | F08[O-S] | Frequency of O - S at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4698 | F08[O-P] | Frequency of O - P at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4699 | F08[O-F] | Frequency of O - F at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4700 | F08[O-Cl] | Frequency of O - Cl at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4701 | F08[O-Br] | Frequency of O - Br at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4702 | F08[O-I] | Frequency of O - I at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4703 | F08[O-B] | Frequency of O - B at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4704 | F08[O-Si] | Frequency of O - Si at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4705 | F08[O-X] | Frequency of O - X at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4706 | F08[S-S] | Frequency of S - S at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4707 | F08[S-P] | Frequency of S - P at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4708 | F08[S-F] | Frequency of S - F at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4709 | F08[S-Cl] | Frequency of S - Cl at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4710 | F08[S-Br] | Frequency of S - Br at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4711 | F08[S-I] | Frequency of S - I at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4712 | F08[S-B] | Frequency of S - B at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4713 | F08[S-Si] | Frequency of S - Si at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4714 | F08[S-X] | Frequency of S - X at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4715 | F08[P-P] | Frequency of P - P at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4716 | F08[P-F] | Frequency of P - F at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4717 | F08[P-Cl] | Frequency of P - Cl at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4718 | F08[P-Br] | Frequency of P - Br at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4719 | F08[P-I] | Frequency of P - I at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4720 | F08[P-B] | Frequency of P - B at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4721 | F08[P-Si] | Frequency of P - Si at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4722 | F08[P-X] | Frequency of P - X at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4723 | F08[F-F] | Frequency of F - F at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4724 | F08[F-Cl] | Frequency of F - Cl at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4725 | F08[F-Br] | Frequency of F - Br at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4726 | F08[F-I] | Frequency of F - I at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4727 | F08[F-B] | Frequency of F - B at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4728 | F08[F-Si] | Frequency of F - Si at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4729 | F08[F-X] | Frequency of F - X at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4730 | F08[Cl-Cl] | Frequency of Cl - Cl at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4731 | F08[Cl-Br] | Frequency of Cl - Br at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4732 | F08[Cl-I] | Frequency of Cl - I at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4733 | F08[Cl-B] | Frequency of Cl - B at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4734 | F08[Cl-Si] | Frequency of Cl - Si at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4735 | F08[Cl-X] | Frequency of Cl - X at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4736 | F08[Br-Br] | Frequency of Br - Br at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4737 | F08[Br-I] | Frequency of Br - I at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4738 | F08[Br-B] | Frequency of Br - B at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4739 | F08[Br-Si] | Frequency of Br - Si at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4740 | F08[Br-X] | Frequency of Br - X at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4741 | F08[I-I] | Frequency of I - I at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4742 | F08[I-B] | Frequency of I - B at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4743 | F08[I-Si] | Frequency of I - Si at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4744 | F08[I-X] | Frequency of I - X at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4745 | F08[B-B] | Frequency of B - B at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4746 | F08[B-Si] | Frequency of B - Si at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4747 | F08[B-X] | Frequency of B - X at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4748 | F08[Si-Si] | Frequency of Si - Si at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4749 | F08[Si-X] | Frequency of Si - X at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4750 | F08[X-X] | Frequency of X - X at topological distance 8 | 2D Atom Pairs | Frequency Atom Pairs of order 8 | 
| 4751 | F09[C-C] | Frequency of C - C at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4752 | F09[C-N] | Frequency of C - N at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4753 | F09[C-O] | Frequency of C - O at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4754 | F09[C-S] | Frequency of C - S at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4755 | F09[C-P] | Frequency of C - P at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4756 | F09[C-F] | Frequency of C - F at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4757 | F09[C-Cl] | Frequency of C - Cl at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4758 | F09[C-Br] | Frequency of C - Br at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4759 | F09[C-I] | Frequency of C - I at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4760 | F09[C-B] | Frequency of C - B at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4761 | F09[C-Si] | Frequency of C - Si at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4762 | F09[C-X] | Frequency of C - X at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4763 | F09[N-N] | Frequency of N - N at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4764 | F09[N-O] | Frequency of N - O at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4765 | F09[N-S] | Frequency of N - S at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4766 | F09[N-P] | Frequency of N - P at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4767 | F09[N-F] | Frequency of N - F at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4768 | F09[N-Cl] | Frequency of N - Cl at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4769 | F09[N-Br] | Frequency of N - Br at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4770 | F09[N-I] | Frequency of N - I at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4771 | F09[N-B] | Frequency of N - B at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4772 | F09[N-Si] | Frequency of N - Si at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4773 | F09[N-X] | Frequency of N - X at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4774 | F09[O-O] | Frequency of O - O at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4775 | F09[O-S] | Frequency of O - S at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4776 | F09[O-P] | Frequency of O - P at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4777 | F09[O-F] | Frequency of O - F at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4778 | F09[O-Cl] | Frequency of O - Cl at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4779 | F09[O-Br] | Frequency of O - Br at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4780 | F09[O-I] | Frequency of O - I at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4781 | F09[O-B] | Frequency of O - B at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4782 | F09[O-Si] | Frequency of O - Si at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4783 | F09[O-X] | Frequency of O - X at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4784 | F09[S-S] | Frequency of S - S at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4785 | F09[S-P] | Frequency of S - P at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4786 | F09[S-F] | Frequency of S - F at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4787 | F09[S-Cl] | Frequency of S - Cl at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4788 | F09[S-Br] | Frequency of S - Br at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4789 | F09[S-I] | Frequency of S - I at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4790 | F09[S-B] | Frequency of S - B at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4791 | F09[S-Si] | Frequency of S - Si at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4792 | F09[S-X] | Frequency of S - X at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4793 | F09[P-P] | Frequency of P - P at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4794 | F09[P-F] | Frequency of P - F at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4795 | F09[P-Cl] | Frequency of P - Cl at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4796 | F09[P-Br] | Frequency of P - Br at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4797 | F09[P-I] | Frequency of P - I at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4798 | F09[P-B] | Frequency of P - B at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4799 | F09[P-Si] | Frequency of P - Si at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4800 | F09[P-X] | Frequency of P - X at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4801 | F09[F-F] | Frequency of F - F at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4802 | F09[F-Cl] | Frequency of F - Cl at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4803 | F09[F-Br] | Frequency of F - Br at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4804 | F09[F-I] | Frequency of F - I at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4805 | F09[F-B] | Frequency of F - B at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4806 | F09[F-Si] | Frequency of F - Si at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4807 | F09[F-X] | Frequency of F - X at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4808 | F09[Cl-Cl] | Frequency of Cl - Cl at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4809 | F09[Cl-Br] | Frequency of Cl - Br at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4810 | F09[Cl-I] | Frequency of Cl - I at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4811 | F09[Cl-B] | Frequency of Cl - B at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4812 | F09[Cl-Si] | Frequency of Cl - Si at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4813 | F09[Cl-X] | Frequency of Cl - X at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4814 | F09[Br-Br] | Frequency of Br - Br at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4815 | F09[Br-I] | Frequency of Br - I at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4816 | F09[Br-B] | Frequency of Br - B at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4817 | F09[Br-Si] | Frequency of Br - Si at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4818 | F09[Br-X] | Frequency of Br - X at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4819 | F09[I-I] | Frequency of I - I at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4820 | F09[I-B] | Frequency of I - B at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4821 | F09[I-Si] | Frequency of I - Si at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4822 | F09[I-X] | Frequency of I - X at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4823 | F09[B-B] | Frequency of B - B at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4824 | F09[B-Si] | Frequency of B - Si at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4825 | F09[B-X] | Frequency of B - X at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4826 | F09[Si-Si] | Frequency of Si - Si at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4827 | F09[Si-X] | Frequency of Si - X at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4828 | F09[X-X] | Frequency of X - X at topological distance 9 | 2D Atom Pairs | Frequency Atom Pairs of order 9 | 
| 4829 | F10[C-C] | Frequency of C - C at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4830 | F10[C-N] | Frequency of C - N at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4831 | F10[C-O] | Frequency of C - O at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4832 | F10[C-S] | Frequency of C - S at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4833 | F10[C-P] | Frequency of C - P at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4834 | F10[C-F] | Frequency of C - F at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4835 | F10[C-Cl] | Frequency of C - Cl at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4836 | F10[C-Br] | Frequency of C - Br at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4837 | F10[C-I] | Frequency of C - I at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4838 | F10[C-B] | Frequency of C - B at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4839 | F10[C-Si] | Frequency of C - Si at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4840 | F10[C-X] | Frequency of C - X at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4841 | F10[N-N] | Frequency of N - N at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4842 | F10[N-O] | Frequency of N - O at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4843 | F10[N-S] | Frequency of N - S at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4844 | F10[N-P] | Frequency of N - P at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4845 | F10[N-F] | Frequency of N - F at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4846 | F10[N-Cl] | Frequency of N - Cl at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4847 | F10[N-Br] | Frequency of N - Br at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4848 | F10[N-I] | Frequency of N - I at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4849 | F10[N-B] | Frequency of N - B at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4850 | F10[N-Si] | Frequency of N - Si at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4851 | F10[N-X] | Frequency of N - X at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4852 | F10[O-O] | Frequency of O - O at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4853 | F10[O-S] | Frequency of O - S at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4854 | F10[O-P] | Frequency of O - P at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4855 | F10[O-F] | Frequency of O - F at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4856 | F10[O-Cl] | Frequency of O - Cl at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4857 | F10[O-Br] | Frequency of O - Br at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4858 | F10[O-I] | Frequency of O - I at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4859 | F10[O-B] | Frequency of O - B at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4860 | F10[O-Si] | Frequency of O - Si at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4861 | F10[O-X] | Frequency of O - X at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4862 | F10[S-S] | Frequency of S - S at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4863 | F10[S-P] | Frequency of S - P at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4864 | F10[S-F] | Frequency of S - F at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4865 | F10[S-Cl] | Frequency of S - Cl at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4866 | F10[S-Br] | Frequency of S - Br at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4867 | F10[S-I] | Frequency of S - I at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4868 | F10[S-B] | Frequency of S - B at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4869 | F10[S-Si] | Frequency of S - Si at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4870 | F10[S-X] | Frequency of S - X at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4871 | F10[P-P] | Frequency of P - P at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4872 | F10[P-F] | Frequency of P - F at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4873 | F10[P-Cl] | Frequency of P - Cl at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4874 | F10[P-Br] | Frequency of P - Br at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4875 | F10[P-I] | Frequency of P - I at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4876 | F10[P-B] | Frequency of P - B at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4877 | F10[P-Si] | Frequency of P - Si at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4878 | F10[P-X] | Frequency of P - X at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4879 | F10[F-F] | Frequency of F - F at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4880 | F10[F-Cl] | Frequency of F - Cl at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4881 | F10[F-Br] | Frequency of F - Br at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4882 | F10[F-I] | Frequency of F - I at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4883 | F10[F-B] | Frequency of F - B at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4884 | F10[F-Si] | Frequency of F - Si at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4885 | F10[F-X] | Frequency of F - X at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4886 | F10[Cl-Cl] | Frequency of Cl - Cl at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4887 | F10[Cl-Br] | Frequency of Cl - Br at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4888 | F10[Cl-I] | Frequency of Cl - I at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4889 | F10[Cl-B] | Frequency of Cl - B at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4890 | F10[Cl-Si] | Frequency of Cl - Si at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4891 | F10[Cl-X] | Frequency of Cl - X at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4892 | F10[Br-Br] | Frequency of Br - Br at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4893 | F10[Br-I] | Frequency of Br - I at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4894 | F10[Br-B] | Frequency of Br - B at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4895 | F10[Br-Si] | Frequency of Br - Si at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4896 | F10[Br-X] | Frequency of Br - X at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4897 | F10[I-I] | Frequency of I - I at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4898 | F10[I-B] | Frequency of I - B at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4899 | F10[I-Si] | Frequency of I - Si at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4900 | F10[I-X] | Frequency of I - X at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4901 | F10[B-B] | Frequency of B - B at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4902 | F10[B-Si] | Frequency of B - Si at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4903 | F10[B-X] | Frequency of B - X at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4904 | F10[Si-Si] | Frequency of Si - Si at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4905 | F10[Si-X] | Frequency of Si - X at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4906 | F10[X-X] | Frequency of X - X at topological distance 10 | 2D Atom Pairs | Frequency Atom Pairs of order 10 | 
| 4907 | G(N..N) | sum of geometrical distances between N..N | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4908 | G(N..O) | sum of geometrical distances between N..O | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4909 | G(N..S) | sum of geometrical distances between N..S | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4910 | G(N..P) | sum of geometrical distances between N..P | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4911 | G(N..F) | sum of geometrical distances between N..F | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4912 | G(N..Cl) | sum of geometrical distances between N..Cl | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4913 | G(N..Br) | sum of geometrical distances between N..Br | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4914 | G(N..I) | sum of geometrical distances between N..I | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4915 | G(O..O) | sum of geometrical distances between O..O | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4916 | G(O..S) | sum of geometrical distances between O..S | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4917 | G(O..P) | sum of geometrical distances between O..P | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4918 | G(O..F) | sum of geometrical distances between O..F | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4919 | G(O..Cl) | sum of geometrical distances between O..Cl | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4920 | G(O..Br) | sum of geometrical distances between O..Br | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4921 | G(O..I) | sum of geometrical distances between O..I | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4922 | G(S..S) | sum of geometrical distances between S..S | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4923 | G(S..P) | sum of geometrical distances between S..P | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4924 | G(S..F) | sum of geometrical distances between S..F | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4925 | G(S..Cl) | sum of geometrical distances between S..Cl | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4926 | G(S..Br) | sum of geometrical distances between S..Br | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4927 | G(S..I) | sum of geometrical distances between S..I | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4928 | G(P..P) | sum of geometrical distances between P..P | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4929 | G(P..F) | sum of geometrical distances between P..F | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4930 | G(P..Cl) | sum of geometrical distances between P..Cl | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4931 | G(P..Br) | sum of geometrical distances between P..Br | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4932 | G(P..I) | sum of geometrical distances between P..I | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4933 | G(F..F) | sum of geometrical distances between F..F | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4934 | G(F..Cl) | sum of geometrical distances between F..Cl | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4935 | G(F..Br) | sum of geometrical distances between F..Br | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4936 | G(F..I) | sum of geometrical distances between F..I | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4937 | G(Cl..Cl) | sum of geometrical distances between Cl..Cl | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4938 | G(Cl..Br) | sum of geometrical distances between Cl..Br | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4939 | G(Cl..I) | sum of geometrical distances between Cl..I | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4940 | G(Br..Br) | sum of geometrical distances between Br..Br | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4941 | G(Br..I) | sum of geometrical distances between Br..I | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4942 | G(I..I) | sum of geometrical distances between I..I | 3D Atom Pairs | Weighted geometrical atom pairs | 
| 4943 | qpmax | maximum positive charge | Charge descriptors | Basic descriptors | 
| 4944 | qnmax | maximum negative charge | Charge descriptors | Basic descriptors | 
| 4945 | Qpos | total positive charge | Charge descriptors | Basic descriptors | 
| 4946 | Qneg | total negative charge | Charge descriptors | Basic descriptors | 
| 4947 | Qtot | total absolute charge (electronic charge index - ECI) | Charge descriptors | Basic descriptors | 
| 4948 | Qmean | mean absolute charge (charge polarization) | Charge descriptors | Basic descriptors | 
| 4949 | Q2 | total squared charge | Charge descriptors | Basic descriptors | 
| 4950 | RPCG | relative positive charge | Charge descriptors | Basic descriptors | 
| 4951 | RNCG | relative negative charge | Charge descriptors | Basic descriptors | 
| 4952 | SPP | submolecular polarity parameter | Charge descriptors | Basic descriptors | 
| 4953 | TE1 | topographic electronic descriptor | Charge descriptors | Basic descriptors | 
| 4954 | TE2 | topographic electronic descriptor (bond resctricted) | Charge descriptors | Basic descriptors | 
| 4955 | PCWTE1 | partial charge weighted topological electronic index | Charge descriptors | Basic descriptors | 
| 4956 | PCWTE2 | partial charge weighted topological electronic index (bond resctricted) | Charge descriptors | Basic descriptors | 
| 4957 | LDI | local dipole index | Charge descriptors | Basic descriptors | 
| 4958 | Uc | unsaturation count | Molecular properties | Basic descriptors | 
| 4959 | Ui | unsaturation index | Molecular properties | Basic descriptors | 
| 4960 | Hy | hydrophilic factor | Molecular properties | Basic descriptors | 
| 4961 | AMR | Ghose-Crippen molar refractivity | Molecular properties | Basic descriptors | 
| 4962 | TPSA(NO) | topological polar surface area using N,O polar contributions | Molecular properties | Basic descriptors | 
| 4963 | TPSA(Tot) | topological polar surface area using N,O,S,P polar contributions | Molecular properties | Basic descriptors | 
| 4964 | MLOGP | Moriguchi octanol-water partition coeff. (logP) | Molecular properties | Basic descriptors | 
| 4965 | MLOGP2 | squared Moriguchi octanol-water partition coeff. (logP^2) | Molecular properties | Basic descriptors | 
| 4966 | ALOGP | Ghose-Crippen octanol-water partition coeff. (logP) | Molecular properties | Basic descriptors | 
| 4967 | ALOGP2 | squared Ghose-Crippen octanol-water partition coeff. (logP^2) | Molecular properties | Basic descriptors | 
| 4968 | SAtot | total surface area from P_VSA-like descriptors | Molecular properties | Basic descriptors | 
| 4969 | SAacc | surface area of acceptor atoms from P_VSA-like descriptors | Molecular properties | Basic descriptors | 
| 4970 | SAdon | surface area of donor atoms from P_VSA-like descriptors | Molecular properties | Basic descriptors | 
| 4971 | Vx | McGowan volume | Molecular properties | Basic descriptors | 
| 4972 | VvdwMG | van der Waals volume from McGowan volume | Molecular properties | Basic descriptors | 
| 4973 | VvdwZAZ | van der Waals volume from Zhao-Abraham-Zissimos equation | Molecular properties | Basic descriptors | 
| 4974 | PDI | packing density index | Molecular properties | Basic descriptors | 
| 4975 | BLTF96 | Verhaar Fish base-line toxicity from MLOGP (mmol/l) | Molecular properties | Basic descriptors | 
| 4976 | BLTD48 | Verhaar Daphnia base-line toxicity from MLOGP (mmol/l) | Molecular properties | Basic descriptors | 
| 4977 | BLTA96 | Verhaar Algae base-line toxicity from MLOGP (mmol/l) | Molecular properties | Basic descriptors | 
| 4978 | Ro5 | Lipinski Rule of 5 | Drug-like indices | Basic indices | 
| 4979 | cRo5 | Complementary Lipinski Alert index | Drug-like indices | Basic indices | 
| 4980 | DLS_01 | modified drug-like score from Lipinski (4 rules) | Drug-like indices | Basic indices | 
| 4981 | DLS_02 | modified drug-like score from Oprea et al. (6 rules) | Drug-like indices | Basic indices | 
| 4982 | DLS_03 | modified drug-like score from Walters et al. (6 rules) | Drug-like indices | Basic indices | 
| 4983 | DLS_04 | modified drug-like score from Chen et al. (7 rules) | Drug-like indices | Basic indices | 
| 4984 | DLS_05 | modified drug-like score from Zheng et al. (2 rules) | Drug-like indices | Basic indices | 
| 4985 | DLS_06 | modified drug-like score from Rishton (6 rules) | Drug-like indices | Basic indices | 
| 4986 | DLS_07 | modified drug-like score from Veber et al. (2 rules) | Drug-like indices | Basic indices | 
| 4987 | DLS_cons | DRAGON consensus drug-like score | Drug-like indices | Basic indices | 
| 4988 | LLS_01 | modified lead-like score from Congreve et al. (6 rules) | Drug-like indices | Basic indices | 
| 4989 | LLS_02 | modified lead-like score from Monge et al. (8 rules) | Drug-like indices | Basic indices | 
| 4990 | CMC-80 | Ghose-Viswanadhan-Wendoloski CMC drug-like index at 80% | Drug-like indices | Basic indices | 
| 4991 | CMC-50 | Ghose-Viswanadhan-Wendoloski CMC drug-like index at 50% | Drug-like indices | Basic indices | 
| 4992 | Inflammat-80 | Ghose-Viswanadhan-Wendoloski antiinflammatory-like index at 80% | Drug-like indices | Basic indices | 
| 4993 | Inflammat-50 | Ghose-Viswanadhan-Wendoloski antiinflammatory-like index at 50% | Drug-like indices | Basic indices | 
| 4994 | Depressant-80 | Ghose-Viswanadhan-Wendoloski antidepressant-like index at 80% | Drug-like indices | Basic indices | 
| 4995 | Depressant-50 | Ghose-Viswanadhan-Wendoloski antidepressant-like index at 50% | Drug-like indices | Basic indices | 
| 4996 | Psychotic-80 | Ghose-Viswanadhan-Wendoloski antipsychotic-like index at 80% | Drug-like indices | Basic indices | 
| 4997 | Psychotic-50 | Ghose-Viswanadhan-Wendoloski antipsychotic-like index at 50% | Drug-like indices | Basic indices | 
| 4998 | Hypertens-80 | Ghose-Viswanadhan-Wendoloski antihypertensive-like index at 80% | Drug-like indices | Basic indices | 
| 4999 | Hypertens-50 | Ghose-Viswanadhan-Wendoloski antihypertensive-like index at 50% | Drug-like indices | Basic indices | 
| 5000 | Hypnotic-80 | Ghose-Viswanadhan-Wendoloski hypnotic-like index at 80% | Drug-like indices | Basic indices | 
| 5001 | Hypnotic-50 | Ghose-Viswanadhan-Wendoloski hypnotic-like index at 50% | Drug-like indices | Basic indices | 
| 5002 | Neoplastic-80 | Ghose-Viswanadhan-Wendoloski antineoplastic-like index at 80% | Drug-like indices | Basic indices | 
| 5003 | Neoplastic-50 | Ghose-Viswanadhan-Wendoloski antineoplastic-like index at 50% | Drug-like indices | Basic indices | 
| 5004 | Infective-80 | Ghose-Viswanadhan-Wendoloski antiinfective-like index at 80% | Drug-like indices | Basic indices | 
| 5005 | Infective-50 | Ghose-Viswanadhan-Wendoloski antiinfective-like index at 50% | Drug-like indices | Basic indices | 
| 5006 | CATS3D_00_DD | CATS3D Donor-Donor BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5007 | CATS3D_01_DD | CATS3D Donor-Donor BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5008 | CATS3D_02_DD | CATS3D Donor-Donor BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5009 | CATS3D_03_DD | CATS3D Donor-Donor BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5010 | CATS3D_04_DD | CATS3D Donor-Donor BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5011 | CATS3D_05_DD | CATS3D Donor-Donor BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5012 | CATS3D_06_DD | CATS3D Donor-Donor BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5013 | CATS3D_07_DD | CATS3D Donor-Donor BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5014 | CATS3D_08_DD | CATS3D Donor-Donor BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5015 | CATS3D_09_DD | CATS3D Donor-Donor BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5016 | CATS3D_10_DD | CATS3D Donor-Donor BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5017 | CATS3D_11_DD | CATS3D Donor-Donor BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5018 | CATS3D_12_DD | CATS3D Donor-Donor BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5019 | CATS3D_13_DD | CATS3D Donor-Donor BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5020 | CATS3D_14_DD | CATS3D Donor-Donor BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5021 | CATS3D_15_DD | CATS3D Donor-Donor BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5022 | CATS3D_16_DD | CATS3D Donor-Donor BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5023 | CATS3D_17_DD | CATS3D Donor-Donor BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5024 | CATS3D_18_DD | CATS3D Donor-Donor BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5025 | CATS3D_19_DD | CATS3D Donor-Donor BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5026 | CATS3D_00_DA | CATS3D Donor-Acceptor BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5027 | CATS3D_01_DA | CATS3D Donor-Acceptor BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5028 | CATS3D_02_DA | CATS3D Donor-Acceptor BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5029 | CATS3D_03_DA | CATS3D Donor-Acceptor BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5030 | CATS3D_04_DA | CATS3D Donor-Acceptor BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5031 | CATS3D_05_DA | CATS3D Donor-Acceptor BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5032 | CATS3D_06_DA | CATS3D Donor-Acceptor BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5033 | CATS3D_07_DA | CATS3D Donor-Acceptor BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5034 | CATS3D_08_DA | CATS3D Donor-Acceptor BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5035 | CATS3D_09_DA | CATS3D Donor-Acceptor BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5036 | CATS3D_10_DA | CATS3D Donor-Acceptor BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5037 | CATS3D_11_DA | CATS3D Donor-Acceptor BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5038 | CATS3D_12_DA | CATS3D Donor-Acceptor BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5039 | CATS3D_13_DA | CATS3D Donor-Acceptor BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5040 | CATS3D_14_DA | CATS3D Donor-Acceptor BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5041 | CATS3D_15_DA | CATS3D Donor-Acceptor BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5042 | CATS3D_16_DA | CATS3D Donor-Acceptor BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5043 | CATS3D_17_DA | CATS3D Donor-Acceptor BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5044 | CATS3D_18_DA | CATS3D Donor-Acceptor BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5045 | CATS3D_19_DA | CATS3D Donor-Acceptor BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5046 | CATS3D_00_DP | CATS3D Donor-Positive BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5047 | CATS3D_01_DP | CATS3D Donor-Positive BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5048 | CATS3D_02_DP | CATS3D Donor-Positive BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5049 | CATS3D_03_DP | CATS3D Donor-Positive BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5050 | CATS3D_04_DP | CATS3D Donor-Positive BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5051 | CATS3D_05_DP | CATS3D Donor-Positive BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5052 | CATS3D_06_DP | CATS3D Donor-Positive BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5053 | CATS3D_07_DP | CATS3D Donor-Positive BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5054 | CATS3D_08_DP | CATS3D Donor-Positive BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5055 | CATS3D_09_DP | CATS3D Donor-Positive BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5056 | CATS3D_10_DP | CATS3D Donor-Positive BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5057 | CATS3D_11_DP | CATS3D Donor-Positive BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5058 | CATS3D_12_DP | CATS3D Donor-Positive BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5059 | CATS3D_13_DP | CATS3D Donor-Positive BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5060 | CATS3D_14_DP | CATS3D Donor-Positive BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5061 | CATS3D_15_DP | CATS3D Donor-Positive BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5062 | CATS3D_16_DP | CATS3D Donor-Positive BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5063 | CATS3D_17_DP | CATS3D Donor-Positive BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5064 | CATS3D_18_DP | CATS3D Donor-Positive BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5065 | CATS3D_19_DP | CATS3D Donor-Positive BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5066 | CATS3D_00_DN | CATS3D Donor-Negative BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5067 | CATS3D_01_DN | CATS3D Donor-Negative BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5068 | CATS3D_02_DN | CATS3D Donor-Negative BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5069 | CATS3D_03_DN | CATS3D Donor-Negative BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5070 | CATS3D_04_DN | CATS3D Donor-Negative BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5071 | CATS3D_05_DN | CATS3D Donor-Negative BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5072 | CATS3D_06_DN | CATS3D Donor-Negative BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5073 | CATS3D_07_DN | CATS3D Donor-Negative BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5074 | CATS3D_08_DN | CATS3D Donor-Negative BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5075 | CATS3D_09_DN | CATS3D Donor-Negative BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5076 | CATS3D_10_DN | CATS3D Donor-Negative BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5077 | CATS3D_11_DN | CATS3D Donor-Negative BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5078 | CATS3D_12_DN | CATS3D Donor-Negative BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5079 | CATS3D_13_DN | CATS3D Donor-Negative BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5080 | CATS3D_14_DN | CATS3D Donor-Negative BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5081 | CATS3D_15_DN | CATS3D Donor-Negative BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5082 | CATS3D_16_DN | CATS3D Donor-Negative BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5083 | CATS3D_17_DN | CATS3D Donor-Negative BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5084 | CATS3D_18_DN | CATS3D Donor-Negative BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5085 | CATS3D_19_DN | CATS3D Donor-Negative BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5086 | CATS3D_00_DL | CATS3D Donor-Lipophilic BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5087 | CATS3D_01_DL | CATS3D Donor-Lipophilic BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5088 | CATS3D_02_DL | CATS3D Donor-Lipophilic BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5089 | CATS3D_03_DL | CATS3D Donor-Lipophilic BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5090 | CATS3D_04_DL | CATS3D Donor-Lipophilic BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5091 | CATS3D_05_DL | CATS3D Donor-Lipophilic BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5092 | CATS3D_06_DL | CATS3D Donor-Lipophilic BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5093 | CATS3D_07_DL | CATS3D Donor-Lipophilic BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5094 | CATS3D_08_DL | CATS3D Donor-Lipophilic BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5095 | CATS3D_09_DL | CATS3D Donor-Lipophilic BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5096 | CATS3D_10_DL | CATS3D Donor-Lipophilic BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5097 | CATS3D_11_DL | CATS3D Donor-Lipophilic BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5098 | CATS3D_12_DL | CATS3D Donor-Lipophilic BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5099 | CATS3D_13_DL | CATS3D Donor-Lipophilic BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5100 | CATS3D_14_DL | CATS3D Donor-Lipophilic BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5101 | CATS3D_15_DL | CATS3D Donor-Lipophilic BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5102 | CATS3D_16_DL | CATS3D Donor-Lipophilic BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5103 | CATS3D_17_DL | CATS3D Donor-Lipophilic BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5104 | CATS3D_18_DL | CATS3D Donor-Lipophilic BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5105 | CATS3D_19_DL | CATS3D Donor-Lipophilic BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5106 | CATS3D_00_AA | CATS3D Acceptor-Acceptor BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5107 | CATS3D_01_AA | CATS3D Acceptor-Acceptor BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5108 | CATS3D_02_AA | CATS3D Acceptor-Acceptor BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5109 | CATS3D_03_AA | CATS3D Acceptor-Acceptor BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5110 | CATS3D_04_AA | CATS3D Acceptor-Acceptor BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5111 | CATS3D_05_AA | CATS3D Acceptor-Acceptor BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5112 | CATS3D_06_AA | CATS3D Acceptor-Acceptor BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5113 | CATS3D_07_AA | CATS3D Acceptor-Acceptor BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5114 | CATS3D_08_AA | CATS3D Acceptor-Acceptor BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5115 | CATS3D_09_AA | CATS3D Acceptor-Acceptor BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5116 | CATS3D_10_AA | CATS3D Acceptor-Acceptor BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5117 | CATS3D_11_AA | CATS3D Acceptor-Acceptor BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5118 | CATS3D_12_AA | CATS3D Acceptor-Acceptor BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5119 | CATS3D_13_AA | CATS3D Acceptor-Acceptor BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5120 | CATS3D_14_AA | CATS3D Acceptor-Acceptor BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5121 | CATS3D_15_AA | CATS3D Acceptor-Acceptor BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5122 | CATS3D_16_AA | CATS3D Acceptor-Acceptor BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5123 | CATS3D_17_AA | CATS3D Acceptor-Acceptor BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5124 | CATS3D_18_AA | CATS3D Acceptor-Acceptor BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5125 | CATS3D_19_AA | CATS3D Acceptor-Acceptor BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5126 | CATS3D_00_AP | CATS3D Acceptor-Positive BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5127 | CATS3D_01_AP | CATS3D Acceptor-Positive BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5128 | CATS3D_02_AP | CATS3D Acceptor-Positive BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5129 | CATS3D_03_AP | CATS3D Acceptor-Positive BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5130 | CATS3D_04_AP | CATS3D Acceptor-Positive BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5131 | CATS3D_05_AP | CATS3D Acceptor-Positive BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5132 | CATS3D_06_AP | CATS3D Acceptor-Positive BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5133 | CATS3D_07_AP | CATS3D Acceptor-Positive BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5134 | CATS3D_08_AP | CATS3D Acceptor-Positive BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5135 | CATS3D_09_AP | CATS3D Acceptor-Positive BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5136 | CATS3D_10_AP | CATS3D Acceptor-Positive BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5137 | CATS3D_11_AP | CATS3D Acceptor-Positive BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5138 | CATS3D_12_AP | CATS3D Acceptor-Positive BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5139 | CATS3D_13_AP | CATS3D Acceptor-Positive BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5140 | CATS3D_14_AP | CATS3D Acceptor-Positive BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5141 | CATS3D_15_AP | CATS3D Acceptor-Positive BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5142 | CATS3D_16_AP | CATS3D Acceptor-Positive BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5143 | CATS3D_17_AP | CATS3D Acceptor-Positive BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5144 | CATS3D_18_AP | CATS3D Acceptor-Positive BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5145 | CATS3D_19_AP | CATS3D Acceptor-Positive BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5146 | CATS3D_00_AN | CATS3D Acceptor-Negative BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5147 | CATS3D_01_AN | CATS3D Acceptor-Negative BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5148 | CATS3D_02_AN | CATS3D Acceptor-Negative BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5149 | CATS3D_03_AN | CATS3D Acceptor-Negative BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5150 | CATS3D_04_AN | CATS3D Acceptor-Negative BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5151 | CATS3D_05_AN | CATS3D Acceptor-Negative BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5152 | CATS3D_06_AN | CATS3D Acceptor-Negative BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5153 | CATS3D_07_AN | CATS3D Acceptor-Negative BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5154 | CATS3D_08_AN | CATS3D Acceptor-Negative BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5155 | CATS3D_09_AN | CATS3D Acceptor-Negative BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5156 | CATS3D_10_AN | CATS3D Acceptor-Negative BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5157 | CATS3D_11_AN | CATS3D Acceptor-Negative BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5158 | CATS3D_12_AN | CATS3D Acceptor-Negative BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5159 | CATS3D_13_AN | CATS3D Acceptor-Negative BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5160 | CATS3D_14_AN | CATS3D Acceptor-Negative BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5161 | CATS3D_15_AN | CATS3D Acceptor-Negative BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5162 | CATS3D_16_AN | CATS3D Acceptor-Negative BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5163 | CATS3D_17_AN | CATS3D Acceptor-Negative BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5164 | CATS3D_18_AN | CATS3D Acceptor-Negative BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5165 | CATS3D_19_AN | CATS3D Acceptor-Negative BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5166 | CATS3D_00_AL | CATS3D Acceptor-Lipophilic BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5167 | CATS3D_01_AL | CATS3D Acceptor-Lipophilic BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5168 | CATS3D_02_AL | CATS3D Acceptor-Lipophilic BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5169 | CATS3D_03_AL | CATS3D Acceptor-Lipophilic BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5170 | CATS3D_04_AL | CATS3D Acceptor-Lipophilic BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5171 | CATS3D_05_AL | CATS3D Acceptor-Lipophilic BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5172 | CATS3D_06_AL | CATS3D Acceptor-Lipophilic BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5173 | CATS3D_07_AL | CATS3D Acceptor-Lipophilic BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5174 | CATS3D_08_AL | CATS3D Acceptor-Lipophilic BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5175 | CATS3D_09_AL | CATS3D Acceptor-Lipophilic BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5176 | CATS3D_10_AL | CATS3D Acceptor-Lipophilic BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5177 | CATS3D_11_AL | CATS3D Acceptor-Lipophilic BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5178 | CATS3D_12_AL | CATS3D Acceptor-Lipophilic BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5179 | CATS3D_13_AL | CATS3D Acceptor-Lipophilic BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5180 | CATS3D_14_AL | CATS3D Acceptor-Lipophilic BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5181 | CATS3D_15_AL | CATS3D Acceptor-Lipophilic BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5182 | CATS3D_16_AL | CATS3D Acceptor-Lipophilic BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5183 | CATS3D_17_AL | CATS3D Acceptor-Lipophilic BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5184 | CATS3D_18_AL | CATS3D Acceptor-Lipophilic BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5185 | CATS3D_19_AL | CATS3D Acceptor-Lipophilic BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5186 | CATS3D_00_PP | CATS3D Positive-Positive BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5187 | CATS3D_01_PP | CATS3D Positive-Positive BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5188 | CATS3D_02_PP | CATS3D Positive-Positive BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5189 | CATS3D_03_PP | CATS3D Positive-Positive BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5190 | CATS3D_04_PP | CATS3D Positive-Positive BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5191 | CATS3D_05_PP | CATS3D Positive-Positive BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5192 | CATS3D_06_PP | CATS3D Positive-Positive BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5193 | CATS3D_07_PP | CATS3D Positive-Positive BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5194 | CATS3D_08_PP | CATS3D Positive-Positive BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5195 | CATS3D_09_PP | CATS3D Positive-Positive BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5196 | CATS3D_10_PP | CATS3D Positive-Positive BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5197 | CATS3D_11_PP | CATS3D Positive-Positive BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5198 | CATS3D_12_PP | CATS3D Positive-Positive BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5199 | CATS3D_13_PP | CATS3D Positive-Positive BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5200 | CATS3D_14_PP | CATS3D Positive-Positive BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5201 | CATS3D_15_PP | CATS3D Positive-Positive BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5202 | CATS3D_16_PP | CATS3D Positive-Positive BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5203 | CATS3D_17_PP | CATS3D Positive-Positive BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5204 | CATS3D_18_PP | CATS3D Positive-Positive BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5205 | CATS3D_19_PP | CATS3D Positive-Positive BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5206 | CATS3D_00_PN | CATS3D Positive-Negative BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5207 | CATS3D_01_PN | CATS3D Positive-Negative BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5208 | CATS3D_02_PN | CATS3D Positive-Negative BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5209 | CATS3D_03_PN | CATS3D Positive-Negative BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5210 | CATS3D_04_PN | CATS3D Positive-Negative BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5211 | CATS3D_05_PN | CATS3D Positive-Negative BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5212 | CATS3D_06_PN | CATS3D Positive-Negative BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5213 | CATS3D_07_PN | CATS3D Positive-Negative BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5214 | CATS3D_08_PN | CATS3D Positive-Negative BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5215 | CATS3D_09_PN | CATS3D Positive-Negative BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5216 | CATS3D_10_PN | CATS3D Positive-Negative BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5217 | CATS3D_11_PN | CATS3D Positive-Negative BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5218 | CATS3D_12_PN | CATS3D Positive-Negative BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5219 | CATS3D_13_PN | CATS3D Positive-Negative BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5220 | CATS3D_14_PN | CATS3D Positive-Negative BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5221 | CATS3D_15_PN | CATS3D Positive-Negative BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5222 | CATS3D_16_PN | CATS3D Positive-Negative BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5223 | CATS3D_17_PN | CATS3D Positive-Negative BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5224 | CATS3D_18_PN | CATS3D Positive-Negative BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5225 | CATS3D_19_PN | CATS3D Positive-Negative BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5226 | CATS3D_00_PL | CATS3D Positive-Lipophilic BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5227 | CATS3D_01_PL | CATS3D Positive-Lipophilic BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5228 | CATS3D_02_PL | CATS3D Positive-Lipophilic BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5229 | CATS3D_03_PL | CATS3D Positive-Lipophilic BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5230 | CATS3D_04_PL | CATS3D Positive-Lipophilic BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5231 | CATS3D_05_PL | CATS3D Positive-Lipophilic BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5232 | CATS3D_06_PL | CATS3D Positive-Lipophilic BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5233 | CATS3D_07_PL | CATS3D Positive-Lipophilic BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5234 | CATS3D_08_PL | CATS3D Positive-Lipophilic BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5235 | CATS3D_09_PL | CATS3D Positive-Lipophilic BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5236 | CATS3D_10_PL | CATS3D Positive-Lipophilic BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5237 | CATS3D_11_PL | CATS3D Positive-Lipophilic BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5238 | CATS3D_12_PL | CATS3D Positive-Lipophilic BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5239 | CATS3D_13_PL | CATS3D Positive-Lipophilic BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5240 | CATS3D_14_PL | CATS3D Positive-Lipophilic BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5241 | CATS3D_15_PL | CATS3D Positive-Lipophilic BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5242 | CATS3D_16_PL | CATS3D Positive-Lipophilic BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5243 | CATS3D_17_PL | CATS3D Positive-Lipophilic BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5244 | CATS3D_18_PL | CATS3D Positive-Lipophilic BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5245 | CATS3D_19_PL | CATS3D Positive-Lipophilic BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5246 | CATS3D_00_NN | CATS3D Negative-Negative BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5247 | CATS3D_01_NN | CATS3D Negative-Negative BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5248 | CATS3D_02_NN | CATS3D Negative-Negative BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5249 | CATS3D_03_NN | CATS3D Negative-Negative BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5250 | CATS3D_04_NN | CATS3D Negative-Negative BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5251 | CATS3D_05_NN | CATS3D Negative-Negative BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5252 | CATS3D_06_NN | CATS3D Negative-Negative BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5253 | CATS3D_07_NN | CATS3D Negative-Negative BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5254 | CATS3D_08_NN | CATS3D Negative-Negative BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5255 | CATS3D_09_NN | CATS3D Negative-Negative BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5256 | CATS3D_10_NN | CATS3D Negative-Negative BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5257 | CATS3D_11_NN | CATS3D Negative-Negative BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5258 | CATS3D_12_NN | CATS3D Negative-Negative BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5259 | CATS3D_13_NN | CATS3D Negative-Negative BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5260 | CATS3D_14_NN | CATS3D Negative-Negative BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5261 | CATS3D_15_NN | CATS3D Negative-Negative BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5262 | CATS3D_16_NN | CATS3D Negative-Negative BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5263 | CATS3D_17_NN | CATS3D Negative-Negative BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5264 | CATS3D_18_NN | CATS3D Negative-Negative BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5265 | CATS3D_19_NN | CATS3D Negative-Negative BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5266 | CATS3D_00_NL | CATS3D Negative-Lipophilic BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5267 | CATS3D_01_NL | CATS3D Negative-Lipophilic BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5268 | CATS3D_02_NL | CATS3D Negative-Lipophilic BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5269 | CATS3D_03_NL | CATS3D Negative-Lipophilic BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5270 | CATS3D_04_NL | CATS3D Negative-Lipophilic BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5271 | CATS3D_05_NL | CATS3D Negative-Lipophilic BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5272 | CATS3D_06_NL | CATS3D Negative-Lipophilic BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5273 | CATS3D_07_NL | CATS3D Negative-Lipophilic BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5274 | CATS3D_08_NL | CATS3D Negative-Lipophilic BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5275 | CATS3D_09_NL | CATS3D Negative-Lipophilic BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5276 | CATS3D_10_NL | CATS3D Negative-Lipophilic BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5277 | CATS3D_11_NL | CATS3D Negative-Lipophilic BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5278 | CATS3D_12_NL | CATS3D Negative-Lipophilic BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5279 | CATS3D_13_NL | CATS3D Negative-Lipophilic BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5280 | CATS3D_14_NL | CATS3D Negative-Lipophilic BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5281 | CATS3D_15_NL | CATS3D Negative-Lipophilic BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5282 | CATS3D_16_NL | CATS3D Negative-Lipophilic BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5283 | CATS3D_17_NL | CATS3D Negative-Lipophilic BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5284 | CATS3D_18_NL | CATS3D Negative-Lipophilic BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5285 | CATS3D_19_NL | CATS3D Negative-Lipophilic BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5286 | CATS3D_00_LL | CATS3D Lipophilic-Lipophilic BIN 00 (0.000 - 1.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5287 | CATS3D_01_LL | CATS3D Lipophilic-Lipophilic BIN 01 (1.000 - 2.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5288 | CATS3D_02_LL | CATS3D Lipophilic-Lipophilic BIN 02 (2.000 - 3.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5289 | CATS3D_03_LL | CATS3D Lipophilic-Lipophilic BIN 03 (3.000 - 4.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5290 | CATS3D_04_LL | CATS3D Lipophilic-Lipophilic BIN 04 (4.000 - 5.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5291 | CATS3D_05_LL | CATS3D Lipophilic-Lipophilic BIN 05 (5.000 - 6.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5292 | CATS3D_06_LL | CATS3D Lipophilic-Lipophilic BIN 06 (6.000 - 7.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5293 | CATS3D_07_LL | CATS3D Lipophilic-Lipophilic BIN 07 (7.000 - 8.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5294 | CATS3D_08_LL | CATS3D Lipophilic-Lipophilic BIN 08 (8.000 - 9.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5295 | CATS3D_09_LL | CATS3D Lipophilic-Lipophilic BIN 09 (9.000 - 10.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5296 | CATS3D_10_LL | CATS3D Lipophilic-Lipophilic BIN 10 (10.000 - 11.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5297 | CATS3D_11_LL | CATS3D Lipophilic-Lipophilic BIN 11 (11.000 - 12.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5298 | CATS3D_12_LL | CATS3D Lipophilic-Lipophilic BIN 12 (12.000 - 13.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5299 | CATS3D_13_LL | CATS3D Lipophilic-Lipophilic BIN 13 (13.000 - 14.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5300 | CATS3D_14_LL | CATS3D Lipophilic-Lipophilic BIN 14 (14.000 - 15.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5301 | CATS3D_15_LL | CATS3D Lipophilic-Lipophilic BIN 15 (15.000 - 16.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5302 | CATS3D_16_LL | CATS3D Lipophilic-Lipophilic BIN 16 (16.000 - 17.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5303 | CATS3D_17_LL | CATS3D Lipophilic-Lipophilic BIN 17 (17.000 - 18.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5304 | CATS3D_18_LL | CATS3D Lipophilic-Lipophilic BIN 18 (18.000 - 19.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
| 5305 | CATS3D_19_LL | CATS3D Lipophilic-Lipophilic BIN 19 (19.000 - 20.000 Ã…) | CATS 3D descriptors | Basic descriptors | 
...